= >(\n Comp: C\n) => C &\n React.ComponentType<\n $Diff, { theme: T }> & { theme?: $DeepShape }\n >;\n\nconst createWithTheme = >(\n ThemeProvider: ThemeProviderType,\n ThemeContext: React.Context\n) =>\n function withTheme(Comp: *) {\n class ThemedComponent extends React.Component<*> {\n _previous: ?{ a: T, b: ?S, result: T };\n\n _merge = (a: T, b: ?S) => {\n const previous = this._previous;\n\n if (previous && previous.a === a && previous.b === b) {\n return previous.result;\n }\n\n const result = a && b && a !== b ? deepmerge(a, b) : a || b;\n\n this._previous = { a, b, result };\n\n return result;\n };\n\n render() {\n const { _reactThemeProviderForwardedRef, ...rest } = this.props;\n\n return (\n \n {theme => (\n \n )}\n \n );\n }\n }\n\n const ResultComponent = React.forwardRef((props, ref) => (\n \n ));\n\n ResultComponent.displayName = `withTheme(${Comp.displayName || Comp.name})`;\n\n hoistNonReactStatics(ResultComponent, Comp);\n\n return (ResultComponent: any);\n };\n\nexport default createWithTheme;\n","/* @flow */\n\nimport createTheming from './createTheming';\n\nexport { createTheming };\nexport type { ThemingType } from './createTheming';\n","(function (global, factory) {\n\ttypeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :\n\ttypeof define === 'function' && define.amd ? define(factory) :\n\t(global = global || self, global.deepmerge = factory());\n}(this, function () { 'use strict';\n\n\tvar isMergeableObject = function isMergeableObject(value) {\n\t\treturn isNonNullObject(value)\n\t\t\t&& !isSpecial(value)\n\t};\n\n\tfunction isNonNullObject(value) {\n\t\treturn !!value && typeof value === 'object'\n\t}\n\n\tfunction isSpecial(value) {\n\t\tvar stringValue = Object.prototype.toString.call(value);\n\n\t\treturn stringValue === '[object RegExp]'\n\t\t\t|| stringValue === '[object Date]'\n\t\t\t|| isReactElement(value)\n\t}\n\n\t// see https://github.com/facebook/react/blob/b5ac963fb791d1298e7f396236383bc955f916c1/src/isomorphic/classic/element/ReactElement.js#L21-L25\n\tvar canUseSymbol = typeof Symbol === 'function' && Symbol.for;\n\tvar REACT_ELEMENT_TYPE = canUseSymbol ? Symbol.for('react.element') : 0xeac7;\n\n\tfunction isReactElement(value) {\n\t\treturn value.$$typeof === REACT_ELEMENT_TYPE\n\t}\n\n\tfunction emptyTarget(val) {\n\t\treturn Array.isArray(val) ? [] : {}\n\t}\n\n\tfunction cloneUnlessOtherwiseSpecified(value, options) {\n\t\treturn (options.clone !== false && options.isMergeableObject(value))\n\t\t\t? deepmerge(emptyTarget(value), value, options)\n\t\t\t: value\n\t}\n\n\tfunction defaultArrayMerge(target, source, options) {\n\t\treturn target.concat(source).map(function(element) {\n\t\t\treturn cloneUnlessOtherwiseSpecified(element, options)\n\t\t})\n\t}\n\n\tfunction getMergeFunction(key, options) {\n\t\tif (!options.customMerge) {\n\t\t\treturn deepmerge\n\t\t}\n\t\tvar customMerge = options.customMerge(key);\n\t\treturn typeof customMerge === 'function' ? customMerge : deepmerge\n\t}\n\n\tfunction getEnumerableOwnPropertySymbols(target) {\n\t\treturn Object.getOwnPropertySymbols\n\t\t\t? Object.getOwnPropertySymbols(target).filter(function(symbol) {\n\t\t\t\treturn target.propertyIsEnumerable(symbol)\n\t\t\t})\n\t\t\t: []\n\t}\n\n\tfunction getKeys(target) {\n\t\treturn Object.keys(target).concat(getEnumerableOwnPropertySymbols(target))\n\t}\n\n\tfunction mergeObject(target, source, options) {\n\t\tvar destination = {};\n\t\tif (options.isMergeableObject(target)) {\n\t\t\tgetKeys(target).forEach(function(key) {\n\t\t\t\tdestination[key] = cloneUnlessOtherwiseSpecified(target[key], options);\n\t\t\t});\n\t\t}\n\t\tgetKeys(source).forEach(function(key) {\n\t\t\tif (!options.isMergeableObject(source[key]) || !target[key]) {\n\t\t\t\tdestination[key] = cloneUnlessOtherwiseSpecified(source[key], options);\n\t\t\t} else {\n\t\t\t\tdestination[key] = getMergeFunction(key, options)(target[key], source[key], options);\n\t\t\t}\n\t\t});\n\t\treturn destination\n\t}\n\n\tfunction deepmerge(target, source, options) {\n\t\toptions = options || {};\n\t\toptions.arrayMerge = options.arrayMerge || defaultArrayMerge;\n\t\toptions.isMergeableObject = options.isMergeableObject || isMergeableObject;\n\n\t\tvar sourceIsArray = Array.isArray(source);\n\t\tvar targetIsArray = Array.isArray(target);\n\t\tvar sourceAndTargetTypesMatch = sourceIsArray === targetIsArray;\n\n\t\tif (!sourceAndTargetTypesMatch) {\n\t\t\treturn cloneUnlessOtherwiseSpecified(source, options)\n\t\t} else if (sourceIsArray) {\n\t\t\treturn options.arrayMerge(target, source, options)\n\t\t} else {\n\t\t\treturn mergeObject(target, source, options)\n\t\t}\n\t}\n\n\tdeepmerge.all = function deepmergeAll(array, options) {\n\t\tif (!Array.isArray(array)) {\n\t\t\tthrow new Error('first argument should be an array')\n\t\t}\n\n\t\treturn array.reduce(function(prev, next) {\n\t\t\treturn deepmerge(prev, next, options)\n\t\t}, {})\n\t};\n\n\tvar deepmerge_1 = deepmerge;\n\n\treturn deepmerge_1;\n\n}));\n","function getAlphanumFromUnicodeRange(\n index: number,\n baseCharcode: number,\n modulo: number,\n alpha: true\n): string | undefined;\nfunction getAlphanumFromUnicodeRange(\n index: number,\n baseCharcode: number,\n modulo: number,\n alpha: false\n): string;\n/**\n * Create an alphabetic initial counter representation from an UTF-16 unicode\n * and a range.\n *\n * @param index - The index to render.\n * @param baseCharcode - The original UTF-16 unicode.\n * @param modulo - The number of symbols in the set.\n * @param alpha - In alpha mode, index starts at 1 instead of 0.\n * @returns\n */\nfunction getAlphanumFromUnicodeRange(\n index: number,\n baseCharcode: number,\n modulo: number,\n alpha: boolean\n): string | undefined {\n const reindex = index - Number(alpha);\n if (reindex < 0) {\n return undefined;\n }\n if (reindex < modulo) {\n return String.fromCharCode(baseCharcode + reindex);\n }\n const rest = reindex % modulo;\n const next = (reindex - rest - modulo) / modulo + 1;\n return (\n getAlphanumFromUnicodeRange(next, baseCharcode, modulo, alpha as true) +\n String.fromCharCode(baseCharcode + rest)\n );\n}\n\nexport default getAlphanumFromUnicodeRange;\n","export default function codepointLength(source?: string | null) {\n // get codepoints length instead of UTF16 code units with the string Iterator.\n return (source && [...source].length) || 0;\n}\n","/**\n * See https://www.w3.org/TR/css-counter-styles-3/#counter-style-suffix\n *\n * @remarks We are using non-breaking space, otherwise iOS text elements get trimmed.\n */\nexport const DEFAULT_SUFFIX = '\\u002E\\u00A0';\nexport const CJK_SUFFIX = '\\u3001';\n","import codepointLength from './utils/codepointLength';\nimport { DEFAULT_SUFFIX } from './constants';\nimport { Specifications, Engine } from './internal-types';\nimport { InitialCounterFormatter } from './public-types';\n\nconst DEFAULT_SPECS: Specifications = {\n suffix: DEFAULT_SUFFIX,\n prefix: null,\n reversedMarker: false,\n reversedCounter: false,\n fallback: {\n renderCounter: (index) => index.toString(),\n maxCounterLenInRange(min, max) {\n return Math.max(\n this.renderCounter(min).length,\n this.renderCounter(max).length\n );\n }\n },\n negative: null,\n range: {\n min: -Infinity,\n max: Infinity\n },\n padding: null\n};\n\nconst styleEngineProto: Pick<\n Engine,\n 'maxLengthInRange' | 'withSpecs' | 'withMaxLengthInRange'\n> = {\n // Cost-inefficient since it requires iterating over the whole range.\n maxLengthInRange(this: Engine, min, max) {\n let len = 0;\n for (let i = Math.max(0, min); i <= max; i++) {\n const val = this.formatter(i);\n len = Math.max(codepointLength(val), len);\n }\n return len;\n },\n withSpecs(this: Engine, spToMerge) {\n const next = Object.create(this) as Engine;\n next.specs = Object.assign({}, this.specs, spToMerge);\n return next;\n },\n withMaxLengthInRange(this: Engine, cp) {\n const next = Object.create(this) as Engine;\n next.maxLengthInRange = cp;\n return next;\n }\n};\n\nexport default function makeCSEngine(\n formatter: InitialCounterFormatter,\n specs: Specifications = DEFAULT_SPECS\n): Engine {\n const eng = Object.create(styleEngineProto) as Engine;\n eng.specs = specs;\n eng.formatter = formatter;\n return eng;\n}\n","export default function codeunitLength(source?: string | null) {\n return (source && source.length) || 0;\n}\n","export default function reverseString(source: string) {\n return Array.from(source).reverse().join('');\n}\n","import codepointLength from './utils/codepointLength';\nimport codeunitLength from './utils/codeunitLength';\nimport { CounterStyleRendererInt, Engine } from './internal-types';\nimport { CounterStyleRenderer, RtlOptions } from './public-types';\nimport reverseString from './utils/reverseString';\n\nconst defaultRtlOptions: Required = {\n reverseCounter: false,\n reversePrefix: true,\n reverseSuffix: true\n};\n\nconst stylePrototype: Omit = {\n getAbsoluteMaxLenInRange(\n this: CounterStyleRendererInt,\n normMin,\n normMax,\n negative\n ) {\n const specs = this.engine.specs;\n const supportedRange = specs.range;\n const supportedMin = Math.max(normMin, supportedRange.min);\n const supportedMax = Math.min(normMax, supportedRange.max);\n const lenMiddle = Math.max(\n this.engine.maxLengthInRange(\n negative ? Math.abs(supportedMax) : supportedMin,\n negative ? Math.abs(supportedMin) : supportedMax\n ) +\n (negative && specs.negative\n ? codeunitLength(specs.negative.prefix) +\n codeunitLength(specs.negative.suffix)\n : 0),\n specs?.padding?.length || 0\n );\n const lenLeft =\n supportedMin > normMin\n ? specs.fallback.maxCounterLenInRange(normMin, supportedMin - 1)\n : 0;\n const lenRight =\n supportedMax < normMax\n ? specs.fallback.maxCounterLenInRange(supportedMax + 1, normMax)\n : 0;\n return Math.max(lenLeft, lenMiddle, lenRight);\n },\n maxCounterLenInRange(this: CounterStyleRendererInt, min, max) {\n if (max < min) {\n return 0;\n }\n if (min >= 0) {\n return this.getAbsoluteMaxLenInRange(min, max, false);\n }\n if (max <= 0) {\n return this.getAbsoluteMaxLenInRange(min, max, true);\n }\n return Math.max(\n this.getAbsoluteMaxLenInRange(min, -1, true),\n this.getAbsoluteMaxLenInRange(0, max, false)\n );\n },\n maxMarkerLenInRange(this: CounterStyleRendererInt, min, max) {\n if (max < min) {\n return 0;\n }\n return (\n this.maxCounterLenInRange(min, max) +\n codeunitLength(this.engine.specs.suffix) +\n codeunitLength(this.engine.specs.prefix)\n );\n },\n renderCounter(this: CounterStyleRendererInt, index) {\n const formatter = this.engine.formatter;\n const sp = this.engine.specs;\n const negative = sp.negative;\n let res;\n if (index < sp.range.min || index > sp.range.max) {\n return sp.fallback.renderCounter(index);\n }\n const decoratorL =\n negative && index < 0\n ? codeunitLength(negative.prefix) + codeunitLength(negative.suffix)\n : 0;\n res = formatter(Math.sign(index) * index);\n if (typeof res === 'undefined') {\n return sp.fallback.renderCounter(index);\n }\n if (sp.padding) {\n const lenWithDecorator = codepointLength(res) + decoratorL;\n if (lenWithDecorator < sp.padding.length) {\n const padChar = sp.padding.char.repeat(\n sp.padding.length - lenWithDecorator\n );\n res = sp.padding.right ? res + padChar : padChar + res;\n }\n }\n if (index < 0 && negative) {\n res = negative.prefix + res + negative.suffix;\n }\n return sp.reversedCounter ? reverseString(res) : res;\n },\n renderMarker(this: CounterStyleRendererInt, index) {\n const sp = this.engine.specs;\n const elements = [\n sp.prefix || '',\n this.renderCounter(index),\n sp.suffix || ''\n ];\n return sp.reversedMarker ? elements.reverse().join('') : elements.join('');\n },\n renderPrefix(this: CounterStyleRendererInt) {\n return this.engine.specs.prefix || '';\n },\n renderSuffix(this: CounterStyleRendererInt) {\n return this.engine.specs.suffix || '';\n },\n withFallback(this: CounterStyleRendererInt, fallback) {\n return makeCSRenderer(this.engine.withSpecs({ fallback }));\n },\n withRange(this: CounterStyleRendererInt, min, max, fallback) {\n const result = makeCSRenderer(\n this.engine.withSpecs({\n range: {\n min,\n max\n }\n })\n );\n return fallback ? result.withFallback(fallback) : result;\n },\n withNegative(this: CounterStyleRendererInt, prefix, suffix = '') {\n return makeCSRenderer(\n this.engine.withSpecs({\n negative: {\n prefix,\n suffix\n }\n })\n );\n },\n withPadLeft(this: CounterStyleRendererInt, length, pad) {\n return makeCSRenderer(\n this.engine.withSpecs({\n padding: {\n right: false,\n char: pad,\n length\n }\n })\n );\n },\n withPadRight(this: CounterStyleRendererInt, length, pad) {\n return makeCSRenderer(\n this.engine.withSpecs({\n padding: {\n right: true,\n char: pad,\n length\n }\n })\n );\n },\n withSuffix(this: CounterStyleRendererInt, suffix) {\n return makeCSRenderer(\n this.engine.withSpecs({\n suffix\n })\n );\n },\n withPrefix(this: CounterStyleRendererInt, prefix) {\n return makeCSRenderer(\n this.engine.withSpecs({\n prefix\n })\n );\n },\n withRtl(this: CounterStyleRendererInt, options) {\n const synthOptions = Object.assign({}, defaultRtlOptions, options);\n const sp = this.engine.specs;\n return makeCSRenderer(\n this.engine.withSpecs({\n reversedMarker: true,\n reversedCounter: synthOptions.reverseCounter,\n suffix:\n synthOptions.reverseSuffix && sp.suffix\n ? reverseString(sp.suffix)\n : sp.suffix,\n prefix:\n synthOptions.reversePrefix && sp.prefix\n ? reverseString(sp.prefix)\n : sp.prefix\n })\n );\n },\n withMaxLengthComputer(this: CounterStyleRendererInt, computer) {\n return makeCSRenderer(\n this.engine.withMaxLengthInRange((min, max) =>\n computer(min, max, this.engine.maxLengthInRange.bind(this.engine))\n )\n );\n }\n};\n\nexport default function makeCSRenderer(engine: Engine): CounterStyleRenderer {\n const target = Object.create(stylePrototype) as CounterStyleRendererInt;\n target.engine = engine;\n return Object.freeze(target);\n}\n","import getAlphanumFromUnicodeRange from './getAlphanumFromUnicodeRange';\nimport makeAlphanumMaxlenComputer from './makeAlphanumMaxlenComputer';\nimport makeCSEngine from './makeCSEngine';\nimport makeCSRenderer from './makeCSRenderer';\nimport type {\n InitialCounterFormatter,\n CounterStyleStatic,\n CounterStyleRenderer\n} from './public-types';\nimport codepointLength from './utils/codepointLength';\n\nconst mod = (value: number, divisor: number) =>\n ((value % divisor) + divisor) % divisor;\n\nfunction makeCSRendererFromFormatter(formatter: InitialCounterFormatter) {\n return makeCSRenderer(makeCSEngine(formatter));\n}\n\nfunction getMaxLenInSymbols(lens: number[], from = 0, to?: number) {\n to = typeof to === 'number' ? to : lens.length;\n return lens.slice(from, to + 1).reduce((p, c) => Math.max(p, c), 0);\n}\n\nfunction numeric(renderer: CounterStyleRenderer, length: number) {\n return renderer\n .withMaxLengthComputer(makeAlphanumMaxlenComputer(length, false))\n .withNegative('-');\n}\n\nfunction alphabetic(renderer: CounterStyleRenderer, length: number) {\n return renderer\n .withMaxLengthComputer(makeAlphanumMaxlenComputer(length, true))\n .withRange(1, Infinity);\n}\n\n/**\n * A static object to build counter style renderers.\n * See {@link CounterStyleStatic}.\n *\n * @public\n */\nconst CounterStyle: Readonly = Object.freeze({\n raw: (formatter) => {\n return makeCSRendererFromFormatter(formatter);\n },\n cyclic: (...symbols) => {\n const symbolLenghts = symbols.map(codepointLength);\n const maxLen = getMaxLenInSymbols(symbolLenghts);\n const renderer =\n symbols.length === 1\n ? makeCSRendererFromFormatter(() => symbols[0])\n : makeCSRendererFromFormatter(\n (index) => symbols[mod(index - 1, symbols.length)]\n );\n return renderer.withMaxLengthComputer((min, max) => {\n return maxLen === 1 || max - min + 1 >= symbols.length\n ? maxLen\n : getMaxLenInSymbols(symbolLenghts, min - 1, max - 1);\n });\n },\n fixed: (...symbols) => {\n const symbolLenghts = symbols.map(codepointLength);\n const maxLen = getMaxLenInSymbols(symbolLenghts);\n return makeCSRendererFromFormatter((index) => symbols[index - 1])\n .withRange(1, symbols.length)\n .withMaxLengthComputer((min, max) => {\n return maxLen === 1\n ? maxLen\n : getMaxLenInSymbols(symbolLenghts, min - 1, max - 1);\n });\n },\n symbolic: (...symbols) =>\n makeCSRendererFromFormatter((index) =>\n symbols[mod(index - 1, symbols.length)].repeat(\n Math.ceil(index / symbols.length)\n )\n )\n .withRange(1, Infinity)\n .withMaxLengthComputer((min, max, defaultCmp) => {\n // Just iterate over the last n elements until max, with n the number\n // of symbols.\n return defaultCmp(\n max < symbols.length ? min : max - symbols.length,\n max\n );\n }),\n alphabetic: (...symbols) => {\n return alphabetic(\n makeCSRendererFromFormatter((index) => {\n let result = '';\n while (index > 0) {\n index--;\n result = symbols[mod(index, symbols.length)] + result;\n index = Math.floor(index / symbols.length);\n }\n return result;\n }),\n symbols.length\n );\n },\n numeric: (...symbols) => {\n return numeric(\n makeCSRendererFromFormatter((index) => {\n if (index === 0) {\n return symbols[0];\n } else {\n let result = '';\n while (index > 0) {\n result = symbols[mod(index, symbols.length)] + result;\n index = Math.floor(index / symbols.length);\n }\n return result;\n }\n }),\n symbols.length\n );\n },\n numericFromUnicodeRange: (originUnicode: number, base: number) => {\n return numeric(\n makeCSRendererFromFormatter(\n (index) =>\n getAlphanumFromUnicodeRange(\n index,\n originUnicode,\n base,\n false\n ) as string\n ),\n base\n );\n },\n alphabeticFromUnicodeRange: (originUnicode: number, alphabetLen: number) => {\n return alphabetic(\n makeCSRendererFromFormatter((index) => {\n return getAlphanumFromUnicodeRange(\n index,\n originUnicode,\n alphabetLen,\n true\n );\n }),\n alphabetLen\n );\n },\n additive: (symbols: { [value: number]: string }) => {\n const values = Object.keys(symbols)\n .map((value) => parseInt(value, 10))\n .sort((a, b) => b - a);\n return makeCSRendererFromFormatter((index) => {\n if (index === 0) {\n return symbols[0];\n }\n let result = '';\n for (const value of values) {\n if (index >= value && value > 0) {\n const repeat = Math.floor(index / value);\n result += symbols[value].repeat(repeat);\n index -= repeat * value;\n }\n }\n return index === 0 ? result : undefined;\n }).withRange(\n values.length ? values[values.length - 1] : 0,\n 0 in symbols && values.length === 1 ? 0 : values.length ? Infinity : -1\n );\n }\n});\n\nexport default CounterStyle;\n","import CounterStyle from './CounterStyle';\n\nexport * from './CounterStyle';\nexport * from './public-types';\n\nexport default CounterStyle;\n","export default function makeAlphanumMaxlenComputer(\n base: number,\n alpha: boolean\n) {\n return function alphanumericMaxLenComputer(_min: number, max: number) {\n let remax = max - Number(alpha);\n let digits: number = 1;\n while (remax >= base) {\n remax /= base;\n digits++;\n }\n return digits;\n };\n}\n","import CounterStyle from '../CounterStyle';\nimport makeAlphanumMaxlenComputer from '../makeAlphanumMaxlenComputer';\n\n// Default implementation is faster than invoking CounterStyle.numeric\nconst decimal = CounterStyle.raw((index) => index.toString())\n .withMaxLengthComputer(makeAlphanumMaxlenComputer(10, false))\n .withNegative('-');\n\nexport default decimal;\n","import decimal from './decimal';\n\nconst decimalLeadingZero = decimal.withPadLeft(2, '0');\n\nexport default decimalLeadingZero;\n","import CounterStyle from '../CounterStyle';\n\nconst lowerAlpha = CounterStyle.alphabeticFromUnicodeRange(97, 26);\n\nexport default lowerAlpha;\n","import CounterStyle from '../CounterStyle';\n\nconst lowerGreek = CounterStyle.alphabeticFromUnicodeRange(\n /* α β γ δ ε ζ η θ ι κ λ μ ν ξ ο π ρ σ τ υ φ χ ψ ω */\n 0x3b1,\n 24\n);\n\nexport default lowerGreek;\n","import CounterStyle from '../CounterStyle';\n\nconst lowerRoman = CounterStyle.additive({\n 1000: 'm',\n 900: 'cm',\n 500: 'd',\n 400: 'cd',\n 100: 'c',\n 90: 'xc',\n 50: 'l',\n 40: 'xl',\n 10: 'x',\n 9: 'ix',\n 5: 'v',\n 4: 'iv',\n 1: 'i'\n}).withRange(1, 3999);\n\nexport default lowerRoman;\n","import CounterStyle from '../CounterStyle';\n\nexport const upperAlpha = CounterStyle.alphabeticFromUnicodeRange(65, 26);\n\nexport default upperAlpha;\n","import CounterStyle from '../CounterStyle';\n\nconst upperRoman = CounterStyle.additive({\n 1000: 'M',\n 900: 'CM',\n 500: 'D',\n 400: 'CD',\n 100: 'C',\n 90: 'XC',\n 50: 'L',\n 40: 'XL',\n 10: 'X',\n 9: 'IX',\n 5: 'V',\n 4: 'IV',\n 1: 'I'\n}).withRange(1, 3999);\n\nexport default upperRoman;\n","import React, { Children, Fragment, PropsWithChildren } from 'react';\nimport MarkedListItem from './MarkedListItem';\nimport { MarkedListProps } from './shared-types';\nimport useMarkedList from './useMarkedList';\n\n/**\n * A component which given a counter style, wraps each of its children with a\n * {@link MarkedListItem}. The latter prepends the child with a marker\n * box containing a marker string representation for this child index.\n *\n * See {@link https://www.w3.org/TR/css-lists-3/#markers | CSS Lists and Counters Module Level 3, Markers}.\n *\n * @public\n */\nexport default function MarkedList({\n children,\n Container = Fragment,\n ...props\n}: PropsWithChildren) {\n const normalChildren = Children.toArray(children);\n const listProps = useMarkedList({ ...props, length: normalChildren.length });\n return React.createElement(\n Container,\n {},\n normalChildren.map((child, index) => {\n return (\n \n {child}\n \n );\n })\n );\n}\n","import React, { PropsWithChildren } from 'react';\nimport { StyleProp, StyleSheet, View, ViewStyle } from 'react-native';\nimport { MarkedListProps } from './shared-types';\n\n/**\n * Props for the {@link MarkedListItem} component.\n *\n * @public\n */\nexport type MarkedListItemProps = Required<\n Pick<\n MarkedListProps,\n | 'counterRenderer'\n | 'renderMarker'\n | 'markerTextStyle'\n | 'markerBoxStyle'\n | 'rtlLineReversed'\n | 'rtlMarkerReversed'\n | 'startIndex'\n >\n> & {\n index: number;\n markerTextWidth: number | false;\n maxNumOfCodepoints: number;\n enableMarkerClipping: boolean;\n style: StyleProp;\n};\n\n/**\n * A component which reproduces CSS3 `display: list-item;` behavior. It\n * prepends its child with a marker box containing a marker string\n * representation for this child index.\n *\n * See {@link https://www.w3.org/TR/css-lists-3/#markers | CSS Lists and Counters Module Level 3, Markers}.\n *\n * @public\n */\nexport default function MarkedListItem({\n counterRenderer,\n index,\n startIndex,\n rtlLineReversed,\n rtlMarkerReversed,\n markerTextStyle,\n markerBoxStyle,\n maxNumOfCodepoints,\n markerTextWidth,\n style,\n renderMarker,\n enableMarkerClipping,\n children\n}: PropsWithChildren) {\n return (\n \n {renderMarker({\n counterRenderer,\n rtlMarkerReversed:\n typeof rtlMarkerReversed === 'boolean' ? rtlMarkerReversed : true,\n counterIndex: index + startIndex,\n maxNumOfCodepoints,\n style: markerBoxStyle,\n markerTextStyle,\n markerTextWidth,\n enableMarkerClipping\n })}\n {children}\n \n );\n}\n\nconst styles = StyleSheet.create({\n lineLtr: { flexWrap: 'nowrap', alignSelf: 'stretch', flexDirection: 'row' },\n lineRtl: {\n flexWrap: 'nowrap',\n alignSelf: 'stretch',\n flexDirection: 'row-reverse'\n }\n});\n","import React from 'react';\nimport { Text, TextProps, View } from 'react-native';\nimport { MarkerBoxProps } from './shared-types';\n\nconst markerClipConfig: Partial = {\n numberOfLines: 1,\n ellipsizeMode: 'clip'\n};\n\n/**\n * Default component to render the list marker.\n *\n * See {@link https://www.w3.org/TR/css-lists-3/#marker-pseudo | CSS Lists and Counters Module Level 3, Markers}\n *\n * @public\n */\nexport default function MarkerBox({\n style,\n counterRenderer,\n counterIndex,\n markerTextStyle,\n markerTextWidth,\n enableMarkerClipping\n}: MarkerBoxProps) {\n const markerStyle =\n typeof markerTextWidth === 'number'\n ? [markerTextStyle, { width: markerTextWidth }]\n : markerTextStyle;\n return (\n \n \n {counterRenderer.renderMarker(counterIndex)}\n \n \n );\n}\n","import MarkedList from './MarkedList';\n\nexport * from './shared-types';\nexport * from './MarkerBox';\nexport * from './MarkedList';\nexport * from './MarkedListItem';\nexport { default as MarkerBox } from './MarkerBox';\nexport { default as MarkedListItem } from './MarkedListItem';\nexport { default as useMarkedList } from './useMarkedList';\nexport { MarkedList };\nexport default MarkedList;\n","import React, { useMemo } from 'react';\nimport { I18nManager } from 'react-native';\nimport MarkerBox from './MarkerBox';\nimport { MarkedListItemProps } from './MarkedListItem';\nimport { MarkedListProps } from './shared-types';\n\nconst defaultRenderMarker: NonNullable = (\n props\n) => React.createElement(MarkerBox, props);\n\nconst defaultComputeMarkerBoxWidth: NonNullable<\n MarkedListProps['computeMarkerBoxWidth']\n> = (maxNumOfCodepoints, fontSize) => maxNumOfCodepoints * fontSize * 0.6;\n\nconst DEFAULT_FONT_SIZE = 14;\n\n/**\n * A hook to reuse MarkedList logic to render custom lists components in\n * combination with {@link MarkedListItem}.\n *\n * @public\n */\nexport default function useMarkedList({\n counterRenderer,\n startIndex = 1,\n lineStyle,\n rtlLineReversed = false,\n rtlMarkerReversed = false,\n markerTextStyle,\n markerBoxStyle,\n dynamicMarkerBoxWidth = true,\n length = 0,\n renderMarker = defaultRenderMarker,\n enableMarkerClipping = false,\n computeMarkerBoxWidth = defaultComputeMarkerBoxWidth\n}: MarkedListProps & { length: number }): Omit {\n const maxNumOfCodepoints = useMemo(\n () =>\n counterRenderer.maxMarkerLenInRange(startIndex, startIndex + length - 1),\n [counterRenderer, length, startIndex]\n );\n const syntheticRtlLineReversed = !I18nManager.isRTL && rtlLineReversed;\n const markerTextWidth = useMemo(\n () =>\n dynamicMarkerBoxWidth &&\n computeMarkerBoxWidth(\n maxNumOfCodepoints,\n markerTextStyle?.fontSize ?? DEFAULT_FONT_SIZE\n ),\n [\n computeMarkerBoxWidth,\n markerTextStyle?.fontSize,\n maxNumOfCodepoints,\n dynamicMarkerBoxWidth\n ]\n );\n const renderer = useMemo(\n () =>\n rtlMarkerReversed\n ? counterRenderer.withRtl(\n rtlMarkerReversed === true ? undefined : rtlMarkerReversed\n )\n : counterRenderer,\n [counterRenderer, rtlMarkerReversed]\n );\n const syntheticMarkerTextStyle = useMemo(\n () =>\n ({\n flexGrow: 0,\n flexShrink: 0,\n fontSize: DEFAULT_FONT_SIZE,\n textAlign: syntheticRtlLineReversed ? 'left' : 'right',\n alignSelf: syntheticRtlLineReversed ? 'flex-start' : 'flex-end',\n ...markerTextStyle\n } as const),\n [markerTextStyle, syntheticRtlLineReversed]\n );\n return {\n maxNumOfCodepoints,\n rtlMarkerReversed,\n markerTextWidth,\n renderMarker,\n startIndex,\n rtlLineReversed: syntheticRtlLineReversed,\n markerTextStyle: syntheticMarkerTextStyle,\n markerBoxStyle: markerBoxStyle as any,\n counterRenderer: renderer,\n style: lineStyle,\n enableMarkerClipping\n };\n}\n","import { getPropertyName } from 'css-to-react-native';\nimport { CSSParseRun } from './CSSParseRun';\nimport { MixedStyleDeclaration } from './CSSProcessor';\nimport { CSSPropertiesValidationRegistry } from './CSSPropertiesValidationRegistry';\nimport { ValidatorsType } from './makepropertiesValidators';\nimport { CSSProperties } from './processor-types';\nimport { ShortMergeRequest } from './ShortMergeRequest';\nimport { LongCSSPropertyValidator } from './validators/LongCSSPropertyValidator';\n\ntype CSSRawPropertiesList = [string, any][];\n\nexport class CSSInlineParseRun extends CSSParseRun {\n private rules: CSSRawPropertiesList;\n\n constructor(inlineCSS: string, registry: CSSPropertiesValidationRegistry) {\n super(registry);\n this.rules = this.parseInlineCSS(inlineCSS);\n this.normalizeProp = this.normalizeProp.bind(this);\n this.reduceProps = this.reduceProps.bind(this);\n }\n\n private parseInlineCSS(inlineCSS: string): CSSRawPropertiesList {\n return inlineCSS\n .split(';')\n .map((prop) => prop.split(':'))\n .reduce((acc, prop) => {\n if (prop.length === 2) {\n return [...acc, [prop[0].trim(), prop[1].trim()]];\n }\n return acc;\n }, []);\n }\n\n normalizeProp(\n rule: CSSRawPropertiesList[number],\n strict = false\n ): null | [keyof ValidatorsType, any] {\n const rawName = rule[0];\n const rawValue = rule[1];\n const camelCaseName = getPropertyName(rawName);\n if (!this.validationMap.shouldRegisterInlineProperty(camelCaseName)) {\n return null;\n }\n const validator = this.validationMap.getValidatorForProperty(camelCaseName);\n const normalizedValue = validator.normalizeInlineCSSValue(rawValue);\n if (normalizedValue === null) {\n if (strict) {\n throw new TypeError();\n }\n return null;\n }\n return [camelCaseName, normalizedValue];\n }\n\n reduceProps(\n reg: CSSProperties,\n rule: null | [keyof ValidatorsType, Exclude]\n ): CSSProperties {\n if (!rule) {\n return reg;\n }\n const [camelCaseName, normalizedValue] = rule;\n if (normalizedValue instanceof ShortMergeRequest) {\n try {\n return normalizedValue\n .map((r) => this.normalizeProp(r, true))\n .reduce(this.reduceProps, reg);\n } catch (e) {\n return reg;\n }\n }\n return {\n ...reg,\n [camelCaseName]: normalizedValue\n };\n }\n\n fillProcessedProps() {\n const rawTransformed = this.rules\n .map((r) => this.normalizeProp(r))\n .reduce(this.reduceProps, {});\n (Object.keys(rawTransformed) as Array).forEach(\n (camelCaseName) => {\n const value = rawTransformed[camelCaseName];\n const validator = this.validationMap.getValidatorForProperty(\n camelCaseName\n ) as LongCSSPropertyValidator;\n const normalizedValue = validator.normalizeInlineCSSValue(value);\n this.processedProps.withProperty(\n camelCaseName as keyof MixedStyleDeclaration,\n normalizedValue,\n validator\n );\n }\n );\n }\n}\n","import { CSSParseRun } from './CSSParseRun';\nimport { MixedStyleDeclaration } from './CSSProcessor';\nimport { CSSPropertiesValidationRegistry } from './CSSPropertiesValidationRegistry';\nimport { lookupRecord } from './helpers';\nimport {\n ExtraNativeTextStyle,\n NativeDirectionalStyleKeys,\n ExtraNativeLongViewStyleKeys\n} from './native-types';\nimport { CSSPropertySpecs } from './processor-types';\nimport { ShortMergeRequest } from './ShortMergeRequest';\n\nconst nativeDirectionalStyleKeys: Record =\n {\n borderBottomEndRadius: 'block',\n borderBottomStartRadius: 'block',\n borderEndColor: 'block',\n borderEndWidth: 'block',\n borderStartColor: 'block',\n borderStartWidth: 'block',\n borderTopEndRadius: 'block',\n borderTopStartRadius: 'block',\n end: 'block',\n marginEnd: 'block',\n marginStart: 'block',\n paddingEnd: 'block',\n paddingStart: 'block',\n start: 'block'\n };\n\nconst extraLongViewStyles: Record = {\n elevation: 'block',\n overflow: 'block',\n overlayColor: 'block',\n resizeMode: 'block',\n rotation: 'block',\n scaleX: 'block',\n scaleY: 'block',\n shadowColor: 'block',\n shadowOffset: 'block',\n shadowOpacity: 'block',\n shadowRadius: 'block',\n testID: 'block',\n tintColor: 'block',\n transformMatrix: 'block',\n translateX: 'block',\n translateY: 'block'\n};\n\nconst extraTextStyles: Record = {\n includeFontPadding: 'text',\n textAlignVertical: 'text',\n textShadowColor: 'text',\n textShadowOffset: 'text',\n textShadowRadius: 'text',\n writingDirection: 'text'\n};\n\nconst extraStylesRegistry = {\n ...extraTextStyles,\n ...extraLongViewStyles\n};\n\nexport class CSSNativeParseRun extends CSSParseRun {\n private declaration: MixedStyleDeclaration;\n\n constructor(\n declaration: MixedStyleDeclaration,\n registry: CSSPropertiesValidationRegistry\n ) {\n super(registry);\n this.declaration = declaration;\n }\n\n private fillProp(\n key: K,\n value: any\n ): void {\n const validator = this.validationMap.getValidatorForProperty(key);\n if (validator) {\n const normalizedValue = validator.normalizeNativeValue(value);\n if (normalizedValue instanceof ShortMergeRequest) {\n normalizedValue.forEach(([innerKey, innerValue]) => {\n this.fillProp(innerKey as any, innerValue);\n });\n } else {\n // assume longhand merge\n this.processedProps.withProperty(\n key,\n normalizedValue,\n validator as CSSPropertySpecs\n );\n }\n } else if (lookupRecord(extraStylesRegistry, key)) {\n this.processedProps.withProperty(key, value, {\n compatCategory: 'native',\n displayCategory: extraStylesRegistry[key],\n propagationCategory: 'retain'\n });\n } else if (lookupRecord(nativeDirectionalStyleKeys, key)) {\n console.warn(\n `Native style property \"${key}\" is a directional style property. These are not yet supported.`\n );\n } else {\n console.warn(\n `Native style property \"${key}\" is not supported and has been ignored.`\n );\n }\n }\n\n protected fillProcessedProps(): void {\n const declaration = this.declaration;\n for (const key of Object.keys(declaration) as Array<\n keyof MixedStyleDeclaration\n >) {\n this.fillProp(key, this.declaration[key]);\n }\n }\n}\n","import { CSSPropertiesValidationRegistry as CSSPropertiesValidationMap } from './CSSPropertiesValidationRegistry';\nimport { CSSProcessedProps } from './CSSProcessedProps';\n\nexport abstract class CSSParseRun {\n protected validationMap: CSSPropertiesValidationMap;\n protected processedProps: CSSProcessedProps;\n\n constructor(validationMap: CSSPropertiesValidationMap) {\n this.validationMap = validationMap;\n this.processedProps = new CSSProcessedProps();\n }\n\n protected abstract fillProcessedProps(): void;\n\n public exec(): CSSProcessedProps {\n this.fillProcessedProps();\n return this.processedProps;\n }\n}\n","import { CSSProperties } from 'react';\nimport { TextStyle, ViewStyle } from 'react-native';\nimport { MixedStyleDeclaration } from './CSSProcessor';\nimport { emptyProps, isNotEmpty } from './emptyProps';\nimport mergeProps from './mergeProps';\nimport {\n CSSPropertyCompatCategory,\n CSSDisplayRegistry,\n WebTextFlowProperties,\n CSSPropertySpecs,\n CSSPropertyDisplayCategory,\n CSSPropertyPropagationCategory\n} from './processor-types';\nimport {\n CSSLongNativeTranslatableBlockFlowedPropKey,\n CSSLongNativeTranslatableBlockRetainedPropKey,\n CSSLongNativeTranslatableTextFlowedPropKey,\n CSSLongNativeTranslatableTextRetainedPropKey,\n CSSLongNativeUntranslatableBlockFlowedPropKey,\n CSSLongNativeUntranslatableBlockPropKey,\n CSSLongWebTextRetainedPropKey\n} from './property-types';\n\nconst compatCategories: ReadonlyArray = [\n 'native',\n 'web'\n];\nconst displayCategories: ReadonlyArray = [\n 'text',\n 'block'\n];\nconst propagationCategories: ReadonlyArray = [\n 'flow',\n 'retain'\n];\n\n/**\n * An object representing categorized style props. Props are categorized\n * depending on their inheritability (flow, retain), target (block, text)\n * and (react) native support (native, web).\n */\nexport class CSSProcessedProps\n implements Record\n{\n readonly native: {\n text: {\n flow: Partial<\n Pick\n >;\n retain: Partial<\n Pick\n >;\n };\n block: {\n flow: Partial<\n Pick\n >;\n retain: Partial<\n Pick\n >;\n };\n };\n readonly web: {\n text: {\n flow: Partial & CSSProperties;\n retain: Partial> &\n CSSProperties;\n };\n block: {\n flow: Partial<\n Pick\n > &\n CSSProperties;\n retain: Partial<\n Pick\n > &\n CSSProperties;\n };\n };\n\n constructor() {\n this.native = this.newCompatCategory<'native'>();\n this.web = this.newCompatCategory<'web'>();\n }\n\n private newCompatCategory<\n T extends CSSPropertyCompatCategory\n >(): CSSProcessedProps[T] {\n return {\n block: {\n retain: emptyProps,\n flow: emptyProps\n },\n text: {\n retain: emptyProps,\n flow: emptyProps\n }\n };\n }\n\n public withProperty(\n propertyName: K,\n propertyValue: MixedStyleDeclaration[K],\n { compatCategory, displayCategory, propagationCategory }: CSSPropertySpecs\n ) {\n if (propertyValue !== null) {\n const target = this[compatCategory][displayCategory][propagationCategory];\n if (!isNotEmpty(target)) {\n this[compatCategory][displayCategory][propagationCategory] = {};\n }\n //@ts-ignore\n this[compatCategory][displayCategory][propagationCategory][propertyName] =\n propertyValue;\n }\n return this;\n }\n\n /**\n * Create a new processed prop object by merging the 'overriders' parameters\n * into this object.\n *\n * @param overriders - The processed props which will be merged into this\n * processed prop. Rightmost props will override leftmost props.\n */\n public merge(...overriders: Array) {\n const filtered = overriders.filter(isNotEmpty);\n const next = new CSSProcessedProps();\n for (const compat of compatCategories) {\n for (const display of displayCategories) {\n for (const propagation of propagationCategories) {\n next[compat][display][propagation] = mergeProps([\n this[compat][display][propagation],\n ...filtered.map((o) => o[compat][display][propagation])\n ]);\n }\n }\n }\n return next;\n }\n\n static new() {\n return new CSSProcessedProps();\n }\n}\n","import { CSSProcessorConfig } from './config';\nimport { CSSInlineParseRun } from './CSSInlineParseRun';\nimport { CSSNativeParseRun } from './CSSNativeParseRun';\nimport { CSSProcessedProps } from './CSSProcessedProps';\nimport { CSSPropertiesValidationRegistry } from './CSSPropertiesValidationRegistry';\nimport { defaultCSSProcessorConfig } from './default';\nimport {\n ExtraNativeShortStyle,\n ExtraNativeTextStyle,\n ExtraNativeUntranslatedLongStyles,\n ExtraNativeViewStyle\n} from './native-types';\nimport {\n WebBlockRetainProperties,\n WebTextFlowProperties\n} from './processor-types';\n\n// https://www.w3.org/TR/CSS22/\n// https://www.w3.org/TR/css3-cascade/\n// https://www.w3.org/TR/css-cascade-4/\n// https://www.w3.org/TR/css-text-3/\n// https://www.w3.org/TR/css3-values/\n// https://www.w3.org/TR/css-values-4/\n\n/**\n * All those styles that result from processing inline styles.\n */\nexport type CSSFlattenProcessedTypes =\n CSSProcessedProps['native']['text']['flow'] &\n CSSProcessedProps['native']['block']['flow'] &\n CSSProcessedProps['native']['text']['retain'] &\n CSSProcessedProps['native']['block']['retain'];\n\n/**\n * These properties can be set to any of the supoprted CSS sizes, including em,\n * rem units and special values such as large, larger for `fontSize`, thin,\n * medium for `borderWidth`, before passed to {@link CSSProcessor.compileStyleDeclaration}.\n */\nexport type MixedSizeCSSPropertiesKeys =\n | 'fontSize'\n | 'borderWidth'\n | 'letterSpacing'\n | 'bottom'\n | 'left'\n | 'top'\n | 'right'\n | 'width'\n | 'height'\n | 'flexBasis'\n | 'borderRadius'\n | 'borderBottomLeftRadius'\n | 'borderBottomRightRadius'\n | 'borderTopLeftRadius'\n | 'borderTopRightRadius'\n | 'borderWidth'\n | 'borderBottomWidth'\n | 'borderLeftWidth'\n | 'borderRightWidth'\n | 'marginBottom'\n | 'marginLeft'\n | 'marginRight'\n | 'marginTop'\n | 'margin'\n | 'marginHorizontal'\n | 'marginVertical'\n | 'maxWidth'\n | 'maxHeight'\n | 'minWidth'\n | 'minHeight'\n | 'padding'\n | 'paddingBottom'\n | 'paddingLeft'\n | 'paddingRight'\n | 'paddingTop'\n | 'paddingHorizontal'\n | 'paddingVertical';\n\n/**\n * A Style object that can contain mixins of a subset of ViewStyle, TextStyle,\n * and special style entries such as \"whiteSpace\", \"listStyleType\".\n *\n * @remarks Also note that special lengths,\n * such as \"em\", \"rem\" units, and special values, such as \"%\" for fontSize, and\n * keyword values ('larger', 'smaller' for fontSize, 'thick', 'thin', 'medium'\n * for border*Width) will be handled as per CSS specifications on units.\n * Another special use case is fontFamily, which can be a list of font names as\n * per the CSS standard. The translated font will be selected with\n * {@link CSSProcessorConfig.isFontSupported}.\n */\nexport type MixedStyleDeclaration = Omit<\n CSSFlattenProcessedTypes,\n MixedSizeCSSPropertiesKeys\n> &\n WebTextFlowProperties &\n WebBlockRetainProperties &\n ExtraNativeTextStyle &\n ExtraNativeViewStyle &\n ExtraNativeShortStyle &\n ExtraNativeUntranslatedLongStyles &\n {\n [k in MixedSizeCSSPropertiesKeys]?: number | string;\n };\n\nexport class CSSProcessor {\n public readonly registry: CSSPropertiesValidationRegistry;\n constructor(userConfig?: Partial) {\n const config = {\n ...defaultCSSProcessorConfig,\n ...userConfig\n };\n this.registry = new CSSPropertiesValidationRegistry(config);\n }\n\n /**\n *\n * Incoming style declaration:\n * - For native styles: any RN compatible style declaration + special units\n * (font-size: medium) + relative units (smaller, larger, em, rem and perhaps vw)\n *\n * @param declaration\n */\n compileStyleDeclaration(\n declaration: MixedStyleDeclaration\n ): CSSProcessedProps {\n const parseRun = new CSSNativeParseRun(declaration, this.registry);\n return parseRun.exec();\n }\n\n compileInlineCSS(inlineCSS: string): CSSProcessedProps {\n const parseRun = new CSSInlineParseRun(inlineCSS, this.registry);\n return parseRun.exec();\n }\n}\n","import { CSSProcessorConfig, CSSPropertyNameList } from './config';\nimport makepropertiesValidators, {\n ValidatorsType\n} from './makepropertiesValidators';\nimport { GenericCSSPropertyValidator } from './validators/GenericPropertyValidator';\n\nfunction makeRegistry(list: CSSPropertyNameList) {\n const registry = {} as any;\n list.forEach((prop) => {\n registry[prop] = true;\n });\n return registry;\n}\n\nexport class CSSPropertiesValidationRegistry {\n public readonly validators: Readonly;\n public readonly ignoredPropertiesRegistry: Partial>;\n public readonly allowedPropertiesRegistry: Partial<\n Record\n > | null;\n\n constructor(config: CSSProcessorConfig) {\n this.validators = makepropertiesValidators(config);\n this.ignoredPropertiesRegistry = makeRegistry(\n config.inlinePropertiesBlacklist\n );\n this.allowedPropertiesRegistry = config.inlinePropertiesWhitelist\n ? makeRegistry(config.inlinePropertiesWhitelist)\n : null;\n }\n\n private isInlinePropertyAllowed(name: string) {\n if (this.allowedPropertiesRegistry) {\n return !!this.allowedPropertiesRegistry[name];\n }\n return !this.ignoredPropertiesRegistry[name];\n }\n\n shouldRegisterInlineProperty(name: string): name is keyof ValidatorsType {\n return (\n this.isInlinePropertyAllowed(name) &&\n !!this.validators[name as keyof ValidatorsType]\n );\n }\n\n getValidatorForProperty(\n name: T\n ): T extends keyof ValidatorsType ? GenericCSSPropertyValidator : null {\n return (this.validators[name as keyof ValidatorsType] as any) || null;\n }\n}\n","import { CSSProperties } from './processor-types';\n\nexport class ShortMergeRequest {\n public readonly properties: CSSProperties | null;\n constructor(properties: CSSProperties | null) {\n this.properties = properties;\n }\n\n forEach(callback: (record: CSSProperties[number]) => void) {\n this.entries().forEach(callback);\n }\n\n map(callback: (record: CSSProperties[number]) => T) {\n return this.entries().map(callback);\n }\n\n entries() {\n if (this.properties == null) {\n return [];\n }\n return Object.entries(this.properties);\n }\n}\n","import { CSSProcessorConfig } from './config';\n\nconst inchMultiplicator = 96;\nconst cmMultiplicator = inchMultiplicator * 2.54;\nconst mmMultiplicator = cmMultiplicator / 10;\nconst ptMultiplicator = 4 / 3;\nconst pcMultiplicator = 12 * ptMultiplicator;\n\nexport const defaultCSSProcessorConfig: CSSProcessorConfig = {\n absoluteLengthUnitsMultiplicators: {\n cm: cmMultiplicator,\n in: inchMultiplicator,\n mm: mmMultiplicator,\n pc: pcMultiplicator,\n pt: ptMultiplicator\n },\n absoluteBorderWidthsPixelMap: {\n medium: 2.5,\n thick: 5,\n thin: 1\n },\n absoluteFontSizesPixelMap: {\n medium: 14,\n 'xx-small': 8.5,\n 'x-small': 10,\n small: 12,\n large: 17,\n 'x-large': 20,\n 'xx-large': 24\n },\n relativeFontSizesCoefficientMap: {\n larger: 1.2,\n smaller: 0.83\n },\n inlinePropertiesBlacklist: [],\n rootFontSize: 16,\n inlinePropertiesWhitelist: null,\n isFontSupported() {\n return true;\n }\n};\n","const emptySymbol = Symbol('emptyProps');\n\nexport type EmptyProps = typeof emptyProps;\n\nexport const emptyProps = (function () {\n let obj = {};\n Object.defineProperty(obj, '$$empty', {\n value: emptySymbol,\n enumerable: false\n });\n obj = Object.freeze(obj);\n return obj;\n})() as {\n $$empty: symbol;\n};\n\nexport function isNotEmpty(p: T): p is Exclude {\n //@ts-ignore\n return !!p && p.$$empty !== emptySymbol;\n}\n","export function lookupRecord>(\n record: T,\n key: any\n): key is keyof T {\n const value = record[key];\n return !!value;\n}\n","import { CSSProcessor } from './CSSProcessor';\nexport { CSSProcessedProps } from './CSSProcessedProps';\nexport * from './config';\nexport * from './default';\nexport * from './processor-types';\nexport * from './property-types';\nexport * from './native-types';\nexport { default as mergeProps } from './mergeProps';\nexport { CSSProcessor };\nexport type {\n CSSFlattenProcessedTypes,\n MixedSizeCSSPropertiesKeys,\n MixedStyleDeclaration\n} from './CSSProcessor';\nexport default CSSProcessor;\n","import { CSSProcessorConfig } from './config';\nimport { LongFontFamilyPropertyValidator } from './validators/LongFontFamilyPropertyValidator';\nimport { LongFloatNumberCSSPropertyValidator } from './validators/LongFloatNumberCSSPropertyValidator';\nimport { LongBorderWidthCSSPropertyValidator } from './validators/LongBorderWidthCSSPropertyValidator';\nimport { LongFontSizeCSSValidator } from './validators/LongFontSizeCSSValidator';\nimport { LongSizeCSSPropertyValidator } from './validators/LongSizeCSSPropertyValidator';\nimport { LongAspectRatioPropertyValidator } from './validators/LongAspectRatioPropertyValidator';\nimport { LongEnumerationListCSSPropertyValidator } from './validators/LongEnumerationListCSSPropertyValidator';\nimport { LongBorderStyleCSSPropertyValidator } from './validators/LongBorderStyleCSSPropertyValidator';\nimport { LongEnumerationCSSPropertyValidator } from './validators/LongEnumerationCSSPropertyValidator';\nimport { LongColorCSSPropertyValidator } from './validators/LongColorCSSPropertyValidator';\nimport { ShortFontCSSValidator } from './validators/ShortFontCSSValidator';\nimport { ShortCSSToReactNativeValidator } from './validators/ShortCSSToReactNativeValidator';\nimport { ShortFlexCSSPropertyValidator } from './validators/ShortFlexCSSPropertyValidator';\nimport { LongCSSToReactNativeValidator } from './validators/LongCSSToReactNativeValidator';\nimport { ShortCardinalCSSpropertyValidator } from './validators/ShortCardinalCSSPropertyValidator';\nimport { ShortDualNativepropertyValidator } from './validators/ShortDualNativePropertyValidator';\nimport { LongForgivingCSSPropertyValidator } from './validators/LongForgivingCSSPropertyValidator';\nimport { LongNonPercentSizeCSSPropertyValidator } from './validators/LongNonPercentSizeCSSPropertyValidator';\n\nconst nativeTranslatableBlockFlowModel = {\n inheritable: true,\n native: true,\n translatable: true,\n display: 'block'\n} as const;\n\nconst nativeTranslatableBlockRetainModel = {\n inheritable: false,\n native: true,\n translatable: true,\n display: 'block'\n} as const;\n\nconst nativeUntranslatableBlockRetainModel = {\n inheritable: false,\n native: true,\n translatable: false,\n display: 'block'\n} as const;\n\nconst nativeTranslatableTextFlowModel = {\n inheritable: true,\n native: true,\n translatable: true,\n display: 'text'\n} as const;\n\nconst nativeTranslatableTextRetainModel = {\n inheritable: false,\n native: true,\n translatable: true,\n display: 'text'\n} as const;\n\nconst webTextFlowModel = {\n inheritable: true,\n native: false,\n translatable: false,\n display: 'text'\n} as const;\n\nconst webBlockRetainModel = {\n inheritable: false,\n native: false,\n translatable: false,\n display: 'block'\n} as const;\n\nexport type ValidatorsType = ReturnType;\n\nexport default function makepropertiesValidators(config: CSSProcessorConfig) {\n return {\n background: new ShortCSSToReactNativeValidator({\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'background'\n }),\n border: new ShortCSSToReactNativeValidator({\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'border'\n }),\n borderRadius: new ShortCardinalCSSpropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'borderRadius'\n },\n {\n top: 'borderTopLeftRadius',\n right: 'borderTopRightRadius',\n bottom: 'borderBottomRightRadius',\n left: 'borderBottomLeftRadius'\n }\n ),\n borderColor: new ShortCardinalCSSpropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'borderColor'\n },\n {\n top: 'borderTopColor',\n right: 'borderRightColor',\n bottom: 'borderBottomColor',\n left: 'borderLeftColor'\n }\n ),\n borderStyle: new LongBorderStyleCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'borderStyle'\n },\n ['solid', 'dotted', 'dashed']\n ),\n borderWidth: new ShortCardinalCSSpropertyValidator(\n {\n config,\n propertyName: 'borderWidth',\n model: nativeTranslatableBlockRetainModel\n },\n {\n top: 'borderTopWidth',\n right: 'borderRightWidth',\n bottom: 'borderBottomWidth',\n left: 'borderLeftWidth'\n }\n ),\n flex: new ShortFlexCSSPropertyValidator({\n config,\n propertyName: 'flex',\n model: nativeTranslatableBlockRetainModel\n }),\n flexFlow: new ShortCSSToReactNativeValidator({\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'flexFlow'\n }),\n font: new ShortFontCSSValidator({\n config,\n model: nativeTranslatableTextFlowModel,\n propertyName: 'font'\n }),\n margin: new ShortCardinalCSSpropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'margin'\n },\n {\n top: 'marginTop',\n right: 'marginRight',\n bottom: 'marginBottom',\n left: 'marginLeft'\n }\n ),\n objectFit: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: webBlockRetainModel,\n propertyName: 'objectFit'\n },\n ['fill', 'contain', 'cover', 'none', 'scale-down']\n ),\n padding: new ShortCardinalCSSpropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'padding'\n },\n {\n top: 'paddingTop',\n right: 'paddingRight',\n bottom: 'paddingBottom',\n left: 'paddingLeft'\n }\n ),\n marginHorizontal: new ShortDualNativepropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'marginHorizontal'\n },\n ['marginLeft', 'marginRight']\n ),\n marginVertical: new ShortDualNativepropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'marginVertical'\n },\n ['marginTop', 'marginBottom']\n ),\n paddingHorizontal: new ShortDualNativepropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'paddingHorizontal'\n },\n ['paddingLeft', 'paddingRight']\n ),\n paddingVertical: new ShortDualNativepropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'paddingVertical'\n },\n ['paddingTop', 'paddingBottom']\n ),\n textDecoration: new ShortCSSToReactNativeValidator({\n config,\n model: nativeTranslatableTextRetainModel,\n propertyName: 'textDecoration'\n }),\n textDecorationColor: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'textDecorationColor',\n model: nativeTranslatableTextRetainModel\n }),\n textDecorationLine: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextRetainModel,\n propertyName: 'textDecorationLine'\n },\n ['none', 'underline', 'line-through', 'underline line-through'] // 'overline' not supported by RN\n ),\n textDecorationStyle: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextRetainModel,\n propertyName: 'textDecorationStyle'\n },\n ['solid', 'double', 'dotted', 'dashed'] // 'wavy' unsupported\n ),\n color: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'color',\n model: nativeTranslatableTextFlowModel\n }),\n fontFamily: new LongFontFamilyPropertyValidator({\n config,\n propertyName: 'fontFamily',\n model: nativeTranslatableTextFlowModel\n }),\n fontSize: new LongFontSizeCSSValidator({\n config,\n propertyName: 'fontSize',\n model: nativeTranslatableTextFlowModel\n }),\n fontStyle: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextFlowModel,\n propertyName: 'fontStyle'\n },\n ['normal', 'italic'] // 'oblique' not supported\n ),\n fontVariant: new LongEnumerationListCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextFlowModel,\n propertyName: 'fontVariant'\n },\n [\n 'small-caps',\n 'oldstyle-nums',\n 'lining-nums',\n 'tabular-nums',\n 'proportional-nums'\n ]\n ),\n fontWeight: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextFlowModel,\n propertyName: 'fontWeight'\n },\n [\n 'normal',\n 'bold',\n '100',\n '200',\n '300',\n '400',\n '500',\n '600',\n '700',\n '800',\n '900'\n ]\n ),\n letterSpacing: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'letterSpacing',\n model: nativeTranslatableTextFlowModel\n }),\n // TODO handle unitless heights\n lineHeight: new LongNonPercentSizeCSSPropertyValidator({\n config,\n propertyName: 'lineHeight',\n model: nativeTranslatableTextFlowModel\n }),\n textAlign: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextFlowModel,\n propertyName: 'textAlign'\n },\n ['auto', 'left', 'right', 'center', 'justify']\n ),\n textTransform: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableTextFlowModel,\n propertyName: 'textTransform'\n },\n ['none', 'capitalize', 'uppercase', 'lowercase']\n ),\n whiteSpace: new LongEnumerationCSSPropertyValidator(\n { config, model: webTextFlowModel, propertyName: 'whiteSpace' },\n ['normal', 'pre']\n ),\n listStyleType: new LongForgivingCSSPropertyValidator({\n config,\n model: webTextFlowModel,\n propertyName: 'listStyleType'\n }),\n userSelect: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: webTextFlowModel,\n propertyName: 'userSelect'\n },\n ['auto', 'text', 'none', 'contain', 'all']\n ),\n alignContent: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'alignContent'\n },\n [\n 'flex-start',\n 'flex-end',\n 'center',\n 'stretch',\n 'space-between',\n 'space-around'\n ]\n ),\n alignItems: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'alignItems'\n },\n ['flex-start', 'flex-end', 'center', 'stretch', 'baseline']\n ),\n alignSelf: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'alignSelf'\n },\n ['auto', 'flex-start', 'flex-end', 'center', 'stretch', 'baseline']\n ),\n aspectRatio: new LongAspectRatioPropertyValidator({\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'aspectRatio'\n }),\n bottom: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'bottom',\n model: nativeTranslatableBlockRetainModel\n }),\n display: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'display'\n },\n ['flex', 'none']\n ),\n flexBasis: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'flexBasis',\n model: nativeTranslatableBlockRetainModel\n }),\n flexDirection: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'flexDirection'\n },\n ['row', 'column', 'row-reverse', 'column-reverse']\n ),\n flexGrow: new LongFloatNumberCSSPropertyValidator({\n config,\n propertyName: 'flexGrow',\n model: nativeTranslatableBlockRetainModel\n }),\n flexShrink: new LongFloatNumberCSSPropertyValidator({\n config,\n propertyName: 'flexShrink',\n model: nativeTranslatableBlockRetainModel\n }),\n flexWrap: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'flexWrap'\n },\n ['wrap', 'nowrap', 'wrap-reverse']\n ),\n justifyContent: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'justifyContent'\n },\n [\n 'flex-start',\n 'flex-end',\n 'center',\n 'space-between',\n 'space-around',\n 'space-evenly'\n ]\n ),\n left: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'left',\n model: nativeTranslatableBlockRetainModel\n }),\n position: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeUntranslatableBlockRetainModel,\n propertyName: 'position'\n },\n ['absolute', 'relative']\n ),\n right: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'right',\n model: nativeTranslatableBlockRetainModel\n }),\n top: new LongSizeCSSPropertyValidator({\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'top'\n }),\n backfaceVisibility: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockRetainModel,\n propertyName: 'backfaceVisibility'\n },\n ['visible', 'hidden']\n ),\n backgroundColor: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'backgroundColor',\n model: nativeTranslatableBlockRetainModel\n }),\n borderBottomColor: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'borderBottomColor',\n model: nativeTranslatableBlockRetainModel\n }),\n borderBottomLeftRadius: new LongNonPercentSizeCSSPropertyValidator({\n config,\n propertyName: 'borderBottomLeftRadius',\n model: nativeTranslatableBlockRetainModel\n }),\n borderBottomRightRadius: new LongNonPercentSizeCSSPropertyValidator({\n config,\n propertyName: 'borderBottomRightRadius',\n model: nativeTranslatableBlockRetainModel\n }),\n borderBottomWidth: new LongBorderWidthCSSPropertyValidator({\n config,\n propertyName: 'borderBottomWidth',\n model: nativeTranslatableBlockRetainModel\n }),\n borderLeftColor: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'borderLeftColor',\n model: nativeTranslatableBlockRetainModel\n }),\n borderLeftWidth: new LongBorderWidthCSSPropertyValidator({\n config,\n propertyName: 'borderLeftWidth',\n model: nativeTranslatableBlockRetainModel\n }),\n borderRightColor: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'borderRightColor',\n model: nativeTranslatableBlockRetainModel\n }),\n borderRightWidth: new LongBorderWidthCSSPropertyValidator({\n config,\n propertyName: 'borderRightWidth',\n model: nativeTranslatableBlockRetainModel\n }),\n borderTopColor: new LongColorCSSPropertyValidator({\n config,\n propertyName: 'borderTopColor',\n model: nativeTranslatableBlockRetainModel\n }),\n borderTopLeftRadius: new LongNonPercentSizeCSSPropertyValidator({\n config,\n propertyName: 'borderTopLeftRadius',\n model: nativeTranslatableBlockRetainModel\n }),\n borderTopRightRadius: new LongNonPercentSizeCSSPropertyValidator({\n config,\n propertyName: 'borderTopRightRadius',\n model: nativeTranslatableBlockRetainModel\n }),\n borderTopWidth: new LongBorderWidthCSSPropertyValidator({\n config,\n propertyName: 'borderTopWidth',\n model: nativeTranslatableBlockRetainModel\n }),\n height: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'height',\n model: nativeTranslatableBlockRetainModel\n }),\n marginBottom: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'marginBottom',\n model: nativeTranslatableBlockRetainModel\n }),\n marginLeft: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'marginLeft',\n model: nativeTranslatableBlockRetainModel\n }),\n marginRight: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'marginRight',\n model: nativeTranslatableBlockRetainModel\n }),\n marginTop: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'marginTop',\n model: nativeTranslatableBlockRetainModel\n }),\n maxHeight: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'maxHeight',\n model: nativeTranslatableBlockRetainModel\n }),\n maxWidth: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'maxWidth',\n model: nativeTranslatableBlockRetainModel\n }),\n minHeight: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'minHeight',\n model: nativeTranslatableBlockRetainModel\n }),\n minWidth: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'minWidth',\n model: nativeTranslatableBlockRetainModel\n }),\n opacity: new LongFloatNumberCSSPropertyValidator({\n config,\n propertyName: 'opacity',\n model: nativeTranslatableBlockRetainModel\n }),\n paddingBottom: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'paddingBottom',\n model: nativeTranslatableBlockRetainModel\n }),\n paddingLeft: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'paddingLeft',\n model: nativeTranslatableBlockRetainModel\n }),\n paddingRight: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'paddingRight',\n model: nativeTranslatableBlockRetainModel\n }),\n paddingTop: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'paddingTop',\n model: nativeTranslatableBlockRetainModel\n }),\n transform: new LongCSSToReactNativeValidator({\n config,\n propertyName: 'transform',\n model: nativeTranslatableBlockRetainModel\n }),\n width: new LongSizeCSSPropertyValidator({\n config,\n propertyName: 'width',\n model: nativeTranslatableBlockRetainModel\n }),\n zIndex: new LongFloatNumberCSSPropertyValidator({\n config,\n propertyName: 'zIndex',\n model: nativeTranslatableBlockRetainModel\n }),\n direction: new LongEnumerationCSSPropertyValidator(\n {\n config,\n model: nativeTranslatableBlockFlowModel,\n propertyName: 'direction'\n },\n ['auto', 'ltr', 'rtl']\n )\n };\n}\n","import { emptyProps, isNotEmpty } from './emptyProps';\n\nfunction mergeProps>(props: Array): T {\n const filteredProps = props.filter(isNotEmpty);\n if (filteredProps.length) {\n return Object.assign({}, ...filteredProps);\n }\n return emptyProps as unknown as T;\n}\n\nexport default mergeProps;\n","import { CSSProcessorConfig } from '../config';\nimport { CSSPropertyModel, CSSPropertyValidatorParams } from './types';\nimport {\n CSSPropertyCompatCategory,\n CSSPropertyDisplayCategory,\n CSSPropertyPropagationCategory,\n CSSPropertySpecs\n} from '../processor-types';\nimport { ShortMergeRequest } from '../ShortMergeRequest';\n\nexport abstract class GenericCSSPropertyValidator<\n C extends CSSPropertyModel = any,\n N = any\n> implements CSSPropertySpecs\n{\n protected readonly model: C;\n protected readonly config: CSSProcessorConfig;\n public readonly compatCategory: CSSPropertyCompatCategory;\n public readonly propagationCategory: CSSPropertyPropagationCategory;\n public readonly displayCategory: CSSPropertyDisplayCategory;\n public readonly propertyName: string;\n private readonly _isShorthand: boolean;\n\n constructor(\n { model, config, propertyName }: CSSPropertyValidatorParams,\n isShorthand: boolean\n ) {\n this.model = model;\n this.config = config;\n this.compatCategory = model.translatable ? 'native' : 'web';\n this.propagationCategory = model.inheritable ? 'flow' : 'retain';\n this.displayCategory = model.display;\n this.propertyName = propertyName;\n this._isShorthand = isShorthand;\n }\n\n /**\n * Normalize value from inline styles\n *\n * @param value\n */\n abstract normalizeInlineCSSValue(\n value: string | N\n ): ShortMergeRequest | N | null;\n\n /**\n * Normalize value from native styles.\n *\n * @param value\n */\n abstract normalizeNativeValue(value: N): ShortMergeRequest | N | null;\n\n isShorthand(): boolean {\n return this._isShorthand;\n }\n}\n","import { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nconst ASPECT_RATIO_REGEX = /^(\\d+)\\/(\\d+)$/;\n\nexport class LongAspectRatioPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string): number | null {\n const match = ASPECT_RATIO_REGEX.exec(value);\n if (match) {\n const ratio = Number(match[1]) / Number(match[2]);\n return Number.isFinite(ratio) ? ratio : null;\n }\n const fallback = Number(value);\n return Number.isNaN(fallback) ? null : fallback;\n }\n\n normalizeNativeValue(value: string | number): number | null {\n return typeof value !== 'string'\n ? value\n : this.normalizeRawInlineCSSValue(value);\n }\n}\n","import { LongEnumerationCSSPropertyValidator } from './LongEnumerationCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nconst WHITESPACE_REGEX = /\\s+/;\n\nexport class LongBorderStyleCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongEnumerationCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string): string | null {\n const normalizedVal = this.pickFirst(value);\n return normalizedVal\n ? super.normalizeRawInlineCSSValue(normalizedVal)\n : null;\n }\n\n normalizeNativeValue(value: string) {\n return this.pickFirst(value);\n }\n\n pickFirst(value: string) {\n const values = value.split(WHITESPACE_REGEX);\n return values[0] || null;\n }\n}\n","import { lookupRecord } from '../helpers';\nimport { LongNonPercentSizeCSSPropertyValidator } from './LongNonPercentSizeCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nexport class LongBorderWidthCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongNonPercentSizeCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string) {\n if (lookupRecord(this.config.absoluteBorderWidthsPixelMap, value)) {\n return this.config.absoluteBorderWidthsPixelMap[value];\n }\n return super.normalizeRawInlineCSSValue(value);\n }\n\n normalizeNativeValue(value: string | number) {\n return this.normalizeInlineCSSValue(value);\n }\n}\n","import { GenericCSSPropertyValidator } from './GenericPropertyValidator';\nimport { CSSPropertyValidatorParams, CSSPropertyModel } from './types';\n\nexport abstract class LongCSSPropertyValidator<\n C extends CSSPropertyModel = any,\n N = any\n> extends GenericCSSPropertyValidator {\n constructor(params: CSSPropertyValidatorParams) {\n super(params, false);\n }\n\n /**\n * Normalize a rule value from inline CSS styles.\n *\n * @param value - The CSS property value to test.\n * @returns The normalized value, or null if normalization failed.\n */\n normalizeInlineCSSValue(value: N | string): N | null {\n if (typeof value !== 'string') {\n return value;\n }\n return this.normalizeRawInlineCSSValue(value);\n }\n\n abstract normalizeRawInlineCSSValue(value: string): N | null;\n\n /**\n * Normalize a mixed value from a @{link MixedStyleDeclaration}.\n *\n * @param value\n */\n normalizeNativeValue(value: N): N | null {\n return value;\n }\n}\n","import { CSSPropertyModel } from './types';\nimport { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport expandCSSToRN from './expandCSSToRN';\n\nexport class LongCSSToReactNativeValidator<\n C extends CSSPropertyModel = any\n> extends LongCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string) {\n const expanded = expandCSSToRN(this.propertyName, value);\n if (expanded) {\n return expanded[this.propertyName];\n }\n return null;\n }\n}\n","import { LongForgivingCSSPropertyValidator } from './LongForgivingCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nconst COLOR_REGEX = /^(rgb|rgba|hsl|hsla)\\([\\d,%. ]+\\)|[#]?\\w+$/;\n\nexport class LongColorCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongForgivingCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string): string | null {\n return value.match(COLOR_REGEX) ? value : null;\n }\n}\n","import { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport { CSSPropertyValidatorParams, CSSPropertyModel } from './types';\n\nexport class LongEnumerationCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n public readonly allowedList: ReadonlyArray;\n constructor(params: CSSPropertyValidatorParams, allowedList: string[]) {\n super(params);\n this.allowedList = allowedList;\n }\n\n normalizeRawInlineCSSValue(v: string): string | null {\n if (this.allowedList.indexOf(v) !== -1) {\n return v;\n }\n return null;\n }\n\n normalizeNativeValue(v: string): string | null {\n return this.normalizeInlineCSSValue(v);\n }\n}\n","import { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport { CSSPropertyValidatorParams, CSSPropertyModel } from './types';\n\nconst WHITESPACE_REGEX = /\\s+/;\n\nexport class LongEnumerationListCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n public readonly allowedList: ReadonlyArray;\n constructor(params: CSSPropertyValidatorParams, allowedList: string[]) {\n super(params);\n this.allowedList = allowedList;\n }\n\n normalizeRawInlineCSSValue(value: string): string[] | null {\n const input = value.split(WHITESPACE_REGEX);\n const values: string[] = [];\n for (const item of input) {\n if (this.allowedList.indexOf(item) !== -1) {\n values.push(item);\n }\n }\n return values.length > 0 ? values : null;\n }\n}\n","import { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nexport class LongFloatNumberCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string): number | null {\n const normalizedVal = Number(value);\n if (Number.isNaN(normalizedVal)) {\n return null;\n }\n return normalizedVal;\n }\n\n normalizeNativeValue(v: string | number): number | null {\n return this.normalizeInlineCSSValue(v);\n }\n}\n","import { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport normalizeFontName from './normalizeFontName';\nimport { CSSPropertyModel } from './types';\n\nconst SEPARATOR_REGEX = /,\\s*/;\n\nexport class LongFontFamilyPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string): string | null {\n const values = value.split(SEPARATOR_REGEX);\n for (const font of values) {\n const normalizedFont = normalizeFontName(font);\n const isFontSupported =\n normalizedFont.length && this.config.isFontSupported(normalizedFont);\n if (isFontSupported) {\n return typeof isFontSupported === 'string'\n ? isFontSupported\n : normalizedFont;\n }\n }\n return null;\n }\n normalizeNativeValue(value: string) {\n return this.normalizeInlineCSSValue(value);\n }\n}\n","import { CSSLengthUnit } from '../config';\nimport { lookupRecord } from '../helpers';\nimport { LongSizeCSSPropertyValidator } from './LongSizeCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nexport class LongFontSizeCSSValidator<\n C extends CSSPropertyModel\n> extends LongSizeCSSPropertyValidator {\n protected computeSize(value: number, unit: CSSLengthUnit) {\n if (unit === '%') {\n return this.computeEmSize(value / 100);\n }\n return super.computeSize(value, unit);\n }\n\n normalizeRawInlineCSSValue(value: string) {\n if (lookupRecord(this.config.absoluteFontSizesPixelMap, value)) {\n return this.config.absoluteFontSizesPixelMap[value];\n }\n if (lookupRecord(this.config.relativeFontSizesCoefficientMap, value)) {\n return this.computeEmSize(\n this.config.relativeFontSizesCoefficientMap[value]\n );\n }\n return super.normalizeRawInlineCSSValue(value);\n }\n\n normalizeNativeValue(value: string | number) {\n return this.normalizeInlineCSSValue(value);\n }\n}\n","import { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nexport class LongForgivingCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n normalizeRawInlineCSSValue(value: string): string | null {\n return value;\n }\n}\n","import { CSSLengthUnit } from '../config';\nimport { LongSizeCSSPropertyValidator } from './LongSizeCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nexport class LongNonPercentSizeCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongSizeCSSPropertyValidator {\n protected computeSize(value: number, unit: CSSLengthUnit) {\n if (unit === '%') {\n return null;\n }\n return super.computeSize(value, unit);\n }\n}\n","import { CSSLengthUnit } from '../config';\nimport { LongCSSPropertyValidator } from './LongCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\n\nexport class LongSizeCSSPropertyValidator<\n C extends CSSPropertyModel\n> extends LongCSSPropertyValidator {\n protected computeSize(\n value: number,\n unit: CSSLengthUnit\n ): number | string | null {\n switch (unit) {\n case '%':\n return `${value}%`;\n case 'px':\n return value;\n case 'cm':\n case 'in':\n case 'mm':\n case 'pc':\n case 'pt':\n return value * this.config.absoluteLengthUnitsMultiplicators[unit];\n case 'em':\n return this.computeEmSize(value);\n case 'ex':\n // This is an approximation.\n return this.computeEmSize(value * 0.63);\n case 'rem':\n return this.config.rootFontSize * value;\n }\n return null;\n }\n\n protected computeEmSize(value: number) {\n return this.config.rootFontSize * value;\n }\n\n protected splitValueAndUnit(value: string): [number, CSSLengthUnit] | null {\n const match =\n /^(\\d*\\.?\\d*)\\s*(cm|mm|in|px|pt|pc|em|ex|ch|rem|vw|vh|vmin|vmax|%)$/g.exec(\n value\n );\n if (match === null) {\n return null;\n }\n return [Number(match[1]), match[2] as CSSLengthUnit];\n }\n\n normalizeRawInlineCSSValue(value: string) {\n if (value === '0') {\n return 0;\n }\n if (value === 'auto') {\n return value;\n }\n const split = this.splitValueAndUnit(value);\n if (split) {\n return this.computeSize(split[0], split[1]);\n }\n return null;\n }\n\n normalizeNativeValue(value: string | number) {\n return this.normalizeInlineCSSValue(value);\n }\n}\n","import { ShortMergeRequest } from '../ShortMergeRequest';\nimport { GenericCSSPropertyValidator } from './GenericPropertyValidator';\nimport { CSSPropertyModel, ShortCSSPropertyValidatorParams } from './types';\n\nexport abstract class ShortCSSPropertyValidator<\n C extends CSSPropertyModel = any,\n N = any\n> extends GenericCSSPropertyValidator {\n constructor(params: ShortCSSPropertyValidatorParams) {\n super(params, true);\n }\n\n /**\n * Expand a CSS shorthand property to its longhand equivalent.\n *\n * @param value\n */\n abstract normalizeInlineCSSValue(value: string): ShortMergeRequest | null;\n\n /**\n * Expand a React Native shorthand property to its longhand equivalent.\n *\n * @param value\n */\n abstract normalizeNativeValue(value: N): ShortMergeRequest | N | null;\n}\n","import { ShortCSSPropertyValidator } from './ShortCSSPropertyValidator';\nimport { CSSPropertyModel } from './types';\nimport expandCSSToRN from './expandCSSToRN';\nimport { ShortMergeRequest } from '../ShortMergeRequest';\n\nexport class ShortCSSToReactNativeValidator<\n C extends CSSPropertyModel = any\n> extends ShortCSSPropertyValidator {\n normalizeInlineCSSValue(value: string): ShortMergeRequest | null {\n return new ShortMergeRequest(expandCSSToRN(this.propertyName, value));\n }\n /**\n * Not supported on Native.\n * @param value\n */\n normalizeNativeValue() {\n return null;\n }\n}\n","import { ShortMergeRequest } from '../ShortMergeRequest';\nimport { ShortCSSPropertyValidator } from './ShortCSSPropertyValidator';\nimport { CSSPropertyModel, ShortCSSPropertyValidatorParams } from './types';\n\nexport type Directions = {\n top: string;\n bottom: string;\n left: string;\n right: string;\n};\n\nconst WHITESPACE_REGEX = /\\s+/;\n\nexport class ShortCardinalCSSpropertyValidator<\n C extends CSSPropertyModel = any\n> extends ShortCSSPropertyValidator {\n public directions: Readonly;\n constructor(\n params: ShortCSSPropertyValidatorParams,\n /**\n * Top, Right, Bottom, Left\n */\n directions: Readonly\n ) {\n super(params);\n this.directions = directions;\n }\n\n normalizeInlineCSSValue(value: string | number) {\n if (typeof value === 'number') {\n return new ShortMergeRequest({\n [this.directions.top]: value,\n [this.directions.right]: value,\n [this.directions.bottom]: value,\n [this.directions.left]: value\n });\n }\n const values = value.split(WHITESPACE_REGEX);\n if (values.length === 4) {\n return new ShortMergeRequest({\n [this.directions.top]: values[0],\n [this.directions.right]: values[1],\n [this.directions.bottom]: values[2],\n [this.directions.left]: values[3]\n });\n }\n if (values.length === 3) {\n return new ShortMergeRequest({\n [this.directions.top]: values[0],\n [this.directions.right]: values[1],\n [this.directions.bottom]: values[2],\n [this.directions.left]: values[1]\n });\n }\n if (values.length === 2) {\n return new ShortMergeRequest({\n [this.directions.top]: values[0],\n [this.directions.right]: values[1],\n [this.directions.bottom]: values[0],\n [this.directions.left]: values[1]\n });\n }\n if (values.length === 1) {\n return new ShortMergeRequest({\n [this.directions.top]: values[0],\n [this.directions.right]: values[0],\n [this.directions.bottom]: values[0],\n [this.directions.left]: values[0]\n });\n }\n return null;\n }\n\n normalizeNativeValue(value: string | number) {\n return this.normalizeInlineCSSValue(value);\n }\n}\n","import { ShortMergeRequest } from '../ShortMergeRequest';\nimport { ShortCSSPropertyValidator } from './ShortCSSPropertyValidator';\nimport { CSSPropertyModel, ShortCSSPropertyValidatorParams } from './types';\n\nexport class ShortDualNativepropertyValidator<\n C extends CSSPropertyModel = any\n> extends ShortCSSPropertyValidator {\n public directions: [string, string];\n constructor(\n params: ShortCSSPropertyValidatorParams,\n /**\n * First direction, second direction.\n */\n directions: [string, string]\n ) {\n super(params);\n this.directions = directions;\n }\n\n // These properties are only available for native styles.\n normalizeInlineCSSValue() {\n return null;\n }\n\n normalizeNativeValue(value: string | number) {\n return new ShortMergeRequest({\n [this.directions[0]]: value,\n [this.directions[1]]: value\n });\n }\n}\n","import { ShortMergeRequest } from '../ShortMergeRequest';\nimport expandCSSToRN from './expandCSSToRN';\nimport { ShortCSSPropertyValidator } from './ShortCSSPropertyValidator';\nimport { CSSPropertyValidatorParams, CSSPropertyModel } from './types';\n\n/**\n * Flex shorthand property in CSS and React Native differ significantly. This\n * validator must therefore expand this shorthand in a way consistent with the\n * specs for both platforms (native and CSS).\n */\nexport class ShortFlexCSSPropertyValidator extends ShortCSSPropertyValidator<\n CSSPropertyModel,\n number\n> {\n constructor(params: CSSPropertyValidatorParams) {\n super({ ...params, propertyName: 'flex' });\n }\n\n normalizeInlineCSSValue(value: string) {\n return new ShortMergeRequest(expandCSSToRN(this.propertyName, value));\n }\n\n /**\n * In React Native, \"flex\" is not a shorthand property, although it looks\n * like one. There is not always a tuple of (flexGrow, flexShrink,\n * flexBasis) that maps exactly to one single \"flex\" value.\n *\n * For this very reason, it is ill-advised to use \"flex\" shorthand property.\n * Use the longhand equivalent when that is possible.\n *\n * @param value\n */\n normalizeNativeValue(value: number) {\n return value;\n }\n}\n","import { ShortCSSToReactNativeValidator } from './ShortCSSToReactNativeValidator';\nimport normalizeFontName from './normalizeFontName';\nimport { CSSPropertyModel } from './types';\nimport { ShortMergeRequest } from '../ShortMergeRequest';\n\nconst WHITESPACE_REGEX = /\\s+/;\n\nexport class ShortFontCSSValidator<\n C extends CSSPropertyModel\n> extends ShortCSSToReactNativeValidator {\n normalizeInlineCSSValue(value: string): ShortMergeRequest | null {\n // A 'font' declaration may end with a list of multiple font families.\n // We must check support for this list before processing.\n const resp = value.split(',');\n let fontFamily = null;\n if (resp.length === 1) {\n return super.normalizeInlineCSSValue(resp[0]);\n }\n const base = resp.splice(0, 1)[0];\n for (const font of resp) {\n const normalizedFont = normalizeFontName(font);\n const isFontSupported = this.config.isFontSupported(normalizedFont);\n if (isFontSupported) {\n fontFamily =\n typeof isFontSupported === 'string'\n ? isFontSupported\n : normalizedFont;\n break;\n }\n }\n return super.normalizeInlineCSSValue(\n base.split(WHITESPACE_REGEX).slice(0, -1).join(' ') +\n ' ' +\n (fontFamily || 'system')\n );\n }\n}\n","import { getStylesForProperty } from 'css-to-react-native';\n\nexport default function expandCSSToRN(propertyName: string, value: string) {\n try {\n return getStylesForProperty(propertyName, value);\n } catch (e) {\n // Ignore this rule if parsing failed\n }\n return null;\n}\n","export default function normalizeFontName(fontName: string) {\n return fontName.replace(/[\"']/g, '').trim();\n}\n","import { collapse } from './flow/collapse';\nimport { hoist } from './flow/hoist';\nimport { translateDocument } from './flow/translate';\nimport { ParserOptions as HTMLParserOptions } from 'htmlparser2';\nimport omit from 'ramda/src/omit';\nimport {\n CSSProcessorConfig,\n defaultCSSProcessorConfig\n} from '@native-html/css-processor';\nimport parseDocument from './dom/parseDocument';\nimport { StylesConfig } from './styles/types';\nimport { TStylesMerger } from './styles/TStylesMerger';\nimport { defaultStylesConfig } from './styles/defaults';\nimport { TStyles } from './styles/TStyles';\nimport HTMLModelRegistry from './model/HTMLModelRegistry';\nimport { HTMLModelRecord, TagName } from './model/model-types';\nimport { DefaultHTMLElementModelsStatic } from './model/defaultHTMLElementModels';\nimport { DataFlowParams } from './flow/types';\nimport {\n Document,\n Element,\n Node,\n NodeWithChildren,\n isDomElement\n} from './dom/dom-utils';\nimport { SetMarkersForTNode, TDocument } from './tree/tree-types';\nimport { DomHandlerOptions, DomVisitorCallbacks } from './dom/DomHandler';\n\nexport interface TRenderEngineOptions {\n /**\n * Customization for CSS inline processing.\n */\n readonly cssProcessorConfig?: Partial;\n /**\n * Options for htmlparser2 library parser.\n */\n readonly htmlParserOptions?: Readonly;\n /**\n * Various configuration for styling.\n */\n readonly stylesConfig?: StylesConfig;\n /**\n * Customize supported tags in the engine.\n *\n * @remarks If you need to add new tags, always use lowercase names.\n */\n readonly customizeHTMLModels?: (\n defaultHTMLElementModels: DefaultHTMLElementModelsStatic\n ) => HTMLModelRecord;\n /**\n * Remove line breaks around special east-asian characters such as defined here:\n * https://www.w3.org/TR/2020/WD-css-text-3-20200429/#line-break-transform\n *\n * @defaultValue false\n */\n readonly removeLineBreaksAroundEastAsianDiscardSet?: boolean;\n /**\n * A list of tags which should not be included in the DOM.\n */\n readonly ignoredDomTags?: string[];\n\n /**\n * An object which callbacks will be invoked when a DOM element or text node\n * has been parsed and its children attached.\n *\n * @remark Each callback is applied during parsing, thus with very little\n * overhead. However, it means that one node next siblings won't be\n * available. If you need some siblings logic, apply this logic to the\n * children of this node.\n */\n readonly domVisitors?: DomVisitorCallbacks;\n\n /**\n * Ignore specific DOM nodes.\n *\n * **Warning**: when this function is invoked, the node has not yet been\n * attached to its parent or siblings. Use the second argument (`parent`)\n * if you need to perform logic based on parent.\n *\n * @remarks The function is applied during parsing, thus with very little\n * overhead. However, it means that one node next siblings won't be\n * available.\n *\n * @returns `true` if this node should not be included in the DOM, anything\n * else otherwise.\n */\n readonly ignoreDomNode?: (\n node: Node,\n parent: NodeWithChildren\n ) => boolean | void | unknown;\n\n /**\n * Select the DOM root before TTree generation. For example, you could\n * iterate over children until you reach an article element and return this\n * element.\n *\n * @remarks Applied after DOM parsing, before normalization and TTree\n * construction. Before normalization implies that a body will be added in\n * the tree **after** selecting root.\n */\n readonly selectDomRoot?: (node: NodeWithChildren) => any;\n\n /**\n * Customize markers logic by extracting markers from TNode properties such\n * as classes, ids, attributes, tagName ...\n *\n * @remarks If you are using JavaScript, you can use module augmentation and\n * declaration merging to add properties to the {@link Markers} shape.\n */\n readonly setMarkersForTNode?: SetMarkersForTNode;\n\n /**\n * Disable hoisting. Note that your layout might break!\n */\n readonly dangerouslyDisableHoisting?: boolean;\n /**\n * Disable whitespace collapsing. Especially useful if your html is\n * being pre-processed server-side with a minifier.\n */\n readonly dangerouslyDisableWhitespaceCollapsing?: boolean;\n}\n\nfunction createStylesConfig(\n options?: TRenderEngineOptions\n): Required {\n const enableUserAgentStyles =\n typeof options?.stylesConfig?.enableUserAgentStyles === 'boolean'\n ? options.stylesConfig.enableUserAgentStyles\n : defaultStylesConfig.enableUserAgentStyles;\n const baseStyle = {\n ...(enableUserAgentStyles\n ? defaultStylesConfig.baseStyle\n : omit(['fontSize'], defaultStylesConfig.baseStyle)),\n ...options?.stylesConfig?.baseStyle\n };\n return {\n ...defaultStylesConfig,\n ...options?.stylesConfig,\n baseStyle\n };\n}\n\n/**\n * The Transient Render Engine.\n *\n * @public\n */\nexport class TRenderEngine {\n private htmlParserOptions: Readonly;\n private dataFlowParams: DataFlowParams;\n private hoistingEnabled: boolean;\n private whitespaceCollapsingEnabled: boolean;\n private selectDomRoot: TRenderEngineOptions['selectDomRoot'];\n constructor(options?: TRenderEngineOptions) {\n const stylesConfig = createStylesConfig(options);\n this.hoistingEnabled = !(options?.dangerouslyDisableHoisting ?? false);\n this.whitespaceCollapsingEnabled = !(\n options?.dangerouslyDisableWhitespaceCollapsing ?? false\n );\n const modelRegistry = new HTMLModelRegistry(options?.customizeHTMLModels);\n const userSelectedFontSize =\n options?.cssProcessorConfig?.rootFontSize ||\n stylesConfig.baseStyle?.fontSize;\n // TODO log a warning when type is string\n const stylesMerger = new TStylesMerger(stylesConfig, modelRegistry, {\n ...defaultCSSProcessorConfig,\n ...options?.cssProcessorConfig,\n rootFontSize:\n typeof userSelectedFontSize === 'number' ? userSelectedFontSize : 14\n });\n this.htmlParserOptions = {\n decodeEntities: true,\n lowerCaseTags: true,\n ignoredTags: options?.ignoredDomTags,\n ignoreNode: options?.ignoreDomNode,\n visitors: options?.domVisitors,\n ...options?.htmlParserOptions\n };\n this.dataFlowParams = {\n stylesMerger,\n modelRegistry,\n setMarkersForTNode: options?.setMarkersForTNode,\n baseStyles: new TStyles(\n stylesMerger.compileStyleDeclaration(stylesConfig.baseStyle)\n ),\n removeLineBreaksAroundEastAsianDiscardSet:\n options?.removeLineBreaksAroundEastAsianDiscardSet || false\n };\n this.selectDomRoot = options?.selectDomRoot;\n }\n\n private normalizeDocument(document: Document) {\n let body: Element | undefined;\n let head: Element | undefined;\n for (const child of document.children) {\n if (body && head) {\n break;\n }\n if (isDomElement(child) && child.tagName === 'body') {\n body = child;\n }\n if (isDomElement(child) && child.tagName === 'head') {\n head = child;\n }\n }\n //@ts-ignore\n if (!body && !head) {\n body = new Element('body', {});\n body.childNodes = document.children;\n document.children.forEach((c) => {\n c.parent = body as Element;\n c.parentNode = body as Element;\n });\n body.parent = document;\n body.parentNode = document;\n document.childNodes = [body];\n }\n return document;\n }\n\n parseDocument(html: string) {\n let document = parseDocument(html, this.htmlParserOptions);\n if (this.selectDomRoot) {\n const selected = this.selectDomRoot(document) as Document;\n if (selected && selected !== document) {\n document.childNodes = [selected];\n selected.parent = document;\n }\n }\n for (const child of document.children) {\n if (isDomElement(child) && child.tagName === 'html') {\n document = child;\n break;\n }\n }\n return this.normalizeDocument(document);\n }\n\n buildTTreeFromDoc(document: Document | Element): TDocument {\n const tdoc = translateDocument(document, this.dataFlowParams);\n const hoistedTDoc = this.hoistingEnabled ? hoist(tdoc) : tdoc;\n const collapsedTDoc = this.whitespaceCollapsingEnabled\n ? collapse(hoistedTDoc)\n : tdoc;\n return collapsedTDoc as unknown as TDocument;\n }\n\n buildTTree(html: string): TDocument {\n return this.buildTTreeFromDoc(this.parseDocument(html));\n }\n\n getHTMLElementsModels() {\n return this.dataFlowParams.modelRegistry.modelRecords;\n }\n}\n","import {\n DomHandler as OriginalDomHandler,\n DomHandlerOptions as OriginalDomHandlerOptions,\n Document,\n Element,\n Node,\n Text,\n NodeWithChildren\n} from 'domhandler';\nimport { isDomElement, isDomText } from './dom-utils';\n\n/**\n * A record of callback to visit the DOM.\n *\n * @public\n */\nexport interface DomVisitorCallbacks {\n /**\n * A callback invoked when encountering a {@link Document}.\n *\n * @param document - The document to visit.\n *\n */\n onDocument?(document: Document): void;\n /**\n * A callback invoked when encountering an {@link Element}.\n *\n * @param element - The element to visit.\n */\n onElement?(element: Element): void;\n /**\n * A callback invoked when encountering a {@link Text} node.\n *\n * @param text - The text to visit.\n */\n onText?(text: Text): void;\n}\n\nexport interface DomHandlerOptions extends OriginalDomHandlerOptions {\n ignoredTags?: string[];\n visitors?: DomVisitorCallbacks;\n ignoreNode?: (\n node: Node,\n parent: NodeWithChildren\n ) => boolean | void | unknown;\n}\n\nexport default class DomHandler extends OriginalDomHandler {\n private ignoredTags: Record;\n private ignoredTagsCount = -1;\n private visitors: DomVisitorCallbacks;\n\n constructor(options: DomHandlerOptions) {\n super(undefined, options, undefined);\n let ignoredTags: DomHandler['ignoredTags'] = {};\n for (const tag of options.ignoredTags || []) {\n ignoredTags[tag] = true;\n }\n this.ignoredTags = ignoredTags;\n this.visitors = options.visitors || {};\n const isIgnored = this.isIgnored.bind(this);\n if (options.ignoreNode) {\n this.isIgnored = (node) => {\n return (\n isIgnored(node) ||\n options.ignoreNode!(node, this.tagStack[this.tagStack.length - 1])\n );\n };\n }\n }\n\n isIgnored(node: Node): boolean | unknown | void {\n return (\n (this.ignoredTags[(node as Element).name] as boolean) ||\n this.ignoredTagsCount > -1\n );\n }\n\n addNode(node: Node): void {\n if (this.isIgnored(node) === true) {\n // increment only for elements.\n if (isDomElement(node)) {\n this.ignoredTagsCount++;\n }\n } else {\n super.addNode(node);\n if (isDomText(node)) {\n this.visitors.onText?.(node);\n }\n }\n }\n\n ontext(text: string) {\n // Only include text when out of an\n // ignoring session.\n if (this.ignoredTagsCount < 0) {\n super.ontext(text);\n }\n }\n\n onopentag(name: string, attribs: any): void {\n super.onopentag(name, attribs);\n }\n\n onclosetag() {\n // Call onElement on close to give access to this node children\n this.visitors.onElement?.(\n this.tagStack[this.tagStack.length - 1] as Element\n );\n super.onclosetag();\n if (this.ignoredTagsCount > -1) {\n this.ignoredTagsCount--;\n }\n }\n\n onend(): void {\n this.visitors.onDocument?.(this.root);\n }\n}\n","import { Text, Element, Node, Document, NodeWithChildren } from 'domhandler';\nimport { Text as TextType, Tag as TagType } from 'domelementtype';\n\nexport { Text, Element, Node, NodeWithChildren, Document };\n\nexport function isDomText(node: any): node is Text {\n return node && node.type === TextType;\n}\n\nexport function isDomElement(node: any): node is Element {\n return node && node.type === TagType;\n}\n","import { Document } from 'domhandler';\nimport { Parser, ParserOptions } from 'htmlparser2';\nimport DomHandler, { DomHandlerOptions } from './DomHandler';\n/**\n * Parses the data, returns the resulting document.\n *\n * @param data The data that should be parsed.\n * @param options Optional options for the parser and DOM builder.\n */\nexport default function parseDocument(\n data: string,\n options: ParserOptions & DomHandlerOptions = {}\n): Document {\n const handler = new DomHandler(options);\n new Parser(handler, options).end(data);\n return handler.root;\n}\n","import { TNodeImpl } from '../tree/tree-types';\n\nexport function collapse(root: TNodeImpl): TNodeImpl {\n root.collapse();\n root.trimLeft();\n root.trimRight();\n return root;\n}\n","import TBlockCtor, { TBlockImpl } from '../tree/TBlockCtor';\nimport { TNodeImpl } from '../tree/tree-types';\nimport { TPhrasingCtor } from '../tree/TPhrasingCtor';\nimport { TTextCtor } from '../tree/TTextCtor';\n\n/**\n * Wrap text nodes around TPhrasing nodes.\n * @param tnode The parent node of all elements to group.\n */\nfunction groupText(tnode: TBlockImpl): TNodeImpl {\n let newChildren: TNodeImpl[] = [];\n const wrapperInit = {\n elementModel: null,\n context: tnode.init.context,\n // We need to merge styles here to make sure\n // some React Native styles working only for the uppermost Text element\n // such as \"textAlign\" are preserved.\n parentStyles: tnode.styles,\n parent: null\n };\n let wrapper = new TPhrasingCtor(wrapperInit);\n let wrapperChildren: TNodeImpl[] = [];\n for (const child of tnode.children) {\n if (child instanceof TTextCtor || child instanceof TPhrasingCtor) {\n wrapperChildren.push(child);\n } else {\n if (wrapperChildren.length) {\n newChildren.push(wrapper);\n wrapper.bindChildren(wrapperChildren);\n wrapper = new TPhrasingCtor(wrapperInit);\n wrapperChildren = [];\n }\n newChildren.push(child);\n }\n }\n if (wrapperChildren.length) {\n wrapper.bindChildren(wrapperChildren);\n newChildren.push(wrapper);\n }\n tnode.bindChildren(newChildren);\n return tnode;\n}\n\nfunction hoistNode(tnode: TNodeImpl): TNodeImpl {\n if (tnode instanceof TTextCtor) {\n return tnode;\n }\n tnode.bindChildren(tnode.children.map(hoistNode));\n if (tnode instanceof TPhrasingCtor) {\n for (const cnode of tnode.children) {\n if (cnode instanceof TBlockCtor) {\n const newNode = new TBlockCtor(tnode.cloneInitParams());\n newNode.bindChildren(tnode.children);\n const output = groupText(newNode);\n return output;\n }\n }\n } else if (tnode instanceof TBlockCtor) {\n if (tnode.children.length > 0) {\n const output = groupText(tnode);\n return output;\n }\n }\n return tnode;\n}\n\nexport function hoist(tree: TNodeImpl): TNodeImpl {\n return hoistNode(tree);\n}\n","// TODO, when React Native supports unicode regexes,\n// we should use `p{Zs}` instead of [ \\t] to comply\n// with the CSS3 Text Module standard. https://www.w3.org/TR/css-text-3/#spaces\nconst COLLAPSIBLE_AROUND_SEGMENT_BREAK_REGEX = /[ \\t]*[\\r\\n\\f]+[ \\t]*/g;\nconst CONSECUTIVE_SEGMENT_BREAKS_REGEX = /[\\r\\n\\f]+/g;\nconst ZERO_WIDTH_SPACES_AROUND_SEGMENT_BREAKS_REGEX =\n /(\\u200b\\n\\u200b?|\\u200b?\\n\\u200b)/g;\nconst SPACE_DISCARDING_CHARSET_REGEX =\n /([\\u2E80-\\u2EFF\\u2F00-\\u2FDF\\u2FF0-\\u2FFF\\u3000-\\u303F\\u3040-\\u309F\\u30A0-\\u30FF\\u3130-\\u318F\\u3190-\\u319F\\u31C0-\\u31EF\\u31F0-\\u31FF\\u3300-\\u33FF\\u3400-\\u4DBF\\u4E00-\\u9FFF\\uA000-\\uA48F\\uA490-\\uA4CF\\uF900-\\uFAFF\\uFE10-\\uFE1F\\uFE30-\\uFE4F\\uFE50-\\uFE6F\\uFF00-\\uFFEF])\\n([\\u2E80-\\u2EFF\\u2F00-\\u2FDF\\u2FF0-\\u2FFF\\u3000-\\u303F\\u3040-\\u309F\\u30A0-\\u30FF\\u3130-\\u318F\\u3190-\\u319F\\u31C0-\\u31EF\\u31F0-\\u31FF\\u3300-\\u33FF\\u3400-\\u4DBF\\u4E00-\\u9FFF\\uA000-\\uA48F\\uA490-\\uA4CF\\uF900-\\uFAFF\\uFE10-\\uFE1F\\uFE30-\\uFE4F\\uFE50-\\uFE6F\\uFF00-\\uFFEF])/g;\nconst SEGMENT_BREAK_REGEX = /\\n/g;\nconst SUBSEQUENT_WHITESPACE_REGEX = /[ \\t]+/g;\n\n// Implementation of\n// https://www.w3.org/TR/2020/WD-css-text-3-20201119/#white-space-phase-1\nexport function removeCollapsibleAroundSegmentBreak(data: string): string {\n return data.replace(COLLAPSIBLE_AROUND_SEGMENT_BREAK_REGEX, '\\n');\n}\n\n// Implementation of\n// https://www.w3.org/TR/2020/WD-css-text-3-20201119/#line-break-transform\nexport function removeConsecutiveSegmentBreaks(data: string): string {\n return data.replace(CONSECUTIVE_SEGMENT_BREAKS_REGEX, '\\n');\n}\n\n// Implementation of\n// https://www.w3.org/TR/2020/WD-css-text-3-20200429/#line-break-transform\n// In the latest version (https://www.w3.org/TR/2020/WD-css-text-3-20201119/),\n// the behavior is considered at UA discretion.\nexport function normalizeZeroWidthWhitespaces(data: string): string {\n return data.replace(ZERO_WIDTH_SPACES_AROUND_SEGMENT_BREAKS_REGEX, '\\u200b');\n}\n\n// Partial implementation of\n// https://www.w3.org/TR/2020/WD-css-text-3-20200429/#line-break-transform\n//\n// Because RN Javascript runtime doesn't support String.fromCharCode, we don't support space discarding\n// for character ranges above U+FFFF\n//\n// In the latest version (https://www.w3.org/TR/2020/WD-css-text-3-20201119/),\n// the behavior is considered at UA discretion.\nexport function removeLineBreaksAroundEastAsianDiscardSet(\n data: string\n): string {\n return data.replace(SPACE_DISCARDING_CHARSET_REGEX, '$1$2');\n}\n\n// Implementation of\n// https://www.w3.org/TR/2020/WD-css-text-3-20201119/#white-space-phase-2\n// (A.1)\nexport function replaceSegmentBreaks(data: string): string {\n return data.replace(SEGMENT_BREAK_REGEX, ' ');\n}\n\n// Implementation of\n// https://www.w3.org/TR/2020/WD-css-text-3-20201119/#white-space-phase-2\n// (A.4)\nexport function normalizeWhitespaces(data: string): string {\n return data.replace(SUBSEQUENT_WHITESPACE_REGEX, ' ');\n}\n","import { TNodeImpl, TNodeInit } from '../tree/tree-types';\nimport { Document } from 'domhandler';\nimport { TTextCtor } from '../tree/TTextCtor';\nimport { TPhrasingCtor } from '../tree/TPhrasingCtor';\nimport { TBlockCtor } from '../tree/TBlockCtor';\nimport { TDocumentCtor, TDocumentImpl } from '../tree/TDocumentImpl';\nimport { isDomElement, isDomText, Element, Node, Text } from '../dom/dom-utils';\nimport { TStyles } from '../styles/TStyles';\n\nimport { TEmptyCtor } from '../tree/TEmptyCtor';\nimport { DataFlowParams } from './types';\n\nexport function mapNodeList({\n nodeList,\n parent,\n parentStyles,\n params\n}: {\n nodeList: Node[];\n parentStyles?: TStyles;\n parent: TNodeImpl | null;\n params: DataFlowParams;\n}): TNodeImpl[] {\n const nextMap: TNodeImpl[] = [];\n for (const i in nodeList) {\n const child = nodeList[i];\n const translated = translateNode({\n node: child,\n parentStyles,\n params,\n nodeIndex: Number(i),\n parent\n });\n if (translated) {\n nextMap.push(translated);\n }\n }\n return nextMap;\n}\n\nexport function bindChildren(\n node: TNodeImpl,\n children: Node[],\n params: DataFlowParams\n) {\n if (!node.elementModel || !node.elementModel.isOpaque) {\n node.bindChildren(\n mapNodeList({\n nodeList: children,\n parent: node,\n params\n })\n );\n }\n}\n\nfunction translateElement({\n node,\n nodeIndex,\n params,\n parent,\n parentStyles\n}: TranslateParams): TNodeImpl | null {\n const tagName = node.tagName;\n const sharedProps: Omit = {\n nodeIndex,\n parentStyles,\n context: params,\n domNode: node,\n parent\n };\n const elementModel = params.modelRegistry.getElementModelFromTagName(tagName);\n if (!elementModel) {\n return new TEmptyCtor({\n ...sharedProps,\n isUnregistered: true,\n elementModel,\n domNode: node\n });\n }\n if (elementModel.isTranslatableTextual()) {\n if (node.children.length === 1) {\n const child = node.children[0] as Node;\n if (isDomText(child)) {\n return new TTextCtor({\n ...sharedProps,\n elementModel,\n textNode: child,\n domNode: node\n });\n }\n } else if (node.children.length === 0) {\n return new TTextCtor({\n ...sharedProps,\n elementModel,\n domNode: node,\n textNode: new Text('')\n });\n }\n const phrasing = new TPhrasingCtor({\n ...sharedProps,\n domNode: node,\n elementModel\n });\n bindChildren(phrasing, node.children, params);\n return phrasing;\n }\n if (elementModel.isTranslatableBlock()) {\n const block = new TBlockCtor({\n ...sharedProps,\n elementModel,\n parentStyles,\n domNode: node\n });\n bindChildren(block, node.children, params);\n return block;\n }\n return new TEmptyCtor({\n ...sharedProps,\n isUnregistered: false,\n elementModel,\n domNode: node\n });\n}\n\ninterface TranslateParams {\n node: T;\n params: DataFlowParams;\n parent: TNodeImpl | null;\n parentStyles?: TStyles;\n nodeIndex?: number;\n}\n\nexport function translateNode({\n node,\n parentStyles,\n params,\n nodeIndex,\n parent\n}: TranslateParams): TNodeImpl | null {\n if (isDomText(node)) {\n return new TTextCtor({\n textNode: node,\n context: params,\n parentStyles,\n domNode: null,\n elementModel: null,\n nodeIndex,\n parent\n });\n }\n if (isDomElement(node)) {\n return translateElement({\n node,\n parentStyles,\n params,\n nodeIndex,\n parent\n });\n }\n return null;\n}\n\nexport function translateDocument(\n document: Document,\n params: DataFlowParams\n): TDocumentImpl {\n const tdoc = new TDocumentCtor({\n context: params,\n styles: params.baseStyles,\n domNode: document as any\n });\n bindChildren(tdoc, document.children, params);\n tdoc.parseChildren();\n return tdoc;\n}\n","export type { StylesConfig, MixedStyleRecord } from './styles/types';\nexport * from './model/model-types';\nexport { default as HTMLElementModel } from './model/HTMLElementModel';\nexport type { HTMLElementModelShape } from './model/HTMLElementModel';\nexport { default as HTMLContentModel } from './model/HTMLContentModel';\nexport type { TStylesShape } from './styles/TStyles';\nexport type {\n DocumentContext,\n ExtractTNodeFromType,\n Markers,\n NativeBlockStyles,\n NativeTextStyles,\n SetMarkersForTNode,\n TBlock,\n TDocument,\n TEmpty,\n TNode,\n TNodeDescriptor,\n TNodeShape,\n TNodeType,\n TNodePrintOptions,\n TPhrasing,\n TText,\n WebBlockStyles,\n WebTextStyles\n} from './tree/tree-types';\nexport * from './dom/dom-utils';\nexport * from './helper-types';\nexport type { DomVisitorCallbacks } from './dom/DomHandler';\nexport { TRenderEngine } from './TRenderEngine';\nexport { TRenderEngine as default } from './TRenderEngine';\nexport type { TRenderEngineOptions } from './TRenderEngine';\nexport { default as defaultHTMLElementModels } from './model/defaultHTMLElementModels';\nexport type { DefaultHTMLElementModelsStatic } from './model/defaultHTMLElementModels';\nexport type {\n CSSAbsoluteHardcodedFontSize,\n CSSAbsoluteLengthUnit,\n CSSAbsoluteLengthUnitsMultiplicators,\n CSSDisplayRegistry,\n CSSFlattenProcessedTypes,\n CSSFlowedPropKey,\n CSSHardcodedBorderWidth,\n CSSLengthUnit,\n CSSListStyleTypePropertyBase,\n CSSLongNativeBlockPropKey,\n CSSLongNativeTextPropKey,\n CSSLongNativeTranslatableBlockFlowedPropKey,\n CSSLongNativeTranslatableBlockPropKey,\n CSSLongNativeTranslatableBlockRetainedPropKey,\n CSSLongNativeTranslatableTextFlowedPropKey,\n CSSLongNativeTranslatableTextPropKey,\n CSSLongNativeTranslatableTextRetainedPropKey,\n CSSLongNativeUntranslatableBlockFlowedPropKey,\n CSSLongNativeUntranslatableBlockPropKey,\n CSSLongNativeUntranslatableBlockRetainedPropKey,\n CSSLongNativeUntranslatableTextFlowedPropKey,\n CSSLongNativeUntranslatableTextPropKey,\n CSSLongNativeUntranslatableTextRetainedPropKey,\n CSSLongWebTextFlowedPropKey,\n CSSLongWebTextRetainedPropKey,\n CSSNativePropKey,\n CSSProcessorConfig,\n CSSPropagationRegistry,\n CSSProperties,\n CSSPropertyCompatCategory,\n CSSPropertyDisplayCategory,\n CSSPropertyNameList,\n CSSPropertyPropagationCategory,\n CSSPropertySpecs,\n CSSRelativeHarcodedFontSize,\n CSSShortBlockPropKey,\n CSSShortNativeTranslatableBlockPropKey,\n CSSShortPropsKey,\n CSSShortTextPropKey,\n ExtendedNativeViewStyleKeys,\n ExtraNativeLongViewStyleKeys,\n ExtraNativeShortStyle,\n ExtraNativeShortViewStyleKeys,\n ExtraNativeTextStyle,\n ExtraNativeTextStyleKeys,\n ExtraNativeUntranslatedLongStyles,\n ExtraNativeViewStyle,\n MixedSizeCSSPropertiesKeys,\n MixedStyleDeclaration,\n NativeDirectionalStyleKeys,\n NativeShortKeys,\n NativeTextStyleKey,\n WebBlockRetainProperties,\n WebTextFlowProperties\n} from '@native-html/css-processor';\n","/**\n * The **content model** associated with a tag determines how this tag should\n * be translated in the Transient Render Tree.\n */\n// eslint-disable-next-line no-shadow\nexport enum HTMLContentModel {\n /**\n * Translatable to TBlock.\n */\n block = 'block',\n /**\n * Translatable to TPhrasing and TText\n */\n textual = 'textual',\n /**\n * Translatable to TBlock, TPhrasing and TText\n */\n mixed = 'mixed',\n /**\n * Translatable to TEmpty\n */\n none = 'none'\n}\n\nexport default HTMLContentModel;\n","/* eslint-disable no-dupe-class-members */\nimport { MixedStyleDeclaration } from '@native-html/css-processor';\nimport { ReactNativePropsDefinitions } from '../helper-types';\nimport { SetMarkersForTNode } from '../tree/tree-types';\nimport HTMLContentModel from './HTMLContentModel';\nimport {\n CustomElementModel,\n ElementCategory,\n ElementModelBase,\n NativeElementModel,\n TagName\n} from './model-types';\n\nconst phrasingCategories: ElementCategory[] = ['textual', 'edits', 'anchor'];\nconst translatableBlockCategories: ElementCategory[] = [\n 'tabular',\n 'grouping',\n 'sectioning'\n];\n\n/**\n * An object to specify custom tags.\n *\n * @typeParam T - The name of the tag to which the model will apply.\n * @typeParam M - The {@link HTMLContentModel} associated with this tag.\n */\nexport interface HTMLElementModelShape<\n T extends string,\n M extends HTMLContentModel\n> extends ElementModelBase {\n /**\n * The {@link HTMLContentModel} attached to this model.\n */\n readonly contentModel: M;\n /**\n * `true` when the associated tag is a {@link https://html.spec.whatwg.org/multipage/syntax.html#void-elements | void element}.\n *\n * @remarks\n *\n * - Void elements cannot have children.\n * - TText-translated void elements will be preserved even though they don't\n * have children.\n */\n readonly isVoid: boolean;\n /**\n * An opaque element translated {@link TNode} will have no translated {@link TNode}\n * children.\n */\n readonly isOpaque: boolean;\n}\n\n/**\n * An object defining engine internals for tags, such as default styles\n * (UAStyles), content model (how this tag is treated during hoisting)... etc.\n *\n * @typeParam T - The name of the tag to which the model will apply.\n * @typeParam M - The {@link HTMLContentModel} associated with this tag.\n */\nexport default class HTMLElementModel<\n T extends string,\n M extends HTMLContentModel\n> implements HTMLElementModelShape\n{\n /**\n * The tag name associated with this model.\n */\n public readonly tagName: T;\n /**\n * The {@link HTMLContentModel} attached to this model.\n */\n public readonly contentModel: M;\n /**\n * An opaque element translated {@link TNode} will have no translated {@link TNode}\n * children.\n */\n public readonly isOpaque: boolean;\n /**\n * `true` when the associated tag is a {@link https://html.spec.whatwg.org/multipage/syntax.html#void-elements | void element}.\n *\n * @remarks\n *\n * - Void elements cannot have children.\n * - TText-translated void elements will be preserved even though they don't\n * have children.\n */\n public readonly isVoid: boolean;\n /**\n * Equivalent of \"user-agent\" styles. The default styles for the element.\n *\n * @remarks These styles will be merged over by `tagsStyles`.\n */\n public readonly mixedUAStyles?: MixedStyleDeclaration;\n /**\n * React Native props grouped by native components. Those props\n * will be passed to the underlying native component at render time.\n *\n * @remarks Some props might be overriden by props derived from the\n * {@link TNode} attributes. For example, if you pass `accessibilityLabel`\n * and there is an `aria-label` attribute attached to one node, the\n * `aria-label` will be used. If you want to be able to override the\n * `aria-label`, use {@link HTMLElementModel.getReactNativeProps} instead.\n *\n * @example\n *\n * ```ts\n * import {HTMLElementModel, HTMLContentModel} from 'react-native-render-html';\n *\n * const customHTMLElementModels = {\n * 'nav-button': HTMLElementModel.fromCustomModel({\n * tagName: 'nav-button',\n * contentModel: HTMLContentModel.block,\n * reactNativeProps: {\n * native: {\n * onPress() {\n * console.info('nav-button pressed');\n * },\n * },\n * },\n * }),\n *};\n * ```\n */\n readonly reactNativeProps?: ReactNativePropsDefinitions;\n /**\n * A function to create conditional \"user-agent\" styles.\n *\n * @deprecated Use {@link HTMLElementModel.getMixedUAStyles} instead.\n */\n public readonly getUADerivedStyleFromAttributes: NativeElementModel['getUADerivedStyleFromAttributes'];\n /**\n * A function to create conditional \"user-agent\" styles.\n *\n * @remarks For example, <a> tags will have underline decoration and be\n * colored blue only when `href` is defined.\n */\n public readonly getMixedUAStyles: NativeElementModel['getMixedUAStyles'];\n /**\n * A function to create React Native props from a {@link TNode} grouped by\n * native components.\n *\n * Those props will be deep-merged over the pre-generated props. You can\n * preserve some of the pre-generated props since you receive them as second\n * argument.\n *\n * **Merge strategy** (latest overrides former):\n *\n * 1. props from `reactNativeProps`,\n * 2. auto-generated props from attributes\n * 3. props returned by this function\n *\n * @param tnode - The {@link TNode} for which to create React Native props.\n * @param preGeneratedProps - The props that were pre-generated for the {@link TNode}\n * based on attributes (e.g. aria-label ...) and\n * {@link ElementModelBase.reactNativeProps}.\n * @returns React Native props grouped by native components (see\n * {@link ReactNativePropsDefinitions}). Those props will be passed to the\n * underlying native component at render time.\n *\n * @example\n *\n * ```ts\n * import { defaultHTMLElementModels } from \"react-native-render-html\";\n *\n * const customHTMLElementModels = {\n * a: defaultHTMLElementModels.a.extend({\n * getReactNativeProps(tnode) {\n * const attributes = tnode.attributes;\n * return {\n * native: {\n * accessibilityHint:\n * attributes['data-scope'] === 'internal'\n * ? 'Open in a new screen.'\n * : 'Open in system web browser.',\n * },\n * };\n * },\n * }),\n * };\n * ```\n */\n public readonly getReactNativeProps: NativeElementModel['getReactNativeProps'];\n\n /**\n * Derive markers for one TNode.\n */\n public readonly setMarkersForTNode?: SetMarkersForTNode;\n\n private constructor({\n tagName,\n contentModel,\n isOpaque,\n mixedUAStyles,\n isVoid,\n getUADerivedStyleFromAttributes,\n getMixedUAStyles,\n setMarkersForTNode,\n getReactNativeProps,\n reactNativeProps\n }: HTMLElementModelShape) {\n this.tagName = tagName;\n this.contentModel = contentModel;\n this.isOpaque = isOpaque || false;\n this.isVoid = isVoid;\n this.mixedUAStyles = mixedUAStyles;\n this.getUADerivedStyleFromAttributes = getUADerivedStyleFromAttributes;\n this.getMixedUAStyles = getMixedUAStyles;\n this.setMarkersForTNode = setMarkersForTNode;\n this.getReactNativeProps = getReactNativeProps;\n this.reactNativeProps = reactNativeProps;\n }\n\n /**\n * Create an {@link HTMLElementModel} from a custom template.\n *\n * @param template - The custom template.\n */\n static fromCustomModel<\n CustomTags extends string,\n ContentModel extends HTMLContentModel\n >(template: CustomElementModel) {\n const {\n contentModel,\n tagName,\n isOpaque = false,\n isVoid = false,\n ...optionalFields\n } = template;\n return new HTMLElementModel({\n tagName,\n contentModel,\n isOpaque,\n isVoid,\n ...optionalFields\n });\n }\n\n /**\n * Create an {@link HTMLElementModel} from a native description.\n *\n * @param nativeElementModel - The native model declaration.\n */\n static fromNativeModel(\n nativeElementModel: NativeElementModel\n ) {\n const {\n category,\n isOpaque,\n isVoid = false,\n ...otherProps\n } = nativeElementModel;\n const isPhrasing = phrasingCategories.indexOf(category) !== -1;\n const isTranslatable =\n isPhrasing || translatableBlockCategories.indexOf(category) !== -1;\n const contentModel =\n category === 'anchor' || category === 'edits'\n ? HTMLContentModel.mixed\n : isPhrasing\n ? HTMLContentModel.textual\n : isTranslatable\n ? HTMLContentModel.block\n : HTMLContentModel.none;\n return new HTMLElementModel<\n TN,\n E extends 'edits' | 'anchor'\n ? HTMLContentModel.mixed\n : E extends 'sectioning' | 'grouping' | 'tabular'\n ? HTMLContentModel.block\n : E extends 'textual'\n ? HTMLContentModel.textual\n : HTMLContentModel.none\n >({\n isVoid,\n contentModel: contentModel as any,\n isOpaque: isOpaque ?? category === 'embedded',\n ...otherProps\n });\n }\n\n isTranslatableBlock(): boolean {\n return this.contentModel === HTMLContentModel.block;\n }\n\n isTranslatableTextual() {\n return (\n this.contentModel === HTMLContentModel.textual ||\n this.contentModel === HTMLContentModel.mixed\n );\n }\n\n /**\n * Create a new {@link HTMLElementModel} by shallow-merging properties into this model.\n *\n * @param merger - A function to generate the new properties to shallow-merge into this model.\n * @typeParam CM - The {@link HTMLContentModel} attached to the new model.\n */\n extend(\n merger: (\n shape: HTMLElementModelShape\n ) => Partial>\n ): HTMLElementModel;\n /**\n * Create a new {@link HTMLElementModel} by shallow-merging properties into this model.\n *\n * @param shape - The {@link HTMLElementModelShape} to shallow-merge into this model.\n * @typeParam CM - The {@link HTMLContentModel} attached to the new model.\n */\n extend(\n shape: Partial>\n ): HTMLElementModel;\n extend(\n arg:\n | ((\n shape: HTMLElementModelShape\n ) => Partial>)\n | Partial>\n ): HTMLElementModel {\n const properties = typeof arg === 'function' ? arg(this) : arg;\n return new HTMLElementModel({\n ...this,\n ...properties\n });\n }\n}\n","import internalHTMLElementModels, {\n DefaultHTMLElementModelsStatic\n} from './defaultHTMLElementModels';\nimport HTMLElementModel from './HTMLElementModel';\nimport { HTMLModelRecord, TagName } from './model-types';\n\nexport default class HTMLModelRegistry {\n public readonly modelRecords: HTMLModelRecord =\n internalHTMLElementModels as HTMLModelRecord;\n\n constructor(\n customize?: (\n defaultHTMLElementModels: DefaultHTMLElementModelsStatic\n ) => HTMLModelRecord\n ) {\n if (typeof customize === 'function') {\n this.modelRecords = customize(internalHTMLElementModels);\n }\n }\n\n getElementModelFromTagName(\n tagName: E | TagName\n ): HTMLElementModel | null {\n if (tagName in this.modelRecords) {\n return this.modelRecords[tagName];\n }\n return null;\n }\n}\n","import { MixedStyleDeclaration } from '@native-html/css-processor';\nimport { textContent } from 'domutils';\nimport HTMLContentModel from './HTMLContentModel';\nimport HTMLElementModel from './HTMLElementModel';\nimport {\n AttribTagNames,\n EditsTagNames,\n EmbeddedTagNames,\n GroupingTagNames,\n InteractiveTagNames,\n MetadataTagNames,\n SectioningTagNames,\n TabularTagNames,\n TextLevelTagNames,\n UnsupportedTagNames,\n UntranslatableTagNames,\n HTMLModelRecord,\n ElementModelBase\n} from './model-types';\n\nconst UA_ANCHOR_COL = '#245dc1';\nconst UA_GRAY = '#CCC';\nconst UA_MARGIN_HZ = 30;\n\nconst bigMarginTopBottomStyle: MixedStyleDeclaration = {\n marginTop: '1em',\n marginBottom: '1em'\n};\n\nconst shortMarginTopBottomStyle: MixedStyleDeclaration = {\n marginTop: '.5em',\n marginBottom: '.5em'\n};\n\nconst lineThroughStyle: MixedStyleDeclaration = {\n textDecorationLine: 'line-through'\n};\n\nconst italicStyle: MixedStyleDeclaration = {\n fontStyle: 'italic'\n};\n\nconst monoStyle: MixedStyleDeclaration = {\n fontFamily: 'monospace'\n};\n\nconst boldStyle: MixedStyleDeclaration = {\n fontWeight: 'bold'\n};\n\nconst spacedBlockStyle: MixedStyleDeclaration = {\n ...bigMarginTopBottomStyle,\n marginLeft: UA_MARGIN_HZ,\n marginRight: UA_MARGIN_HZ\n};\n\nconst anchorStyle: MixedStyleDeclaration = {\n color: UA_ANCHOR_COL,\n textDecorationLine: 'underline',\n textDecorationColor: UA_ANCHOR_COL\n};\n\nconst leftBorderQuoteStyle: MixedStyleDeclaration = {\n borderLeftWidth: 2,\n borderLeftColor: UA_GRAY\n};\n\nconst dottedUnderlineStyle: MixedStyleDeclaration = {\n textDecorationLine: 'underline',\n textDecorationStyle: 'dotted'\n};\n\nconst solidUnderlineStyle: MixedStyleDeclaration = {\n textDecorationLine: 'underline',\n textDecorationStyle: 'solid'\n};\n\n// TODO, support directional styles\nconst listStyles: MixedStyleDeclaration = {\n ...bigMarginTopBottomStyle,\n paddingLeft: 30\n};\n\nconst preStyles: MixedStyleDeclaration = {\n whiteSpace: 'pre',\n ...monoStyle,\n ...bigMarginTopBottomStyle\n};\n\nfunction headerStyle(\n fontSize: string,\n marginSize: string\n): MixedStyleDeclaration {\n return {\n fontSize,\n marginTop: marginSize,\n marginBottom: marginSize,\n ...boldStyle\n };\n}\n\nconst getReactNativePropsForHeading: ElementModelBase['getReactNativeProps'] =\n ({ domNode }) => {\n const textLabel = textContent(domNode!);\n return {\n native: {\n accessible: true,\n accessibilityLabel: textLabel,\n accessibilityRole: 'header'\n }\n };\n };\n\nconst getReactNativePropsWithHref: ElementModelBase['getReactNativeProps'] =\n function getReactNativePropsWithHref({ attributes }) {\n if (typeof attributes.href === 'string' && attributes.href.length > 0) {\n return {\n native: {\n accessible: true,\n accessibilityRole: 'link'\n }\n };\n }\n };\n\nconst sectioningModelMap: HTMLModelRecord<\n SectioningTagNames,\n HTMLContentModel.block\n> = {\n address: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'address',\n mixedUAStyles: italicStyle\n }),\n article: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'article'\n }),\n aside: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'aside'\n }),\n body: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'body'\n }),\n footer: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'footer'\n }),\n h1: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'h1',\n mixedUAStyles: headerStyle('2em', '.67em'),\n getReactNativeProps: getReactNativePropsForHeading\n }),\n h2: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'h2',\n mixedUAStyles: headerStyle('1.5em', '.83em'),\n getReactNativeProps: getReactNativePropsForHeading\n }),\n h3: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'h3',\n mixedUAStyles: headerStyle('1.17em', '1em'),\n getReactNativeProps: getReactNativePropsForHeading\n }),\n h4: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'h4',\n mixedUAStyles: headerStyle('1em', '1.33em'),\n getReactNativeProps: getReactNativePropsForHeading\n }),\n h5: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'h5',\n mixedUAStyles: headerStyle('.83em', '1.67em'),\n getReactNativeProps: getReactNativePropsForHeading\n }),\n h6: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'h6',\n mixedUAStyles: headerStyle('.67em', '2.33em'),\n getReactNativeProps: getReactNativePropsForHeading\n }),\n header: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'header'\n }),\n hgroup: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'hgroup'\n }),\n nav: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'nav'\n }),\n section: HTMLElementModel.fromNativeModel({\n category: 'sectioning',\n tagName: 'section'\n })\n};\n\nconst unsupportedModelMap: HTMLModelRecord<\n UnsupportedTagNames,\n HTMLContentModel.none\n> = {\n area: HTMLElementModel.fromNativeModel({\n tagName: 'area',\n category: 'untranslatable',\n isVoid: true,\n getReactNativeProps: getReactNativePropsWithHref\n }),\n map: HTMLElementModel.fromNativeModel({\n tagName: 'map',\n category: 'untranslatable'\n })\n};\n\nconst attribsModelMap: HTMLModelRecord =\n {\n accesskey: HTMLElementModel.fromNativeModel({\n tagName: 'accesskey',\n category: 'untranslatable'\n }),\n caption: HTMLElementModel.fromNativeModel({\n tagName: 'caption',\n category: 'untranslatable'\n }),\n col: HTMLElementModel.fromNativeModel({\n tagName: 'col',\n category: 'untranslatable',\n isVoid: true\n }),\n colgroup: HTMLElementModel.fromNativeModel({\n tagName: 'colgroup',\n category: 'untranslatable'\n }),\n datalist: HTMLElementModel.fromNativeModel({\n tagName: 'datalist',\n category: 'untranslatable'\n }),\n source: HTMLElementModel.fromNativeModel({\n tagName: 'source',\n category: 'untranslatable',\n isVoid: true\n }),\n track: HTMLElementModel.fromNativeModel({\n tagName: 'track',\n category: 'untranslatable',\n isVoid: true\n }),\n optgroup: HTMLElementModel.fromNativeModel({\n tagName: 'optgroup',\n category: 'untranslatable'\n }),\n option: HTMLElementModel.fromNativeModel({\n tagName: 'option',\n category: 'untranslatable'\n }),\n param: HTMLElementModel.fromNativeModel({\n tagName: 'param',\n category: 'untranslatable',\n isVoid: true\n })\n };\n\nconst interactiveModelMap: HTMLModelRecord<\n InteractiveTagNames,\n HTMLContentModel.none\n> = {\n button: HTMLElementModel.fromNativeModel({\n tagName: 'button',\n category: 'interactive',\n reactNativeProps: {\n native: {\n accessibilityRole: 'button'\n }\n }\n }),\n fieldset: HTMLElementModel.fromNativeModel({\n tagName: 'fieldset',\n category: 'interactive'\n }),\n form: HTMLElementModel.fromNativeModel({\n tagName: 'form',\n category: 'interactive'\n }),\n input: HTMLElementModel.fromNativeModel({\n tagName: 'input',\n category: 'interactive',\n isVoid: true\n }),\n label: HTMLElementModel.fromNativeModel({\n tagName: 'label',\n category: 'interactive'\n }),\n legend: HTMLElementModel.fromNativeModel({\n tagName: 'legend',\n category: 'interactive'\n }),\n meter: HTMLElementModel.fromNativeModel({\n tagName: 'meter',\n category: 'interactive'\n }),\n progress: HTMLElementModel.fromNativeModel({\n tagName: 'progress',\n category: 'interactive'\n }),\n select: HTMLElementModel.fromNativeModel({\n tagName: 'select',\n category: 'interactive',\n reactNativeProps: {\n native: {\n accessible: true,\n accessibilityRole: 'combobox'\n }\n }\n }),\n details: HTMLElementModel.fromNativeModel({\n tagName: 'details',\n category: 'interactive'\n }),\n dialog: HTMLElementModel.fromNativeModel({\n tagName: 'dialog',\n category: 'interactive'\n }),\n output: HTMLElementModel.fromNativeModel({\n tagName: 'output',\n category: 'interactive'\n }),\n summary: HTMLElementModel.fromNativeModel({\n tagName: 'summary',\n category: 'interactive'\n }),\n textarea: HTMLElementModel.fromNativeModel({\n tagName: 'textarea',\n category: 'interactive'\n })\n};\n\nconst metadataModelMap: HTMLModelRecord<\n MetadataTagNames,\n HTMLContentModel.none\n> = {\n base: HTMLElementModel.fromNativeModel({\n tagName: 'base',\n category: 'untranslatable',\n isVoid: true\n }),\n head: HTMLElementModel.fromNativeModel({\n tagName: 'head',\n category: 'untranslatable',\n isOpaque: true\n }),\n link: HTMLElementModel.fromNativeModel({\n tagName: 'link',\n category: 'untranslatable',\n isVoid: true\n }),\n meta: HTMLElementModel.fromNativeModel({\n tagName: 'meta',\n category: 'untranslatable',\n isVoid: true\n }),\n title: HTMLElementModel.fromNativeModel({\n tagName: 'title',\n category: 'untranslatable'\n })\n};\n\nconst untranslatableModelMap: HTMLModelRecord<\n UntranslatableTagNames,\n HTMLContentModel.none\n> = {\n ...attribsModelMap,\n ...interactiveModelMap,\n ...unsupportedModelMap,\n ...metadataModelMap\n};\n\nconst groupingModelMap: HTMLModelRecord<\n GroupingTagNames,\n HTMLContentModel.block\n> = {\n blockquote: HTMLElementModel.fromNativeModel({\n tagName: 'blockquote',\n category: 'grouping',\n getMixedUAStyles: ({ attributes }) => {\n if (attributes.type === 'cite') {\n return leftBorderQuoteStyle;\n }\n },\n mixedUAStyles: spacedBlockStyle\n }),\n dd: HTMLElementModel.fromNativeModel({\n tagName: 'dd',\n category: 'grouping',\n mixedUAStyles: {\n marginLeft: UA_MARGIN_HZ\n }\n }),\n div: HTMLElementModel.fromNativeModel({\n tagName: 'div',\n category: 'grouping'\n }),\n dl: HTMLElementModel.fromNativeModel({\n tagName: 'dl',\n category: 'grouping',\n mixedUAStyles: bigMarginTopBottomStyle\n }),\n dt: HTMLElementModel.fromNativeModel({\n tagName: 'dt',\n category: 'grouping',\n mixedUAStyles: boldStyle\n }),\n figcaption: HTMLElementModel.fromNativeModel({\n tagName: 'figcaption',\n category: 'grouping',\n mixedUAStyles: {\n ...italicStyle,\n textAlign: 'center'\n }\n }),\n figure: HTMLElementModel.fromNativeModel({\n tagName: 'figure',\n category: 'grouping',\n mixedUAStyles: spacedBlockStyle\n }),\n hr: HTMLElementModel.fromNativeModel({\n tagName: 'hr',\n category: 'grouping',\n mixedUAStyles: {\n marginLeft: 'auto',\n marginRight: 'auto',\n height: 1,\n width: '100%',\n backgroundColor: UA_GRAY,\n ...shortMarginTopBottomStyle\n }\n }),\n li: HTMLElementModel.fromNativeModel({\n tagName: 'li',\n category: 'grouping'\n }),\n main: HTMLElementModel.fromNativeModel({\n tagName: 'main',\n category: 'grouping'\n }),\n menu: HTMLElementModel.fromNativeModel({\n tagName: 'menu',\n category: 'grouping'\n }),\n ol: HTMLElementModel.fromNativeModel({\n tagName: 'ol',\n category: 'grouping',\n mixedUAStyles: listStyles,\n setMarkersForTNode(targetMarkers, parentMarkers) {\n targetMarkers.olNestLevel = parentMarkers.olNestLevel + 1;\n }\n }),\n p: HTMLElementModel.fromNativeModel({\n tagName: 'p',\n category: 'grouping',\n mixedUAStyles: bigMarginTopBottomStyle\n }),\n pre: HTMLElementModel.fromNativeModel({\n tagName: 'pre',\n category: 'grouping',\n mixedUAStyles: preStyles\n }),\n xmp: HTMLElementModel.fromNativeModel({\n tagName: 'xmp',\n category: 'grouping',\n mixedUAStyles: preStyles\n }),\n listing: HTMLElementModel.fromNativeModel({\n tagName: 'listing',\n category: 'grouping',\n mixedUAStyles: preStyles\n }),\n plaintext: HTMLElementModel.fromNativeModel({\n tagName: 'plaintext',\n category: 'grouping',\n mixedUAStyles: preStyles\n }),\n ul: HTMLElementModel.fromNativeModel({\n tagName: 'ul',\n category: 'grouping',\n mixedUAStyles: listStyles,\n setMarkersForTNode(targetMarkers, parentMarkers) {\n targetMarkers.ulNestLevel = parentMarkers.ulNestLevel + 1;\n }\n }),\n dir: HTMLElementModel.fromNativeModel({\n tagName: 'dir',\n category: 'grouping',\n mixedUAStyles: listStyles\n })\n};\n\nconst tabularModelMap: HTMLModelRecord<\n TabularTagNames,\n HTMLContentModel.block\n> = {\n table: HTMLElementModel.fromNativeModel({\n tagName: 'table',\n category: 'tabular'\n }),\n tbody: HTMLElementModel.fromNativeModel({\n tagName: 'tbody',\n category: 'tabular'\n }),\n td: HTMLElementModel.fromNativeModel({\n tagName: 'td',\n category: 'tabular',\n mixedUAStyles: {\n padding: 2,\n flex: 1\n }\n }),\n tfoot: HTMLElementModel.fromNativeModel({\n tagName: 'tfoot',\n category: 'tabular'\n }),\n th: HTMLElementModel.fromNativeModel({\n tagName: 'th',\n category: 'tabular',\n mixedUAStyles: {\n padding: 2,\n flex: 1,\n fontWeight: 'bold'\n }\n }),\n thead: HTMLElementModel.fromNativeModel({\n tagName: 'thead',\n category: 'tabular'\n }),\n tr: HTMLElementModel.fromNativeModel({\n tagName: 'tr',\n category: 'tabular',\n mixedUAStyles: {\n flexDirection: 'row',\n flexWrap: 'nowrap'\n }\n })\n};\n\n// These emnbedded should be rendered by default.\nconst renderedEmbeddedModelMap: HTMLModelRecord<\n Extract,\n HTMLContentModel.block\n> = {\n img: HTMLElementModel.fromNativeModel({\n tagName: 'img',\n category: 'embedded',\n isVoid: true,\n getReactNativeProps({ attributes }, props) {\n // see https://w3c.github.io/html-aria/#el-img\n const label = attributes['aria-label'] || attributes.alt;\n if (label && (!props?.view || props.view.accessibilityRole !== 'none')) {\n return {\n native: {\n accessibilityLabel: label,\n accessibilityRole: 'image'\n }\n };\n }\n return {\n native: {\n accessibilityRole: 'none'\n }\n };\n }\n }).extend({\n contentModel: HTMLContentModel.block\n }),\n picture: HTMLElementModel.fromNativeModel({\n tagName: 'picture',\n category: 'embedded',\n isOpaque: false,\n isVoid: false // allows source and img\n }).extend({\n contentModel: HTMLContentModel.block\n })\n};\n\n// Embedded elements content model is \"none\" by default.\nconst emptyEmbeddedModelMap: HTMLModelRecord<\n Exclude,\n HTMLContentModel.none\n> = {\n audio: HTMLElementModel.fromNativeModel({\n tagName: 'audio',\n category: 'embedded',\n isVoid: false // allows tracks\n }),\n canvas: HTMLElementModel.fromNativeModel({\n tagName: 'canvas',\n category: 'embedded',\n isVoid: false // allows specific content\n }),\n embed: HTMLElementModel.fromNativeModel({\n tagName: 'embed',\n category: 'embedded',\n isVoid: true\n }),\n iframe: HTMLElementModel.fromNativeModel({\n tagName: 'iframe',\n category: 'embedded',\n isVoid: true\n }),\n math: HTMLElementModel.fromNativeModel({\n tagName: 'math',\n category: 'embedded',\n isVoid: false, // allows mathml elems\n isOpaque: true\n }),\n object: HTMLElementModel.fromNativeModel({\n tagName: 'object',\n category: 'embedded',\n isVoid: false // allows params\n }),\n svg: HTMLElementModel.fromNativeModel({\n tagName: 'svg',\n category: 'embedded',\n isVoid: false, // allows svg elems\n isOpaque: true,\n getReactNativeProps({ attributes }) {\n if (attributes['aria-label']) {\n return {\n native: {\n accessibilityLabel: attributes['aria-label'],\n accessibilityRole: 'image'\n }\n };\n }\n return {\n native: {\n accessibilityRole: 'none'\n }\n };\n }\n }),\n video: HTMLElementModel.fromNativeModel({\n tagName: 'video',\n category: 'embedded',\n isVoid: false // allows source, tracks + transparent\n })\n};\n\nconst editsModelMap: HTMLModelRecord = {\n ins: HTMLElementModel.fromNativeModel({\n tagName: 'ins',\n category: 'edits',\n mixedUAStyles: solidUnderlineStyle,\n setMarkersForTNode(targetMarkers) {\n targetMarkers.edits = 'ins';\n }\n }),\n del: HTMLElementModel.fromNativeModel({\n tagName: 'del',\n category: 'edits',\n mixedUAStyles: lineThroughStyle,\n setMarkersForTNode(targetMarkers) {\n targetMarkers.edits = 'del';\n }\n })\n};\n\nconst textLevelModelMap: HTMLModelRecord<\n TextLevelTagNames,\n HTMLContentModel.textual\n> = {\n em: HTMLElementModel.fromNativeModel({\n tagName: 'em',\n category: 'textual',\n mixedUAStyles: italicStyle\n }),\n strong: HTMLElementModel.fromNativeModel({\n tagName: 'strong',\n category: 'textual',\n mixedUAStyles: boldStyle\n }),\n small: HTMLElementModel.fromNativeModel({\n tagName: 'small',\n category: 'textual',\n mixedUAStyles: {\n fontSize: 'smaller'\n }\n }),\n big: HTMLElementModel.fromNativeModel({\n tagName: 'big',\n category: 'textual',\n mixedUAStyles: {\n fontSize: 'larger'\n }\n }),\n s: HTMLElementModel.fromNativeModel({\n tagName: 's',\n category: 'textual',\n mixedUAStyles: lineThroughStyle\n }),\n strike: HTMLElementModel.fromNativeModel({\n tagName: 'strike',\n category: 'textual',\n mixedUAStyles: lineThroughStyle\n }),\n cite: HTMLElementModel.fromNativeModel({\n tagName: 'cite',\n category: 'textual',\n mixedUAStyles: italicStyle\n }),\n q: HTMLElementModel.fromNativeModel({\n tagName: 'q',\n category: 'textual'\n // default style, content: \"open,close-quote\"\n }),\n dfn: HTMLElementModel.fromNativeModel({\n tagName: 'dfn',\n category: 'textual',\n mixedUAStyles: italicStyle\n }),\n abbr: HTMLElementModel.fromNativeModel({\n tagName: 'abbr',\n category: 'textual',\n mixedUAStyles: dottedUnderlineStyle\n }),\n acronym: HTMLElementModel.fromNativeModel({\n tagName: 'acronym',\n category: 'textual',\n mixedUAStyles: dottedUnderlineStyle\n }),\n ruby: HTMLElementModel.fromNativeModel({\n tagName: 'ruby',\n category: 'textual'\n }),\n rt: HTMLElementModel.fromNativeModel({\n tagName: 'rt',\n category: 'textual'\n }),\n rp: HTMLElementModel.fromNativeModel({\n tagName: 'rp',\n category: 'textual'\n }),\n data: HTMLElementModel.fromNativeModel({\n tagName: 'data',\n category: 'textual'\n }),\n time: HTMLElementModel.fromNativeModel({\n tagName: 'time',\n category: 'textual'\n }),\n code: HTMLElementModel.fromNativeModel({\n tagName: 'code',\n category: 'textual',\n mixedUAStyles: monoStyle\n }),\n tt: HTMLElementModel.fromNativeModel({\n tagName: 'tt',\n category: 'textual',\n mixedUAStyles: monoStyle\n }),\n var: HTMLElementModel.fromNativeModel({\n tagName: 'var',\n category: 'textual',\n mixedUAStyles: italicStyle\n }),\n samp: HTMLElementModel.fromNativeModel({\n tagName: 'samp',\n category: 'textual',\n mixedUAStyles: monoStyle\n }),\n kbd: HTMLElementModel.fromNativeModel({\n tagName: 'kbd',\n category: 'textual',\n mixedUAStyles: monoStyle\n }),\n sub: HTMLElementModel.fromNativeModel({\n tagName: 'sub',\n category: 'textual',\n mixedUAStyles: {\n textAlignVertical: 'bottom',\n fontSize: 'smaller'\n }\n }),\n sup: HTMLElementModel.fromNativeModel({\n tagName: 'sup',\n category: 'textual',\n mixedUAStyles: {\n textAlignVertical: 'top',\n fontSize: 'smaller'\n }\n }),\n i: HTMLElementModel.fromNativeModel({\n tagName: 'i',\n category: 'textual',\n mixedUAStyles: italicStyle\n }),\n b: HTMLElementModel.fromNativeModel({\n tagName: 'b',\n category: 'textual',\n mixedUAStyles: boldStyle\n }),\n u: HTMLElementModel.fromNativeModel({\n tagName: 'u',\n category: 'textual',\n mixedUAStyles: solidUnderlineStyle\n }),\n mark: HTMLElementModel.fromNativeModel({\n tagName: 'mark',\n category: 'textual',\n mixedUAStyles: {\n backgroundColor: 'yellow',\n color: 'black'\n }\n }),\n bdi: HTMLElementModel.fromNativeModel({\n tagName: 'bdi',\n category: 'textual'\n // unicode-bidi: isolate;\n }),\n bdo: HTMLElementModel.fromNativeModel({\n tagName: 'bdo',\n category: 'textual'\n // unicode-bidi: isolate-override;\n }),\n span: HTMLElementModel.fromNativeModel({\n tagName: 'span',\n category: 'textual'\n }),\n br: HTMLElementModel.fromNativeModel({\n tagName: 'br',\n category: 'textual',\n isVoid: true\n }),\n wbr: HTMLElementModel.fromNativeModel({\n tagName: 'wbr',\n category: 'textual',\n isVoid: true\n })\n};\n\nconst defaultHTMLElementModels = {\n a: HTMLElementModel.fromNativeModel({\n tagName: 'a',\n category: 'anchor',\n getMixedUAStyles: ({ attributes }) => {\n if (typeof attributes.href === 'string') {\n return anchorStyle;\n }\n },\n getReactNativeProps: getReactNativePropsWithHref,\n setMarkersForTNode(targetMarkers) {\n targetMarkers.anchor = true;\n }\n }),\n ...textLevelModelMap,\n ...editsModelMap,\n ...renderedEmbeddedModelMap,\n ...emptyEmbeddedModelMap,\n ...tabularModelMap,\n ...groupingModelMap,\n ...sectioningModelMap,\n ...interactiveModelMap,\n ...untranslatableModelMap\n};\n\nexport type DefaultHTMLElementModelsStatic = typeof defaultHTMLElementModels;\n\nexport default defaultHTMLElementModels;\n","import { CSSProperties, CSSProcessedProps } from '@native-html/css-processor';\nimport nil from 'ramda/src/isNil';\nimport not from 'ramda/src/not';\nimport compose from 'ramda/src/compose';\n\nconst notNil = compose(not, nil);\n/**\n * A merge properties from left to right.\n *\n * @param child\n * @param parent\n */\nfunction inheritProperties(\n ...properties: Array\n): CSSProperties {\n const realProperties = properties.filter(notNil) as CSSProperties[];\n if (realProperties.length === 1) {\n return realProperties[0];\n }\n if (Object.keys(realProperties[0]).length === 0) {\n return realProperties[1];\n }\n return realProperties.reduce(\n (prev, curr) => ({ ...prev, ...curr }),\n Object.prototype as CSSProperties\n ) as CSSProperties;\n}\n\n/**\n * A record of styles organized in logical chunks:\n *\n * - wether they are supported in React Native (native) and others (web).\n * - wether they target native Views (block) or Text (text).\n * - wether they are inherited by this node's children (flow) or not (retain).\n *\n * @public\n */\nexport interface TStylesShape {\n readonly nativeTextFlow: CSSProcessedProps['native']['text']['flow'];\n readonly nativeBlockFlow: CSSProcessedProps['native']['block']['flow'];\n readonly nativeTextRet: CSSProcessedProps['native']['text']['retain'];\n readonly nativeBlockRet: CSSProcessedProps['native']['block']['retain'];\n readonly webTextFlow: CSSProcessedProps['web']['text']['flow'];\n readonly webBlockRet: CSSProcessedProps['web']['block']['retain'];\n}\n\nexport class TStyles implements TStylesShape {\n public readonly nativeTextFlow: CSSProcessedProps['native']['text']['flow'];\n public readonly nativeBlockFlow: CSSProcessedProps['native']['block']['flow'];\n public readonly nativeTextRet: CSSProcessedProps['native']['text']['retain'];\n public readonly nativeBlockRet: CSSProcessedProps['native']['block']['retain'];\n public readonly webTextFlow: CSSProcessedProps['web']['text']['flow'];\n public readonly webBlockRet: CSSProcessedProps['web']['block']['retain'];\n\n constructor(\n ownProcessedProps: CSSProcessedProps,\n parentStyles?: TStyles | null\n ) {\n this.nativeTextFlow = inheritProperties(\n parentStyles?.nativeTextFlow,\n ownProcessedProps.native.text.flow\n );\n this.nativeBlockFlow = inheritProperties(\n parentStyles?.nativeBlockFlow,\n ownProcessedProps.native.block.flow\n );\n this.webTextFlow = inheritProperties(\n parentStyles?.webTextFlow,\n ownProcessedProps.web.text.flow\n );\n // In theory, we shouldn't merge those properties. However, these\n // properties being textDecoration*, we actually want children nodes to\n // inherit from them. A cleaner solution would be to to let each TNode\n // handle its merging logic, because only TPhrasing and TText nodes would\n // need to merge these.\n this.nativeTextRet = inheritProperties(\n parentStyles?.nativeTextRet,\n ownProcessedProps.native.text.retain\n );\n this.nativeBlockRet = ownProcessedProps.native.block.retain;\n this.webBlockRet = ownProcessedProps.web.block.retain;\n }\n\n static empty(): TStyles {\n return new TStyles(new CSSProcessedProps());\n }\n}\n","import CSSProcessor, {\n CSSProcessedProps,\n CSSProcessorConfig,\n MixedStyleDeclaration\n} from '@native-html/css-processor';\nimport HTMLModelRegistry from '../model/HTMLModelRegistry';\nimport { TNodeDescriptor } from '../tree/tree-types';\nimport { TStyles } from './TStyles';\nimport { StylesConfig } from './types';\n\nexport const emptyProcessedPropsReg: CSSProcessedProps =\n new CSSProcessedProps();\n\nfunction mapMixedStyleRecordToCSSProcessedPropsReg(\n processor: CSSProcessor,\n styles?: Record\n): Record {\n let regStyles: Record = {};\n for (const key in styles) {\n regStyles[key] = processor.compileStyleDeclaration(styles[key]);\n }\n return regStyles;\n}\n\n// Specificity hierarchy, in descending order:\n// 1. Inline styles\n// 2. ID (idsStyles)\n// 3. Classes (classesStyles)\n// 4. Element name (tagsStyles)\n// 5. Attribute styles (styles derived from attributes)\n// 6. Default element styles\n// 7. Inherited styles (baseFontStyles)\nexport class TStylesMerger {\n private processor: CSSProcessor;\n private tagsStyles: Record;\n private classesStyles: Record;\n private idsStyles: Record;\n private enableCSSInlineProcessing: boolean;\n private enableUserAgentStyles: boolean;\n private modelRegistry: HTMLModelRegistry;\n constructor(\n config: Required,\n modelRegistry: HTMLModelRegistry,\n cssProcessorConfig?: CSSProcessorConfig\n ) {\n this.processor = new CSSProcessor(cssProcessorConfig);\n this.modelRegistry = modelRegistry;\n this.classesStyles = mapMixedStyleRecordToCSSProcessedPropsReg(\n this.processor,\n config.classesStyles\n );\n this.tagsStyles = mapMixedStyleRecordToCSSProcessedPropsReg(\n this.processor,\n config.tagsStyles\n );\n this.idsStyles = mapMixedStyleRecordToCSSProcessedPropsReg(\n this.processor,\n config.idsStyles\n );\n this.enableCSSInlineProcessing = config.enableCSSInlineProcessing;\n this.enableUserAgentStyles = config.enableUserAgentStyles;\n }\n\n compileInlineCSS(inlineCSS: string) {\n return this.processor.compileInlineCSS(inlineCSS);\n }\n\n compileStyleDeclaration(styleDeclaration: MixedStyleDeclaration) {\n return this.processor.compileStyleDeclaration(styleDeclaration);\n }\n\n buildStyles(\n inlineStyle: string,\n parentStyles: TStyles | null,\n descriptor: TNodeDescriptor\n ): TStyles {\n const ownInlinePropsReg =\n this.enableCSSInlineProcessing && inlineStyle\n ? this.compileInlineCSS(inlineStyle)\n : null;\n const model = descriptor.tagName\n ? this.modelRegistry.getElementModelFromTagName(descriptor.tagName)\n : null;\n const userTagOwnProps =\n this.tagsStyles[descriptor.tagName as string] ?? null;\n const userIdOwnProps = this.idsStyles[descriptor.id as string] ?? null;\n const classes = descriptor.classes;\n const userClassesOwnPropsList = classes.map(\n (c) => this.classesStyles[c] || null\n );\n const dynamicPropsFromAttributes = this.enableUserAgentStyles\n ? (model?.getMixedUAStyles?.(descriptor, descriptor.domNode!) || null) ??\n model?.getUADerivedStyleFromAttributes?.(\n descriptor.attributes,\n descriptor.markers\n ) ??\n null\n : null;\n const userAgentTagProps = this.enableUserAgentStyles\n ? model?.mixedUAStyles ?? null\n : null;\n // Latest properties will override former properties.\n const mergedOwnProps = emptyProcessedPropsReg.merge(\n userAgentTagProps &&\n this.processor.compileStyleDeclaration(userAgentTagProps),\n dynamicPropsFromAttributes &&\n this.processor.compileStyleDeclaration(dynamicPropsFromAttributes),\n userTagOwnProps,\n ...userClassesOwnPropsList,\n userIdOwnProps,\n ownInlinePropsReg\n );\n return new TStyles(mergedOwnProps, parentStyles);\n }\n}\n","import { StylesConfig } from './types';\n\nexport const defaultStylesConfig: Required = {\n classesStyles: {},\n enableCSSInlineProcessing: true,\n enableUserAgentStyles: false,\n idsStyles: {},\n tagsStyles: {},\n baseStyle: {\n fontSize: 14,\n whiteSpace: 'normal'\n }\n};\n","import HTMLContentModel from '../model/HTMLContentModel';\nimport TNodeCtor, { GenericTNodeCtor, Mutable } from './TNodeCtor';\nimport { TNodeImpl, TNodeInit } from './tree-types';\n\nexport interface TBlockImpl extends TNodeImpl {}\n\nconst TBlockCtor = function TBlock(this: Mutable, init: TNodeInit) {\n this.initialize(init);\n} as Function as GenericTNodeCtor;\n\n//@ts-ignore\nTBlockCtor.prototype = new TNodeCtor('block', 'TBlock');\n\nTBlockCtor.prototype.matchContentModel = function matchContentModel(\n contentModel\n) {\n return (\n contentModel === HTMLContentModel.block ||\n contentModel === HTMLContentModel.mixed\n );\n};\n\nTBlockCtor.prototype.collapseChildren = function collapseChildren() {\n let indexesToSplice: number[] = [];\n this.children.forEach((child, i) => {\n child.collapse();\n if (child.isEmpty()) {\n indexesToSplice.push(i);\n }\n });\n this.spliceChildren(indexesToSplice);\n};\n\nTBlockCtor.prototype.getNativeStyles = function getNativeStyles(\n this: TNodeImpl\n) {\n if (this.__nativeStyles === false) {\n this.__nativeStyles = {\n ...this.styles.nativeBlockFlow,\n ...this.styles.nativeBlockRet\n };\n }\n return this.__nativeStyles;\n};\n\nexport default TBlockCtor;\n\nexport { TBlockCtor };\n","import { GenericTNodeCtor, Mutable } from './TNodeCtor';\nimport HTMLElementModel from '../model/HTMLElementModel';\nimport { isDomElement, isDomText } from '../dom/dom-utils';\nimport { TEmptyImpl } from './TEmptyCtor';\nimport { TNodeInit, TNodeImpl, DocumentContext } from './tree-types';\nimport TBlockImpl from './TBlockCtor';\n\nexport type TDocumentInit = Omit;\n\nexport interface TDocumentImpl extends TNodeImpl {\n readonly context: Readonly;\n /**\n * Iterate over children and extract meta-information into context field.\n * Replace children with a single-element array containing the body.\n */\n parseChildren(): void;\n}\n\nconst defaultContextBase: DocumentContext = Object.freeze({\n baseHref: 'about:blank',\n baseTarget: '_self',\n charset: 'utf-8',\n title: '',\n lang: 'en',\n dir: 'ltr',\n links: [],\n meta: []\n});\n\nfunction getDefaultDocumentContext(): DocumentContext {\n return Object.assign({}, defaultContextBase, { links: [], meta: [] });\n}\n\nfunction extractContextFromHead(head: TEmptyImpl, lang?: string, dir?: string) {\n const context = getDefaultDocumentContext();\n if (lang) {\n context.lang = lang;\n }\n if (dir) {\n context.dir = 'rtl';\n }\n const domNode = head.domNode;\n const children = domNode.children;\n children.filter(isDomElement).forEach((child) => {\n if (child.tagName === 'meta') {\n if (child.attribs.name) {\n context.meta.push(child.attribs as any);\n } else if (child.attribs.charset) {\n context.charset = child.attribs.charset.toLowerCase();\n }\n } else if (child.tagName === 'link') {\n context.links.push(child.attribs);\n } else if (child.tagName === 'title') {\n for (const titleChild of child.children.filter(isDomText)) {\n context.title = titleChild.data.trim();\n break;\n }\n } else if (child.tagName === 'base') {\n context.baseHref = child.attribs.href || context.baseHref;\n context.baseTarget = (child.attribs.target as any) || context.baseTarget;\n }\n });\n return context;\n}\n\nconst htmlModel = HTMLElementModel.fromNativeModel({\n tagName: 'html' as any,\n category: 'grouping'\n});\n\nconst TDocumentCtor = function TDocument(\n this: Mutable,\n init: TDocumentInit\n) {\n this.initialize(init as TNodeInit);\n} as Function as GenericTNodeCtor;\n\nTDocumentCtor.prototype = Object.create(TBlockImpl.prototype);\n\nObject.defineProperty(TDocumentCtor.prototype, 'tagName', {\n value: 'html',\n writable: false\n});\n\nObject.defineProperty(TDocumentCtor.prototype, 'type', {\n value: 'document',\n writable: false\n});\n\nObject.defineProperty(TDocumentCtor.prototype, 'displayName', {\n value: 'TDocument',\n writable: false\n});\n\nObject.defineProperty(TDocumentCtor.prototype, 'elementModel', {\n value: htmlModel,\n writable: false\n});\n\nTDocumentCtor.prototype.parseChildren = function parseChildren(\n this: Mutable\n) {\n let head: TEmptyImpl | undefined;\n for (const child of this.children) {\n if (child.tagName === 'head') {\n head = child as unknown as TEmptyImpl;\n break;\n }\n }\n this.context = Object.freeze(\n head\n ? extractContextFromHead(\n head,\n this.attributes!.lang,\n this.attributes!.dir\n )\n : {\n ...getDefaultDocumentContext(),\n lang: this.attributes!.lang,\n dir: this.attributes!.dir as any\n }\n );\n};\n\nexport { TDocumentCtor };\n\nexport default TDocumentCtor;\n","import HTMLContentModel from '../model/HTMLContentModel';\nimport { Element } from '../dom/dom-utils';\nimport { TNodeImpl, TNodeInit } from './tree-types';\nimport TNodeCtor, { GenericTNodeCtor, Mutable } from './TNodeCtor';\n\nexport interface TEmptyImpl extends TNodeImpl {\n readonly domNode: Element;\n}\n\nexport interface TEmptyInit extends TNodeInit {\n domNode: Element;\n}\n\nconst TEmptyCtor = function TEmpty(\n this: Mutable,\n init: TEmptyInit\n) {\n this.initialize(init);\n} as Function as GenericTNodeCtor;\n\n//@ts-ignore\nTEmptyCtor.prototype = new TNodeCtor('empty', 'TEmpty');\n\nTEmptyCtor.prototype.matchContentModel = function matchContentModel(\n contentModel: HTMLContentModel\n) {\n return contentModel === HTMLContentModel.none;\n};\n\nexport default TEmptyCtor;\n\nexport { TEmptyCtor };\n","import { AccessibilityProps, AccessibilityRole } from 'react-native';\nimport {\n ReactNativePropsSwitch,\n ReactNativePropsDefinitions\n} from '../helper-types';\nimport { TStyles } from '../styles/TStyles';\nimport markersPrototype from './markersPrototype';\nimport tnodeToString from './tnodeSnapshot';\nimport {\n Markers,\n TNodeDescriptor,\n TNodeImpl,\n TNodeInit,\n TNodeType\n} from './tree-types';\n\nexport type GenericTNodeCtor = {\n new (init: Init): Impl;\n prototype: Impl;\n};\n\nexport type Mutable = {\n -readonly [P in keyof T]: T[P];\n};\n\nfunction updateNodeIndexes(node: Mutable, i: number) {\n node.nodeIndex = i;\n}\n\nconst emptyAttrs = Object.freeze({});\nconst emptyClasses = Object.freeze([]);\n\nfunction findNativeRole(ariaRole: string): AccessibilityRole | undefined {\n if (ariaRole === 'img') {\n return 'image';\n }\n if (ariaRole === 'heading') {\n return 'header';\n }\n if (ariaRole === 'dialog') {\n return 'alert';\n }\n if (ariaRole === 'presentation') {\n return 'none';\n }\n if (\n ariaRole === 'button' ||\n ariaRole === 'switch' ||\n ariaRole === 'checkbox' ||\n ariaRole === 'radio' ||\n ariaRole === 'radiogroup' ||\n ariaRole === 'link' ||\n ariaRole === 'search'\n ) {\n return ariaRole;\n }\n}\n\nfunction setMarkersFromAttributes(\n targetMarkers: Markers,\n _parentMarkers: Readonly,\n { attributes }: TNodeDescriptor\n): void {\n if ('dir' in attributes) {\n targetMarkers.direction = attributes.dir as 'rtl';\n }\n if ('lang' in attributes) {\n targetMarkers.lang = attributes.lang;\n }\n}\n\nfunction transformPropsDefinitionsToSwitch(\n definition?: ReactNativePropsDefinitions | null\n): ReactNativePropsSwitch | null {\n if (!definition) {\n return null;\n }\n return {\n text: {\n ...definition.native,\n ...definition.text\n },\n view: {\n ...definition.native,\n ...definition.view\n }\n };\n}\n\nfunction mergeSwitches(\n prev: ReactNativePropsSwitch | null,\n next: ReactNativePropsSwitch | null\n) {\n if (!prev) {\n return next;\n }\n if (!next) {\n return prev;\n }\n return {\n text: {\n ...prev.text,\n ...next.text\n },\n view: {\n ...prev.view,\n ...next.view\n }\n };\n}\n\nconst prototype: Omit = {\n children: Object.freeze([]) as any,\n init: Object.freeze({}) as any,\n classes: Object.freeze([]) as any,\n styles: Object.freeze(TStyles.empty()) as any,\n markers: markersPrototype,\n __nodeIndex: null,\n __trimmedLeft: false,\n __trimmedRight: false,\n __nativeProps: false,\n __nativeStyles: false,\n __webStyles: false,\n __generateNativePropsFromTNode() {\n let ret: ReactNativePropsSwitch | null = null;\n if (this.styles.webTextFlow.userSelect) {\n ret = mergeSwitches(ret, {\n text: {\n selectable: this.styles.webTextFlow.userSelect !== 'none'\n }\n });\n }\n if (this.attributes['aria-label']) {\n const accessibilityProps: AccessibilityProps = {\n accessibilityLabel: this.attributes['aria-label']\n };\n ret = mergeSwitches(ret, {\n view: accessibilityProps,\n text: accessibilityProps\n });\n }\n if (this.attributes.role) {\n const role = this.attributes.role;\n const accessibilityRole = findNativeRole(role);\n if (accessibilityRole) {\n const accessibilityProps: AccessibilityProps = {\n accessibilityRole: accessibilityRole\n };\n ret = mergeSwitches(ret, {\n view: accessibilityProps,\n text: accessibilityProps\n });\n }\n }\n return ret;\n },\n\n __generateDynamicNativePropsFromModel(autoGeneratedProps) {\n const elm = this.elementModel;\n if (!elm || !elm.getReactNativeProps) {\n return null;\n }\n return transformPropsDefinitionsToSwitch(\n elm.getReactNativeProps(this as any, autoGeneratedProps, this.domNode!) ||\n null\n );\n },\n\n get attributes() {\n return this.domNode?.attribs || emptyAttrs;\n },\n\n get hasWhiteSpaceCollapsingEnabled() {\n return typeof this.styles.webTextFlow.whiteSpace === 'string'\n ? this.styles.webTextFlow.whiteSpace === 'normal'\n : true;\n },\n\n get contentModel() {\n return this.elementModel?.contentModel || null;\n },\n\n get parentStyles() {\n return this.init.parentStyles || this.parent?.styles || null;\n },\n\n get id() {\n return this.attributes.id || null;\n },\n\n get domNode() {\n return this.init.domNode || null;\n },\n\n get elementModel() {\n return this.init.elementModel;\n },\n\n get tagName() {\n return this.init.domNode?.name || null;\n },\n\n get parent() {\n return (this.init.parent as any) || null;\n },\n\n get nodeIndex() {\n if (this.__nodeIndex === null) {\n this.__nodeIndex = this.init.nodeIndex || 0;\n }\n return this.__nodeIndex;\n },\n\n get isUnregistered() {\n return this.init.isUnregistered || false;\n },\n\n set nodeIndex(nodeIndex: number) {\n this.__nodeIndex = nodeIndex;\n },\n\n bindChildren(children, shouldUpdateNodeIndexes = false) {\n //@ts-ignore\n this.children = children;\n if (shouldUpdateNodeIndexes) {\n children.forEach(updateNodeIndexes);\n }\n },\n\n cloneInitParams(partial) {\n return Object.assign({}, this.init, partial) as any;\n },\n\n isCollapsibleLeft() {\n if (this.children.length) {\n return (\n this.hasWhiteSpaceCollapsingEnabled &&\n this.children[0].isCollapsibleLeft()\n );\n }\n return false;\n },\n\n isCollapsibleRight() {\n if (this.children.length) {\n return (\n this.hasWhiteSpaceCollapsingEnabled &&\n this.children[this.children.length - 1].isCollapsibleRight()\n );\n }\n return false;\n },\n\n isEmpty() {\n return false;\n },\n\n trimLeft() {\n if (!this.__trimmedLeft && this.children.length) {\n const firstChild = this.children[0];\n firstChild.trimLeft();\n if (firstChild.isEmpty()) {\n //@ts-ignore\n this.children.splice(0, 1);\n }\n this.__trimmedLeft = true;\n }\n },\n\n trimRight() {\n if (!this.__trimmedRight && this.children.length) {\n const lastChild = this.children[this.children.length - 1];\n lastChild.trimRight();\n if (lastChild.isEmpty()) {\n //@ts-ignore\n this.children.splice(-1, 1);\n }\n this.__trimmedRight = true;\n }\n },\n\n matchContentModel() {\n return false;\n },\n\n spliceChildren(indexesToSplice) {\n let offset = 0;\n for (const i of indexesToSplice) {\n //@ts-ignore\n this.children.splice(i - offset, 1);\n offset += 1;\n }\n },\n\n collapse() {\n this.collapseChildren();\n this.bindChildren(this.children, true);\n },\n\n getNativeStyles() {\n if (this.__nativeStyles === false) {\n this.__nativeStyles = {\n ...this.styles.nativeBlockFlow,\n ...this.styles.nativeBlockRet,\n ...this.styles.nativeTextFlow,\n ...this.styles.nativeTextRet\n };\n }\n return this.__nativeStyles;\n },\n\n getWebStyles() {\n if (this.__webStyles === false) {\n this.__webStyles = {\n ...this.styles.webTextFlow,\n ...this.styles.webBlockRet\n } as ReturnType;\n }\n return this.__webStyles;\n },\n\n collapseChildren() {\n return;\n },\n\n snapshot(options = {}) {\n const { withStyles = false, withNodeIndex = false } = options;\n return tnodeToString(this as any, { withStyles, withNodeIndex });\n },\n\n hasClass(className) {\n return this.classes.indexOf(className) > -1;\n },\n\n toString() {\n return this.snapshot();\n },\n\n setMarkers(targetMarkers, parentMarkers) {\n if (this.elementModel?.setMarkersForTNode) {\n this.elementModel.setMarkersForTNode(targetMarkers, parentMarkers, this);\n }\n setMarkersFromAttributes(targetMarkers, parentMarkers, this);\n this.init.context.setMarkersForTNode?.(targetMarkers, parentMarkers, this);\n },\n\n getReactNativeProps() {\n if (this.__nativeProps === false) {\n const staticFromModel = transformPropsDefinitionsToSwitch(\n this.elementModel?.reactNativeProps\n );\n const dynamicFromAttrs = this.__generateNativePropsFromTNode();\n const autoGeneratedProps = mergeSwitches(\n staticFromModel,\n dynamicFromAttrs\n );\n const dynamicFromModel =\n this.__generateDynamicNativePropsFromModel(autoGeneratedProps);\n this.__nativeProps = mergeSwitches(autoGeneratedProps, dynamicFromModel);\n }\n return this.__nativeProps;\n },\n\n initialize = TNodeImpl>(\n this: Mutable,\n init: Impl['init']\n ) {\n this.init = init;\n this.classes = this.attributes.class?.split(/\\s+/) || emptyClasses;\n const parentMarkers = init.parent\n ? init.parent.markers\n : markersPrototype.extend();\n this.markers = parentMarkers.extend();\n this.setMarkers(this.markers, parentMarkers, this);\n // Avoid very long prototype chains by assigning parent to current\n // when current has no own properties\n if (Object.keys(this.markers).length === 0) {\n this.markers = parentMarkers;\n }\n this.styles =\n init.styles ||\n init.context.stylesMerger.buildStyles(\n this.attributes.style,\n this.parentStyles || null,\n this\n );\n }\n};\n\nconst TNodeCtor = function TNode(\n this: Mutable,\n type: TNodeType,\n displayName: string,\n extraAccessors?: {\n [k in Exclude]: {\n get: () => any;\n set?: (val: any) => void;\n };\n }\n) {\n this.type = type;\n this.displayName = displayName;\n extraAccessors && Object.defineProperties(this, extraAccessors);\n};\n\nTNodeCtor.prototype = prototype as any;\n\nexport default TNodeCtor;\n","import HTMLContentModel from '../model/HTMLContentModel';\nimport TNodeCtor, { GenericTNodeCtor, Mutable } from './TNodeCtor';\nimport { TNodeImpl, TNodeInit } from './tree-types';\n\nexport interface TPhrasingImpl extends TNodeImpl {}\n\nfunction isChildEmpty(c: TNodeImpl) {\n return c.isEmpty();\n}\n\nconst TPhrasingCtor = function TPhrasing(\n this: Mutable,\n init: TNodeInit\n) {\n this.initialize(init);\n} as Function as GenericTNodeCtor;\n\n//@ts-ignore\nTPhrasingCtor.prototype = new TNodeCtor('phrasing', 'TPhrasing');\n\nTPhrasingCtor.prototype.matchContentModel = function matchContentModel(\n contentModel\n) {\n return (\n contentModel === HTMLContentModel.textual ||\n contentModel === HTMLContentModel.mixed\n );\n};\n\nTPhrasingCtor.prototype.isEmpty = function isEmpty() {\n // Only anonymous phrasing nodes with every children empty can be considered \"empty\"\n return this.tagName === null && this.children.every(isChildEmpty);\n};\n\nTPhrasingCtor.prototype.collapseChildren = function collapseChildren() {\n let previous: TNodeImpl | null = null;\n this.children.forEach((childK, k) => {\n const j = k - 1;\n childK.collapse();\n if (\n j > -1 &&\n childK.isCollapsibleLeft() &&\n (previous as TNodeImpl).isCollapsibleRight()\n ) {\n // We must trim left from current to support trimming\n // after
and tags.\n childK.trimLeft();\n }\n previous = childK;\n });\n this.trimLeft();\n this.trimRight();\n return null;\n};\n\nexport default TPhrasingCtor;\n\nexport { TPhrasingCtor };\n","import { Text } from '../dom/dom-utils';\nimport HTMLContentModel from '../model/HTMLContentModel';\n\nimport compose from 'ramda/src/compose';\nimport { TNodeInit, TNodeImpl } from './tree-types';\nimport {\n normalizeWhitespaces,\n normalizeZeroWidthWhitespaces,\n removeCollapsibleAroundSegmentBreak,\n removeConsecutiveSegmentBreaks,\n removeLineBreaksAroundEastAsianDiscardSet,\n replaceSegmentBreaks\n} from '../flow/text-transforms';\nimport TNodeCtor, { GenericTNodeCtor, Mutable } from './TNodeCtor';\n\nexport interface TTextInit extends TNodeInit {\n readonly textNode: Text;\n}\n\nexport interface TTextImpl extends TNodeImpl {\n readonly data: string;\n /**\n * True when tagName is defined and should be substituted with text when\n * rendering. E.g.
tags.\n */\n readonly isVoid: boolean;\n}\n\nconst collapseWhiteSpaces = compose(\n normalizeWhitespaces,\n replaceSegmentBreaks,\n normalizeZeroWidthWhitespaces,\n removeConsecutiveSegmentBreaks,\n removeCollapsibleAroundSegmentBreak\n);\n\nconst collapseWhiteSpacesWithEastAsianCharset = compose(\n normalizeWhitespaces,\n replaceSegmentBreaks,\n removeLineBreaksAroundEastAsianDiscardSet,\n normalizeZeroWidthWhitespaces,\n removeConsecutiveSegmentBreaks,\n removeCollapsibleAroundSegmentBreak\n);\n\nconst TTextCtor = function TText(this: Mutable, init: TTextInit) {\n this.initialize(init);\n this.isVoid = this.elementModel ? this.elementModel.isVoid : false;\n} as Function as GenericTNodeCtor;\n\n//@ts-ignore\nTTextCtor.prototype = new TNodeCtor('text', 'TText', {\n data: {\n get(this: TTextImpl) {\n return this.init.textNode.data;\n },\n set(this: TTextImpl, data: string) {\n this.init.textNode.data = data;\n }\n }\n});\n\nTTextCtor.prototype.matchContentModel = function matchContentModel(\n contentModel: HTMLContentModel\n) {\n return (\n contentModel === HTMLContentModel.textual ||\n contentModel === HTMLContentModel.mixed\n );\n};\n\nTTextCtor.prototype.isCollapsibleLeft = function isCollapsibleLeft(\n this: TTextImpl\n) {\n return (\n this.hasWhiteSpaceCollapsingEnabled &&\n !this.isEmpty() &&\n this.data[0] === ' '\n );\n};\n\nTTextCtor.prototype.isCollapsibleRight = function isCollapsibleRight(\n this: TTextImpl\n) {\n return (\n this.hasWhiteSpaceCollapsingEnabled &&\n !this.isEmpty() &&\n (this.isVoid || this.data[this.data.length - 1] === ' ')\n );\n};\n\nTTextCtor.prototype.isEmpty = function isEmpty(this: TTextImpl) {\n // Only anonymous text nodes can be considered \"empty\"\n return this.tagName === null && !this.data.length;\n};\n\nTTextCtor.prototype.trimLeft = function trimLeft(this: Mutable) {\n if (this.isCollapsibleLeft()) {\n this.data = this.data.slice(1);\n }\n};\n\nTTextCtor.prototype.trimRight = function trimRight(this: Mutable) {\n if (this.isCollapsibleRight()) {\n this.data = this.data.substr(0, this.data.length - 1);\n }\n};\n\nTTextCtor.prototype.collapseChildren = function collapseChildren(\n this: Mutable\n) {\n if (this.hasWhiteSpaceCollapsingEnabled) {\n if (this.init.context.removeLineBreaksAroundEastAsianDiscardSet) {\n this.data = collapseWhiteSpacesWithEastAsianCharset(this.data);\n } else {\n this.data = collapseWhiteSpaces(this.data);\n }\n }\n return null;\n};\n\nexport default TTextCtor;\n\nexport { TTextCtor };\n","import { Markers } from './tree-types';\n\nconst markersPrototype: Markers = {\n anchor: false,\n edits: 'none',\n lang: 'en',\n olNestLevel: -1,\n ulNestLevel: -1,\n direction: 'ltr',\n extend(this: Markers) {\n return Object.create(this);\n },\n toString() {\n let print = 'Markers {\\n';\n for (const key in this) {\n //@ts-ignore\n const val = this[key];\n if (typeof val !== 'function') {\n print += ` ${key}: ${JSON.stringify(val)}\\n`;\n }\n }\n return print + '}';\n }\n};\n\nexport default markersPrototype;\n","import { TNode, TNodePrintOptions } from './tree-types';\n\nfunction printTableStyles(styles: Record) {\n const entries = Object.entries(styles);\n return entries.reduce((prev, [name, val]) => {\n return `${prev}${prev ? ',' : ''} ${name}: ${JSON.stringify(val)}`;\n }, '');\n}\n\nfunction tnodePropertiesString(\n tnode: TNode,\n { withNodeIndex, withStyles }: TNodePrintOptions\n) {\n const tagPrint = tnode.tagName ? `tagName=\"${tnode.tagName}\"` : 'anonymous';\n const unregisteredPrint = tnode.isUnregistered ? 'unregistered' : null;\n const indexPrint = withNodeIndex ? `nodeIndex={${tnode.nodeIndex}}` : null;\n const idPrint = tnode.id ? `id=${tnode.id}` : null;\n const classesPrint = tnode.classes?.length\n ? `classes={[${tnode.classes.join(', ')}]}`\n : null;\n const dataPrint =\n tnode.type === 'text' ? `data=${JSON.stringify(tnode.data)}` : null;\n const anchorPrint =\n typeof tnode.attributes.href === 'string'\n ? `href=${JSON.stringify(tnode.attributes.href)}`\n : null;\n const srcPrint =\n typeof tnode.attributes.src === 'string'\n ? `src=${JSON.stringify(tnode.attributes.src)}`\n : null;\n const pstyles = withStyles ? printTableStyles(tnode.getNativeStyles()) : null;\n const nativeStylesPrint = pstyles ? `nativeStyles={{${pstyles} }}` : null;\n const oStyles = withStyles ? printTableStyles(tnode.getWebStyles()) : null;\n const webStylesPrint = oStyles ? `webStyles={{${oStyles}}}` : null;\n const detailsPrint = [\n tagPrint,\n unregisteredPrint,\n indexPrint,\n idPrint,\n classesPrint,\n dataPrint,\n anchorPrint,\n srcPrint,\n nativeStylesPrint,\n webStylesPrint\n ]\n .filter((p) => p !== null)\n .join(' ');\n return `<${tnode.displayName} ${detailsPrint}`;\n}\n\ninterface TNodePrintState {\n parentLeftPrefix: string;\n isChild: boolean;\n isLast: boolean;\n}\n\nexport default function tnodeSnapshot(\n tnode: TNode,\n params: Partial & TNodePrintOptions\n): string {\n const {\n parentLeftPrefix = '',\n isChild = false,\n isLast = true,\n withStyles,\n withNodeIndex\n } = params;\n const prefix = isChild ? ' ' : '';\n const totalPrefixLeft = parentLeftPrefix + prefix;\n const childrenPrint = tnode.children\n .map((c, i) =>\n tnodeSnapshot(c, {\n parentLeftPrefix: parentLeftPrefix + ''.padStart(prefix.length, ' '),\n isChild: true,\n isLast: i === tnode.children.length - 1,\n withStyles,\n withNodeIndex\n })\n )\n .join('');\n return `${totalPrefixLeft}${tnodePropertiesString(tnode, {\n withStyles,\n withNodeIndex\n })}${\n childrenPrint\n ? `>\\n${childrenPrint}\\n${totalPrefixLeft}${tnode.displayName}>`\n : ' />'\n }${isLast ? '' : '\\n'}`;\n}\n","/**\n * Copyright (c) Meta Platforms, Inc. and affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * @noflow\n */\n\n/* eslint no-bitwise: 0 */\n\n'use strict';\n\nfunction normalizeColor(color) {\n if (typeof color === 'number') {\n if (color >>> 0 === color && color >= 0 && color <= 0xffffffff) {\n return color;\n }\n return null;\n }\n\n if (typeof color !== 'string') {\n return null;\n }\n\n const matchers = getMatchers();\n let match;\n\n // Ordered based on occurrences on Facebook codebase\n if ((match = matchers.hex6.exec(color))) {\n return parseInt(match[1] + 'ff', 16) >>> 0;\n }\n\n const colorFromKeyword = normalizeKeyword(color);\n if (colorFromKeyword != null) {\n return colorFromKeyword;\n }\n\n if ((match = matchers.rgb.exec(color))) {\n return (\n ((parse255(match[1]) << 24) | // r\n (parse255(match[2]) << 16) | // g\n (parse255(match[3]) << 8) | // b\n 0x000000ff) >>> // a\n 0\n );\n }\n\n if ((match = matchers.rgba.exec(color))) {\n // rgba(R G B / A) notation\n if (match[6] !== undefined) {\n return (\n ((parse255(match[6]) << 24) | // r\n (parse255(match[7]) << 16) | // g\n (parse255(match[8]) << 8) | // b\n parse1(match[9])) >>> // a\n 0\n );\n }\n\n // rgba(R, G, B, A) notation\n return (\n ((parse255(match[2]) << 24) | // r\n (parse255(match[3]) << 16) | // g\n (parse255(match[4]) << 8) | // b\n parse1(match[5])) >>> // a\n 0\n );\n }\n\n if ((match = matchers.hex3.exec(color))) {\n return (\n parseInt(\n match[1] +\n match[1] + // r\n match[2] +\n match[2] + // g\n match[3] +\n match[3] + // b\n 'ff', // a\n 16,\n ) >>> 0\n );\n }\n\n // https://drafts.csswg.org/css-color-4/#hex-notation\n if ((match = matchers.hex8.exec(color))) {\n return parseInt(match[1], 16) >>> 0;\n }\n\n if ((match = matchers.hex4.exec(color))) {\n return (\n parseInt(\n match[1] +\n match[1] + // r\n match[2] +\n match[2] + // g\n match[3] +\n match[3] + // b\n match[4] +\n match[4], // a\n 16,\n ) >>> 0\n );\n }\n\n if ((match = matchers.hsl.exec(color))) {\n return (\n (hslToRgb(\n parse360(match[1]), // h\n parsePercentage(match[2]), // s\n parsePercentage(match[3]), // l\n ) |\n 0x000000ff) >>> // a\n 0\n );\n }\n\n if ((match = matchers.hsla.exec(color))) {\n // hsla(H S L / A) notation\n if (match[6] !== undefined) {\n return (\n (hslToRgb(\n parse360(match[6]), // h\n parsePercentage(match[7]), // s\n parsePercentage(match[8]), // l\n ) |\n parse1(match[9])) >>> // a\n 0\n );\n }\n\n // hsla(H, S, L, A) notation\n return (\n (hslToRgb(\n parse360(match[2]), // h\n parsePercentage(match[3]), // s\n parsePercentage(match[4]), // l\n ) |\n parse1(match[5])) >>> // a\n 0\n );\n }\n\n if ((match = matchers.hwb.exec(color))) {\n return (\n (hwbToRgb(\n parse360(match[1]), // h\n parsePercentage(match[2]), // w\n parsePercentage(match[3]), // b\n ) |\n 0x000000ff) >>> // a\n 0\n );\n }\n\n return null;\n}\n\nfunction hue2rgb(p, q, t) {\n if (t < 0) {\n t += 1;\n }\n if (t > 1) {\n t -= 1;\n }\n if (t < 1 / 6) {\n return p + (q - p) * 6 * t;\n }\n if (t < 1 / 2) {\n return q;\n }\n if (t < 2 / 3) {\n return p + (q - p) * (2 / 3 - t) * 6;\n }\n return p;\n}\n\nfunction hslToRgb(h, s, l) {\n const q = l < 0.5 ? l * (1 + s) : l + s - l * s;\n const p = 2 * l - q;\n const r = hue2rgb(p, q, h + 1 / 3);\n const g = hue2rgb(p, q, h);\n const b = hue2rgb(p, q, h - 1 / 3);\n\n return (\n (Math.round(r * 255) << 24) |\n (Math.round(g * 255) << 16) |\n (Math.round(b * 255) << 8)\n );\n}\n\nfunction hwbToRgb(h, w, b) {\n if (w + b >= 1) {\n const gray = Math.round((w * 255) / (w + b));\n\n return (gray << 24) | (gray << 16) | (gray << 8);\n }\n\n const red = hue2rgb(0, 1, h + 1 / 3) * (1 - w - b) + w;\n const green = hue2rgb(0, 1, h) * (1 - w - b) + w;\n const blue = hue2rgb(0, 1, h - 1 / 3) * (1 - w - b) + w;\n\n return (\n (Math.round(red * 255) << 24) |\n (Math.round(green * 255) << 16) |\n (Math.round(blue * 255) << 8)\n );\n}\n\nconst NUMBER = '[-+]?\\\\d*\\\\.?\\\\d+';\nconst PERCENTAGE = NUMBER + '%';\n\nfunction call(...args) {\n return '\\\\(\\\\s*(' + args.join(')\\\\s*,?\\\\s*(') + ')\\\\s*\\\\)';\n}\n\nfunction callWithSlashSeparator(...args) {\n return (\n '\\\\(\\\\s*(' +\n args.slice(0, args.length - 1).join(')\\\\s*,?\\\\s*(') +\n ')\\\\s*/\\\\s*(' +\n args[args.length - 1] +\n ')\\\\s*\\\\)'\n );\n}\n\nfunction commaSeparatedCall(...args) {\n return '\\\\(\\\\s*(' + args.join(')\\\\s*,\\\\s*(') + ')\\\\s*\\\\)';\n}\n\nlet cachedMatchers;\n\nfunction getMatchers() {\n if (cachedMatchers === undefined) {\n cachedMatchers = {\n rgb: new RegExp('rgb' + call(NUMBER, NUMBER, NUMBER)),\n rgba: new RegExp(\n 'rgba(' +\n commaSeparatedCall(NUMBER, NUMBER, NUMBER, NUMBER) +\n '|' +\n callWithSlashSeparator(NUMBER, NUMBER, NUMBER, NUMBER) +\n ')',\n ),\n hsl: new RegExp('hsl' + call(NUMBER, PERCENTAGE, PERCENTAGE)),\n hsla: new RegExp(\n 'hsla(' +\n commaSeparatedCall(NUMBER, PERCENTAGE, PERCENTAGE, NUMBER) +\n '|' +\n callWithSlashSeparator(NUMBER, PERCENTAGE, PERCENTAGE, NUMBER) +\n ')',\n ),\n hwb: new RegExp('hwb' + call(NUMBER, PERCENTAGE, PERCENTAGE)),\n hex3: /^#([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,\n hex4: /^#([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,\n hex6: /^#([0-9a-fA-F]{6})$/,\n hex8: /^#([0-9a-fA-F]{8})$/,\n };\n }\n return cachedMatchers;\n}\n\nfunction parse255(str) {\n const int = parseInt(str, 10);\n if (int < 0) {\n return 0;\n }\n if (int > 255) {\n return 255;\n }\n return int;\n}\n\nfunction parse360(str) {\n const int = parseFloat(str);\n return (((int % 360) + 360) % 360) / 360;\n}\n\nfunction parse1(str) {\n const num = parseFloat(str);\n if (num < 0) {\n return 0;\n }\n if (num > 1) {\n return 255;\n }\n return Math.round(num * 255);\n}\n\nfunction parsePercentage(str) {\n // parseFloat conveniently ignores the final %\n const int = parseFloat(str);\n if (int < 0) {\n return 0;\n }\n if (int > 100) {\n return 1;\n }\n return int / 100;\n}\n\nfunction normalizeKeyword(name) {\n // prettier-ignore\n switch (name) {\n case 'transparent': return 0x00000000;\n // http://www.w3.org/TR/css3-color/#svg-color\n case 'aliceblue': return 0xf0f8ffff;\n case 'antiquewhite': return 0xfaebd7ff;\n case 'aqua': return 0x00ffffff;\n case 'aquamarine': return 0x7fffd4ff;\n case 'azure': return 0xf0ffffff;\n case 'beige': return 0xf5f5dcff;\n case 'bisque': return 0xffe4c4ff;\n case 'black': return 0x000000ff;\n case 'blanchedalmond': return 0xffebcdff;\n case 'blue': return 0x0000ffff;\n case 'blueviolet': return 0x8a2be2ff;\n case 'brown': return 0xa52a2aff;\n case 'burlywood': return 0xdeb887ff;\n case 'burntsienna': return 0xea7e5dff;\n case 'cadetblue': return 0x5f9ea0ff;\n case 'chartreuse': return 0x7fff00ff;\n case 'chocolate': return 0xd2691eff;\n case 'coral': return 0xff7f50ff;\n case 'cornflowerblue': return 0x6495edff;\n case 'cornsilk': return 0xfff8dcff;\n case 'crimson': return 0xdc143cff;\n case 'cyan': return 0x00ffffff;\n case 'darkblue': return 0x00008bff;\n case 'darkcyan': return 0x008b8bff;\n case 'darkgoldenrod': return 0xb8860bff;\n case 'darkgray': return 0xa9a9a9ff;\n case 'darkgreen': return 0x006400ff;\n case 'darkgrey': return 0xa9a9a9ff;\n case 'darkkhaki': return 0xbdb76bff;\n case 'darkmagenta': return 0x8b008bff;\n case 'darkolivegreen': return 0x556b2fff;\n case 'darkorange': return 0xff8c00ff;\n case 'darkorchid': return 0x9932ccff;\n case 'darkred': return 0x8b0000ff;\n case 'darksalmon': return 0xe9967aff;\n case 'darkseagreen': return 0x8fbc8fff;\n case 'darkslateblue': return 0x483d8bff;\n case 'darkslategray': return 0x2f4f4fff;\n case 'darkslategrey': return 0x2f4f4fff;\n case 'darkturquoise': return 0x00ced1ff;\n case 'darkviolet': return 0x9400d3ff;\n case 'deeppink': return 0xff1493ff;\n case 'deepskyblue': return 0x00bfffff;\n case 'dimgray': return 0x696969ff;\n case 'dimgrey': return 0x696969ff;\n case 'dodgerblue': return 0x1e90ffff;\n case 'firebrick': return 0xb22222ff;\n case 'floralwhite': return 0xfffaf0ff;\n case 'forestgreen': return 0x228b22ff;\n case 'fuchsia': return 0xff00ffff;\n case 'gainsboro': return 0xdcdcdcff;\n case 'ghostwhite': return 0xf8f8ffff;\n case 'gold': return 0xffd700ff;\n case 'goldenrod': return 0xdaa520ff;\n case 'gray': return 0x808080ff;\n case 'green': return 0x008000ff;\n case 'greenyellow': return 0xadff2fff;\n case 'grey': return 0x808080ff;\n case 'honeydew': return 0xf0fff0ff;\n case 'hotpink': return 0xff69b4ff;\n case 'indianred': return 0xcd5c5cff;\n case 'indigo': return 0x4b0082ff;\n case 'ivory': return 0xfffff0ff;\n case 'khaki': return 0xf0e68cff;\n case 'lavender': return 0xe6e6faff;\n case 'lavenderblush': return 0xfff0f5ff;\n case 'lawngreen': return 0x7cfc00ff;\n case 'lemonchiffon': return 0xfffacdff;\n case 'lightblue': return 0xadd8e6ff;\n case 'lightcoral': return 0xf08080ff;\n case 'lightcyan': return 0xe0ffffff;\n case 'lightgoldenrodyellow': return 0xfafad2ff;\n case 'lightgray': return 0xd3d3d3ff;\n case 'lightgreen': return 0x90ee90ff;\n case 'lightgrey': return 0xd3d3d3ff;\n case 'lightpink': return 0xffb6c1ff;\n case 'lightsalmon': return 0xffa07aff;\n case 'lightseagreen': return 0x20b2aaff;\n case 'lightskyblue': return 0x87cefaff;\n case 'lightslategray': return 0x778899ff;\n case 'lightslategrey': return 0x778899ff;\n case 'lightsteelblue': return 0xb0c4deff;\n case 'lightyellow': return 0xffffe0ff;\n case 'lime': return 0x00ff00ff;\n case 'limegreen': return 0x32cd32ff;\n case 'linen': return 0xfaf0e6ff;\n case 'magenta': return 0xff00ffff;\n case 'maroon': return 0x800000ff;\n case 'mediumaquamarine': return 0x66cdaaff;\n case 'mediumblue': return 0x0000cdff;\n case 'mediumorchid': return 0xba55d3ff;\n case 'mediumpurple': return 0x9370dbff;\n case 'mediumseagreen': return 0x3cb371ff;\n case 'mediumslateblue': return 0x7b68eeff;\n case 'mediumspringgreen': return 0x00fa9aff;\n case 'mediumturquoise': return 0x48d1ccff;\n case 'mediumvioletred': return 0xc71585ff;\n case 'midnightblue': return 0x191970ff;\n case 'mintcream': return 0xf5fffaff;\n case 'mistyrose': return 0xffe4e1ff;\n case 'moccasin': return 0xffe4b5ff;\n case 'navajowhite': return 0xffdeadff;\n case 'navy': return 0x000080ff;\n case 'oldlace': return 0xfdf5e6ff;\n case 'olive': return 0x808000ff;\n case 'olivedrab': return 0x6b8e23ff;\n case 'orange': return 0xffa500ff;\n case 'orangered': return 0xff4500ff;\n case 'orchid': return 0xda70d6ff;\n case 'palegoldenrod': return 0xeee8aaff;\n case 'palegreen': return 0x98fb98ff;\n case 'paleturquoise': return 0xafeeeeff;\n case 'palevioletred': return 0xdb7093ff;\n case 'papayawhip': return 0xffefd5ff;\n case 'peachpuff': return 0xffdab9ff;\n case 'peru': return 0xcd853fff;\n case 'pink': return 0xffc0cbff;\n case 'plum': return 0xdda0ddff;\n case 'powderblue': return 0xb0e0e6ff;\n case 'purple': return 0x800080ff;\n case 'rebeccapurple': return 0x663399ff;\n case 'red': return 0xff0000ff;\n case 'rosybrown': return 0xbc8f8fff;\n case 'royalblue': return 0x4169e1ff;\n case 'saddlebrown': return 0x8b4513ff;\n case 'salmon': return 0xfa8072ff;\n case 'sandybrown': return 0xf4a460ff;\n case 'seagreen': return 0x2e8b57ff;\n case 'seashell': return 0xfff5eeff;\n case 'sienna': return 0xa0522dff;\n case 'silver': return 0xc0c0c0ff;\n case 'skyblue': return 0x87ceebff;\n case 'slateblue': return 0x6a5acdff;\n case 'slategray': return 0x708090ff;\n case 'slategrey': return 0x708090ff;\n case 'snow': return 0xfffafaff;\n case 'springgreen': return 0x00ff7fff;\n case 'steelblue': return 0x4682b4ff;\n case 'tan': return 0xd2b48cff;\n case 'teal': return 0x008080ff;\n case 'thistle': return 0xd8bfd8ff;\n case 'tomato': return 0xff6347ff;\n case 'turquoise': return 0x40e0d0ff;\n case 'violet': return 0xee82eeff;\n case 'wheat': return 0xf5deb3ff;\n case 'white': return 0xffffffff;\n case 'whitesmoke': return 0xf5f5f5ff;\n case 'yellow': return 0xffff00ff;\n case 'yellowgreen': return 0x9acd32ff;\n }\n return null;\n}\n\nmodule.exports = normalizeColor;\n","module.exports = { \"default\": require(\"core-js/library/fn/object/assign\"), __esModule: true };","module.exports = { \"default\": require(\"core-js/library/fn/object/create\"), __esModule: true };","module.exports = { \"default\": require(\"core-js/library/fn/object/define-property\"), __esModule: true };","module.exports = { \"default\": require(\"core-js/library/fn/object/get-prototype-of\"), __esModule: true };","module.exports = { \"default\": require(\"core-js/library/fn/object/set-prototype-of\"), __esModule: true };","module.exports = { \"default\": require(\"core-js/library/fn/symbol\"), __esModule: true };","module.exports = { \"default\": require(\"core-js/library/fn/symbol/iterator\"), __esModule: true };","\"use strict\";\n\nexports.__esModule = true;\n\nexports.default = function (instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n};","\"use strict\";\n\nexports.__esModule = true;\n\nvar _defineProperty = require(\"../core-js/object/define-property\");\n\nvar _defineProperty2 = _interopRequireDefault(_defineProperty);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nexports.default = function () {\n function defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n (0, _defineProperty2.default)(target, descriptor.key, descriptor);\n }\n }\n\n return function (Constructor, protoProps, staticProps) {\n if (protoProps) defineProperties(Constructor.prototype, protoProps);\n if (staticProps) defineProperties(Constructor, staticProps);\n return Constructor;\n };\n}();","\"use strict\";\n\nexports.__esModule = true;\n\nvar _assign = require(\"../core-js/object/assign\");\n\nvar _assign2 = _interopRequireDefault(_assign);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nexports.default = _assign2.default || function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n\n return target;\n};","\"use strict\";\n\nexports.__esModule = true;\n\nvar _setPrototypeOf = require(\"../core-js/object/set-prototype-of\");\n\nvar _setPrototypeOf2 = _interopRequireDefault(_setPrototypeOf);\n\nvar _create = require(\"../core-js/object/create\");\n\nvar _create2 = _interopRequireDefault(_create);\n\nvar _typeof2 = require(\"../helpers/typeof\");\n\nvar _typeof3 = _interopRequireDefault(_typeof2);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nexports.default = function (subClass, superClass) {\n if (typeof superClass !== \"function\" && superClass !== null) {\n throw new TypeError(\"Super expression must either be null or a function, not \" + (typeof superClass === \"undefined\" ? \"undefined\" : (0, _typeof3.default)(superClass)));\n }\n\n subClass.prototype = (0, _create2.default)(superClass && superClass.prototype, {\n constructor: {\n value: subClass,\n enumerable: false,\n writable: true,\n configurable: true\n }\n });\n if (superClass) _setPrototypeOf2.default ? (0, _setPrototypeOf2.default)(subClass, superClass) : subClass.__proto__ = superClass;\n};","\"use strict\";\n\nexports.__esModule = true;\n\nvar _typeof2 = require(\"../helpers/typeof\");\n\nvar _typeof3 = _interopRequireDefault(_typeof2);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nexports.default = function (self, call) {\n if (!self) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n\n return call && ((typeof call === \"undefined\" ? \"undefined\" : (0, _typeof3.default)(call)) === \"object\" || typeof call === \"function\") ? call : self;\n};","\"use strict\";\n\nexports.__esModule = true;\n\nvar _iterator = require(\"../core-js/symbol/iterator\");\n\nvar _iterator2 = _interopRequireDefault(_iterator);\n\nvar _symbol = require(\"../core-js/symbol\");\n\nvar _symbol2 = _interopRequireDefault(_symbol);\n\nvar _typeof = typeof _symbol2.default === \"function\" && typeof _iterator2.default === \"symbol\" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof _symbol2.default === \"function\" && obj.constructor === _symbol2.default && obj !== _symbol2.default.prototype ? \"symbol\" : typeof obj; };\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nexports.default = typeof _symbol2.default === \"function\" && _typeof(_iterator2.default) === \"symbol\" ? function (obj) {\n return typeof obj === \"undefined\" ? \"undefined\" : _typeof(obj);\n} : function (obj) {\n return obj && typeof _symbol2.default === \"function\" && obj.constructor === _symbol2.default && obj !== _symbol2.default.prototype ? \"symbol\" : typeof obj === \"undefined\" ? \"undefined\" : _typeof(obj);\n};","'use strict';\n\nmodule.exports = function (obj) {\n\tif (typeof obj === 'string') { return camelCase(obj); }\n\treturn walk(obj);\n};\n\nfunction walk(obj) {\n\tif (!obj || typeof obj !== 'object') { return obj; }\n\tif (isDate(obj) || isRegex(obj)) { return obj; }\n\tif (isArray(obj)) { return map(obj, walk); }\n\treturn reduce(objectKeys(obj), function (acc, key) {\n\t\tvar camel = camelCase(key);\n\t\tacc[camel] = walk(obj[key]);\n\t\treturn acc;\n\t}, {});\n}\n\nfunction camelCase(str) {\n\treturn str.replace(/[_.-](\\w|$)/g, function (_, x) {\n\t\treturn x.toUpperCase();\n\t});\n}\n\nvar isArray = Array.isArray || function (obj) {\n\treturn Object.prototype.toString.call(obj) === '[object Array]';\n};\n\nvar isDate = function (obj) {\n\treturn Object.prototype.toString.call(obj) === '[object Date]';\n};\n\nvar isRegex = function (obj) {\n\treturn Object.prototype.toString.call(obj) === '[object RegExp]';\n};\n\nvar has = Object.prototype.hasOwnProperty;\nvar objectKeys = Object.keys || function (obj) {\n\tvar keys = [];\n\tfor (var key in obj) {\n\t\tif (has.call(obj, key)) { keys.push(key); }\n\t}\n\treturn keys;\n};\n\nfunction map(xs, f) {\n\tif (xs.map) { return xs.map(f); }\n\tvar res = [];\n\tfor (var i = 0; i < xs.length; i++) {\n\t\tres.push(f(xs[i], i));\n\t}\n\treturn res;\n}\n\nfunction reduce(xs, f, acc) {\n\tif (xs.reduce) { return xs.reduce(f, acc); }\n\tfor (var i = 0; i < xs.length; i++) {\n\t\tacc = f(acc, xs[i], i);\n\t}\n\treturn acc;\n}\n","/* MIT license */\nvar cssKeywords = require('color-name');\n\n// NOTE: conversions should only return primitive values (i.e. arrays, or\n// values that give correct `typeof` results).\n// do not use box values types (i.e. Number(), String(), etc.)\n\nvar reverseKeywords = {};\nfor (var key in cssKeywords) {\n\tif (cssKeywords.hasOwnProperty(key)) {\n\t\treverseKeywords[cssKeywords[key]] = key;\n\t}\n}\n\nvar convert = module.exports = {\n\trgb: {channels: 3, labels: 'rgb'},\n\thsl: {channels: 3, labels: 'hsl'},\n\thsv: {channels: 3, labels: 'hsv'},\n\thwb: {channels: 3, labels: 'hwb'},\n\tcmyk: {channels: 4, labels: 'cmyk'},\n\txyz: {channels: 3, labels: 'xyz'},\n\tlab: {channels: 3, labels: 'lab'},\n\tlch: {channels: 3, labels: 'lch'},\n\thex: {channels: 1, labels: ['hex']},\n\tkeyword: {channels: 1, labels: ['keyword']},\n\tansi16: {channels: 1, labels: ['ansi16']},\n\tansi256: {channels: 1, labels: ['ansi256']},\n\thcg: {channels: 3, labels: ['h', 'c', 'g']},\n\tapple: {channels: 3, labels: ['r16', 'g16', 'b16']},\n\tgray: {channels: 1, labels: ['gray']}\n};\n\n// hide .channels and .labels properties\nfor (var model in convert) {\n\tif (convert.hasOwnProperty(model)) {\n\t\tif (!('channels' in convert[model])) {\n\t\t\tthrow new Error('missing channels property: ' + model);\n\t\t}\n\n\t\tif (!('labels' in convert[model])) {\n\t\t\tthrow new Error('missing channel labels property: ' + model);\n\t\t}\n\n\t\tif (convert[model].labels.length !== convert[model].channels) {\n\t\t\tthrow new Error('channel and label counts mismatch: ' + model);\n\t\t}\n\n\t\tvar channels = convert[model].channels;\n\t\tvar labels = convert[model].labels;\n\t\tdelete convert[model].channels;\n\t\tdelete convert[model].labels;\n\t\tObject.defineProperty(convert[model], 'channels', {value: channels});\n\t\tObject.defineProperty(convert[model], 'labels', {value: labels});\n\t}\n}\n\nconvert.rgb.hsl = function (rgb) {\n\tvar r = rgb[0] / 255;\n\tvar g = rgb[1] / 255;\n\tvar b = rgb[2] / 255;\n\tvar min = Math.min(r, g, b);\n\tvar max = Math.max(r, g, b);\n\tvar delta = max - min;\n\tvar h;\n\tvar s;\n\tvar l;\n\n\tif (max === min) {\n\t\th = 0;\n\t} else if (r === max) {\n\t\th = (g - b) / delta;\n\t} else if (g === max) {\n\t\th = 2 + (b - r) / delta;\n\t} else if (b === max) {\n\t\th = 4 + (r - g) / delta;\n\t}\n\n\th = Math.min(h * 60, 360);\n\n\tif (h < 0) {\n\t\th += 360;\n\t}\n\n\tl = (min + max) / 2;\n\n\tif (max === min) {\n\t\ts = 0;\n\t} else if (l <= 0.5) {\n\t\ts = delta / (max + min);\n\t} else {\n\t\ts = delta / (2 - max - min);\n\t}\n\n\treturn [h, s * 100, l * 100];\n};\n\nconvert.rgb.hsv = function (rgb) {\n\tvar rdif;\n\tvar gdif;\n\tvar bdif;\n\tvar h;\n\tvar s;\n\n\tvar r = rgb[0] / 255;\n\tvar g = rgb[1] / 255;\n\tvar b = rgb[2] / 255;\n\tvar v = Math.max(r, g, b);\n\tvar diff = v - Math.min(r, g, b);\n\tvar diffc = function (c) {\n\t\treturn (v - c) / 6 / diff + 1 / 2;\n\t};\n\n\tif (diff === 0) {\n\t\th = s = 0;\n\t} else {\n\t\ts = diff / v;\n\t\trdif = diffc(r);\n\t\tgdif = diffc(g);\n\t\tbdif = diffc(b);\n\n\t\tif (r === v) {\n\t\t\th = bdif - gdif;\n\t\t} else if (g === v) {\n\t\t\th = (1 / 3) + rdif - bdif;\n\t\t} else if (b === v) {\n\t\t\th = (2 / 3) + gdif - rdif;\n\t\t}\n\t\tif (h < 0) {\n\t\t\th += 1;\n\t\t} else if (h > 1) {\n\t\t\th -= 1;\n\t\t}\n\t}\n\n\treturn [\n\t\th * 360,\n\t\ts * 100,\n\t\tv * 100\n\t];\n};\n\nconvert.rgb.hwb = function (rgb) {\n\tvar r = rgb[0];\n\tvar g = rgb[1];\n\tvar b = rgb[2];\n\tvar h = convert.rgb.hsl(rgb)[0];\n\tvar w = 1 / 255 * Math.min(r, Math.min(g, b));\n\n\tb = 1 - 1 / 255 * Math.max(r, Math.max(g, b));\n\n\treturn [h, w * 100, b * 100];\n};\n\nconvert.rgb.cmyk = function (rgb) {\n\tvar r = rgb[0] / 255;\n\tvar g = rgb[1] / 255;\n\tvar b = rgb[2] / 255;\n\tvar c;\n\tvar m;\n\tvar y;\n\tvar k;\n\n\tk = Math.min(1 - r, 1 - g, 1 - b);\n\tc = (1 - r - k) / (1 - k) || 0;\n\tm = (1 - g - k) / (1 - k) || 0;\n\ty = (1 - b - k) / (1 - k) || 0;\n\n\treturn [c * 100, m * 100, y * 100, k * 100];\n};\n\n/**\n * See https://en.m.wikipedia.org/wiki/Euclidean_distance#Squared_Euclidean_distance\n * */\nfunction comparativeDistance(x, y) {\n\treturn (\n\t\tMath.pow(x[0] - y[0], 2) +\n\t\tMath.pow(x[1] - y[1], 2) +\n\t\tMath.pow(x[2] - y[2], 2)\n\t);\n}\n\nconvert.rgb.keyword = function (rgb) {\n\tvar reversed = reverseKeywords[rgb];\n\tif (reversed) {\n\t\treturn reversed;\n\t}\n\n\tvar currentClosestDistance = Infinity;\n\tvar currentClosestKeyword;\n\n\tfor (var keyword in cssKeywords) {\n\t\tif (cssKeywords.hasOwnProperty(keyword)) {\n\t\t\tvar value = cssKeywords[keyword];\n\n\t\t\t// Compute comparative distance\n\t\t\tvar distance = comparativeDistance(rgb, value);\n\n\t\t\t// Check if its less, if so set as closest\n\t\t\tif (distance < currentClosestDistance) {\n\t\t\t\tcurrentClosestDistance = distance;\n\t\t\t\tcurrentClosestKeyword = keyword;\n\t\t\t}\n\t\t}\n\t}\n\n\treturn currentClosestKeyword;\n};\n\nconvert.keyword.rgb = function (keyword) {\n\treturn cssKeywords[keyword];\n};\n\nconvert.rgb.xyz = function (rgb) {\n\tvar r = rgb[0] / 255;\n\tvar g = rgb[1] / 255;\n\tvar b = rgb[2] / 255;\n\n\t// assume sRGB\n\tr = r > 0.04045 ? Math.pow(((r + 0.055) / 1.055), 2.4) : (r / 12.92);\n\tg = g > 0.04045 ? Math.pow(((g + 0.055) / 1.055), 2.4) : (g / 12.92);\n\tb = b > 0.04045 ? Math.pow(((b + 0.055) / 1.055), 2.4) : (b / 12.92);\n\n\tvar x = (r * 0.4124) + (g * 0.3576) + (b * 0.1805);\n\tvar y = (r * 0.2126) + (g * 0.7152) + (b * 0.0722);\n\tvar z = (r * 0.0193) + (g * 0.1192) + (b * 0.9505);\n\n\treturn [x * 100, y * 100, z * 100];\n};\n\nconvert.rgb.lab = function (rgb) {\n\tvar xyz = convert.rgb.xyz(rgb);\n\tvar x = xyz[0];\n\tvar y = xyz[1];\n\tvar z = xyz[2];\n\tvar l;\n\tvar a;\n\tvar b;\n\n\tx /= 95.047;\n\ty /= 100;\n\tz /= 108.883;\n\n\tx = x > 0.008856 ? Math.pow(x, 1 / 3) : (7.787 * x) + (16 / 116);\n\ty = y > 0.008856 ? Math.pow(y, 1 / 3) : (7.787 * y) + (16 / 116);\n\tz = z > 0.008856 ? Math.pow(z, 1 / 3) : (7.787 * z) + (16 / 116);\n\n\tl = (116 * y) - 16;\n\ta = 500 * (x - y);\n\tb = 200 * (y - z);\n\n\treturn [l, a, b];\n};\n\nconvert.hsl.rgb = function (hsl) {\n\tvar h = hsl[0] / 360;\n\tvar s = hsl[1] / 100;\n\tvar l = hsl[2] / 100;\n\tvar t1;\n\tvar t2;\n\tvar t3;\n\tvar rgb;\n\tvar val;\n\n\tif (s === 0) {\n\t\tval = l * 255;\n\t\treturn [val, val, val];\n\t}\n\n\tif (l < 0.5) {\n\t\tt2 = l * (1 + s);\n\t} else {\n\t\tt2 = l + s - l * s;\n\t}\n\n\tt1 = 2 * l - t2;\n\n\trgb = [0, 0, 0];\n\tfor (var i = 0; i < 3; i++) {\n\t\tt3 = h + 1 / 3 * -(i - 1);\n\t\tif (t3 < 0) {\n\t\t\tt3++;\n\t\t}\n\t\tif (t3 > 1) {\n\t\t\tt3--;\n\t\t}\n\n\t\tif (6 * t3 < 1) {\n\t\t\tval = t1 + (t2 - t1) * 6 * t3;\n\t\t} else if (2 * t3 < 1) {\n\t\t\tval = t2;\n\t\t} else if (3 * t3 < 2) {\n\t\t\tval = t1 + (t2 - t1) * (2 / 3 - t3) * 6;\n\t\t} else {\n\t\t\tval = t1;\n\t\t}\n\n\t\trgb[i] = val * 255;\n\t}\n\n\treturn rgb;\n};\n\nconvert.hsl.hsv = function (hsl) {\n\tvar h = hsl[0];\n\tvar s = hsl[1] / 100;\n\tvar l = hsl[2] / 100;\n\tvar smin = s;\n\tvar lmin = Math.max(l, 0.01);\n\tvar sv;\n\tvar v;\n\n\tl *= 2;\n\ts *= (l <= 1) ? l : 2 - l;\n\tsmin *= lmin <= 1 ? lmin : 2 - lmin;\n\tv = (l + s) / 2;\n\tsv = l === 0 ? (2 * smin) / (lmin + smin) : (2 * s) / (l + s);\n\n\treturn [h, sv * 100, v * 100];\n};\n\nconvert.hsv.rgb = function (hsv) {\n\tvar h = hsv[0] / 60;\n\tvar s = hsv[1] / 100;\n\tvar v = hsv[2] / 100;\n\tvar hi = Math.floor(h) % 6;\n\n\tvar f = h - Math.floor(h);\n\tvar p = 255 * v * (1 - s);\n\tvar q = 255 * v * (1 - (s * f));\n\tvar t = 255 * v * (1 - (s * (1 - f)));\n\tv *= 255;\n\n\tswitch (hi) {\n\t\tcase 0:\n\t\t\treturn [v, t, p];\n\t\tcase 1:\n\t\t\treturn [q, v, p];\n\t\tcase 2:\n\t\t\treturn [p, v, t];\n\t\tcase 3:\n\t\t\treturn [p, q, v];\n\t\tcase 4:\n\t\t\treturn [t, p, v];\n\t\tcase 5:\n\t\t\treturn [v, p, q];\n\t}\n};\n\nconvert.hsv.hsl = function (hsv) {\n\tvar h = hsv[0];\n\tvar s = hsv[1] / 100;\n\tvar v = hsv[2] / 100;\n\tvar vmin = Math.max(v, 0.01);\n\tvar lmin;\n\tvar sl;\n\tvar l;\n\n\tl = (2 - s) * v;\n\tlmin = (2 - s) * vmin;\n\tsl = s * vmin;\n\tsl /= (lmin <= 1) ? lmin : 2 - lmin;\n\tsl = sl || 0;\n\tl /= 2;\n\n\treturn [h, sl * 100, l * 100];\n};\n\n// http://dev.w3.org/csswg/css-color/#hwb-to-rgb\nconvert.hwb.rgb = function (hwb) {\n\tvar h = hwb[0] / 360;\n\tvar wh = hwb[1] / 100;\n\tvar bl = hwb[2] / 100;\n\tvar ratio = wh + bl;\n\tvar i;\n\tvar v;\n\tvar f;\n\tvar n;\n\n\t// wh + bl cant be > 1\n\tif (ratio > 1) {\n\t\twh /= ratio;\n\t\tbl /= ratio;\n\t}\n\n\ti = Math.floor(6 * h);\n\tv = 1 - bl;\n\tf = 6 * h - i;\n\n\tif ((i & 0x01) !== 0) {\n\t\tf = 1 - f;\n\t}\n\n\tn = wh + f * (v - wh); // linear interpolation\n\n\tvar r;\n\tvar g;\n\tvar b;\n\tswitch (i) {\n\t\tdefault:\n\t\tcase 6:\n\t\tcase 0: r = v; g = n; b = wh; break;\n\t\tcase 1: r = n; g = v; b = wh; break;\n\t\tcase 2: r = wh; g = v; b = n; break;\n\t\tcase 3: r = wh; g = n; b = v; break;\n\t\tcase 4: r = n; g = wh; b = v; break;\n\t\tcase 5: r = v; g = wh; b = n; break;\n\t}\n\n\treturn [r * 255, g * 255, b * 255];\n};\n\nconvert.cmyk.rgb = function (cmyk) {\n\tvar c = cmyk[0] / 100;\n\tvar m = cmyk[1] / 100;\n\tvar y = cmyk[2] / 100;\n\tvar k = cmyk[3] / 100;\n\tvar r;\n\tvar g;\n\tvar b;\n\n\tr = 1 - Math.min(1, c * (1 - k) + k);\n\tg = 1 - Math.min(1, m * (1 - k) + k);\n\tb = 1 - Math.min(1, y * (1 - k) + k);\n\n\treturn [r * 255, g * 255, b * 255];\n};\n\nconvert.xyz.rgb = function (xyz) {\n\tvar x = xyz[0] / 100;\n\tvar y = xyz[1] / 100;\n\tvar z = xyz[2] / 100;\n\tvar r;\n\tvar g;\n\tvar b;\n\n\tr = (x * 3.2406) + (y * -1.5372) + (z * -0.4986);\n\tg = (x * -0.9689) + (y * 1.8758) + (z * 0.0415);\n\tb = (x * 0.0557) + (y * -0.2040) + (z * 1.0570);\n\n\t// assume sRGB\n\tr = r > 0.0031308\n\t\t? ((1.055 * Math.pow(r, 1.0 / 2.4)) - 0.055)\n\t\t: r * 12.92;\n\n\tg = g > 0.0031308\n\t\t? ((1.055 * Math.pow(g, 1.0 / 2.4)) - 0.055)\n\t\t: g * 12.92;\n\n\tb = b > 0.0031308\n\t\t? ((1.055 * Math.pow(b, 1.0 / 2.4)) - 0.055)\n\t\t: b * 12.92;\n\n\tr = Math.min(Math.max(0, r), 1);\n\tg = Math.min(Math.max(0, g), 1);\n\tb = Math.min(Math.max(0, b), 1);\n\n\treturn [r * 255, g * 255, b * 255];\n};\n\nconvert.xyz.lab = function (xyz) {\n\tvar x = xyz[0];\n\tvar y = xyz[1];\n\tvar z = xyz[2];\n\tvar l;\n\tvar a;\n\tvar b;\n\n\tx /= 95.047;\n\ty /= 100;\n\tz /= 108.883;\n\n\tx = x > 0.008856 ? Math.pow(x, 1 / 3) : (7.787 * x) + (16 / 116);\n\ty = y > 0.008856 ? Math.pow(y, 1 / 3) : (7.787 * y) + (16 / 116);\n\tz = z > 0.008856 ? Math.pow(z, 1 / 3) : (7.787 * z) + (16 / 116);\n\n\tl = (116 * y) - 16;\n\ta = 500 * (x - y);\n\tb = 200 * (y - z);\n\n\treturn [l, a, b];\n};\n\nconvert.lab.xyz = function (lab) {\n\tvar l = lab[0];\n\tvar a = lab[1];\n\tvar b = lab[2];\n\tvar x;\n\tvar y;\n\tvar z;\n\n\ty = (l + 16) / 116;\n\tx = a / 500 + y;\n\tz = y - b / 200;\n\n\tvar y2 = Math.pow(y, 3);\n\tvar x2 = Math.pow(x, 3);\n\tvar z2 = Math.pow(z, 3);\n\ty = y2 > 0.008856 ? y2 : (y - 16 / 116) / 7.787;\n\tx = x2 > 0.008856 ? x2 : (x - 16 / 116) / 7.787;\n\tz = z2 > 0.008856 ? z2 : (z - 16 / 116) / 7.787;\n\n\tx *= 95.047;\n\ty *= 100;\n\tz *= 108.883;\n\n\treturn [x, y, z];\n};\n\nconvert.lab.lch = function (lab) {\n\tvar l = lab[0];\n\tvar a = lab[1];\n\tvar b = lab[2];\n\tvar hr;\n\tvar h;\n\tvar c;\n\n\thr = Math.atan2(b, a);\n\th = hr * 360 / 2 / Math.PI;\n\n\tif (h < 0) {\n\t\th += 360;\n\t}\n\n\tc = Math.sqrt(a * a + b * b);\n\n\treturn [l, c, h];\n};\n\nconvert.lch.lab = function (lch) {\n\tvar l = lch[0];\n\tvar c = lch[1];\n\tvar h = lch[2];\n\tvar a;\n\tvar b;\n\tvar hr;\n\n\thr = h / 360 * 2 * Math.PI;\n\ta = c * Math.cos(hr);\n\tb = c * Math.sin(hr);\n\n\treturn [l, a, b];\n};\n\nconvert.rgb.ansi16 = function (args) {\n\tvar r = args[0];\n\tvar g = args[1];\n\tvar b = args[2];\n\tvar value = 1 in arguments ? arguments[1] : convert.rgb.hsv(args)[2]; // hsv -> ansi16 optimization\n\n\tvalue = Math.round(value / 50);\n\n\tif (value === 0) {\n\t\treturn 30;\n\t}\n\n\tvar ansi = 30\n\t\t+ ((Math.round(b / 255) << 2)\n\t\t| (Math.round(g / 255) << 1)\n\t\t| Math.round(r / 255));\n\n\tif (value === 2) {\n\t\tansi += 60;\n\t}\n\n\treturn ansi;\n};\n\nconvert.hsv.ansi16 = function (args) {\n\t// optimization here; we already know the value and don't need to get\n\t// it converted for us.\n\treturn convert.rgb.ansi16(convert.hsv.rgb(args), args[2]);\n};\n\nconvert.rgb.ansi256 = function (args) {\n\tvar r = args[0];\n\tvar g = args[1];\n\tvar b = args[2];\n\n\t// we use the extended greyscale palette here, with the exception of\n\t// black and white. normal palette only has 4 greyscale shades.\n\tif (r === g && g === b) {\n\t\tif (r < 8) {\n\t\t\treturn 16;\n\t\t}\n\n\t\tif (r > 248) {\n\t\t\treturn 231;\n\t\t}\n\n\t\treturn Math.round(((r - 8) / 247) * 24) + 232;\n\t}\n\n\tvar ansi = 16\n\t\t+ (36 * Math.round(r / 255 * 5))\n\t\t+ (6 * Math.round(g / 255 * 5))\n\t\t+ Math.round(b / 255 * 5);\n\n\treturn ansi;\n};\n\nconvert.ansi16.rgb = function (args) {\n\tvar color = args % 10;\n\n\t// handle greyscale\n\tif (color === 0 || color === 7) {\n\t\tif (args > 50) {\n\t\t\tcolor += 3.5;\n\t\t}\n\n\t\tcolor = color / 10.5 * 255;\n\n\t\treturn [color, color, color];\n\t}\n\n\tvar mult = (~~(args > 50) + 1) * 0.5;\n\tvar r = ((color & 1) * mult) * 255;\n\tvar g = (((color >> 1) & 1) * mult) * 255;\n\tvar b = (((color >> 2) & 1) * mult) * 255;\n\n\treturn [r, g, b];\n};\n\nconvert.ansi256.rgb = function (args) {\n\t// handle greyscale\n\tif (args >= 232) {\n\t\tvar c = (args - 232) * 10 + 8;\n\t\treturn [c, c, c];\n\t}\n\n\targs -= 16;\n\n\tvar rem;\n\tvar r = Math.floor(args / 36) / 5 * 255;\n\tvar g = Math.floor((rem = args % 36) / 6) / 5 * 255;\n\tvar b = (rem % 6) / 5 * 255;\n\n\treturn [r, g, b];\n};\n\nconvert.rgb.hex = function (args) {\n\tvar integer = ((Math.round(args[0]) & 0xFF) << 16)\n\t\t+ ((Math.round(args[1]) & 0xFF) << 8)\n\t\t+ (Math.round(args[2]) & 0xFF);\n\n\tvar string = integer.toString(16).toUpperCase();\n\treturn '000000'.substring(string.length) + string;\n};\n\nconvert.hex.rgb = function (args) {\n\tvar match = args.toString(16).match(/[a-f0-9]{6}|[a-f0-9]{3}/i);\n\tif (!match) {\n\t\treturn [0, 0, 0];\n\t}\n\n\tvar colorString = match[0];\n\n\tif (match[0].length === 3) {\n\t\tcolorString = colorString.split('').map(function (char) {\n\t\t\treturn char + char;\n\t\t}).join('');\n\t}\n\n\tvar integer = parseInt(colorString, 16);\n\tvar r = (integer >> 16) & 0xFF;\n\tvar g = (integer >> 8) & 0xFF;\n\tvar b = integer & 0xFF;\n\n\treturn [r, g, b];\n};\n\nconvert.rgb.hcg = function (rgb) {\n\tvar r = rgb[0] / 255;\n\tvar g = rgb[1] / 255;\n\tvar b = rgb[2] / 255;\n\tvar max = Math.max(Math.max(r, g), b);\n\tvar min = Math.min(Math.min(r, g), b);\n\tvar chroma = (max - min);\n\tvar grayscale;\n\tvar hue;\n\n\tif (chroma < 1) {\n\t\tgrayscale = min / (1 - chroma);\n\t} else {\n\t\tgrayscale = 0;\n\t}\n\n\tif (chroma <= 0) {\n\t\thue = 0;\n\t} else\n\tif (max === r) {\n\t\thue = ((g - b) / chroma) % 6;\n\t} else\n\tif (max === g) {\n\t\thue = 2 + (b - r) / chroma;\n\t} else {\n\t\thue = 4 + (r - g) / chroma + 4;\n\t}\n\n\thue /= 6;\n\thue %= 1;\n\n\treturn [hue * 360, chroma * 100, grayscale * 100];\n};\n\nconvert.hsl.hcg = function (hsl) {\n\tvar s = hsl[1] / 100;\n\tvar l = hsl[2] / 100;\n\tvar c = 1;\n\tvar f = 0;\n\n\tif (l < 0.5) {\n\t\tc = 2.0 * s * l;\n\t} else {\n\t\tc = 2.0 * s * (1.0 - l);\n\t}\n\n\tif (c < 1.0) {\n\t\tf = (l - 0.5 * c) / (1.0 - c);\n\t}\n\n\treturn [hsl[0], c * 100, f * 100];\n};\n\nconvert.hsv.hcg = function (hsv) {\n\tvar s = hsv[1] / 100;\n\tvar v = hsv[2] / 100;\n\n\tvar c = s * v;\n\tvar f = 0;\n\n\tif (c < 1.0) {\n\t\tf = (v - c) / (1 - c);\n\t}\n\n\treturn [hsv[0], c * 100, f * 100];\n};\n\nconvert.hcg.rgb = function (hcg) {\n\tvar h = hcg[0] / 360;\n\tvar c = hcg[1] / 100;\n\tvar g = hcg[2] / 100;\n\n\tif (c === 0.0) {\n\t\treturn [g * 255, g * 255, g * 255];\n\t}\n\n\tvar pure = [0, 0, 0];\n\tvar hi = (h % 1) * 6;\n\tvar v = hi % 1;\n\tvar w = 1 - v;\n\tvar mg = 0;\n\n\tswitch (Math.floor(hi)) {\n\t\tcase 0:\n\t\t\tpure[0] = 1; pure[1] = v; pure[2] = 0; break;\n\t\tcase 1:\n\t\t\tpure[0] = w; pure[1] = 1; pure[2] = 0; break;\n\t\tcase 2:\n\t\t\tpure[0] = 0; pure[1] = 1; pure[2] = v; break;\n\t\tcase 3:\n\t\t\tpure[0] = 0; pure[1] = w; pure[2] = 1; break;\n\t\tcase 4:\n\t\t\tpure[0] = v; pure[1] = 0; pure[2] = 1; break;\n\t\tdefault:\n\t\t\tpure[0] = 1; pure[1] = 0; pure[2] = w;\n\t}\n\n\tmg = (1.0 - c) * g;\n\n\treturn [\n\t\t(c * pure[0] + mg) * 255,\n\t\t(c * pure[1] + mg) * 255,\n\t\t(c * pure[2] + mg) * 255\n\t];\n};\n\nconvert.hcg.hsv = function (hcg) {\n\tvar c = hcg[1] / 100;\n\tvar g = hcg[2] / 100;\n\n\tvar v = c + g * (1.0 - c);\n\tvar f = 0;\n\n\tif (v > 0.0) {\n\t\tf = c / v;\n\t}\n\n\treturn [hcg[0], f * 100, v * 100];\n};\n\nconvert.hcg.hsl = function (hcg) {\n\tvar c = hcg[1] / 100;\n\tvar g = hcg[2] / 100;\n\n\tvar l = g * (1.0 - c) + 0.5 * c;\n\tvar s = 0;\n\n\tif (l > 0.0 && l < 0.5) {\n\t\ts = c / (2 * l);\n\t} else\n\tif (l >= 0.5 && l < 1.0) {\n\t\ts = c / (2 * (1 - l));\n\t}\n\n\treturn [hcg[0], s * 100, l * 100];\n};\n\nconvert.hcg.hwb = function (hcg) {\n\tvar c = hcg[1] / 100;\n\tvar g = hcg[2] / 100;\n\tvar v = c + g * (1.0 - c);\n\treturn [hcg[0], (v - c) * 100, (1 - v) * 100];\n};\n\nconvert.hwb.hcg = function (hwb) {\n\tvar w = hwb[1] / 100;\n\tvar b = hwb[2] / 100;\n\tvar v = 1 - b;\n\tvar c = v - w;\n\tvar g = 0;\n\n\tif (c < 1) {\n\t\tg = (v - c) / (1 - c);\n\t}\n\n\treturn [hwb[0], c * 100, g * 100];\n};\n\nconvert.apple.rgb = function (apple) {\n\treturn [(apple[0] / 65535) * 255, (apple[1] / 65535) * 255, (apple[2] / 65535) * 255];\n};\n\nconvert.rgb.apple = function (rgb) {\n\treturn [(rgb[0] / 255) * 65535, (rgb[1] / 255) * 65535, (rgb[2] / 255) * 65535];\n};\n\nconvert.gray.rgb = function (args) {\n\treturn [args[0] / 100 * 255, args[0] / 100 * 255, args[0] / 100 * 255];\n};\n\nconvert.gray.hsl = convert.gray.hsv = function (args) {\n\treturn [0, 0, args[0]];\n};\n\nconvert.gray.hwb = function (gray) {\n\treturn [0, 100, gray[0]];\n};\n\nconvert.gray.cmyk = function (gray) {\n\treturn [0, 0, 0, gray[0]];\n};\n\nconvert.gray.lab = function (gray) {\n\treturn [gray[0], 0, 0];\n};\n\nconvert.gray.hex = function (gray) {\n\tvar val = Math.round(gray[0] / 100 * 255) & 0xFF;\n\tvar integer = (val << 16) + (val << 8) + val;\n\n\tvar string = integer.toString(16).toUpperCase();\n\treturn '000000'.substring(string.length) + string;\n};\n\nconvert.rgb.gray = function (rgb) {\n\tvar val = (rgb[0] + rgb[1] + rgb[2]) / 3;\n\treturn [val / 255 * 100];\n};\n","var conversions = require('./conversions');\nvar route = require('./route');\n\nvar convert = {};\n\nvar models = Object.keys(conversions);\n\nfunction wrapRaw(fn) {\n\tvar wrappedFn = function (args) {\n\t\tif (args === undefined || args === null) {\n\t\t\treturn args;\n\t\t}\n\n\t\tif (arguments.length > 1) {\n\t\t\targs = Array.prototype.slice.call(arguments);\n\t\t}\n\n\t\treturn fn(args);\n\t};\n\n\t// preserve .conversion property if there is one\n\tif ('conversion' in fn) {\n\t\twrappedFn.conversion = fn.conversion;\n\t}\n\n\treturn wrappedFn;\n}\n\nfunction wrapRounded(fn) {\n\tvar wrappedFn = function (args) {\n\t\tif (args === undefined || args === null) {\n\t\t\treturn args;\n\t\t}\n\n\t\tif (arguments.length > 1) {\n\t\t\targs = Array.prototype.slice.call(arguments);\n\t\t}\n\n\t\tvar result = fn(args);\n\n\t\t// we're assuming the result is an array here.\n\t\t// see notice in conversions.js; don't use box types\n\t\t// in conversion functions.\n\t\tif (typeof result === 'object') {\n\t\t\tfor (var len = result.length, i = 0; i < len; i++) {\n\t\t\t\tresult[i] = Math.round(result[i]);\n\t\t\t}\n\t\t}\n\n\t\treturn result;\n\t};\n\n\t// preserve .conversion property if there is one\n\tif ('conversion' in fn) {\n\t\twrappedFn.conversion = fn.conversion;\n\t}\n\n\treturn wrappedFn;\n}\n\nmodels.forEach(function (fromModel) {\n\tconvert[fromModel] = {};\n\n\tObject.defineProperty(convert[fromModel], 'channels', {value: conversions[fromModel].channels});\n\tObject.defineProperty(convert[fromModel], 'labels', {value: conversions[fromModel].labels});\n\n\tvar routes = route(fromModel);\n\tvar routeModels = Object.keys(routes);\n\n\trouteModels.forEach(function (toModel) {\n\t\tvar fn = routes[toModel];\n\n\t\tconvert[fromModel][toModel] = wrapRounded(fn);\n\t\tconvert[fromModel][toModel].raw = wrapRaw(fn);\n\t});\n});\n\nmodule.exports = convert;\n","'use strict'\r\n\r\nmodule.exports = {\r\n\t\"aliceblue\": [240, 248, 255],\r\n\t\"antiquewhite\": [250, 235, 215],\r\n\t\"aqua\": [0, 255, 255],\r\n\t\"aquamarine\": [127, 255, 212],\r\n\t\"azure\": [240, 255, 255],\r\n\t\"beige\": [245, 245, 220],\r\n\t\"bisque\": [255, 228, 196],\r\n\t\"black\": [0, 0, 0],\r\n\t\"blanchedalmond\": [255, 235, 205],\r\n\t\"blue\": [0, 0, 255],\r\n\t\"blueviolet\": [138, 43, 226],\r\n\t\"brown\": [165, 42, 42],\r\n\t\"burlywood\": [222, 184, 135],\r\n\t\"cadetblue\": [95, 158, 160],\r\n\t\"chartreuse\": [127, 255, 0],\r\n\t\"chocolate\": [210, 105, 30],\r\n\t\"coral\": [255, 127, 80],\r\n\t\"cornflowerblue\": [100, 149, 237],\r\n\t\"cornsilk\": [255, 248, 220],\r\n\t\"crimson\": [220, 20, 60],\r\n\t\"cyan\": [0, 255, 255],\r\n\t\"darkblue\": [0, 0, 139],\r\n\t\"darkcyan\": [0, 139, 139],\r\n\t\"darkgoldenrod\": [184, 134, 11],\r\n\t\"darkgray\": [169, 169, 169],\r\n\t\"darkgreen\": [0, 100, 0],\r\n\t\"darkgrey\": [169, 169, 169],\r\n\t\"darkkhaki\": [189, 183, 107],\r\n\t\"darkmagenta\": [139, 0, 139],\r\n\t\"darkolivegreen\": [85, 107, 47],\r\n\t\"darkorange\": [255, 140, 0],\r\n\t\"darkorchid\": [153, 50, 204],\r\n\t\"darkred\": [139, 0, 0],\r\n\t\"darksalmon\": [233, 150, 122],\r\n\t\"darkseagreen\": [143, 188, 143],\r\n\t\"darkslateblue\": [72, 61, 139],\r\n\t\"darkslategray\": [47, 79, 79],\r\n\t\"darkslategrey\": [47, 79, 79],\r\n\t\"darkturquoise\": [0, 206, 209],\r\n\t\"darkviolet\": [148, 0, 211],\r\n\t\"deeppink\": [255, 20, 147],\r\n\t\"deepskyblue\": [0, 191, 255],\r\n\t\"dimgray\": [105, 105, 105],\r\n\t\"dimgrey\": [105, 105, 105],\r\n\t\"dodgerblue\": [30, 144, 255],\r\n\t\"firebrick\": [178, 34, 34],\r\n\t\"floralwhite\": [255, 250, 240],\r\n\t\"forestgreen\": [34, 139, 34],\r\n\t\"fuchsia\": [255, 0, 255],\r\n\t\"gainsboro\": [220, 220, 220],\r\n\t\"ghostwhite\": [248, 248, 255],\r\n\t\"gold\": [255, 215, 0],\r\n\t\"goldenrod\": [218, 165, 32],\r\n\t\"gray\": [128, 128, 128],\r\n\t\"green\": [0, 128, 0],\r\n\t\"greenyellow\": [173, 255, 47],\r\n\t\"grey\": [128, 128, 128],\r\n\t\"honeydew\": [240, 255, 240],\r\n\t\"hotpink\": [255, 105, 180],\r\n\t\"indianred\": [205, 92, 92],\r\n\t\"indigo\": [75, 0, 130],\r\n\t\"ivory\": [255, 255, 240],\r\n\t\"khaki\": [240, 230, 140],\r\n\t\"lavender\": [230, 230, 250],\r\n\t\"lavenderblush\": [255, 240, 245],\r\n\t\"lawngreen\": [124, 252, 0],\r\n\t\"lemonchiffon\": [255, 250, 205],\r\n\t\"lightblue\": [173, 216, 230],\r\n\t\"lightcoral\": [240, 128, 128],\r\n\t\"lightcyan\": [224, 255, 255],\r\n\t\"lightgoldenrodyellow\": [250, 250, 210],\r\n\t\"lightgray\": [211, 211, 211],\r\n\t\"lightgreen\": [144, 238, 144],\r\n\t\"lightgrey\": [211, 211, 211],\r\n\t\"lightpink\": [255, 182, 193],\r\n\t\"lightsalmon\": [255, 160, 122],\r\n\t\"lightseagreen\": [32, 178, 170],\r\n\t\"lightskyblue\": [135, 206, 250],\r\n\t\"lightslategray\": [119, 136, 153],\r\n\t\"lightslategrey\": [119, 136, 153],\r\n\t\"lightsteelblue\": [176, 196, 222],\r\n\t\"lightyellow\": [255, 255, 224],\r\n\t\"lime\": [0, 255, 0],\r\n\t\"limegreen\": [50, 205, 50],\r\n\t\"linen\": [250, 240, 230],\r\n\t\"magenta\": [255, 0, 255],\r\n\t\"maroon\": [128, 0, 0],\r\n\t\"mediumaquamarine\": [102, 205, 170],\r\n\t\"mediumblue\": [0, 0, 205],\r\n\t\"mediumorchid\": [186, 85, 211],\r\n\t\"mediumpurple\": [147, 112, 219],\r\n\t\"mediumseagreen\": [60, 179, 113],\r\n\t\"mediumslateblue\": [123, 104, 238],\r\n\t\"mediumspringgreen\": [0, 250, 154],\r\n\t\"mediumturquoise\": [72, 209, 204],\r\n\t\"mediumvioletred\": [199, 21, 133],\r\n\t\"midnightblue\": [25, 25, 112],\r\n\t\"mintcream\": [245, 255, 250],\r\n\t\"mistyrose\": [255, 228, 225],\r\n\t\"moccasin\": [255, 228, 181],\r\n\t\"navajowhite\": [255, 222, 173],\r\n\t\"navy\": [0, 0, 128],\r\n\t\"oldlace\": [253, 245, 230],\r\n\t\"olive\": [128, 128, 0],\r\n\t\"olivedrab\": [107, 142, 35],\r\n\t\"orange\": [255, 165, 0],\r\n\t\"orangered\": [255, 69, 0],\r\n\t\"orchid\": [218, 112, 214],\r\n\t\"palegoldenrod\": [238, 232, 170],\r\n\t\"palegreen\": [152, 251, 152],\r\n\t\"paleturquoise\": [175, 238, 238],\r\n\t\"palevioletred\": [219, 112, 147],\r\n\t\"papayawhip\": [255, 239, 213],\r\n\t\"peachpuff\": [255, 218, 185],\r\n\t\"peru\": [205, 133, 63],\r\n\t\"pink\": [255, 192, 203],\r\n\t\"plum\": [221, 160, 221],\r\n\t\"powderblue\": [176, 224, 230],\r\n\t\"purple\": [128, 0, 128],\r\n\t\"rebeccapurple\": [102, 51, 153],\r\n\t\"red\": [255, 0, 0],\r\n\t\"rosybrown\": [188, 143, 143],\r\n\t\"royalblue\": [65, 105, 225],\r\n\t\"saddlebrown\": [139, 69, 19],\r\n\t\"salmon\": [250, 128, 114],\r\n\t\"sandybrown\": [244, 164, 96],\r\n\t\"seagreen\": [46, 139, 87],\r\n\t\"seashell\": [255, 245, 238],\r\n\t\"sienna\": [160, 82, 45],\r\n\t\"silver\": [192, 192, 192],\r\n\t\"skyblue\": [135, 206, 235],\r\n\t\"slateblue\": [106, 90, 205],\r\n\t\"slategray\": [112, 128, 144],\r\n\t\"slategrey\": [112, 128, 144],\r\n\t\"snow\": [255, 250, 250],\r\n\t\"springgreen\": [0, 255, 127],\r\n\t\"steelblue\": [70, 130, 180],\r\n\t\"tan\": [210, 180, 140],\r\n\t\"teal\": [0, 128, 128],\r\n\t\"thistle\": [216, 191, 216],\r\n\t\"tomato\": [255, 99, 71],\r\n\t\"turquoise\": [64, 224, 208],\r\n\t\"violet\": [238, 130, 238],\r\n\t\"wheat\": [245, 222, 179],\r\n\t\"white\": [255, 255, 255],\r\n\t\"whitesmoke\": [245, 245, 245],\r\n\t\"yellow\": [255, 255, 0],\r\n\t\"yellowgreen\": [154, 205, 50]\r\n};\r\n","var conversions = require('./conversions');\n\n/*\n\tthis function routes a model to all other models.\n\n\tall functions that are routed have a property `.conversion` attached\n\tto the returned synthetic function. This property is an array\n\tof strings, each with the steps in between the 'from' and 'to'\n\tcolor models (inclusive).\n\n\tconversions that are not possible simply are not included.\n*/\n\nfunction buildGraph() {\n\tvar graph = {};\n\t// https://jsperf.com/object-keys-vs-for-in-with-closure/3\n\tvar models = Object.keys(conversions);\n\n\tfor (var len = models.length, i = 0; i < len; i++) {\n\t\tgraph[models[i]] = {\n\t\t\t// http://jsperf.com/1-vs-infinity\n\t\t\t// micro-opt, but this is simple.\n\t\t\tdistance: -1,\n\t\t\tparent: null\n\t\t};\n\t}\n\n\treturn graph;\n}\n\n// https://en.wikipedia.org/wiki/Breadth-first_search\nfunction deriveBFS(fromModel) {\n\tvar graph = buildGraph();\n\tvar queue = [fromModel]; // unshift -> queue -> pop\n\n\tgraph[fromModel].distance = 0;\n\n\twhile (queue.length) {\n\t\tvar current = queue.pop();\n\t\tvar adjacents = Object.keys(conversions[current]);\n\n\t\tfor (var len = adjacents.length, i = 0; i < len; i++) {\n\t\t\tvar adjacent = adjacents[i];\n\t\t\tvar node = graph[adjacent];\n\n\t\t\tif (node.distance === -1) {\n\t\t\t\tnode.distance = graph[current].distance + 1;\n\t\t\t\tnode.parent = current;\n\t\t\t\tqueue.unshift(adjacent);\n\t\t\t}\n\t\t}\n\t}\n\n\treturn graph;\n}\n\nfunction link(from, to) {\n\treturn function (args) {\n\t\treturn to(from(args));\n\t};\n}\n\nfunction wrapConversion(toModel, graph) {\n\tvar path = [graph[toModel].parent, toModel];\n\tvar fn = conversions[graph[toModel].parent][toModel];\n\n\tvar cur = graph[toModel].parent;\n\twhile (graph[cur].parent) {\n\t\tpath.unshift(graph[cur].parent);\n\t\tfn = link(conversions[graph[cur].parent][cur], fn);\n\t\tcur = graph[cur].parent;\n\t}\n\n\tfn.conversion = path;\n\treturn fn;\n}\n\nmodule.exports = function (fromModel) {\n\tvar graph = deriveBFS(fromModel);\n\tvar conversion = {};\n\n\tvar models = Object.keys(graph);\n\tfor (var len = models.length, i = 0; i < len; i++) {\n\t\tvar toModel = models[i];\n\t\tvar node = graph[toModel];\n\n\t\tif (node.parent === null) {\n\t\t\t// no possible conversion, or this node is the source model.\n\t\t\tcontinue;\n\t\t}\n\n\t\tconversion[toModel] = wrapConversion(toModel, graph);\n\t}\n\n\treturn conversion;\n};\n\n","'use strict'\r\n\r\nmodule.exports = {\r\n\t\"aliceblue\": [240, 248, 255],\r\n\t\"antiquewhite\": [250, 235, 215],\r\n\t\"aqua\": [0, 255, 255],\r\n\t\"aquamarine\": [127, 255, 212],\r\n\t\"azure\": [240, 255, 255],\r\n\t\"beige\": [245, 245, 220],\r\n\t\"bisque\": [255, 228, 196],\r\n\t\"black\": [0, 0, 0],\r\n\t\"blanchedalmond\": [255, 235, 205],\r\n\t\"blue\": [0, 0, 255],\r\n\t\"blueviolet\": [138, 43, 226],\r\n\t\"brown\": [165, 42, 42],\r\n\t\"burlywood\": [222, 184, 135],\r\n\t\"cadetblue\": [95, 158, 160],\r\n\t\"chartreuse\": [127, 255, 0],\r\n\t\"chocolate\": [210, 105, 30],\r\n\t\"coral\": [255, 127, 80],\r\n\t\"cornflowerblue\": [100, 149, 237],\r\n\t\"cornsilk\": [255, 248, 220],\r\n\t\"crimson\": [220, 20, 60],\r\n\t\"cyan\": [0, 255, 255],\r\n\t\"darkblue\": [0, 0, 139],\r\n\t\"darkcyan\": [0, 139, 139],\r\n\t\"darkgoldenrod\": [184, 134, 11],\r\n\t\"darkgray\": [169, 169, 169],\r\n\t\"darkgreen\": [0, 100, 0],\r\n\t\"darkgrey\": [169, 169, 169],\r\n\t\"darkkhaki\": [189, 183, 107],\r\n\t\"darkmagenta\": [139, 0, 139],\r\n\t\"darkolivegreen\": [85, 107, 47],\r\n\t\"darkorange\": [255, 140, 0],\r\n\t\"darkorchid\": [153, 50, 204],\r\n\t\"darkred\": [139, 0, 0],\r\n\t\"darksalmon\": [233, 150, 122],\r\n\t\"darkseagreen\": [143, 188, 143],\r\n\t\"darkslateblue\": [72, 61, 139],\r\n\t\"darkslategray\": [47, 79, 79],\r\n\t\"darkslategrey\": [47, 79, 79],\r\n\t\"darkturquoise\": [0, 206, 209],\r\n\t\"darkviolet\": [148, 0, 211],\r\n\t\"deeppink\": [255, 20, 147],\r\n\t\"deepskyblue\": [0, 191, 255],\r\n\t\"dimgray\": [105, 105, 105],\r\n\t\"dimgrey\": [105, 105, 105],\r\n\t\"dodgerblue\": [30, 144, 255],\r\n\t\"firebrick\": [178, 34, 34],\r\n\t\"floralwhite\": [255, 250, 240],\r\n\t\"forestgreen\": [34, 139, 34],\r\n\t\"fuchsia\": [255, 0, 255],\r\n\t\"gainsboro\": [220, 220, 220],\r\n\t\"ghostwhite\": [248, 248, 255],\r\n\t\"gold\": [255, 215, 0],\r\n\t\"goldenrod\": [218, 165, 32],\r\n\t\"gray\": [128, 128, 128],\r\n\t\"green\": [0, 128, 0],\r\n\t\"greenyellow\": [173, 255, 47],\r\n\t\"grey\": [128, 128, 128],\r\n\t\"honeydew\": [240, 255, 240],\r\n\t\"hotpink\": [255, 105, 180],\r\n\t\"indianred\": [205, 92, 92],\r\n\t\"indigo\": [75, 0, 130],\r\n\t\"ivory\": [255, 255, 240],\r\n\t\"khaki\": [240, 230, 140],\r\n\t\"lavender\": [230, 230, 250],\r\n\t\"lavenderblush\": [255, 240, 245],\r\n\t\"lawngreen\": [124, 252, 0],\r\n\t\"lemonchiffon\": [255, 250, 205],\r\n\t\"lightblue\": [173, 216, 230],\r\n\t\"lightcoral\": [240, 128, 128],\r\n\t\"lightcyan\": [224, 255, 255],\r\n\t\"lightgoldenrodyellow\": [250, 250, 210],\r\n\t\"lightgray\": [211, 211, 211],\r\n\t\"lightgreen\": [144, 238, 144],\r\n\t\"lightgrey\": [211, 211, 211],\r\n\t\"lightpink\": [255, 182, 193],\r\n\t\"lightsalmon\": [255, 160, 122],\r\n\t\"lightseagreen\": [32, 178, 170],\r\n\t\"lightskyblue\": [135, 206, 250],\r\n\t\"lightslategray\": [119, 136, 153],\r\n\t\"lightslategrey\": [119, 136, 153],\r\n\t\"lightsteelblue\": [176, 196, 222],\r\n\t\"lightyellow\": [255, 255, 224],\r\n\t\"lime\": [0, 255, 0],\r\n\t\"limegreen\": [50, 205, 50],\r\n\t\"linen\": [250, 240, 230],\r\n\t\"magenta\": [255, 0, 255],\r\n\t\"maroon\": [128, 0, 0],\r\n\t\"mediumaquamarine\": [102, 205, 170],\r\n\t\"mediumblue\": [0, 0, 205],\r\n\t\"mediumorchid\": [186, 85, 211],\r\n\t\"mediumpurple\": [147, 112, 219],\r\n\t\"mediumseagreen\": [60, 179, 113],\r\n\t\"mediumslateblue\": [123, 104, 238],\r\n\t\"mediumspringgreen\": [0, 250, 154],\r\n\t\"mediumturquoise\": [72, 209, 204],\r\n\t\"mediumvioletred\": [199, 21, 133],\r\n\t\"midnightblue\": [25, 25, 112],\r\n\t\"mintcream\": [245, 255, 250],\r\n\t\"mistyrose\": [255, 228, 225],\r\n\t\"moccasin\": [255, 228, 181],\r\n\t\"navajowhite\": [255, 222, 173],\r\n\t\"navy\": [0, 0, 128],\r\n\t\"oldlace\": [253, 245, 230],\r\n\t\"olive\": [128, 128, 0],\r\n\t\"olivedrab\": [107, 142, 35],\r\n\t\"orange\": [255, 165, 0],\r\n\t\"orangered\": [255, 69, 0],\r\n\t\"orchid\": [218, 112, 214],\r\n\t\"palegoldenrod\": [238, 232, 170],\r\n\t\"palegreen\": [152, 251, 152],\r\n\t\"paleturquoise\": [175, 238, 238],\r\n\t\"palevioletred\": [219, 112, 147],\r\n\t\"papayawhip\": [255, 239, 213],\r\n\t\"peachpuff\": [255, 218, 185],\r\n\t\"peru\": [205, 133, 63],\r\n\t\"pink\": [255, 192, 203],\r\n\t\"plum\": [221, 160, 221],\r\n\t\"powderblue\": [176, 224, 230],\r\n\t\"purple\": [128, 0, 128],\r\n\t\"rebeccapurple\": [102, 51, 153],\r\n\t\"red\": [255, 0, 0],\r\n\t\"rosybrown\": [188, 143, 143],\r\n\t\"royalblue\": [65, 105, 225],\r\n\t\"saddlebrown\": [139, 69, 19],\r\n\t\"salmon\": [250, 128, 114],\r\n\t\"sandybrown\": [244, 164, 96],\r\n\t\"seagreen\": [46, 139, 87],\r\n\t\"seashell\": [255, 245, 238],\r\n\t\"sienna\": [160, 82, 45],\r\n\t\"silver\": [192, 192, 192],\r\n\t\"skyblue\": [135, 206, 235],\r\n\t\"slateblue\": [106, 90, 205],\r\n\t\"slategray\": [112, 128, 144],\r\n\t\"slategrey\": [112, 128, 144],\r\n\t\"snow\": [255, 250, 250],\r\n\t\"springgreen\": [0, 255, 127],\r\n\t\"steelblue\": [70, 130, 180],\r\n\t\"tan\": [210, 180, 140],\r\n\t\"teal\": [0, 128, 128],\r\n\t\"thistle\": [216, 191, 216],\r\n\t\"tomato\": [255, 99, 71],\r\n\t\"turquoise\": [64, 224, 208],\r\n\t\"violet\": [238, 130, 238],\r\n\t\"wheat\": [245, 222, 179],\r\n\t\"white\": [255, 255, 255],\r\n\t\"whitesmoke\": [245, 245, 245],\r\n\t\"yellow\": [255, 255, 0],\r\n\t\"yellowgreen\": [154, 205, 50]\r\n};\r\n","/* MIT license */\nvar colorNames = require('color-name');\nvar swizzle = require('simple-swizzle');\nvar hasOwnProperty = Object.hasOwnProperty;\n\nvar reverseNames = Object.create(null);\n\n// create a list of reverse color names\nfor (var name in colorNames) {\n\tif (hasOwnProperty.call(colorNames, name)) {\n\t\treverseNames[colorNames[name]] = name;\n\t}\n}\n\nvar cs = module.exports = {\n\tto: {},\n\tget: {}\n};\n\ncs.get = function (string) {\n\tvar prefix = string.substring(0, 3).toLowerCase();\n\tvar val;\n\tvar model;\n\tswitch (prefix) {\n\t\tcase 'hsl':\n\t\t\tval = cs.get.hsl(string);\n\t\t\tmodel = 'hsl';\n\t\t\tbreak;\n\t\tcase 'hwb':\n\t\t\tval = cs.get.hwb(string);\n\t\t\tmodel = 'hwb';\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tval = cs.get.rgb(string);\n\t\t\tmodel = 'rgb';\n\t\t\tbreak;\n\t}\n\n\tif (!val) {\n\t\treturn null;\n\t}\n\n\treturn {model: model, value: val};\n};\n\ncs.get.rgb = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar abbr = /^#([a-f0-9]{3,4})$/i;\n\tvar hex = /^#([a-f0-9]{6})([a-f0-9]{2})?$/i;\n\tvar rgba = /^rgba?\\(\\s*([+-]?\\d+)(?=[\\s,])\\s*(?:,\\s*)?([+-]?\\d+)(?=[\\s,])\\s*(?:,\\s*)?([+-]?\\d+)\\s*(?:[,|\\/]\\s*([+-]?[\\d\\.]+)(%?)\\s*)?\\)$/;\n\tvar per = /^rgba?\\(\\s*([+-]?[\\d\\.]+)\\%\\s*,?\\s*([+-]?[\\d\\.]+)\\%\\s*,?\\s*([+-]?[\\d\\.]+)\\%\\s*(?:[,|\\/]\\s*([+-]?[\\d\\.]+)(%?)\\s*)?\\)$/;\n\tvar keyword = /^(\\w+)$/;\n\n\tvar rgb = [0, 0, 0, 1];\n\tvar match;\n\tvar i;\n\tvar hexAlpha;\n\n\tif (match = string.match(hex)) {\n\t\thexAlpha = match[2];\n\t\tmatch = match[1];\n\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\t// https://jsperf.com/slice-vs-substr-vs-substring-methods-long-string/19\n\t\t\tvar i2 = i * 2;\n\t\t\trgb[i] = parseInt(match.slice(i2, i2 + 2), 16);\n\t\t}\n\n\t\tif (hexAlpha) {\n\t\t\trgb[3] = parseInt(hexAlpha, 16) / 255;\n\t\t}\n\t} else if (match = string.match(abbr)) {\n\t\tmatch = match[1];\n\t\thexAlpha = match[3];\n\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = parseInt(match[i] + match[i], 16);\n\t\t}\n\n\t\tif (hexAlpha) {\n\t\t\trgb[3] = parseInt(hexAlpha + hexAlpha, 16) / 255;\n\t\t}\n\t} else if (match = string.match(rgba)) {\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = parseInt(match[i + 1], 0);\n\t\t}\n\n\t\tif (match[4]) {\n\t\t\tif (match[5]) {\n\t\t\t\trgb[3] = parseFloat(match[4]) * 0.01;\n\t\t\t} else {\n\t\t\t\trgb[3] = parseFloat(match[4]);\n\t\t\t}\n\t\t}\n\t} else if (match = string.match(per)) {\n\t\tfor (i = 0; i < 3; i++) {\n\t\t\trgb[i] = Math.round(parseFloat(match[i + 1]) * 2.55);\n\t\t}\n\n\t\tif (match[4]) {\n\t\t\tif (match[5]) {\n\t\t\t\trgb[3] = parseFloat(match[4]) * 0.01;\n\t\t\t} else {\n\t\t\t\trgb[3] = parseFloat(match[4]);\n\t\t\t}\n\t\t}\n\t} else if (match = string.match(keyword)) {\n\t\tif (match[1] === 'transparent') {\n\t\t\treturn [0, 0, 0, 0];\n\t\t}\n\n\t\tif (!hasOwnProperty.call(colorNames, match[1])) {\n\t\t\treturn null;\n\t\t}\n\n\t\trgb = colorNames[match[1]];\n\t\trgb[3] = 1;\n\n\t\treturn rgb;\n\t} else {\n\t\treturn null;\n\t}\n\n\tfor (i = 0; i < 3; i++) {\n\t\trgb[i] = clamp(rgb[i], 0, 255);\n\t}\n\trgb[3] = clamp(rgb[3], 0, 1);\n\n\treturn rgb;\n};\n\ncs.get.hsl = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar hsl = /^hsla?\\(\\s*([+-]?(?:\\d{0,3}\\.)?\\d+)(?:deg)?\\s*,?\\s*([+-]?[\\d\\.]+)%\\s*,?\\s*([+-]?[\\d\\.]+)%\\s*(?:[,|\\/]\\s*([+-]?(?=\\.\\d|\\d)(?:0|[1-9]\\d*)?(?:\\.\\d*)?(?:[eE][+-]?\\d+)?)\\s*)?\\)$/;\n\tvar match = string.match(hsl);\n\n\tif (match) {\n\t\tvar alpha = parseFloat(match[4]);\n\t\tvar h = ((parseFloat(match[1]) % 360) + 360) % 360;\n\t\tvar s = clamp(parseFloat(match[2]), 0, 100);\n\t\tvar l = clamp(parseFloat(match[3]), 0, 100);\n\t\tvar a = clamp(isNaN(alpha) ? 1 : alpha, 0, 1);\n\n\t\treturn [h, s, l, a];\n\t}\n\n\treturn null;\n};\n\ncs.get.hwb = function (string) {\n\tif (!string) {\n\t\treturn null;\n\t}\n\n\tvar hwb = /^hwb\\(\\s*([+-]?\\d{0,3}(?:\\.\\d+)?)(?:deg)?\\s*,\\s*([+-]?[\\d\\.]+)%\\s*,\\s*([+-]?[\\d\\.]+)%\\s*(?:,\\s*([+-]?(?=\\.\\d|\\d)(?:0|[1-9]\\d*)?(?:\\.\\d*)?(?:[eE][+-]?\\d+)?)\\s*)?\\)$/;\n\tvar match = string.match(hwb);\n\n\tif (match) {\n\t\tvar alpha = parseFloat(match[4]);\n\t\tvar h = ((parseFloat(match[1]) % 360) + 360) % 360;\n\t\tvar w = clamp(parseFloat(match[2]), 0, 100);\n\t\tvar b = clamp(parseFloat(match[3]), 0, 100);\n\t\tvar a = clamp(isNaN(alpha) ? 1 : alpha, 0, 1);\n\t\treturn [h, w, b, a];\n\t}\n\n\treturn null;\n};\n\ncs.to.hex = function () {\n\tvar rgba = swizzle(arguments);\n\n\treturn (\n\t\t'#' +\n\t\thexDouble(rgba[0]) +\n\t\thexDouble(rgba[1]) +\n\t\thexDouble(rgba[2]) +\n\t\t(rgba[3] < 1\n\t\t\t? (hexDouble(Math.round(rgba[3] * 255)))\n\t\t\t: '')\n\t);\n};\n\ncs.to.rgb = function () {\n\tvar rgba = swizzle(arguments);\n\n\treturn rgba.length < 4 || rgba[3] === 1\n\t\t? 'rgb(' + Math.round(rgba[0]) + ', ' + Math.round(rgba[1]) + ', ' + Math.round(rgba[2]) + ')'\n\t\t: 'rgba(' + Math.round(rgba[0]) + ', ' + Math.round(rgba[1]) + ', ' + Math.round(rgba[2]) + ', ' + rgba[3] + ')';\n};\n\ncs.to.rgb.percent = function () {\n\tvar rgba = swizzle(arguments);\n\n\tvar r = Math.round(rgba[0] / 255 * 100);\n\tvar g = Math.round(rgba[1] / 255 * 100);\n\tvar b = Math.round(rgba[2] / 255 * 100);\n\n\treturn rgba.length < 4 || rgba[3] === 1\n\t\t? 'rgb(' + r + '%, ' + g + '%, ' + b + '%)'\n\t\t: 'rgba(' + r + '%, ' + g + '%, ' + b + '%, ' + rgba[3] + ')';\n};\n\ncs.to.hsl = function () {\n\tvar hsla = swizzle(arguments);\n\treturn hsla.length < 4 || hsla[3] === 1\n\t\t? 'hsl(' + hsla[0] + ', ' + hsla[1] + '%, ' + hsla[2] + '%)'\n\t\t: 'hsla(' + hsla[0] + ', ' + hsla[1] + '%, ' + hsla[2] + '%, ' + hsla[3] + ')';\n};\n\n// hwb is a bit different than rgb(a) & hsl(a) since there is no alpha specific syntax\n// (hwb have alpha optional & 1 is default value)\ncs.to.hwb = function () {\n\tvar hwba = swizzle(arguments);\n\n\tvar a = '';\n\tif (hwba.length >= 4 && hwba[3] !== 1) {\n\t\ta = ', ' + hwba[3];\n\t}\n\n\treturn 'hwb(' + hwba[0] + ', ' + hwba[1] + '%, ' + hwba[2] + '%' + a + ')';\n};\n\ncs.to.keyword = function (rgb) {\n\treturn reverseNames[rgb.slice(0, 3)];\n};\n\n// helpers\nfunction clamp(num, min, max) {\n\treturn Math.min(Math.max(min, num), max);\n}\n\nfunction hexDouble(num) {\n\tvar str = Math.round(num).toString(16).toUpperCase();\n\treturn (str.length < 2) ? '0' + str : str;\n}\n","const colorString = require('color-string');\nconst convert = require('color-convert');\n\nconst skippedModels = [\n\t// To be honest, I don't really feel like keyword belongs in color convert, but eh.\n\t'keyword',\n\n\t// Gray conflicts with some method names, and has its own method defined.\n\t'gray',\n\n\t// Shouldn't really be in color-convert either...\n\t'hex',\n];\n\nconst hashedModelKeys = {};\nfor (const model of Object.keys(convert)) {\n\thashedModelKeys[[...convert[model].labels].sort().join('')] = model;\n}\n\nconst limiters = {};\n\nfunction Color(object, model) {\n\tif (!(this instanceof Color)) {\n\t\treturn new Color(object, model);\n\t}\n\n\tif (model && model in skippedModels) {\n\t\tmodel = null;\n\t}\n\n\tif (model && !(model in convert)) {\n\t\tthrow new Error('Unknown model: ' + model);\n\t}\n\n\tlet i;\n\tlet channels;\n\n\tif (object == null) { // eslint-disable-line no-eq-null,eqeqeq\n\t\tthis.model = 'rgb';\n\t\tthis.color = [0, 0, 0];\n\t\tthis.valpha = 1;\n\t} else if (object instanceof Color) {\n\t\tthis.model = object.model;\n\t\tthis.color = [...object.color];\n\t\tthis.valpha = object.valpha;\n\t} else if (typeof object === 'string') {\n\t\tconst result = colorString.get(object);\n\t\tif (result === null) {\n\t\t\tthrow new Error('Unable to parse color from string: ' + object);\n\t\t}\n\n\t\tthis.model = result.model;\n\t\tchannels = convert[this.model].channels;\n\t\tthis.color = result.value.slice(0, channels);\n\t\tthis.valpha = typeof result.value[channels] === 'number' ? result.value[channels] : 1;\n\t} else if (object.length > 0) {\n\t\tthis.model = model || 'rgb';\n\t\tchannels = convert[this.model].channels;\n\t\tconst newArray = Array.prototype.slice.call(object, 0, channels);\n\t\tthis.color = zeroArray(newArray, channels);\n\t\tthis.valpha = typeof object[channels] === 'number' ? object[channels] : 1;\n\t} else if (typeof object === 'number') {\n\t\t// This is always RGB - can be converted later on.\n\t\tthis.model = 'rgb';\n\t\tthis.color = [\n\t\t\t(object >> 16) & 0xFF,\n\t\t\t(object >> 8) & 0xFF,\n\t\t\tobject & 0xFF,\n\t\t];\n\t\tthis.valpha = 1;\n\t} else {\n\t\tthis.valpha = 1;\n\n\t\tconst keys = Object.keys(object);\n\t\tif ('alpha' in object) {\n\t\t\tkeys.splice(keys.indexOf('alpha'), 1);\n\t\t\tthis.valpha = typeof object.alpha === 'number' ? object.alpha : 0;\n\t\t}\n\n\t\tconst hashedKeys = keys.sort().join('');\n\t\tif (!(hashedKeys in hashedModelKeys)) {\n\t\t\tthrow new Error('Unable to parse color from object: ' + JSON.stringify(object));\n\t\t}\n\n\t\tthis.model = hashedModelKeys[hashedKeys];\n\n\t\tconst {labels} = convert[this.model];\n\t\tconst color = [];\n\t\tfor (i = 0; i < labels.length; i++) {\n\t\t\tcolor.push(object[labels[i]]);\n\t\t}\n\n\t\tthis.color = zeroArray(color);\n\t}\n\n\t// Perform limitations (clamping, etc.)\n\tif (limiters[this.model]) {\n\t\tchannels = convert[this.model].channels;\n\t\tfor (i = 0; i < channels; i++) {\n\t\t\tconst limit = limiters[this.model][i];\n\t\t\tif (limit) {\n\t\t\t\tthis.color[i] = limit(this.color[i]);\n\t\t\t}\n\t\t}\n\t}\n\n\tthis.valpha = Math.max(0, Math.min(1, this.valpha));\n\n\tif (Object.freeze) {\n\t\tObject.freeze(this);\n\t}\n}\n\nColor.prototype = {\n\ttoString() {\n\t\treturn this.string();\n\t},\n\n\ttoJSON() {\n\t\treturn this[this.model]();\n\t},\n\n\tstring(places) {\n\t\tlet self = this.model in colorString.to ? this : this.rgb();\n\t\tself = self.round(typeof places === 'number' ? places : 1);\n\t\tconst args = self.valpha === 1 ? self.color : [...self.color, this.valpha];\n\t\treturn colorString.to[self.model](args);\n\t},\n\n\tpercentString(places) {\n\t\tconst self = this.rgb().round(typeof places === 'number' ? places : 1);\n\t\tconst args = self.valpha === 1 ? self.color : [...self.color, this.valpha];\n\t\treturn colorString.to.rgb.percent(args);\n\t},\n\n\tarray() {\n\t\treturn this.valpha === 1 ? [...this.color] : [...this.color, this.valpha];\n\t},\n\n\tobject() {\n\t\tconst result = {};\n\t\tconst {channels} = convert[this.model];\n\t\tconst {labels} = convert[this.model];\n\n\t\tfor (let i = 0; i < channels; i++) {\n\t\t\tresult[labels[i]] = this.color[i];\n\t\t}\n\n\t\tif (this.valpha !== 1) {\n\t\t\tresult.alpha = this.valpha;\n\t\t}\n\n\t\treturn result;\n\t},\n\n\tunitArray() {\n\t\tconst rgb = this.rgb().color;\n\t\trgb[0] /= 255;\n\t\trgb[1] /= 255;\n\t\trgb[2] /= 255;\n\n\t\tif (this.valpha !== 1) {\n\t\t\trgb.push(this.valpha);\n\t\t}\n\n\t\treturn rgb;\n\t},\n\n\tunitObject() {\n\t\tconst rgb = this.rgb().object();\n\t\trgb.r /= 255;\n\t\trgb.g /= 255;\n\t\trgb.b /= 255;\n\n\t\tif (this.valpha !== 1) {\n\t\t\trgb.alpha = this.valpha;\n\t\t}\n\n\t\treturn rgb;\n\t},\n\n\tround(places) {\n\t\tplaces = Math.max(places || 0, 0);\n\t\treturn new Color([...this.color.map(roundToPlace(places)), this.valpha], this.model);\n\t},\n\n\talpha(value) {\n\t\tif (value !== undefined) {\n\t\t\treturn new Color([...this.color, Math.max(0, Math.min(1, value))], this.model);\n\t\t}\n\n\t\treturn this.valpha;\n\t},\n\n\t// Rgb\n\tred: getset('rgb', 0, maxfn(255)),\n\tgreen: getset('rgb', 1, maxfn(255)),\n\tblue: getset('rgb', 2, maxfn(255)),\n\n\thue: getset(['hsl', 'hsv', 'hsl', 'hwb', 'hcg'], 0, value => ((value % 360) + 360) % 360),\n\n\tsaturationl: getset('hsl', 1, maxfn(100)),\n\tlightness: getset('hsl', 2, maxfn(100)),\n\n\tsaturationv: getset('hsv', 1, maxfn(100)),\n\tvalue: getset('hsv', 2, maxfn(100)),\n\n\tchroma: getset('hcg', 1, maxfn(100)),\n\tgray: getset('hcg', 2, maxfn(100)),\n\n\twhite: getset('hwb', 1, maxfn(100)),\n\twblack: getset('hwb', 2, maxfn(100)),\n\n\tcyan: getset('cmyk', 0, maxfn(100)),\n\tmagenta: getset('cmyk', 1, maxfn(100)),\n\tyellow: getset('cmyk', 2, maxfn(100)),\n\tblack: getset('cmyk', 3, maxfn(100)),\n\n\tx: getset('xyz', 0, maxfn(95.047)),\n\ty: getset('xyz', 1, maxfn(100)),\n\tz: getset('xyz', 2, maxfn(108.833)),\n\n\tl: getset('lab', 0, maxfn(100)),\n\ta: getset('lab', 1),\n\tb: getset('lab', 2),\n\n\tkeyword(value) {\n\t\tif (value !== undefined) {\n\t\t\treturn new Color(value);\n\t\t}\n\n\t\treturn convert[this.model].keyword(this.color);\n\t},\n\n\thex(value) {\n\t\tif (value !== undefined) {\n\t\t\treturn new Color(value);\n\t\t}\n\n\t\treturn colorString.to.hex(this.rgb().round().color);\n\t},\n\n\thexa(value) {\n\t\tif (value !== undefined) {\n\t\t\treturn new Color(value);\n\t\t}\n\n\t\tconst rgbArray = this.rgb().round().color;\n\n\t\tlet alphaHex = Math.round(this.valpha * 255).toString(16).toUpperCase();\n\t\tif (alphaHex.length === 1) {\n\t\t\talphaHex = '0' + alphaHex;\n\t\t}\n\n\t\treturn colorString.to.hex(rgbArray) + alphaHex;\n\t},\n\n\trgbNumber() {\n\t\tconst rgb = this.rgb().color;\n\t\treturn ((rgb[0] & 0xFF) << 16) | ((rgb[1] & 0xFF) << 8) | (rgb[2] & 0xFF);\n\t},\n\n\tluminosity() {\n\t\t// http://www.w3.org/TR/WCAG20/#relativeluminancedef\n\t\tconst rgb = this.rgb().color;\n\n\t\tconst lum = [];\n\t\tfor (const [i, element] of rgb.entries()) {\n\t\t\tconst chan = element / 255;\n\t\t\tlum[i] = (chan <= 0.04045) ? chan / 12.92 : ((chan + 0.055) / 1.055) ** 2.4;\n\t\t}\n\n\t\treturn 0.2126 * lum[0] + 0.7152 * lum[1] + 0.0722 * lum[2];\n\t},\n\n\tcontrast(color2) {\n\t\t// http://www.w3.org/TR/WCAG20/#contrast-ratiodef\n\t\tconst lum1 = this.luminosity();\n\t\tconst lum2 = color2.luminosity();\n\n\t\tif (lum1 > lum2) {\n\t\t\treturn (lum1 + 0.05) / (lum2 + 0.05);\n\t\t}\n\n\t\treturn (lum2 + 0.05) / (lum1 + 0.05);\n\t},\n\n\tlevel(color2) {\n\t\t// https://www.w3.org/TR/WCAG/#contrast-enhanced\n\t\tconst contrastRatio = this.contrast(color2);\n\t\tif (contrastRatio >= 7) {\n\t\t\treturn 'AAA';\n\t\t}\n\n\t\treturn (contrastRatio >= 4.5) ? 'AA' : '';\n\t},\n\n\tisDark() {\n\t\t// YIQ equation from http://24ways.org/2010/calculating-color-contrast\n\t\tconst rgb = this.rgb().color;\n\t\tconst yiq = (rgb[0] * 2126 + rgb[1] * 7152 + rgb[2] * 722) / 10000;\n\t\treturn yiq < 128;\n\t},\n\n\tisLight() {\n\t\treturn !this.isDark();\n\t},\n\n\tnegate() {\n\t\tconst rgb = this.rgb();\n\t\tfor (let i = 0; i < 3; i++) {\n\t\t\trgb.color[i] = 255 - rgb.color[i];\n\t\t}\n\n\t\treturn rgb;\n\t},\n\n\tlighten(ratio) {\n\t\tconst hsl = this.hsl();\n\t\thsl.color[2] += hsl.color[2] * ratio;\n\t\treturn hsl;\n\t},\n\n\tdarken(ratio) {\n\t\tconst hsl = this.hsl();\n\t\thsl.color[2] -= hsl.color[2] * ratio;\n\t\treturn hsl;\n\t},\n\n\tsaturate(ratio) {\n\t\tconst hsl = this.hsl();\n\t\thsl.color[1] += hsl.color[1] * ratio;\n\t\treturn hsl;\n\t},\n\n\tdesaturate(ratio) {\n\t\tconst hsl = this.hsl();\n\t\thsl.color[1] -= hsl.color[1] * ratio;\n\t\treturn hsl;\n\t},\n\n\twhiten(ratio) {\n\t\tconst hwb = this.hwb();\n\t\thwb.color[1] += hwb.color[1] * ratio;\n\t\treturn hwb;\n\t},\n\n\tblacken(ratio) {\n\t\tconst hwb = this.hwb();\n\t\thwb.color[2] += hwb.color[2] * ratio;\n\t\treturn hwb;\n\t},\n\n\tgrayscale() {\n\t\t// http://en.wikipedia.org/wiki/Grayscale#Converting_color_to_grayscale\n\t\tconst rgb = this.rgb().color;\n\t\tconst value = rgb[0] * 0.3 + rgb[1] * 0.59 + rgb[2] * 0.11;\n\t\treturn Color.rgb(value, value, value);\n\t},\n\n\tfade(ratio) {\n\t\treturn this.alpha(this.valpha - (this.valpha * ratio));\n\t},\n\n\topaquer(ratio) {\n\t\treturn this.alpha(this.valpha + (this.valpha * ratio));\n\t},\n\n\trotate(degrees) {\n\t\tconst hsl = this.hsl();\n\t\tlet hue = hsl.color[0];\n\t\thue = (hue + degrees) % 360;\n\t\thue = hue < 0 ? 360 + hue : hue;\n\t\thsl.color[0] = hue;\n\t\treturn hsl;\n\t},\n\n\tmix(mixinColor, weight) {\n\t\t// Ported from sass implementation in C\n\t\t// https://github.com/sass/libsass/blob/0e6b4a2850092356aa3ece07c6b249f0221caced/functions.cpp#L209\n\t\tif (!mixinColor || !mixinColor.rgb) {\n\t\t\tthrow new Error('Argument to \"mix\" was not a Color instance, but rather an instance of ' + typeof mixinColor);\n\t\t}\n\n\t\tconst color1 = mixinColor.rgb();\n\t\tconst color2 = this.rgb();\n\t\tconst p = weight === undefined ? 0.5 : weight;\n\n\t\tconst w = 2 * p - 1;\n\t\tconst a = color1.alpha() - color2.alpha();\n\n\t\tconst w1 = (((w * a === -1) ? w : (w + a) / (1 + w * a)) + 1) / 2;\n\t\tconst w2 = 1 - w1;\n\n\t\treturn Color.rgb(\n\t\t\tw1 * color1.red() + w2 * color2.red(),\n\t\t\tw1 * color1.green() + w2 * color2.green(),\n\t\t\tw1 * color1.blue() + w2 * color2.blue(),\n\t\t\tcolor1.alpha() * p + color2.alpha() * (1 - p));\n\t},\n};\n\n// Model conversion methods and static constructors\nfor (const model of Object.keys(convert)) {\n\tif (skippedModels.includes(model)) {\n\t\tcontinue;\n\t}\n\n\tconst {channels} = convert[model];\n\n\t// Conversion methods\n\tColor.prototype[model] = function (...args) {\n\t\tif (this.model === model) {\n\t\t\treturn new Color(this);\n\t\t}\n\n\t\tif (args.length > 0) {\n\t\t\treturn new Color(args, model);\n\t\t}\n\n\t\treturn new Color([...assertArray(convert[this.model][model].raw(this.color)), this.valpha], model);\n\t};\n\n\t// 'static' construction methods\n\tColor[model] = function (...args) {\n\t\tlet color = args[0];\n\t\tif (typeof color === 'number') {\n\t\t\tcolor = zeroArray(args, channels);\n\t\t}\n\n\t\treturn new Color(color, model);\n\t};\n}\n\nfunction roundTo(number, places) {\n\treturn Number(number.toFixed(places));\n}\n\nfunction roundToPlace(places) {\n\treturn function (number) {\n\t\treturn roundTo(number, places);\n\t};\n}\n\nfunction getset(model, channel, modifier) {\n\tmodel = Array.isArray(model) ? model : [model];\n\n\tfor (const m of model) {\n\t\t(limiters[m] || (limiters[m] = []))[channel] = modifier;\n\t}\n\n\tmodel = model[0];\n\n\treturn function (value) {\n\t\tlet result;\n\n\t\tif (value !== undefined) {\n\t\t\tif (modifier) {\n\t\t\t\tvalue = modifier(value);\n\t\t\t}\n\n\t\t\tresult = this[model]();\n\t\t\tresult.color[channel] = value;\n\t\t\treturn result;\n\t\t}\n\n\t\tresult = this[model]().color[channel];\n\t\tif (modifier) {\n\t\t\tresult = modifier(result);\n\t\t}\n\n\t\treturn result;\n\t};\n}\n\nfunction maxfn(max) {\n\treturn function (v) {\n\t\treturn Math.max(0, Math.min(max, v));\n\t};\n}\n\nfunction assertArray(value) {\n\treturn Array.isArray(value) ? value : [value];\n}\n\nfunction zeroArray(array, length) {\n\tfor (let i = 0; i < length; i++) {\n\t\tif (typeof array[i] !== 'number') {\n\t\t\tarray[i] = 0;\n\t\t}\n\t}\n\n\treturn array;\n}\n\nmodule.exports = Color;\n","/* MIT license */\n/* eslint-disable no-mixed-operators */\nconst cssKeywords = require('color-name');\n\n// NOTE: conversions should only return primitive values (i.e. arrays, or\n// values that give correct `typeof` results).\n// do not use box values types (i.e. Number(), String(), etc.)\n\nconst reverseKeywords = {};\nfor (const key of Object.keys(cssKeywords)) {\n\treverseKeywords[cssKeywords[key]] = key;\n}\n\nconst convert = {\n\trgb: {channels: 3, labels: 'rgb'},\n\thsl: {channels: 3, labels: 'hsl'},\n\thsv: {channels: 3, labels: 'hsv'},\n\thwb: {channels: 3, labels: 'hwb'},\n\tcmyk: {channels: 4, labels: 'cmyk'},\n\txyz: {channels: 3, labels: 'xyz'},\n\tlab: {channels: 3, labels: 'lab'},\n\tlch: {channels: 3, labels: 'lch'},\n\thex: {channels: 1, labels: ['hex']},\n\tkeyword: {channels: 1, labels: ['keyword']},\n\tansi16: {channels: 1, labels: ['ansi16']},\n\tansi256: {channels: 1, labels: ['ansi256']},\n\thcg: {channels: 3, labels: ['h', 'c', 'g']},\n\tapple: {channels: 3, labels: ['r16', 'g16', 'b16']},\n\tgray: {channels: 1, labels: ['gray']}\n};\n\nmodule.exports = convert;\n\n// Hide .channels and .labels properties\nfor (const model of Object.keys(convert)) {\n\tif (!('channels' in convert[model])) {\n\t\tthrow new Error('missing channels property: ' + model);\n\t}\n\n\tif (!('labels' in convert[model])) {\n\t\tthrow new Error('missing channel labels property: ' + model);\n\t}\n\n\tif (convert[model].labels.length !== convert[model].channels) {\n\t\tthrow new Error('channel and label counts mismatch: ' + model);\n\t}\n\n\tconst {channels, labels} = convert[model];\n\tdelete convert[model].channels;\n\tdelete convert[model].labels;\n\tObject.defineProperty(convert[model], 'channels', {value: channels});\n\tObject.defineProperty(convert[model], 'labels', {value: labels});\n}\n\nconvert.rgb.hsl = function (rgb) {\n\tconst r = rgb[0] / 255;\n\tconst g = rgb[1] / 255;\n\tconst b = rgb[2] / 255;\n\tconst min = Math.min(r, g, b);\n\tconst max = Math.max(r, g, b);\n\tconst delta = max - min;\n\tlet h;\n\tlet s;\n\n\tif (max === min) {\n\t\th = 0;\n\t} else if (r === max) {\n\t\th = (g - b) / delta;\n\t} else if (g === max) {\n\t\th = 2 + (b - r) / delta;\n\t} else if (b === max) {\n\t\th = 4 + (r - g) / delta;\n\t}\n\n\th = Math.min(h * 60, 360);\n\n\tif (h < 0) {\n\t\th += 360;\n\t}\n\n\tconst l = (min + max) / 2;\n\n\tif (max === min) {\n\t\ts = 0;\n\t} else if (l <= 0.5) {\n\t\ts = delta / (max + min);\n\t} else {\n\t\ts = delta / (2 - max - min);\n\t}\n\n\treturn [h, s * 100, l * 100];\n};\n\nconvert.rgb.hsv = function (rgb) {\n\tlet rdif;\n\tlet gdif;\n\tlet bdif;\n\tlet h;\n\tlet s;\n\n\tconst r = rgb[0] / 255;\n\tconst g = rgb[1] / 255;\n\tconst b = rgb[2] / 255;\n\tconst v = Math.max(r, g, b);\n\tconst diff = v - Math.min(r, g, b);\n\tconst diffc = function (c) {\n\t\treturn (v - c) / 6 / diff + 1 / 2;\n\t};\n\n\tif (diff === 0) {\n\t\th = 0;\n\t\ts = 0;\n\t} else {\n\t\ts = diff / v;\n\t\trdif = diffc(r);\n\t\tgdif = diffc(g);\n\t\tbdif = diffc(b);\n\n\t\tif (r === v) {\n\t\t\th = bdif - gdif;\n\t\t} else if (g === v) {\n\t\t\th = (1 / 3) + rdif - bdif;\n\t\t} else if (b === v) {\n\t\t\th = (2 / 3) + gdif - rdif;\n\t\t}\n\n\t\tif (h < 0) {\n\t\t\th += 1;\n\t\t} else if (h > 1) {\n\t\t\th -= 1;\n\t\t}\n\t}\n\n\treturn [\n\t\th * 360,\n\t\ts * 100,\n\t\tv * 100\n\t];\n};\n\nconvert.rgb.hwb = function (rgb) {\n\tconst r = rgb[0];\n\tconst g = rgb[1];\n\tlet b = rgb[2];\n\tconst h = convert.rgb.hsl(rgb)[0];\n\tconst w = 1 / 255 * Math.min(r, Math.min(g, b));\n\n\tb = 1 - 1 / 255 * Math.max(r, Math.max(g, b));\n\n\treturn [h, w * 100, b * 100];\n};\n\nconvert.rgb.cmyk = function (rgb) {\n\tconst r = rgb[0] / 255;\n\tconst g = rgb[1] / 255;\n\tconst b = rgb[2] / 255;\n\n\tconst k = Math.min(1 - r, 1 - g, 1 - b);\n\tconst c = (1 - r - k) / (1 - k) || 0;\n\tconst m = (1 - g - k) / (1 - k) || 0;\n\tconst y = (1 - b - k) / (1 - k) || 0;\n\n\treturn [c * 100, m * 100, y * 100, k * 100];\n};\n\nfunction comparativeDistance(x, y) {\n\t/*\n\t\tSee https://en.m.wikipedia.org/wiki/Euclidean_distance#Squared_Euclidean_distance\n\t*/\n\treturn (\n\t\t((x[0] - y[0]) ** 2) +\n\t\t((x[1] - y[1]) ** 2) +\n\t\t((x[2] - y[2]) ** 2)\n\t);\n}\n\nconvert.rgb.keyword = function (rgb) {\n\tconst reversed = reverseKeywords[rgb];\n\tif (reversed) {\n\t\treturn reversed;\n\t}\n\n\tlet currentClosestDistance = Infinity;\n\tlet currentClosestKeyword;\n\n\tfor (const keyword of Object.keys(cssKeywords)) {\n\t\tconst value = cssKeywords[keyword];\n\n\t\t// Compute comparative distance\n\t\tconst distance = comparativeDistance(rgb, value);\n\n\t\t// Check if its less, if so set as closest\n\t\tif (distance < currentClosestDistance) {\n\t\t\tcurrentClosestDistance = distance;\n\t\t\tcurrentClosestKeyword = keyword;\n\t\t}\n\t}\n\n\treturn currentClosestKeyword;\n};\n\nconvert.keyword.rgb = function (keyword) {\n\treturn cssKeywords[keyword];\n};\n\nconvert.rgb.xyz = function (rgb) {\n\tlet r = rgb[0] / 255;\n\tlet g = rgb[1] / 255;\n\tlet b = rgb[2] / 255;\n\n\t// Assume sRGB\n\tr = r > 0.04045 ? (((r + 0.055) / 1.055) ** 2.4) : (r / 12.92);\n\tg = g > 0.04045 ? (((g + 0.055) / 1.055) ** 2.4) : (g / 12.92);\n\tb = b > 0.04045 ? (((b + 0.055) / 1.055) ** 2.4) : (b / 12.92);\n\n\tconst x = (r * 0.4124) + (g * 0.3576) + (b * 0.1805);\n\tconst y = (r * 0.2126) + (g * 0.7152) + (b * 0.0722);\n\tconst z = (r * 0.0193) + (g * 0.1192) + (b * 0.9505);\n\n\treturn [x * 100, y * 100, z * 100];\n};\n\nconvert.rgb.lab = function (rgb) {\n\tconst xyz = convert.rgb.xyz(rgb);\n\tlet x = xyz[0];\n\tlet y = xyz[1];\n\tlet z = xyz[2];\n\n\tx /= 95.047;\n\ty /= 100;\n\tz /= 108.883;\n\n\tx = x > 0.008856 ? (x ** (1 / 3)) : (7.787 * x) + (16 / 116);\n\ty = y > 0.008856 ? (y ** (1 / 3)) : (7.787 * y) + (16 / 116);\n\tz = z > 0.008856 ? (z ** (1 / 3)) : (7.787 * z) + (16 / 116);\n\n\tconst l = (116 * y) - 16;\n\tconst a = 500 * (x - y);\n\tconst b = 200 * (y - z);\n\n\treturn [l, a, b];\n};\n\nconvert.hsl.rgb = function (hsl) {\n\tconst h = hsl[0] / 360;\n\tconst s = hsl[1] / 100;\n\tconst l = hsl[2] / 100;\n\tlet t2;\n\tlet t3;\n\tlet val;\n\n\tif (s === 0) {\n\t\tval = l * 255;\n\t\treturn [val, val, val];\n\t}\n\n\tif (l < 0.5) {\n\t\tt2 = l * (1 + s);\n\t} else {\n\t\tt2 = l + s - l * s;\n\t}\n\n\tconst t1 = 2 * l - t2;\n\n\tconst rgb = [0, 0, 0];\n\tfor (let i = 0; i < 3; i++) {\n\t\tt3 = h + 1 / 3 * -(i - 1);\n\t\tif (t3 < 0) {\n\t\t\tt3++;\n\t\t}\n\n\t\tif (t3 > 1) {\n\t\t\tt3--;\n\t\t}\n\n\t\tif (6 * t3 < 1) {\n\t\t\tval = t1 + (t2 - t1) * 6 * t3;\n\t\t} else if (2 * t3 < 1) {\n\t\t\tval = t2;\n\t\t} else if (3 * t3 < 2) {\n\t\t\tval = t1 + (t2 - t1) * (2 / 3 - t3) * 6;\n\t\t} else {\n\t\t\tval = t1;\n\t\t}\n\n\t\trgb[i] = val * 255;\n\t}\n\n\treturn rgb;\n};\n\nconvert.hsl.hsv = function (hsl) {\n\tconst h = hsl[0];\n\tlet s = hsl[1] / 100;\n\tlet l = hsl[2] / 100;\n\tlet smin = s;\n\tconst lmin = Math.max(l, 0.01);\n\n\tl *= 2;\n\ts *= (l <= 1) ? l : 2 - l;\n\tsmin *= lmin <= 1 ? lmin : 2 - lmin;\n\tconst v = (l + s) / 2;\n\tconst sv = l === 0 ? (2 * smin) / (lmin + smin) : (2 * s) / (l + s);\n\n\treturn [h, sv * 100, v * 100];\n};\n\nconvert.hsv.rgb = function (hsv) {\n\tconst h = hsv[0] / 60;\n\tconst s = hsv[1] / 100;\n\tlet v = hsv[2] / 100;\n\tconst hi = Math.floor(h) % 6;\n\n\tconst f = h - Math.floor(h);\n\tconst p = 255 * v * (1 - s);\n\tconst q = 255 * v * (1 - (s * f));\n\tconst t = 255 * v * (1 - (s * (1 - f)));\n\tv *= 255;\n\n\tswitch (hi) {\n\t\tcase 0:\n\t\t\treturn [v, t, p];\n\t\tcase 1:\n\t\t\treturn [q, v, p];\n\t\tcase 2:\n\t\t\treturn [p, v, t];\n\t\tcase 3:\n\t\t\treturn [p, q, v];\n\t\tcase 4:\n\t\t\treturn [t, p, v];\n\t\tcase 5:\n\t\t\treturn [v, p, q];\n\t}\n};\n\nconvert.hsv.hsl = function (hsv) {\n\tconst h = hsv[0];\n\tconst s = hsv[1] / 100;\n\tconst v = hsv[2] / 100;\n\tconst vmin = Math.max(v, 0.01);\n\tlet sl;\n\tlet l;\n\n\tl = (2 - s) * v;\n\tconst lmin = (2 - s) * vmin;\n\tsl = s * vmin;\n\tsl /= (lmin <= 1) ? lmin : 2 - lmin;\n\tsl = sl || 0;\n\tl /= 2;\n\n\treturn [h, sl * 100, l * 100];\n};\n\n// http://dev.w3.org/csswg/css-color/#hwb-to-rgb\nconvert.hwb.rgb = function (hwb) {\n\tconst h = hwb[0] / 360;\n\tlet wh = hwb[1] / 100;\n\tlet bl = hwb[2] / 100;\n\tconst ratio = wh + bl;\n\tlet f;\n\n\t// Wh + bl cant be > 1\n\tif (ratio > 1) {\n\t\twh /= ratio;\n\t\tbl /= ratio;\n\t}\n\n\tconst i = Math.floor(6 * h);\n\tconst v = 1 - bl;\n\tf = 6 * h - i;\n\n\tif ((i & 0x01) !== 0) {\n\t\tf = 1 - f;\n\t}\n\n\tconst n = wh + f * (v - wh); // Linear interpolation\n\n\tlet r;\n\tlet g;\n\tlet b;\n\t/* eslint-disable max-statements-per-line,no-multi-spaces */\n\tswitch (i) {\n\t\tdefault:\n\t\tcase 6:\n\t\tcase 0: r = v; g = n; b = wh; break;\n\t\tcase 1: r = n; g = v; b = wh; break;\n\t\tcase 2: r = wh; g = v; b = n; break;\n\t\tcase 3: r = wh; g = n; b = v; break;\n\t\tcase 4: r = n; g = wh; b = v; break;\n\t\tcase 5: r = v; g = wh; b = n; break;\n\t}\n\t/* eslint-enable max-statements-per-line,no-multi-spaces */\n\n\treturn [r * 255, g * 255, b * 255];\n};\n\nconvert.cmyk.rgb = function (cmyk) {\n\tconst c = cmyk[0] / 100;\n\tconst m = cmyk[1] / 100;\n\tconst y = cmyk[2] / 100;\n\tconst k = cmyk[3] / 100;\n\n\tconst r = 1 - Math.min(1, c * (1 - k) + k);\n\tconst g = 1 - Math.min(1, m * (1 - k) + k);\n\tconst b = 1 - Math.min(1, y * (1 - k) + k);\n\n\treturn [r * 255, g * 255, b * 255];\n};\n\nconvert.xyz.rgb = function (xyz) {\n\tconst x = xyz[0] / 100;\n\tconst y = xyz[1] / 100;\n\tconst z = xyz[2] / 100;\n\tlet r;\n\tlet g;\n\tlet b;\n\n\tr = (x * 3.2406) + (y * -1.5372) + (z * -0.4986);\n\tg = (x * -0.9689) + (y * 1.8758) + (z * 0.0415);\n\tb = (x * 0.0557) + (y * -0.2040) + (z * 1.0570);\n\n\t// Assume sRGB\n\tr = r > 0.0031308\n\t\t? ((1.055 * (r ** (1.0 / 2.4))) - 0.055)\n\t\t: r * 12.92;\n\n\tg = g > 0.0031308\n\t\t? ((1.055 * (g ** (1.0 / 2.4))) - 0.055)\n\t\t: g * 12.92;\n\n\tb = b > 0.0031308\n\t\t? ((1.055 * (b ** (1.0 / 2.4))) - 0.055)\n\t\t: b * 12.92;\n\n\tr = Math.min(Math.max(0, r), 1);\n\tg = Math.min(Math.max(0, g), 1);\n\tb = Math.min(Math.max(0, b), 1);\n\n\treturn [r * 255, g * 255, b * 255];\n};\n\nconvert.xyz.lab = function (xyz) {\n\tlet x = xyz[0];\n\tlet y = xyz[1];\n\tlet z = xyz[2];\n\n\tx /= 95.047;\n\ty /= 100;\n\tz /= 108.883;\n\n\tx = x > 0.008856 ? (x ** (1 / 3)) : (7.787 * x) + (16 / 116);\n\ty = y > 0.008856 ? (y ** (1 / 3)) : (7.787 * y) + (16 / 116);\n\tz = z > 0.008856 ? (z ** (1 / 3)) : (7.787 * z) + (16 / 116);\n\n\tconst l = (116 * y) - 16;\n\tconst a = 500 * (x - y);\n\tconst b = 200 * (y - z);\n\n\treturn [l, a, b];\n};\n\nconvert.lab.xyz = function (lab) {\n\tconst l = lab[0];\n\tconst a = lab[1];\n\tconst b = lab[2];\n\tlet x;\n\tlet y;\n\tlet z;\n\n\ty = (l + 16) / 116;\n\tx = a / 500 + y;\n\tz = y - b / 200;\n\n\tconst y2 = y ** 3;\n\tconst x2 = x ** 3;\n\tconst z2 = z ** 3;\n\ty = y2 > 0.008856 ? y2 : (y - 16 / 116) / 7.787;\n\tx = x2 > 0.008856 ? x2 : (x - 16 / 116) / 7.787;\n\tz = z2 > 0.008856 ? z2 : (z - 16 / 116) / 7.787;\n\n\tx *= 95.047;\n\ty *= 100;\n\tz *= 108.883;\n\n\treturn [x, y, z];\n};\n\nconvert.lab.lch = function (lab) {\n\tconst l = lab[0];\n\tconst a = lab[1];\n\tconst b = lab[2];\n\tlet h;\n\n\tconst hr = Math.atan2(b, a);\n\th = hr * 360 / 2 / Math.PI;\n\n\tif (h < 0) {\n\t\th += 360;\n\t}\n\n\tconst c = Math.sqrt(a * a + b * b);\n\n\treturn [l, c, h];\n};\n\nconvert.lch.lab = function (lch) {\n\tconst l = lch[0];\n\tconst c = lch[1];\n\tconst h = lch[2];\n\n\tconst hr = h / 360 * 2 * Math.PI;\n\tconst a = c * Math.cos(hr);\n\tconst b = c * Math.sin(hr);\n\n\treturn [l, a, b];\n};\n\nconvert.rgb.ansi16 = function (args, saturation = null) {\n\tconst [r, g, b] = args;\n\tlet value = saturation === null ? convert.rgb.hsv(args)[2] : saturation; // Hsv -> ansi16 optimization\n\n\tvalue = Math.round(value / 50);\n\n\tif (value === 0) {\n\t\treturn 30;\n\t}\n\n\tlet ansi = 30\n\t\t+ ((Math.round(b / 255) << 2)\n\t\t| (Math.round(g / 255) << 1)\n\t\t| Math.round(r / 255));\n\n\tif (value === 2) {\n\t\tansi += 60;\n\t}\n\n\treturn ansi;\n};\n\nconvert.hsv.ansi16 = function (args) {\n\t// Optimization here; we already know the value and don't need to get\n\t// it converted for us.\n\treturn convert.rgb.ansi16(convert.hsv.rgb(args), args[2]);\n};\n\nconvert.rgb.ansi256 = function (args) {\n\tconst r = args[0];\n\tconst g = args[1];\n\tconst b = args[2];\n\n\t// We use the extended greyscale palette here, with the exception of\n\t// black and white. normal palette only has 4 greyscale shades.\n\tif (r === g && g === b) {\n\t\tif (r < 8) {\n\t\t\treturn 16;\n\t\t}\n\n\t\tif (r > 248) {\n\t\t\treturn 231;\n\t\t}\n\n\t\treturn Math.round(((r - 8) / 247) * 24) + 232;\n\t}\n\n\tconst ansi = 16\n\t\t+ (36 * Math.round(r / 255 * 5))\n\t\t+ (6 * Math.round(g / 255 * 5))\n\t\t+ Math.round(b / 255 * 5);\n\n\treturn ansi;\n};\n\nconvert.ansi16.rgb = function (args) {\n\tlet color = args % 10;\n\n\t// Handle greyscale\n\tif (color === 0 || color === 7) {\n\t\tif (args > 50) {\n\t\t\tcolor += 3.5;\n\t\t}\n\n\t\tcolor = color / 10.5 * 255;\n\n\t\treturn [color, color, color];\n\t}\n\n\tconst mult = (~~(args > 50) + 1) * 0.5;\n\tconst r = ((color & 1) * mult) * 255;\n\tconst g = (((color >> 1) & 1) * mult) * 255;\n\tconst b = (((color >> 2) & 1) * mult) * 255;\n\n\treturn [r, g, b];\n};\n\nconvert.ansi256.rgb = function (args) {\n\t// Handle greyscale\n\tif (args >= 232) {\n\t\tconst c = (args - 232) * 10 + 8;\n\t\treturn [c, c, c];\n\t}\n\n\targs -= 16;\n\n\tlet rem;\n\tconst r = Math.floor(args / 36) / 5 * 255;\n\tconst g = Math.floor((rem = args % 36) / 6) / 5 * 255;\n\tconst b = (rem % 6) / 5 * 255;\n\n\treturn [r, g, b];\n};\n\nconvert.rgb.hex = function (args) {\n\tconst integer = ((Math.round(args[0]) & 0xFF) << 16)\n\t\t+ ((Math.round(args[1]) & 0xFF) << 8)\n\t\t+ (Math.round(args[2]) & 0xFF);\n\n\tconst string = integer.toString(16).toUpperCase();\n\treturn '000000'.substring(string.length) + string;\n};\n\nconvert.hex.rgb = function (args) {\n\tconst match = args.toString(16).match(/[a-f0-9]{6}|[a-f0-9]{3}/i);\n\tif (!match) {\n\t\treturn [0, 0, 0];\n\t}\n\n\tlet colorString = match[0];\n\n\tif (match[0].length === 3) {\n\t\tcolorString = colorString.split('').map(char => {\n\t\t\treturn char + char;\n\t\t}).join('');\n\t}\n\n\tconst integer = parseInt(colorString, 16);\n\tconst r = (integer >> 16) & 0xFF;\n\tconst g = (integer >> 8) & 0xFF;\n\tconst b = integer & 0xFF;\n\n\treturn [r, g, b];\n};\n\nconvert.rgb.hcg = function (rgb) {\n\tconst r = rgb[0] / 255;\n\tconst g = rgb[1] / 255;\n\tconst b = rgb[2] / 255;\n\tconst max = Math.max(Math.max(r, g), b);\n\tconst min = Math.min(Math.min(r, g), b);\n\tconst chroma = (max - min);\n\tlet grayscale;\n\tlet hue;\n\n\tif (chroma < 1) {\n\t\tgrayscale = min / (1 - chroma);\n\t} else {\n\t\tgrayscale = 0;\n\t}\n\n\tif (chroma <= 0) {\n\t\thue = 0;\n\t} else\n\tif (max === r) {\n\t\thue = ((g - b) / chroma) % 6;\n\t} else\n\tif (max === g) {\n\t\thue = 2 + (b - r) / chroma;\n\t} else {\n\t\thue = 4 + (r - g) / chroma;\n\t}\n\n\thue /= 6;\n\thue %= 1;\n\n\treturn [hue * 360, chroma * 100, grayscale * 100];\n};\n\nconvert.hsl.hcg = function (hsl) {\n\tconst s = hsl[1] / 100;\n\tconst l = hsl[2] / 100;\n\n\tconst c = l < 0.5 ? (2.0 * s * l) : (2.0 * s * (1.0 - l));\n\n\tlet f = 0;\n\tif (c < 1.0) {\n\t\tf = (l - 0.5 * c) / (1.0 - c);\n\t}\n\n\treturn [hsl[0], c * 100, f * 100];\n};\n\nconvert.hsv.hcg = function (hsv) {\n\tconst s = hsv[1] / 100;\n\tconst v = hsv[2] / 100;\n\n\tconst c = s * v;\n\tlet f = 0;\n\n\tif (c < 1.0) {\n\t\tf = (v - c) / (1 - c);\n\t}\n\n\treturn [hsv[0], c * 100, f * 100];\n};\n\nconvert.hcg.rgb = function (hcg) {\n\tconst h = hcg[0] / 360;\n\tconst c = hcg[1] / 100;\n\tconst g = hcg[2] / 100;\n\n\tif (c === 0.0) {\n\t\treturn [g * 255, g * 255, g * 255];\n\t}\n\n\tconst pure = [0, 0, 0];\n\tconst hi = (h % 1) * 6;\n\tconst v = hi % 1;\n\tconst w = 1 - v;\n\tlet mg = 0;\n\n\t/* eslint-disable max-statements-per-line */\n\tswitch (Math.floor(hi)) {\n\t\tcase 0:\n\t\t\tpure[0] = 1; pure[1] = v; pure[2] = 0; break;\n\t\tcase 1:\n\t\t\tpure[0] = w; pure[1] = 1; pure[2] = 0; break;\n\t\tcase 2:\n\t\t\tpure[0] = 0; pure[1] = 1; pure[2] = v; break;\n\t\tcase 3:\n\t\t\tpure[0] = 0; pure[1] = w; pure[2] = 1; break;\n\t\tcase 4:\n\t\t\tpure[0] = v; pure[1] = 0; pure[2] = 1; break;\n\t\tdefault:\n\t\t\tpure[0] = 1; pure[1] = 0; pure[2] = w;\n\t}\n\t/* eslint-enable max-statements-per-line */\n\n\tmg = (1.0 - c) * g;\n\n\treturn [\n\t\t(c * pure[0] + mg) * 255,\n\t\t(c * pure[1] + mg) * 255,\n\t\t(c * pure[2] + mg) * 255\n\t];\n};\n\nconvert.hcg.hsv = function (hcg) {\n\tconst c = hcg[1] / 100;\n\tconst g = hcg[2] / 100;\n\n\tconst v = c + g * (1.0 - c);\n\tlet f = 0;\n\n\tif (v > 0.0) {\n\t\tf = c / v;\n\t}\n\n\treturn [hcg[0], f * 100, v * 100];\n};\n\nconvert.hcg.hsl = function (hcg) {\n\tconst c = hcg[1] / 100;\n\tconst g = hcg[2] / 100;\n\n\tconst l = g * (1.0 - c) + 0.5 * c;\n\tlet s = 0;\n\n\tif (l > 0.0 && l < 0.5) {\n\t\ts = c / (2 * l);\n\t} else\n\tif (l >= 0.5 && l < 1.0) {\n\t\ts = c / (2 * (1 - l));\n\t}\n\n\treturn [hcg[0], s * 100, l * 100];\n};\n\nconvert.hcg.hwb = function (hcg) {\n\tconst c = hcg[1] / 100;\n\tconst g = hcg[2] / 100;\n\tconst v = c + g * (1.0 - c);\n\treturn [hcg[0], (v - c) * 100, (1 - v) * 100];\n};\n\nconvert.hwb.hcg = function (hwb) {\n\tconst w = hwb[1] / 100;\n\tconst b = hwb[2] / 100;\n\tconst v = 1 - b;\n\tconst c = v - w;\n\tlet g = 0;\n\n\tif (c < 1) {\n\t\tg = (v - c) / (1 - c);\n\t}\n\n\treturn [hwb[0], c * 100, g * 100];\n};\n\nconvert.apple.rgb = function (apple) {\n\treturn [(apple[0] / 65535) * 255, (apple[1] / 65535) * 255, (apple[2] / 65535) * 255];\n};\n\nconvert.rgb.apple = function (rgb) {\n\treturn [(rgb[0] / 255) * 65535, (rgb[1] / 255) * 65535, (rgb[2] / 255) * 65535];\n};\n\nconvert.gray.rgb = function (args) {\n\treturn [args[0] / 100 * 255, args[0] / 100 * 255, args[0] / 100 * 255];\n};\n\nconvert.gray.hsl = function (args) {\n\treturn [0, 0, args[0]];\n};\n\nconvert.gray.hsv = convert.gray.hsl;\n\nconvert.gray.hwb = function (gray) {\n\treturn [0, 100, gray[0]];\n};\n\nconvert.gray.cmyk = function (gray) {\n\treturn [0, 0, 0, gray[0]];\n};\n\nconvert.gray.lab = function (gray) {\n\treturn [gray[0], 0, 0];\n};\n\nconvert.gray.hex = function (gray) {\n\tconst val = Math.round(gray[0] / 100 * 255) & 0xFF;\n\tconst integer = (val << 16) + (val << 8) + val;\n\n\tconst string = integer.toString(16).toUpperCase();\n\treturn '000000'.substring(string.length) + string;\n};\n\nconvert.rgb.gray = function (rgb) {\n\tconst val = (rgb[0] + rgb[1] + rgb[2]) / 3;\n\treturn [val / 255 * 100];\n};\n","const conversions = require('./conversions');\nconst route = require('./route');\n\nconst convert = {};\n\nconst models = Object.keys(conversions);\n\nfunction wrapRaw(fn) {\n\tconst wrappedFn = function (...args) {\n\t\tconst arg0 = args[0];\n\t\tif (arg0 === undefined || arg0 === null) {\n\t\t\treturn arg0;\n\t\t}\n\n\t\tif (arg0.length > 1) {\n\t\t\targs = arg0;\n\t\t}\n\n\t\treturn fn(args);\n\t};\n\n\t// Preserve .conversion property if there is one\n\tif ('conversion' in fn) {\n\t\twrappedFn.conversion = fn.conversion;\n\t}\n\n\treturn wrappedFn;\n}\n\nfunction wrapRounded(fn) {\n\tconst wrappedFn = function (...args) {\n\t\tconst arg0 = args[0];\n\n\t\tif (arg0 === undefined || arg0 === null) {\n\t\t\treturn arg0;\n\t\t}\n\n\t\tif (arg0.length > 1) {\n\t\t\targs = arg0;\n\t\t}\n\n\t\tconst result = fn(args);\n\n\t\t// We're assuming the result is an array here.\n\t\t// see notice in conversions.js; don't use box types\n\t\t// in conversion functions.\n\t\tif (typeof result === 'object') {\n\t\t\tfor (let len = result.length, i = 0; i < len; i++) {\n\t\t\t\tresult[i] = Math.round(result[i]);\n\t\t\t}\n\t\t}\n\n\t\treturn result;\n\t};\n\n\t// Preserve .conversion property if there is one\n\tif ('conversion' in fn) {\n\t\twrappedFn.conversion = fn.conversion;\n\t}\n\n\treturn wrappedFn;\n}\n\nmodels.forEach(fromModel => {\n\tconvert[fromModel] = {};\n\n\tObject.defineProperty(convert[fromModel], 'channels', {value: conversions[fromModel].channels});\n\tObject.defineProperty(convert[fromModel], 'labels', {value: conversions[fromModel].labels});\n\n\tconst routes = route(fromModel);\n\tconst routeModels = Object.keys(routes);\n\n\trouteModels.forEach(toModel => {\n\t\tconst fn = routes[toModel];\n\n\t\tconvert[fromModel][toModel] = wrapRounded(fn);\n\t\tconvert[fromModel][toModel].raw = wrapRaw(fn);\n\t});\n});\n\nmodule.exports = convert;\n","const conversions = require('./conversions');\n\n/*\n\tThis function routes a model to all other models.\n\n\tall functions that are routed have a property `.conversion` attached\n\tto the returned synthetic function. This property is an array\n\tof strings, each with the steps in between the 'from' and 'to'\n\tcolor models (inclusive).\n\n\tconversions that are not possible simply are not included.\n*/\n\nfunction buildGraph() {\n\tconst graph = {};\n\t// https://jsperf.com/object-keys-vs-for-in-with-closure/3\n\tconst models = Object.keys(conversions);\n\n\tfor (let len = models.length, i = 0; i < len; i++) {\n\t\tgraph[models[i]] = {\n\t\t\t// http://jsperf.com/1-vs-infinity\n\t\t\t// micro-opt, but this is simple.\n\t\t\tdistance: -1,\n\t\t\tparent: null\n\t\t};\n\t}\n\n\treturn graph;\n}\n\n// https://en.wikipedia.org/wiki/Breadth-first_search\nfunction deriveBFS(fromModel) {\n\tconst graph = buildGraph();\n\tconst queue = [fromModel]; // Unshift -> queue -> pop\n\n\tgraph[fromModel].distance = 0;\n\n\twhile (queue.length) {\n\t\tconst current = queue.pop();\n\t\tconst adjacents = Object.keys(conversions[current]);\n\n\t\tfor (let len = adjacents.length, i = 0; i < len; i++) {\n\t\t\tconst adjacent = adjacents[i];\n\t\t\tconst node = graph[adjacent];\n\n\t\t\tif (node.distance === -1) {\n\t\t\t\tnode.distance = graph[current].distance + 1;\n\t\t\t\tnode.parent = current;\n\t\t\t\tqueue.unshift(adjacent);\n\t\t\t}\n\t\t}\n\t}\n\n\treturn graph;\n}\n\nfunction link(from, to) {\n\treturn function (args) {\n\t\treturn to(from(args));\n\t};\n}\n\nfunction wrapConversion(toModel, graph) {\n\tconst path = [graph[toModel].parent, toModel];\n\tlet fn = conversions[graph[toModel].parent][toModel];\n\n\tlet cur = graph[toModel].parent;\n\twhile (graph[cur].parent) {\n\t\tpath.unshift(graph[cur].parent);\n\t\tfn = link(conversions[graph[cur].parent][cur], fn);\n\t\tcur = graph[cur].parent;\n\t}\n\n\tfn.conversion = path;\n\treturn fn;\n}\n\nmodule.exports = function (fromModel) {\n\tconst graph = deriveBFS(fromModel);\n\tconst conversion = {};\n\n\tconst models = Object.keys(graph);\n\tfor (let len = models.length, i = 0; i < len; i++) {\n\t\tconst toModel = models[i];\n\t\tconst node = graph[toModel];\n\n\t\tif (node.parent === null) {\n\t\t\t// No possible conversion, or this node is the source model.\n\t\t\tcontinue;\n\t\t}\n\n\t\tconversion[toModel] = wrapConversion(toModel, graph);\n\t}\n\n\treturn conversion;\n};\n\n","require('../../modules/es6.object.assign');\nmodule.exports = require('../../modules/_core').Object.assign;\n","require('../../modules/es6.object.create');\nvar $Object = require('../../modules/_core').Object;\nmodule.exports = function create(P, D) {\n return $Object.create(P, D);\n};\n","require('../../modules/es6.object.define-property');\nvar $Object = require('../../modules/_core').Object;\nmodule.exports = function defineProperty(it, key, desc) {\n return $Object.defineProperty(it, key, desc);\n};\n","require('../../modules/es6.object.get-prototype-of');\nmodule.exports = require('../../modules/_core').Object.getPrototypeOf;\n","require('../../modules/es6.object.set-prototype-of');\nmodule.exports = require('../../modules/_core').Object.setPrototypeOf;\n","require('../../modules/es6.symbol');\nrequire('../../modules/es6.object.to-string');\nrequire('../../modules/es7.symbol.async-iterator');\nrequire('../../modules/es7.symbol.observable');\nmodule.exports = require('../../modules/_core').Symbol;\n","require('../../modules/es6.string.iterator');\nrequire('../../modules/web.dom.iterable');\nmodule.exports = require('../../modules/_wks-ext').f('iterator');\n","module.exports = function (it) {\n if (typeof it != 'function') throw TypeError(it + ' is not a function!');\n return it;\n};\n","module.exports = function () { /* empty */ };\n","var isObject = require('./_is-object');\nmodule.exports = function (it) {\n if (!isObject(it)) throw TypeError(it + ' is not an object!');\n return it;\n};\n","// false -> Array#indexOf\n// true -> Array#includes\nvar toIObject = require('./_to-iobject');\nvar toLength = require('./_to-length');\nvar toAbsoluteIndex = require('./_to-absolute-index');\nmodule.exports = function (IS_INCLUDES) {\n return function ($this, el, fromIndex) {\n var O = toIObject($this);\n var length = toLength(O.length);\n var index = toAbsoluteIndex(fromIndex, length);\n var value;\n // Array#includes uses SameValueZero equality algorithm\n // eslint-disable-next-line no-self-compare\n if (IS_INCLUDES && el != el) while (length > index) {\n value = O[index++];\n // eslint-disable-next-line no-self-compare\n if (value != value) return true;\n // Array#indexOf ignores holes, Array#includes - not\n } else for (;length > index; index++) if (IS_INCLUDES || index in O) {\n if (O[index] === el) return IS_INCLUDES || index || 0;\n } return !IS_INCLUDES && -1;\n };\n};\n","var toString = {}.toString;\n\nmodule.exports = function (it) {\n return toString.call(it).slice(8, -1);\n};\n","var core = module.exports = { version: '2.6.12' };\nif (typeof __e == 'number') __e = core; // eslint-disable-line no-undef\n","// optional / simple context binding\nvar aFunction = require('./_a-function');\nmodule.exports = function (fn, that, length) {\n aFunction(fn);\n if (that === undefined) return fn;\n switch (length) {\n case 1: return function (a) {\n return fn.call(that, a);\n };\n case 2: return function (a, b) {\n return fn.call(that, a, b);\n };\n case 3: return function (a, b, c) {\n return fn.call(that, a, b, c);\n };\n }\n return function (/* ...args */) {\n return fn.apply(that, arguments);\n };\n};\n","// 7.2.1 RequireObjectCoercible(argument)\nmodule.exports = function (it) {\n if (it == undefined) throw TypeError(\"Can't call method on \" + it);\n return it;\n};\n","// Thank's IE8 for his funny defineProperty\nmodule.exports = !require('./_fails')(function () {\n return Object.defineProperty({}, 'a', { get: function () { return 7; } }).a != 7;\n});\n","var isObject = require('./_is-object');\nvar document = require('./_global').document;\n// typeof document.createElement is 'object' in old IE\nvar is = isObject(document) && isObject(document.createElement);\nmodule.exports = function (it) {\n return is ? document.createElement(it) : {};\n};\n","// IE 8- don't enum bug keys\nmodule.exports = (\n 'constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf'\n).split(',');\n","// all enumerable object keys, includes symbols\nvar getKeys = require('./_object-keys');\nvar gOPS = require('./_object-gops');\nvar pIE = require('./_object-pie');\nmodule.exports = function (it) {\n var result = getKeys(it);\n var getSymbols = gOPS.f;\n if (getSymbols) {\n var symbols = getSymbols(it);\n var isEnum = pIE.f;\n var i = 0;\n var key;\n while (symbols.length > i) if (isEnum.call(it, key = symbols[i++])) result.push(key);\n } return result;\n};\n","var global = require('./_global');\nvar core = require('./_core');\nvar ctx = require('./_ctx');\nvar hide = require('./_hide');\nvar has = require('./_has');\nvar PROTOTYPE = 'prototype';\n\nvar $export = function (type, name, source) {\n var IS_FORCED = type & $export.F;\n var IS_GLOBAL = type & $export.G;\n var IS_STATIC = type & $export.S;\n var IS_PROTO = type & $export.P;\n var IS_BIND = type & $export.B;\n var IS_WRAP = type & $export.W;\n var exports = IS_GLOBAL ? core : core[name] || (core[name] = {});\n var expProto = exports[PROTOTYPE];\n var target = IS_GLOBAL ? global : IS_STATIC ? global[name] : (global[name] || {})[PROTOTYPE];\n var key, own, out;\n if (IS_GLOBAL) source = name;\n for (key in source) {\n // contains in native\n own = !IS_FORCED && target && target[key] !== undefined;\n if (own && has(exports, key)) continue;\n // export native or passed\n out = own ? target[key] : source[key];\n // prevent global pollution for namespaces\n exports[key] = IS_GLOBAL && typeof target[key] != 'function' ? source[key]\n // bind timers to global for call from export context\n : IS_BIND && own ? ctx(out, global)\n // wrap global constructors for prevent change them in library\n : IS_WRAP && target[key] == out ? (function (C) {\n var F = function (a, b, c) {\n if (this instanceof C) {\n switch (arguments.length) {\n case 0: return new C();\n case 1: return new C(a);\n case 2: return new C(a, b);\n } return new C(a, b, c);\n } return C.apply(this, arguments);\n };\n F[PROTOTYPE] = C[PROTOTYPE];\n return F;\n // make static versions for prototype methods\n })(out) : IS_PROTO && typeof out == 'function' ? ctx(Function.call, out) : out;\n // export proto methods to core.%CONSTRUCTOR%.methods.%NAME%\n if (IS_PROTO) {\n (exports.virtual || (exports.virtual = {}))[key] = out;\n // export proto methods to core.%CONSTRUCTOR%.prototype.%NAME%\n if (type & $export.R && expProto && !expProto[key]) hide(expProto, key, out);\n }\n }\n};\n// type bitmap\n$export.F = 1; // forced\n$export.G = 2; // global\n$export.S = 4; // static\n$export.P = 8; // proto\n$export.B = 16; // bind\n$export.W = 32; // wrap\n$export.U = 64; // safe\n$export.R = 128; // real proto method for `library`\nmodule.exports = $export;\n","module.exports = function (exec) {\n try {\n return !!exec();\n } catch (e) {\n return true;\n }\n};\n","// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028\nvar global = module.exports = typeof window != 'undefined' && window.Math == Math\n ? window : typeof self != 'undefined' && self.Math == Math ? self\n // eslint-disable-next-line no-new-func\n : Function('return this')();\nif (typeof __g == 'number') __g = global; // eslint-disable-line no-undef\n","var hasOwnProperty = {}.hasOwnProperty;\nmodule.exports = function (it, key) {\n return hasOwnProperty.call(it, key);\n};\n","var dP = require('./_object-dp');\nvar createDesc = require('./_property-desc');\nmodule.exports = require('./_descriptors') ? function (object, key, value) {\n return dP.f(object, key, createDesc(1, value));\n} : function (object, key, value) {\n object[key] = value;\n return object;\n};\n","var document = require('./_global').document;\nmodule.exports = document && document.documentElement;\n","module.exports = !require('./_descriptors') && !require('./_fails')(function () {\n return Object.defineProperty(require('./_dom-create')('div'), 'a', { get: function () { return 7; } }).a != 7;\n});\n","// fallback for non-array-like ES3 and non-enumerable old V8 strings\nvar cof = require('./_cof');\n// eslint-disable-next-line no-prototype-builtins\nmodule.exports = Object('z').propertyIsEnumerable(0) ? Object : function (it) {\n return cof(it) == 'String' ? it.split('') : Object(it);\n};\n","// 7.2.2 IsArray(argument)\nvar cof = require('./_cof');\nmodule.exports = Array.isArray || function isArray(arg) {\n return cof(arg) == 'Array';\n};\n","module.exports = function (it) {\n return typeof it === 'object' ? it !== null : typeof it === 'function';\n};\n","'use strict';\nvar create = require('./_object-create');\nvar descriptor = require('./_property-desc');\nvar setToStringTag = require('./_set-to-string-tag');\nvar IteratorPrototype = {};\n\n// 25.1.2.1.1 %IteratorPrototype%[@@iterator]()\nrequire('./_hide')(IteratorPrototype, require('./_wks')('iterator'), function () { return this; });\n\nmodule.exports = function (Constructor, NAME, next) {\n Constructor.prototype = create(IteratorPrototype, { next: descriptor(1, next) });\n setToStringTag(Constructor, NAME + ' Iterator');\n};\n","'use strict';\nvar LIBRARY = require('./_library');\nvar $export = require('./_export');\nvar redefine = require('./_redefine');\nvar hide = require('./_hide');\nvar Iterators = require('./_iterators');\nvar $iterCreate = require('./_iter-create');\nvar setToStringTag = require('./_set-to-string-tag');\nvar getPrototypeOf = require('./_object-gpo');\nvar ITERATOR = require('./_wks')('iterator');\nvar BUGGY = !([].keys && 'next' in [].keys()); // Safari has buggy iterators w/o `next`\nvar FF_ITERATOR = '@@iterator';\nvar KEYS = 'keys';\nvar VALUES = 'values';\n\nvar returnThis = function () { return this; };\n\nmodule.exports = function (Base, NAME, Constructor, next, DEFAULT, IS_SET, FORCED) {\n $iterCreate(Constructor, NAME, next);\n var getMethod = function (kind) {\n if (!BUGGY && kind in proto) return proto[kind];\n switch (kind) {\n case KEYS: return function keys() { return new Constructor(this, kind); };\n case VALUES: return function values() { return new Constructor(this, kind); };\n } return function entries() { return new Constructor(this, kind); };\n };\n var TAG = NAME + ' Iterator';\n var DEF_VALUES = DEFAULT == VALUES;\n var VALUES_BUG = false;\n var proto = Base.prototype;\n var $native = proto[ITERATOR] || proto[FF_ITERATOR] || DEFAULT && proto[DEFAULT];\n var $default = $native || getMethod(DEFAULT);\n var $entries = DEFAULT ? !DEF_VALUES ? $default : getMethod('entries') : undefined;\n var $anyNative = NAME == 'Array' ? proto.entries || $native : $native;\n var methods, key, IteratorPrototype;\n // Fix native\n if ($anyNative) {\n IteratorPrototype = getPrototypeOf($anyNative.call(new Base()));\n if (IteratorPrototype !== Object.prototype && IteratorPrototype.next) {\n // Set @@toStringTag to native iterators\n setToStringTag(IteratorPrototype, TAG, true);\n // fix for some old engines\n if (!LIBRARY && typeof IteratorPrototype[ITERATOR] != 'function') hide(IteratorPrototype, ITERATOR, returnThis);\n }\n }\n // fix Array#{values, @@iterator}.name in V8 / FF\n if (DEF_VALUES && $native && $native.name !== VALUES) {\n VALUES_BUG = true;\n $default = function values() { return $native.call(this); };\n }\n // Define iterator\n if ((!LIBRARY || FORCED) && (BUGGY || VALUES_BUG || !proto[ITERATOR])) {\n hide(proto, ITERATOR, $default);\n }\n // Plug for library\n Iterators[NAME] = $default;\n Iterators[TAG] = returnThis;\n if (DEFAULT) {\n methods = {\n values: DEF_VALUES ? $default : getMethod(VALUES),\n keys: IS_SET ? $default : getMethod(KEYS),\n entries: $entries\n };\n if (FORCED) for (key in methods) {\n if (!(key in proto)) redefine(proto, key, methods[key]);\n } else $export($export.P + $export.F * (BUGGY || VALUES_BUG), NAME, methods);\n }\n return methods;\n};\n","module.exports = function (done, value) {\n return { value: value, done: !!done };\n};\n","module.exports = {};\n","module.exports = true;\n","var META = require('./_uid')('meta');\nvar isObject = require('./_is-object');\nvar has = require('./_has');\nvar setDesc = require('./_object-dp').f;\nvar id = 0;\nvar isExtensible = Object.isExtensible || function () {\n return true;\n};\nvar FREEZE = !require('./_fails')(function () {\n return isExtensible(Object.preventExtensions({}));\n});\nvar setMeta = function (it) {\n setDesc(it, META, { value: {\n i: 'O' + ++id, // object ID\n w: {} // weak collections IDs\n } });\n};\nvar fastKey = function (it, create) {\n // return primitive with prefix\n if (!isObject(it)) return typeof it == 'symbol' ? it : (typeof it == 'string' ? 'S' : 'P') + it;\n if (!has(it, META)) {\n // can't set metadata to uncaught frozen object\n if (!isExtensible(it)) return 'F';\n // not necessary to add metadata\n if (!create) return 'E';\n // add missing metadata\n setMeta(it);\n // return object ID\n } return it[META].i;\n};\nvar getWeak = function (it, create) {\n if (!has(it, META)) {\n // can't set metadata to uncaught frozen object\n if (!isExtensible(it)) return true;\n // not necessary to add metadata\n if (!create) return false;\n // add missing metadata\n setMeta(it);\n // return hash weak collections IDs\n } return it[META].w;\n};\n// add metadata on freeze-family methods calling\nvar onFreeze = function (it) {\n if (FREEZE && meta.NEED && isExtensible(it) && !has(it, META)) setMeta(it);\n return it;\n};\nvar meta = module.exports = {\n KEY: META,\n NEED: false,\n fastKey: fastKey,\n getWeak: getWeak,\n onFreeze: onFreeze\n};\n","'use strict';\n// 19.1.2.1 Object.assign(target, source, ...)\nvar DESCRIPTORS = require('./_descriptors');\nvar getKeys = require('./_object-keys');\nvar gOPS = require('./_object-gops');\nvar pIE = require('./_object-pie');\nvar toObject = require('./_to-object');\nvar IObject = require('./_iobject');\nvar $assign = Object.assign;\n\n// should work with symbols and should have deterministic property order (V8 bug)\nmodule.exports = !$assign || require('./_fails')(function () {\n var A = {};\n var B = {};\n // eslint-disable-next-line no-undef\n var S = Symbol();\n var K = 'abcdefghijklmnopqrst';\n A[S] = 7;\n K.split('').forEach(function (k) { B[k] = k; });\n return $assign({}, A)[S] != 7 || Object.keys($assign({}, B)).join('') != K;\n}) ? function assign(target, source) { // eslint-disable-line no-unused-vars\n var T = toObject(target);\n var aLen = arguments.length;\n var index = 1;\n var getSymbols = gOPS.f;\n var isEnum = pIE.f;\n while (aLen > index) {\n var S = IObject(arguments[index++]);\n var keys = getSymbols ? getKeys(S).concat(getSymbols(S)) : getKeys(S);\n var length = keys.length;\n var j = 0;\n var key;\n while (length > j) {\n key = keys[j++];\n if (!DESCRIPTORS || isEnum.call(S, key)) T[key] = S[key];\n }\n } return T;\n} : $assign;\n","// 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])\nvar anObject = require('./_an-object');\nvar dPs = require('./_object-dps');\nvar enumBugKeys = require('./_enum-bug-keys');\nvar IE_PROTO = require('./_shared-key')('IE_PROTO');\nvar Empty = function () { /* empty */ };\nvar PROTOTYPE = 'prototype';\n\n// Create object with fake `null` prototype: use iframe Object with cleared prototype\nvar createDict = function () {\n // Thrash, waste and sodomy: IE GC bug\n var iframe = require('./_dom-create')('iframe');\n var i = enumBugKeys.length;\n var lt = '<';\n var gt = '>';\n var iframeDocument;\n iframe.style.display = 'none';\n require('./_html').appendChild(iframe);\n iframe.src = 'javascript:'; // eslint-disable-line no-script-url\n // createDict = iframe.contentWindow.Object;\n // html.removeChild(iframe);\n iframeDocument = iframe.contentWindow.document;\n iframeDocument.open();\n iframeDocument.write(lt + 'script' + gt + 'document.F=Object' + lt + '/script' + gt);\n iframeDocument.close();\n createDict = iframeDocument.F;\n while (i--) delete createDict[PROTOTYPE][enumBugKeys[i]];\n return createDict();\n};\n\nmodule.exports = Object.create || function create(O, Properties) {\n var result;\n if (O !== null) {\n Empty[PROTOTYPE] = anObject(O);\n result = new Empty();\n Empty[PROTOTYPE] = null;\n // add \"__proto__\" for Object.getPrototypeOf polyfill\n result[IE_PROTO] = O;\n } else result = createDict();\n return Properties === undefined ? result : dPs(result, Properties);\n};\n","var anObject = require('./_an-object');\nvar IE8_DOM_DEFINE = require('./_ie8-dom-define');\nvar toPrimitive = require('./_to-primitive');\nvar dP = Object.defineProperty;\n\nexports.f = require('./_descriptors') ? Object.defineProperty : function defineProperty(O, P, Attributes) {\n anObject(O);\n P = toPrimitive(P, true);\n anObject(Attributes);\n if (IE8_DOM_DEFINE) try {\n return dP(O, P, Attributes);\n } catch (e) { /* empty */ }\n if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported!');\n if ('value' in Attributes) O[P] = Attributes.value;\n return O;\n};\n","var dP = require('./_object-dp');\nvar anObject = require('./_an-object');\nvar getKeys = require('./_object-keys');\n\nmodule.exports = require('./_descriptors') ? Object.defineProperties : function defineProperties(O, Properties) {\n anObject(O);\n var keys = getKeys(Properties);\n var length = keys.length;\n var i = 0;\n var P;\n while (length > i) dP.f(O, P = keys[i++], Properties[P]);\n return O;\n};\n","var pIE = require('./_object-pie');\nvar createDesc = require('./_property-desc');\nvar toIObject = require('./_to-iobject');\nvar toPrimitive = require('./_to-primitive');\nvar has = require('./_has');\nvar IE8_DOM_DEFINE = require('./_ie8-dom-define');\nvar gOPD = Object.getOwnPropertyDescriptor;\n\nexports.f = require('./_descriptors') ? gOPD : function getOwnPropertyDescriptor(O, P) {\n O = toIObject(O);\n P = toPrimitive(P, true);\n if (IE8_DOM_DEFINE) try {\n return gOPD(O, P);\n } catch (e) { /* empty */ }\n if (has(O, P)) return createDesc(!pIE.f.call(O, P), O[P]);\n};\n","// fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window\nvar toIObject = require('./_to-iobject');\nvar gOPN = require('./_object-gopn').f;\nvar toString = {}.toString;\n\nvar windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames\n ? Object.getOwnPropertyNames(window) : [];\n\nvar getWindowNames = function (it) {\n try {\n return gOPN(it);\n } catch (e) {\n return windowNames.slice();\n }\n};\n\nmodule.exports.f = function getOwnPropertyNames(it) {\n return windowNames && toString.call(it) == '[object Window]' ? getWindowNames(it) : gOPN(toIObject(it));\n};\n","// 19.1.2.7 / 15.2.3.4 Object.getOwnPropertyNames(O)\nvar $keys = require('./_object-keys-internal');\nvar hiddenKeys = require('./_enum-bug-keys').concat('length', 'prototype');\n\nexports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) {\n return $keys(O, hiddenKeys);\n};\n","exports.f = Object.getOwnPropertySymbols;\n","// 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O)\nvar has = require('./_has');\nvar toObject = require('./_to-object');\nvar IE_PROTO = require('./_shared-key')('IE_PROTO');\nvar ObjectProto = Object.prototype;\n\nmodule.exports = Object.getPrototypeOf || function (O) {\n O = toObject(O);\n if (has(O, IE_PROTO)) return O[IE_PROTO];\n if (typeof O.constructor == 'function' && O instanceof O.constructor) {\n return O.constructor.prototype;\n } return O instanceof Object ? ObjectProto : null;\n};\n","var has = require('./_has');\nvar toIObject = require('./_to-iobject');\nvar arrayIndexOf = require('./_array-includes')(false);\nvar IE_PROTO = require('./_shared-key')('IE_PROTO');\n\nmodule.exports = function (object, names) {\n var O = toIObject(object);\n var i = 0;\n var result = [];\n var key;\n for (key in O) if (key != IE_PROTO) has(O, key) && result.push(key);\n // Don't enum bug & hidden keys\n while (names.length > i) if (has(O, key = names[i++])) {\n ~arrayIndexOf(result, key) || result.push(key);\n }\n return result;\n};\n","// 19.1.2.14 / 15.2.3.14 Object.keys(O)\nvar $keys = require('./_object-keys-internal');\nvar enumBugKeys = require('./_enum-bug-keys');\n\nmodule.exports = Object.keys || function keys(O) {\n return $keys(O, enumBugKeys);\n};\n","exports.f = {}.propertyIsEnumerable;\n","// most Object methods by ES6 should accept primitives\nvar $export = require('./_export');\nvar core = require('./_core');\nvar fails = require('./_fails');\nmodule.exports = function (KEY, exec) {\n var fn = (core.Object || {})[KEY] || Object[KEY];\n var exp = {};\n exp[KEY] = exec(fn);\n $export($export.S + $export.F * fails(function () { fn(1); }), 'Object', exp);\n};\n","module.exports = function (bitmap, value) {\n return {\n enumerable: !(bitmap & 1),\n configurable: !(bitmap & 2),\n writable: !(bitmap & 4),\n value: value\n };\n};\n","module.exports = require('./_hide');\n","// Works with __proto__ only. Old v8 can't work with null proto objects.\n/* eslint-disable no-proto */\nvar isObject = require('./_is-object');\nvar anObject = require('./_an-object');\nvar check = function (O, proto) {\n anObject(O);\n if (!isObject(proto) && proto !== null) throw TypeError(proto + \": can't set as prototype!\");\n};\nmodule.exports = {\n set: Object.setPrototypeOf || ('__proto__' in {} ? // eslint-disable-line\n function (test, buggy, set) {\n try {\n set = require('./_ctx')(Function.call, require('./_object-gopd').f(Object.prototype, '__proto__').set, 2);\n set(test, []);\n buggy = !(test instanceof Array);\n } catch (e) { buggy = true; }\n return function setPrototypeOf(O, proto) {\n check(O, proto);\n if (buggy) O.__proto__ = proto;\n else set(O, proto);\n return O;\n };\n }({}, false) : undefined),\n check: check\n};\n","var def = require('./_object-dp').f;\nvar has = require('./_has');\nvar TAG = require('./_wks')('toStringTag');\n\nmodule.exports = function (it, tag, stat) {\n if (it && !has(it = stat ? it : it.prototype, TAG)) def(it, TAG, { configurable: true, value: tag });\n};\n","var shared = require('./_shared')('keys');\nvar uid = require('./_uid');\nmodule.exports = function (key) {\n return shared[key] || (shared[key] = uid(key));\n};\n","var core = require('./_core');\nvar global = require('./_global');\nvar SHARED = '__core-js_shared__';\nvar store = global[SHARED] || (global[SHARED] = {});\n\n(module.exports = function (key, value) {\n return store[key] || (store[key] = value !== undefined ? value : {});\n})('versions', []).push({\n version: core.version,\n mode: require('./_library') ? 'pure' : 'global',\n copyright: '© 2020 Denis Pushkarev (zloirock.ru)'\n});\n","var toInteger = require('./_to-integer');\nvar defined = require('./_defined');\n// true -> String#at\n// false -> String#codePointAt\nmodule.exports = function (TO_STRING) {\n return function (that, pos) {\n var s = String(defined(that));\n var i = toInteger(pos);\n var l = s.length;\n var a, b;\n if (i < 0 || i >= l) return TO_STRING ? '' : undefined;\n a = s.charCodeAt(i);\n return a < 0xd800 || a > 0xdbff || i + 1 === l || (b = s.charCodeAt(i + 1)) < 0xdc00 || b > 0xdfff\n ? TO_STRING ? s.charAt(i) : a\n : TO_STRING ? s.slice(i, i + 2) : (a - 0xd800 << 10) + (b - 0xdc00) + 0x10000;\n };\n};\n","var toInteger = require('./_to-integer');\nvar max = Math.max;\nvar min = Math.min;\nmodule.exports = function (index, length) {\n index = toInteger(index);\n return index < 0 ? max(index + length, 0) : min(index, length);\n};\n","// 7.1.4 ToInteger\nvar ceil = Math.ceil;\nvar floor = Math.floor;\nmodule.exports = function (it) {\n return isNaN(it = +it) ? 0 : (it > 0 ? floor : ceil)(it);\n};\n","// to indexed object, toObject with fallback for non-array-like ES3 strings\nvar IObject = require('./_iobject');\nvar defined = require('./_defined');\nmodule.exports = function (it) {\n return IObject(defined(it));\n};\n","// 7.1.15 ToLength\nvar toInteger = require('./_to-integer');\nvar min = Math.min;\nmodule.exports = function (it) {\n return it > 0 ? min(toInteger(it), 0x1fffffffffffff) : 0; // pow(2, 53) - 1 == 9007199254740991\n};\n","// 7.1.13 ToObject(argument)\nvar defined = require('./_defined');\nmodule.exports = function (it) {\n return Object(defined(it));\n};\n","// 7.1.1 ToPrimitive(input [, PreferredType])\nvar isObject = require('./_is-object');\n// instead of the ES6 spec version, we didn't implement @@toPrimitive case\n// and the second argument - flag - preferred type is a string\nmodule.exports = function (it, S) {\n if (!isObject(it)) return it;\n var fn, val;\n if (S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;\n if (typeof (fn = it.valueOf) == 'function' && !isObject(val = fn.call(it))) return val;\n if (!S && typeof (fn = it.toString) == 'function' && !isObject(val = fn.call(it))) return val;\n throw TypeError(\"Can't convert object to primitive value\");\n};\n","var id = 0;\nvar px = Math.random();\nmodule.exports = function (key) {\n return 'Symbol('.concat(key === undefined ? '' : key, ')_', (++id + px).toString(36));\n};\n","var global = require('./_global');\nvar core = require('./_core');\nvar LIBRARY = require('./_library');\nvar wksExt = require('./_wks-ext');\nvar defineProperty = require('./_object-dp').f;\nmodule.exports = function (name) {\n var $Symbol = core.Symbol || (core.Symbol = LIBRARY ? {} : global.Symbol || {});\n if (name.charAt(0) != '_' && !(name in $Symbol)) defineProperty($Symbol, name, { value: wksExt.f(name) });\n};\n","exports.f = require('./_wks');\n","var store = require('./_shared')('wks');\nvar uid = require('./_uid');\nvar Symbol = require('./_global').Symbol;\nvar USE_SYMBOL = typeof Symbol == 'function';\n\nvar $exports = module.exports = function (name) {\n return store[name] || (store[name] =\n USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name));\n};\n\n$exports.store = store;\n","'use strict';\nvar addToUnscopables = require('./_add-to-unscopables');\nvar step = require('./_iter-step');\nvar Iterators = require('./_iterators');\nvar toIObject = require('./_to-iobject');\n\n// 22.1.3.4 Array.prototype.entries()\n// 22.1.3.13 Array.prototype.keys()\n// 22.1.3.29 Array.prototype.values()\n// 22.1.3.30 Array.prototype[@@iterator]()\nmodule.exports = require('./_iter-define')(Array, 'Array', function (iterated, kind) {\n this._t = toIObject(iterated); // target\n this._i = 0; // next index\n this._k = kind; // kind\n// 22.1.5.2.1 %ArrayIteratorPrototype%.next()\n}, function () {\n var O = this._t;\n var kind = this._k;\n var index = this._i++;\n if (!O || index >= O.length) {\n this._t = undefined;\n return step(1);\n }\n if (kind == 'keys') return step(0, index);\n if (kind == 'values') return step(0, O[index]);\n return step(0, [index, O[index]]);\n}, 'values');\n\n// argumentsList[@@iterator] is %ArrayProto_values% (9.4.4.6, 9.4.4.7)\nIterators.Arguments = Iterators.Array;\n\naddToUnscopables('keys');\naddToUnscopables('values');\naddToUnscopables('entries');\n","// 19.1.3.1 Object.assign(target, source)\nvar $export = require('./_export');\n\n$export($export.S + $export.F, 'Object', { assign: require('./_object-assign') });\n","var $export = require('./_export');\n// 19.1.2.2 / 15.2.3.5 Object.create(O [, Properties])\n$export($export.S, 'Object', { create: require('./_object-create') });\n","var $export = require('./_export');\n// 19.1.2.4 / 15.2.3.6 Object.defineProperty(O, P, Attributes)\n$export($export.S + $export.F * !require('./_descriptors'), 'Object', { defineProperty: require('./_object-dp').f });\n","// 19.1.2.9 Object.getPrototypeOf(O)\nvar toObject = require('./_to-object');\nvar $getPrototypeOf = require('./_object-gpo');\n\nrequire('./_object-sap')('getPrototypeOf', function () {\n return function getPrototypeOf(it) {\n return $getPrototypeOf(toObject(it));\n };\n});\n","// 19.1.3.19 Object.setPrototypeOf(O, proto)\nvar $export = require('./_export');\n$export($export.S, 'Object', { setPrototypeOf: require('./_set-proto').set });\n","'use strict';\nvar $at = require('./_string-at')(true);\n\n// 21.1.3.27 String.prototype[@@iterator]()\nrequire('./_iter-define')(String, 'String', function (iterated) {\n this._t = String(iterated); // target\n this._i = 0; // next index\n// 21.1.5.2.1 %StringIteratorPrototype%.next()\n}, function () {\n var O = this._t;\n var index = this._i;\n var point;\n if (index >= O.length) return { value: undefined, done: true };\n point = $at(O, index);\n this._i += point.length;\n return { value: point, done: false };\n});\n","'use strict';\n// ECMAScript 6 symbols shim\nvar global = require('./_global');\nvar has = require('./_has');\nvar DESCRIPTORS = require('./_descriptors');\nvar $export = require('./_export');\nvar redefine = require('./_redefine');\nvar META = require('./_meta').KEY;\nvar $fails = require('./_fails');\nvar shared = require('./_shared');\nvar setToStringTag = require('./_set-to-string-tag');\nvar uid = require('./_uid');\nvar wks = require('./_wks');\nvar wksExt = require('./_wks-ext');\nvar wksDefine = require('./_wks-define');\nvar enumKeys = require('./_enum-keys');\nvar isArray = require('./_is-array');\nvar anObject = require('./_an-object');\nvar isObject = require('./_is-object');\nvar toObject = require('./_to-object');\nvar toIObject = require('./_to-iobject');\nvar toPrimitive = require('./_to-primitive');\nvar createDesc = require('./_property-desc');\nvar _create = require('./_object-create');\nvar gOPNExt = require('./_object-gopn-ext');\nvar $GOPD = require('./_object-gopd');\nvar $GOPS = require('./_object-gops');\nvar $DP = require('./_object-dp');\nvar $keys = require('./_object-keys');\nvar gOPD = $GOPD.f;\nvar dP = $DP.f;\nvar gOPN = gOPNExt.f;\nvar $Symbol = global.Symbol;\nvar $JSON = global.JSON;\nvar _stringify = $JSON && $JSON.stringify;\nvar PROTOTYPE = 'prototype';\nvar HIDDEN = wks('_hidden');\nvar TO_PRIMITIVE = wks('toPrimitive');\nvar isEnum = {}.propertyIsEnumerable;\nvar SymbolRegistry = shared('symbol-registry');\nvar AllSymbols = shared('symbols');\nvar OPSymbols = shared('op-symbols');\nvar ObjectProto = Object[PROTOTYPE];\nvar USE_NATIVE = typeof $Symbol == 'function' && !!$GOPS.f;\nvar QObject = global.QObject;\n// Don't use setters in Qt Script, https://github.com/zloirock/core-js/issues/173\nvar setter = !QObject || !QObject[PROTOTYPE] || !QObject[PROTOTYPE].findChild;\n\n// fallback for old Android, https://code.google.com/p/v8/issues/detail?id=687\nvar setSymbolDesc = DESCRIPTORS && $fails(function () {\n return _create(dP({}, 'a', {\n get: function () { return dP(this, 'a', { value: 7 }).a; }\n })).a != 7;\n}) ? function (it, key, D) {\n var protoDesc = gOPD(ObjectProto, key);\n if (protoDesc) delete ObjectProto[key];\n dP(it, key, D);\n if (protoDesc && it !== ObjectProto) dP(ObjectProto, key, protoDesc);\n} : dP;\n\nvar wrap = function (tag) {\n var sym = AllSymbols[tag] = _create($Symbol[PROTOTYPE]);\n sym._k = tag;\n return sym;\n};\n\nvar isSymbol = USE_NATIVE && typeof $Symbol.iterator == 'symbol' ? function (it) {\n return typeof it == 'symbol';\n} : function (it) {\n return it instanceof $Symbol;\n};\n\nvar $defineProperty = function defineProperty(it, key, D) {\n if (it === ObjectProto) $defineProperty(OPSymbols, key, D);\n anObject(it);\n key = toPrimitive(key, true);\n anObject(D);\n if (has(AllSymbols, key)) {\n if (!D.enumerable) {\n if (!has(it, HIDDEN)) dP(it, HIDDEN, createDesc(1, {}));\n it[HIDDEN][key] = true;\n } else {\n if (has(it, HIDDEN) && it[HIDDEN][key]) it[HIDDEN][key] = false;\n D = _create(D, { enumerable: createDesc(0, false) });\n } return setSymbolDesc(it, key, D);\n } return dP(it, key, D);\n};\nvar $defineProperties = function defineProperties(it, P) {\n anObject(it);\n var keys = enumKeys(P = toIObject(P));\n var i = 0;\n var l = keys.length;\n var key;\n while (l > i) $defineProperty(it, key = keys[i++], P[key]);\n return it;\n};\nvar $create = function create(it, P) {\n return P === undefined ? _create(it) : $defineProperties(_create(it), P);\n};\nvar $propertyIsEnumerable = function propertyIsEnumerable(key) {\n var E = isEnum.call(this, key = toPrimitive(key, true));\n if (this === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return false;\n return E || !has(this, key) || !has(AllSymbols, key) || has(this, HIDDEN) && this[HIDDEN][key] ? E : true;\n};\nvar $getOwnPropertyDescriptor = function getOwnPropertyDescriptor(it, key) {\n it = toIObject(it);\n key = toPrimitive(key, true);\n if (it === ObjectProto && has(AllSymbols, key) && !has(OPSymbols, key)) return;\n var D = gOPD(it, key);\n if (D && has(AllSymbols, key) && !(has(it, HIDDEN) && it[HIDDEN][key])) D.enumerable = true;\n return D;\n};\nvar $getOwnPropertyNames = function getOwnPropertyNames(it) {\n var names = gOPN(toIObject(it));\n var result = [];\n var i = 0;\n var key;\n while (names.length > i) {\n if (!has(AllSymbols, key = names[i++]) && key != HIDDEN && key != META) result.push(key);\n } return result;\n};\nvar $getOwnPropertySymbols = function getOwnPropertySymbols(it) {\n var IS_OP = it === ObjectProto;\n var names = gOPN(IS_OP ? OPSymbols : toIObject(it));\n var result = [];\n var i = 0;\n var key;\n while (names.length > i) {\n if (has(AllSymbols, key = names[i++]) && (IS_OP ? has(ObjectProto, key) : true)) result.push(AllSymbols[key]);\n } return result;\n};\n\n// 19.4.1.1 Symbol([description])\nif (!USE_NATIVE) {\n $Symbol = function Symbol() {\n if (this instanceof $Symbol) throw TypeError('Symbol is not a constructor!');\n var tag = uid(arguments.length > 0 ? arguments[0] : undefined);\n var $set = function (value) {\n if (this === ObjectProto) $set.call(OPSymbols, value);\n if (has(this, HIDDEN) && has(this[HIDDEN], tag)) this[HIDDEN][tag] = false;\n setSymbolDesc(this, tag, createDesc(1, value));\n };\n if (DESCRIPTORS && setter) setSymbolDesc(ObjectProto, tag, { configurable: true, set: $set });\n return wrap(tag);\n };\n redefine($Symbol[PROTOTYPE], 'toString', function toString() {\n return this._k;\n });\n\n $GOPD.f = $getOwnPropertyDescriptor;\n $DP.f = $defineProperty;\n require('./_object-gopn').f = gOPNExt.f = $getOwnPropertyNames;\n require('./_object-pie').f = $propertyIsEnumerable;\n $GOPS.f = $getOwnPropertySymbols;\n\n if (DESCRIPTORS && !require('./_library')) {\n redefine(ObjectProto, 'propertyIsEnumerable', $propertyIsEnumerable, true);\n }\n\n wksExt.f = function (name) {\n return wrap(wks(name));\n };\n}\n\n$export($export.G + $export.W + $export.F * !USE_NATIVE, { Symbol: $Symbol });\n\nfor (var es6Symbols = (\n // 19.4.2.2, 19.4.2.3, 19.4.2.4, 19.4.2.6, 19.4.2.8, 19.4.2.9, 19.4.2.10, 19.4.2.11, 19.4.2.12, 19.4.2.13, 19.4.2.14\n 'hasInstance,isConcatSpreadable,iterator,match,replace,search,species,split,toPrimitive,toStringTag,unscopables'\n).split(','), j = 0; es6Symbols.length > j;)wks(es6Symbols[j++]);\n\nfor (var wellKnownSymbols = $keys(wks.store), k = 0; wellKnownSymbols.length > k;) wksDefine(wellKnownSymbols[k++]);\n\n$export($export.S + $export.F * !USE_NATIVE, 'Symbol', {\n // 19.4.2.1 Symbol.for(key)\n 'for': function (key) {\n return has(SymbolRegistry, key += '')\n ? SymbolRegistry[key]\n : SymbolRegistry[key] = $Symbol(key);\n },\n // 19.4.2.5 Symbol.keyFor(sym)\n keyFor: function keyFor(sym) {\n if (!isSymbol(sym)) throw TypeError(sym + ' is not a symbol!');\n for (var key in SymbolRegistry) if (SymbolRegistry[key] === sym) return key;\n },\n useSetter: function () { setter = true; },\n useSimple: function () { setter = false; }\n});\n\n$export($export.S + $export.F * !USE_NATIVE, 'Object', {\n // 19.1.2.2 Object.create(O [, Properties])\n create: $create,\n // 19.1.2.4 Object.defineProperty(O, P, Attributes)\n defineProperty: $defineProperty,\n // 19.1.2.3 Object.defineProperties(O, Properties)\n defineProperties: $defineProperties,\n // 19.1.2.6 Object.getOwnPropertyDescriptor(O, P)\n getOwnPropertyDescriptor: $getOwnPropertyDescriptor,\n // 19.1.2.7 Object.getOwnPropertyNames(O)\n getOwnPropertyNames: $getOwnPropertyNames,\n // 19.1.2.8 Object.getOwnPropertySymbols(O)\n getOwnPropertySymbols: $getOwnPropertySymbols\n});\n\n// Chrome 38 and 39 `Object.getOwnPropertySymbols` fails on primitives\n// https://bugs.chromium.org/p/v8/issues/detail?id=3443\nvar FAILS_ON_PRIMITIVES = $fails(function () { $GOPS.f(1); });\n\n$export($export.S + $export.F * FAILS_ON_PRIMITIVES, 'Object', {\n getOwnPropertySymbols: function getOwnPropertySymbols(it) {\n return $GOPS.f(toObject(it));\n }\n});\n\n// 24.3.2 JSON.stringify(value [, replacer [, space]])\n$JSON && $export($export.S + $export.F * (!USE_NATIVE || $fails(function () {\n var S = $Symbol();\n // MS Edge converts symbol values to JSON as {}\n // WebKit converts symbol values to JSON as null\n // V8 throws on boxed symbols\n return _stringify([S]) != '[null]' || _stringify({ a: S }) != '{}' || _stringify(Object(S)) != '{}';\n})), 'JSON', {\n stringify: function stringify(it) {\n var args = [it];\n var i = 1;\n var replacer, $replacer;\n while (arguments.length > i) args.push(arguments[i++]);\n $replacer = replacer = args[1];\n if (!isObject(replacer) && it === undefined || isSymbol(it)) return; // IE8 returns string on undefined\n if (!isArray(replacer)) replacer = function (key, value) {\n if (typeof $replacer == 'function') value = $replacer.call(this, key, value);\n if (!isSymbol(value)) return value;\n };\n args[1] = replacer;\n return _stringify.apply($JSON, args);\n }\n});\n\n// 19.4.3.4 Symbol.prototype[@@toPrimitive](hint)\n$Symbol[PROTOTYPE][TO_PRIMITIVE] || require('./_hide')($Symbol[PROTOTYPE], TO_PRIMITIVE, $Symbol[PROTOTYPE].valueOf);\n// 19.4.3.5 Symbol.prototype[@@toStringTag]\nsetToStringTag($Symbol, 'Symbol');\n// 20.2.1.9 Math[@@toStringTag]\nsetToStringTag(Math, 'Math', true);\n// 24.3.3 JSON[@@toStringTag]\nsetToStringTag(global.JSON, 'JSON', true);\n","require('./_wks-define')('asyncIterator');\n","require('./_wks-define')('observable');\n","require('./es6.array.iterator');\nvar global = require('./_global');\nvar hide = require('./_hide');\nvar Iterators = require('./_iterators');\nvar TO_STRING_TAG = require('./_wks')('toStringTag');\n\nvar DOMIterables = ('CSSRuleList,CSSStyleDeclaration,CSSValueList,ClientRectList,DOMRectList,DOMStringList,' +\n 'DOMTokenList,DataTransferItemList,FileList,HTMLAllCollection,HTMLCollection,HTMLFormElement,HTMLSelectElement,' +\n 'MediaList,MimeTypeArray,NamedNodeMap,NodeList,PaintRequestList,Plugin,PluginArray,SVGLengthList,SVGNumberList,' +\n 'SVGPathSegList,SVGPointList,SVGStringList,SVGTransformList,SourceBufferList,StyleSheetList,TextTrackCueList,' +\n 'TextTrackList,TouchList').split(',');\n\nfor (var i = 0; i < DOMIterables.length; i++) {\n var NAME = DOMIterables[i];\n var Collection = global[NAME];\n var proto = Collection && Collection.prototype;\n if (proto && !proto[TO_STRING_TAG]) hide(proto, TO_STRING_TAG, NAME);\n Iterators[NAME] = Iterators.Array;\n}\n","'use strict'\n\nmodule.exports = require('./colors.json')\n","function _typeof(obj) { \"@babel/helpers - typeof\"; if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof(obj); }\n\nfunction _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }\n\nfunction _nonIterableSpread() { throw new TypeError(\"Invalid attempt to spread non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\n\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(n); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\n\nfunction _iterableToArray(iter) { if (typeof Symbol !== \"undefined\" && Symbol.iterator in Object(iter)) return Array.from(iter); }\n\nfunction _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }\n\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }\n\nfunction filterUniqueArray(arr) {\n return arr.filter(function (val, index) {\n return arr.lastIndexOf(val) === index;\n });\n}\n\nexport default function assignStyle(base) {\n for (var i = 0, len = arguments.length <= 1 ? 0 : arguments.length - 1; i < len; ++i) {\n var style = i + 1 < 1 || arguments.length <= i + 1 ? undefined : arguments[i + 1];\n\n for (var property in style) {\n var value = style[property];\n var baseValue = base[property];\n\n if (baseValue && value) {\n if (Array.isArray(baseValue)) {\n base[property] = filterUniqueArray(baseValue.concat(value));\n continue;\n }\n\n if (Array.isArray(value)) {\n base[property] = filterUniqueArray([baseValue].concat(_toConsumableArray(value)));\n continue;\n }\n\n if (_typeof(value) === 'object') {\n base[property] = assignStyle({}, baseValue, value);\n continue;\n }\n }\n\n base[property] = value;\n }\n }\n\n return base;\n}","var DASH = /-([a-z])/g;\nvar MS = /^Ms/g;\nvar cache = {};\n\nfunction toUpper(match) {\n return match[1].toUpperCase();\n}\n\nexport default function camelCaseProperty(property) {\n if (cache.hasOwnProperty(property)) {\n return cache[property];\n }\n\n var camelProp = property.replace(DASH, toUpper).replace(MS, 'ms');\n cache[property] = camelProp;\n return camelProp;\n}","import hyphenateStyleName from 'hyphenate-style-name';\nexport default function hyphenateProperty(property) {\n return hyphenateStyleName(property);\n}","import hyphenateProperty from './hyphenateProperty';\nexport default function cssifyDeclaration(property, value) {\n return hyphenateProperty(property) + ':' + value;\n}","import cssifyDeclaration from './cssifyDeclaration';\nexport default function cssifyObject(style) {\n var css = '';\n\n for (var property in style) {\n var value = style[property];\n\n if (typeof value !== 'string' && typeof value !== 'number') {\n continue;\n } // prevents the semicolon after\n // the last rule declaration\n\n\n if (css) {\n css += ';';\n }\n\n css += cssifyDeclaration(property, value);\n }\n\n return css;\n}","var RE = /^(Webkit|Moz|O|ms)/;\nexport default function isPrefixedProperty(property) {\n return RE.test(property);\n}","var RE = /-webkit-|-moz-|-ms-/;\nexport default function isPrefixedValue(value) {\n return typeof value === 'string' && RE.test(value);\n}","import hyphenateProperty from './hyphenateProperty';\nvar unitlessProperties = {\n borderImageOutset: true,\n borderImageSlice: true,\n borderImageWidth: true,\n fontWeight: true,\n lineHeight: true,\n opacity: true,\n orphans: true,\n tabSize: true,\n widows: true,\n zIndex: true,\n zoom: true,\n // SVG-related properties\n fillOpacity: true,\n floodOpacity: true,\n stopOpacity: true,\n strokeDasharray: true,\n strokeDashoffset: true,\n strokeMiterlimit: true,\n strokeOpacity: true,\n strokeWidth: true\n};\nvar prefixedUnitlessProperties = ['animationIterationCount', 'boxFlex', 'boxFlexGroup', 'boxOrdinalGroup', 'columnCount', 'flex', 'flexGrow', 'flexPositive', 'flexShrink', 'flexNegative', 'flexOrder', 'gridColumn', 'gridColumnEnd', 'gridColumnStart', 'gridRow', 'gridRowEnd', 'gridRowStart', 'lineClamp', 'order'];\nvar prefixes = ['Webkit', 'ms', 'Moz', 'O'];\n\nfunction getPrefixedProperty(prefix, property) {\n return prefix + property.charAt(0).toUpperCase() + property.slice(1);\n} // add all prefixed properties to the unitless properties\n\n\nfor (var i = 0, len = prefixedUnitlessProperties.length; i < len; ++i) {\n var property = prefixedUnitlessProperties[i];\n unitlessProperties[property] = true;\n\n for (var j = 0, jLen = prefixes.length; j < jLen; ++j) {\n unitlessProperties[getPrefixedProperty(prefixes[j], property)] = true;\n }\n} // add all hypenated properties as well\n\n\nfor (var _property in unitlessProperties) {\n unitlessProperties[hyphenateProperty(_property)] = true;\n}\n\nexport default function isUnitlessProperty(property) {\n return unitlessProperties.hasOwnProperty(property);\n}","var RE = /^(ms|Webkit|Moz|O)/;\nexport default function unprefixProperty(property) {\n var propertyWithoutPrefix = property.replace(RE, '');\n return propertyWithoutPrefix.charAt(0).toLowerCase() + propertyWithoutPrefix.slice(1);\n}","import camelCaseProperty from './camelCaseProperty';\nimport unprefixProperty from './unprefixProperty';\nexport default function normalizeProperty(property) {\n return unprefixProperty(camelCaseProperty(property));\n}","import hyphenateProperty from './hyphenateProperty';\nexport default function resolveArrayValue(property, value) {\n return value.join(';' + hyphenateProperty(property) + ':');\n}","var RE = /(-ms-|-webkit-|-moz-|-o-)/g;\nexport default function unprefixValue(value) {\n if (typeof value === 'string') {\n return value.replace(RE, '');\n }\n\n return value;\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports[\"default\"] = hyphenateProperty;\n\nvar _hyphenateStyleName = require(\"hyphenate-style-name\");\n\nvar _hyphenateStyleName2 = _interopRequireDefault(_hyphenateStyleName);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { \"default\": obj }; }\n\nfunction hyphenateProperty(property) {\n return (0, _hyphenateStyleName2[\"default\"])(property);\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports[\"default\"] = isPrefixedValue;\nvar RE = /-webkit-|-moz-|-ms-/;\n\nfunction isPrefixedValue(value) {\n return typeof value === 'string' && RE.test(value);\n}","'use strict';\n\nObject.defineProperty(exports, '__esModule', {\n value: true\n});\n\nfunction _interopDefault(ex) {\n return ex && typeof ex === 'object' && 'default' in ex ? ex['default'] : ex;\n}\n\nvar parse = require('postcss-value-parser');\n\nvar parse__default = _interopDefault(parse);\n\nvar camelizeStyleName = _interopDefault(require('camelize'));\n\nvar cssColorKeywords = _interopDefault(require('css-color-keywords'));\n\nvar matchString = function matchString(node) {\n if (node.type !== 'string') return null;\n return node.value.replace(/\\\\([0-9a-f]{1,6})(?:\\s|$)/gi, function (match, charCode) {\n return String.fromCharCode(parseInt(charCode, 16));\n }).replace(/\\\\/g, '');\n};\n\nvar hexColorRe = /^(#(?:[0-9a-f]{3,4}){1,2})$/i;\nvar cssFunctionNameRe = /^(rgba?|hsla?|hwb|lab|lch|gray|color)$/;\n\nvar matchColor = function matchColor(node) {\n if (node.type === 'word' && (hexColorRe.test(node.value) || node.value in cssColorKeywords || node.value === 'transparent')) {\n return node.value;\n } else if (node.type === 'function' && cssFunctionNameRe.test(node.value)) {\n return parse.stringify(node);\n }\n\n return null;\n};\n\nvar noneRe = /^(none)$/i;\nvar autoRe = /^(auto)$/i;\nvar identRe = /(^-?[_a-z][_a-z0-9-]*$)/i; // Note if these are wrong, you'll need to change index.js too\n\nvar numberRe = /^([+-]?(?:\\d*\\.)?\\d+(?:e[+-]?\\d+)?)$/i; // Note lengthRe is sneaky: you can omit units for 0\n\nvar lengthRe = /^(0$|(?:[+-]?(?:\\d*\\.)?\\d+(?:e[+-]?\\d+)?)(?=px$))/i;\nvar unsupportedUnitRe = /^([+-]?(?:\\d*\\.)?\\d+(?:e[+-]?\\d+)?(ch|em|ex|rem|vh|vw|vmin|vmax|cm|mm|in|pc|pt))$/i;\nvar angleRe = /^([+-]?(?:\\d*\\.)?\\d+(?:e[+-]?\\d+)?(?:deg|rad))$/i;\nvar percentRe = /^([+-]?(?:\\d*\\.)?\\d+(?:e[+-]?\\d+)?%)$/i;\n\nvar noopToken = function noopToken(predicate) {\n return function (node) {\n return predicate(node) ? '' : null;\n };\n};\n\nvar valueForTypeToken = function valueForTypeToken(type) {\n return function (node) {\n return node.type === type ? node.value : null;\n };\n};\n\nvar regExpToken = function regExpToken(regExp, transform) {\n if (transform === void 0) {\n transform = String;\n }\n\n return function (node) {\n if (node.type !== 'word') return null;\n var match = node.value.match(regExp);\n if (match === null) return null;\n var value = transform(match[1]);\n return value;\n };\n};\n\nvar SPACE = noopToken(function (node) {\n return node.type === 'space';\n});\nvar SLASH = noopToken(function (node) {\n return node.type === 'div' && node.value === '/';\n});\nvar COMMA = noopToken(function (node) {\n return node.type === 'div' && node.value === ',';\n});\nvar WORD = valueForTypeToken('word');\nvar NONE = regExpToken(noneRe);\nvar AUTO = regExpToken(autoRe);\nvar NUMBER = regExpToken(numberRe, Number);\nvar LENGTH = regExpToken(lengthRe, Number);\nvar UNSUPPORTED_LENGTH_UNIT = regExpToken(unsupportedUnitRe);\nvar ANGLE = regExpToken(angleRe, function (angle) {\n return angle.toLowerCase();\n});\nvar PERCENT = regExpToken(percentRe);\nvar IDENT = regExpToken(identRe);\nvar STRING = matchString;\nvar COLOR = matchColor;\nvar LINE = regExpToken(/^(none|underline|line-through)$/i);\n\nvar aspectRatio = function aspectRatio(tokenStream) {\n var aspectRatio = tokenStream.expect(NUMBER);\n\n if (tokenStream.hasTokens()) {\n tokenStream.expect(SLASH);\n aspectRatio /= tokenStream.expect(NUMBER);\n }\n\n return {\n aspectRatio: aspectRatio\n };\n};\n\nvar BORDER_STYLE = regExpToken(/^(solid|dashed|dotted)$/);\nvar defaultBorderWidth = 1;\nvar defaultBorderColor = 'black';\nvar defaultBorderStyle = 'solid';\n\nvar border = function border(tokenStream) {\n var borderWidth;\n var borderColor;\n var borderStyle;\n\n if (tokenStream.matches(NONE)) {\n tokenStream.expectEmpty();\n return {\n borderWidth: 0,\n borderColor: 'black',\n borderStyle: 'solid'\n };\n }\n\n var partsParsed = 0;\n\n while (partsParsed < 3 && tokenStream.hasTokens()) {\n if (partsParsed !== 0) tokenStream.expect(SPACE);\n\n if (borderWidth === undefined && tokenStream.matches(LENGTH, UNSUPPORTED_LENGTH_UNIT)) {\n borderWidth = tokenStream.lastValue;\n } else if (borderColor === undefined && tokenStream.matches(COLOR)) {\n borderColor = tokenStream.lastValue;\n } else if (borderStyle === undefined && tokenStream.matches(BORDER_STYLE)) {\n borderStyle = tokenStream.lastValue;\n } else {\n tokenStream[\"throw\"]();\n }\n\n partsParsed += 1;\n }\n\n tokenStream.expectEmpty();\n if (borderWidth === undefined) borderWidth = defaultBorderWidth;\n if (borderColor === undefined) borderColor = defaultBorderColor;\n if (borderStyle === undefined) borderStyle = defaultBorderStyle;\n return {\n borderWidth: borderWidth,\n borderColor: borderColor,\n borderStyle: borderStyle\n };\n};\n\nvar directionFactory = function directionFactory(_ref) {\n var _ref$types = _ref.types,\n types = _ref$types === void 0 ? [LENGTH, UNSUPPORTED_LENGTH_UNIT, PERCENT] : _ref$types,\n _ref$directions = _ref.directions,\n directions = _ref$directions === void 0 ? ['Top', 'Right', 'Bottom', 'Left'] : _ref$directions,\n _ref$prefix = _ref.prefix,\n prefix = _ref$prefix === void 0 ? '' : _ref$prefix,\n _ref$suffix = _ref.suffix,\n suffix = _ref$suffix === void 0 ? '' : _ref$suffix;\n return function (tokenStream) {\n var _ref2;\n\n var values = []; // borderWidth doesn't currently allow a percent value, but may do in the future\n\n values.push(tokenStream.expect.apply(tokenStream, types));\n\n while (values.length < 4 && tokenStream.hasTokens()) {\n tokenStream.expect(SPACE);\n values.push(tokenStream.expect.apply(tokenStream, types));\n }\n\n tokenStream.expectEmpty();\n var top = values[0],\n _values$ = values[1],\n right = _values$ === void 0 ? top : _values$,\n _values$2 = values[2],\n bottom = _values$2 === void 0 ? top : _values$2,\n _values$3 = values[3],\n left = _values$3 === void 0 ? right : _values$3;\n\n var keyFor = function keyFor(n) {\n return \"\" + prefix + directions[n] + suffix;\n };\n\n return _ref2 = {}, _ref2[keyFor(0)] = top, _ref2[keyFor(1)] = right, _ref2[keyFor(2)] = bottom, _ref2[keyFor(3)] = left, _ref2;\n };\n};\n\nvar parseShadowOffset = function parseShadowOffset(tokenStream) {\n var width = tokenStream.expect(LENGTH);\n var height = tokenStream.matches(SPACE) ? tokenStream.expect(LENGTH) : width;\n tokenStream.expectEmpty();\n return {\n width: width,\n height: height\n };\n};\n\nvar parseShadow = function parseShadow(tokenStream) {\n var offsetX;\n var offsetY;\n var radius;\n var color;\n\n if (tokenStream.matches(NONE)) {\n tokenStream.expectEmpty();\n return {\n offset: {\n width: 0,\n height: 0\n },\n radius: 0,\n color: 'black'\n };\n }\n\n var didParseFirst = false;\n\n while (tokenStream.hasTokens()) {\n if (didParseFirst) tokenStream.expect(SPACE);\n\n if (offsetX === undefined && tokenStream.matches(LENGTH, UNSUPPORTED_LENGTH_UNIT)) {\n offsetX = tokenStream.lastValue;\n tokenStream.expect(SPACE);\n offsetY = tokenStream.expect(LENGTH, UNSUPPORTED_LENGTH_UNIT);\n tokenStream.saveRewindPoint();\n\n if (tokenStream.matches(SPACE) && tokenStream.matches(LENGTH, UNSUPPORTED_LENGTH_UNIT)) {\n radius = tokenStream.lastValue;\n } else {\n tokenStream.rewind();\n }\n } else if (color === undefined && tokenStream.matches(COLOR)) {\n color = tokenStream.lastValue;\n } else {\n tokenStream[\"throw\"]();\n }\n\n didParseFirst = true;\n }\n\n if (offsetX === undefined) tokenStream[\"throw\"]();\n return {\n offset: {\n width: offsetX,\n height: offsetY\n },\n radius: radius !== undefined ? radius : 0,\n color: color !== undefined ? color : 'black'\n };\n};\n\nvar boxShadow = function boxShadow(tokenStream) {\n var _parseShadow = parseShadow(tokenStream),\n offset = _parseShadow.offset,\n radius = _parseShadow.radius,\n color = _parseShadow.color;\n\n return {\n shadowOffset: offset,\n shadowRadius: radius,\n shadowColor: color,\n shadowOpacity: 1\n };\n};\n\nvar defaultFlexGrow = 1;\nvar defaultFlexShrink = 1;\nvar defaultFlexBasis = 0;\n\nvar flex = function flex(tokenStream) {\n var flexGrow;\n var flexShrink;\n var flexBasis;\n\n if (tokenStream.matches(NONE)) {\n tokenStream.expectEmpty();\n return {\n flexGrow: 0,\n flexShrink: 0,\n flexBasis: 'auto'\n };\n }\n\n tokenStream.saveRewindPoint();\n\n if (tokenStream.matches(AUTO) && !tokenStream.hasTokens()) {\n return {\n flexGrow: 1,\n flexShrink: 1,\n flexBasis: 'auto'\n };\n }\n\n tokenStream.rewind();\n var partsParsed = 0;\n\n while (partsParsed < 2 && tokenStream.hasTokens()) {\n if (partsParsed !== 0) tokenStream.expect(SPACE);\n\n if (flexGrow === undefined && tokenStream.matches(NUMBER)) {\n flexGrow = tokenStream.lastValue;\n tokenStream.saveRewindPoint();\n\n if (tokenStream.matches(SPACE) && tokenStream.matches(NUMBER)) {\n flexShrink = tokenStream.lastValue;\n } else {\n tokenStream.rewind();\n }\n } else if (flexBasis === undefined && tokenStream.matches(LENGTH, UNSUPPORTED_LENGTH_UNIT, PERCENT)) {\n flexBasis = tokenStream.lastValue;\n } else if (flexBasis === undefined && tokenStream.matches(AUTO)) {\n flexBasis = 'auto';\n } else {\n tokenStream[\"throw\"]();\n }\n\n partsParsed += 1;\n }\n\n tokenStream.expectEmpty();\n if (flexGrow === undefined) flexGrow = defaultFlexGrow;\n if (flexShrink === undefined) flexShrink = defaultFlexShrink;\n if (flexBasis === undefined) flexBasis = defaultFlexBasis;\n return {\n flexGrow: flexGrow,\n flexShrink: flexShrink,\n flexBasis: flexBasis\n };\n};\n\nvar FLEX_WRAP = regExpToken(/(nowrap|wrap|wrap-reverse)/);\nvar FLEX_DIRECTION = regExpToken(/(row|row-reverse|column|column-reverse)/);\nvar defaultFlexWrap = 'nowrap';\nvar defaultFlexDirection = 'row';\n\nvar flexFlow = function flexFlow(tokenStream) {\n var flexWrap;\n var flexDirection;\n var partsParsed = 0;\n\n while (partsParsed < 2 && tokenStream.hasTokens()) {\n if (partsParsed !== 0) tokenStream.expect(SPACE);\n\n if (flexWrap === undefined && tokenStream.matches(FLEX_WRAP)) {\n flexWrap = tokenStream.lastValue;\n } else if (flexDirection === undefined && tokenStream.matches(FLEX_DIRECTION)) {\n flexDirection = tokenStream.lastValue;\n } else {\n tokenStream[\"throw\"]();\n }\n\n partsParsed += 1;\n }\n\n tokenStream.expectEmpty();\n if (flexWrap === undefined) flexWrap = defaultFlexWrap;\n if (flexDirection === undefined) flexDirection = defaultFlexDirection;\n return {\n flexWrap: flexWrap,\n flexDirection: flexDirection\n };\n};\n\nvar fontFamily = function fontFamily(tokenStream) {\n var fontFamily;\n\n if (tokenStream.matches(STRING)) {\n fontFamily = tokenStream.lastValue;\n } else {\n fontFamily = tokenStream.expect(IDENT);\n\n while (tokenStream.hasTokens()) {\n tokenStream.expect(SPACE);\n var nextIdent = tokenStream.expect(IDENT);\n fontFamily += \" \" + nextIdent;\n }\n }\n\n tokenStream.expectEmpty();\n return {\n fontFamily: fontFamily\n };\n};\n\nvar NORMAL = regExpToken(/^(normal)$/);\nvar STYLE = regExpToken(/^(italic)$/);\nvar WEIGHT = regExpToken(/^([1-9]00|bold)$/);\nvar VARIANT = regExpToken(/^(small-caps)$/);\nvar defaultFontStyle = 'normal';\nvar defaultFontWeight = 'normal';\nvar defaultFontVariant = [];\n\nvar font = function font(tokenStream) {\n var fontStyle;\n var fontWeight;\n var fontVariant; // let fontSize;\n\n var lineHeight; // let fontFamily;\n\n var numStyleWeightVariantMatched = 0;\n\n while (numStyleWeightVariantMatched < 3 && tokenStream.hasTokens()) {\n if (tokenStream.matches(NORMAL)) ;else if (fontStyle === undefined && tokenStream.matches(STYLE)) {\n fontStyle = tokenStream.lastValue;\n } else if (fontWeight === undefined && tokenStream.matches(WEIGHT)) {\n fontWeight = tokenStream.lastValue;\n } else if (fontVariant === undefined && tokenStream.matches(VARIANT)) {\n fontVariant = [tokenStream.lastValue];\n } else {\n break;\n }\n tokenStream.expect(SPACE);\n numStyleWeightVariantMatched += 1;\n }\n\n var fontSize = tokenStream.expect(LENGTH, UNSUPPORTED_LENGTH_UNIT);\n\n if (tokenStream.matches(SLASH)) {\n lineHeight = tokenStream.expect(LENGTH, UNSUPPORTED_LENGTH_UNIT);\n }\n\n tokenStream.expect(SPACE);\n\n var _fontFamily = fontFamily(tokenStream),\n fontFamily$1 = _fontFamily.fontFamily;\n\n if (fontStyle === undefined) fontStyle = defaultFontStyle;\n if (fontWeight === undefined) fontWeight = defaultFontWeight;\n if (fontVariant === undefined) fontVariant = defaultFontVariant;\n var out = {\n fontStyle: fontStyle,\n fontWeight: fontWeight,\n fontVariant: fontVariant,\n fontSize: fontSize,\n fontFamily: fontFamily$1\n };\n if (lineHeight !== undefined) out.lineHeight = lineHeight;\n return out;\n};\n\nvar fontVariant = function fontVariant(tokenStream) {\n var values = [tokenStream.expect(IDENT)];\n\n while (tokenStream.hasTokens()) {\n tokenStream.expect(SPACE);\n values.push(tokenStream.expect(IDENT));\n }\n\n return {\n fontVariant: values\n };\n};\n\nvar ALIGN_CONTENT = regExpToken(/(flex-(?:start|end)|center|stretch|space-(?:between|around))/);\nvar JUSTIFY_CONTENT = regExpToken(/(flex-(?:start|end)|center|space-(?:between|around|evenly))/);\n\nvar placeContent = function placeContent(tokenStream) {\n var alignContent = tokenStream.expect(ALIGN_CONTENT);\n var justifyContent;\n\n if (tokenStream.hasTokens()) {\n tokenStream.expect(SPACE);\n justifyContent = tokenStream.expect(JUSTIFY_CONTENT);\n } else {\n justifyContent = 'stretch';\n }\n\n tokenStream.expectEmpty();\n return {\n alignContent: alignContent,\n justifyContent: justifyContent\n };\n};\n\nvar STYLE$1 = regExpToken(/^(solid|double|dotted|dashed)$/);\nvar defaultTextDecorationLine = 'none';\nvar defaultTextDecorationStyle = 'solid';\nvar defaultTextDecorationColor = 'black';\n\nvar textDecoration = function textDecoration(tokenStream) {\n var line;\n var style;\n var color;\n var didParseFirst = false;\n\n while (tokenStream.hasTokens()) {\n if (didParseFirst) tokenStream.expect(SPACE);\n\n if (line === undefined && tokenStream.matches(LINE)) {\n var lines = [tokenStream.lastValue.toLowerCase()];\n tokenStream.saveRewindPoint();\n\n if (lines[0] !== 'none' && tokenStream.matches(SPACE) && tokenStream.matches(LINE)) {\n lines.push(tokenStream.lastValue.toLowerCase()); // Underline comes before line-through\n\n lines.sort().reverse();\n } else {\n tokenStream.rewind();\n }\n\n line = lines.join(' ');\n } else if (style === undefined && tokenStream.matches(STYLE$1)) {\n style = tokenStream.lastValue;\n } else if (color === undefined && tokenStream.matches(COLOR)) {\n color = tokenStream.lastValue;\n } else {\n tokenStream[\"throw\"]();\n }\n\n didParseFirst = true;\n }\n\n return {\n textDecorationLine: line !== undefined ? line : defaultTextDecorationLine,\n textDecorationColor: color !== undefined ? color : defaultTextDecorationColor,\n textDecorationStyle: style !== undefined ? style : defaultTextDecorationStyle\n };\n};\n\nvar textDecorationLine = function textDecorationLine(tokenStream) {\n var lines = [];\n var didParseFirst = false;\n\n while (tokenStream.hasTokens()) {\n if (didParseFirst) tokenStream.expect(SPACE);\n lines.push(tokenStream.expect(LINE).toLowerCase());\n didParseFirst = true;\n }\n\n lines.sort().reverse();\n return {\n textDecorationLine: lines.join(' ')\n };\n};\n\nvar textShadow = function textShadow(tokenStream) {\n var _parseShadow2 = parseShadow(tokenStream),\n offset = _parseShadow2.offset,\n radius = _parseShadow2.radius,\n color = _parseShadow2.color;\n\n return {\n textShadowOffset: offset,\n textShadowRadius: radius,\n textShadowColor: color\n };\n};\n\nvar oneOfType = function oneOfType(tokenType) {\n return function (functionStream) {\n var value = functionStream.expect(tokenType);\n functionStream.expectEmpty();\n return value;\n };\n};\n\nvar singleNumber = oneOfType(NUMBER);\nvar singleLength = oneOfType(LENGTH);\nvar singleAngle = oneOfType(ANGLE);\n\nvar xyTransformFactory = function xyTransformFactory(tokenType) {\n return function (key, valueIfOmitted) {\n return function (functionStream) {\n var _ref3, _ref4;\n\n var x = functionStream.expect(tokenType);\n var y;\n\n if (functionStream.hasTokens()) {\n functionStream.expect(COMMA);\n y = functionStream.expect(tokenType);\n } else if (valueIfOmitted !== undefined) {\n y = valueIfOmitted;\n } else {\n // Assumption, if x === y, then we can omit XY\n // I.e. scale(5) => [{ scale: 5 }] rather than [{ scaleX: 5 }, { scaleY: 5 }]\n return x;\n }\n\n functionStream.expectEmpty();\n return [(_ref3 = {}, _ref3[key + \"Y\"] = y, _ref3), (_ref4 = {}, _ref4[key + \"X\"] = x, _ref4)];\n };\n };\n};\n\nvar xyNumber = xyTransformFactory(NUMBER);\nvar xyLength = xyTransformFactory(LENGTH);\nvar xyAngle = xyTransformFactory(ANGLE);\nvar partTransforms = {\n perspective: singleNumber,\n scale: xyNumber('scale'),\n scaleX: singleNumber,\n scaleY: singleNumber,\n translate: xyLength('translate', 0),\n translateX: singleLength,\n translateY: singleLength,\n rotate: singleAngle,\n rotateX: singleAngle,\n rotateY: singleAngle,\n rotateZ: singleAngle,\n skewX: singleAngle,\n skewY: singleAngle,\n skew: xyAngle('skew', '0deg')\n};\n\nvar transform = function transform(tokenStream) {\n var transforms = [];\n var didParseFirst = false;\n\n while (tokenStream.hasTokens()) {\n if (didParseFirst) tokenStream.expect(SPACE);\n var functionStream = tokenStream.expectFunction();\n var functionName = functionStream.functionName;\n var transformedValues = partTransforms[functionName](functionStream);\n\n if (!Array.isArray(transformedValues)) {\n var _ref5;\n\n transformedValues = [(_ref5 = {}, _ref5[functionName] = transformedValues, _ref5)];\n }\n\n transforms = transformedValues.concat(transforms);\n didParseFirst = true;\n }\n\n return {\n transform: transforms\n };\n};\n\nvar background = function background(tokenStream) {\n return {\n backgroundColor: tokenStream.expect(COLOR)\n };\n};\n\nvar borderColor = directionFactory({\n types: [COLOR],\n prefix: 'border',\n suffix: 'Color'\n});\nvar borderRadius = directionFactory({\n directions: ['TopLeft', 'TopRight', 'BottomRight', 'BottomLeft'],\n prefix: 'border',\n suffix: 'Radius'\n});\nvar borderWidth = directionFactory({\n prefix: 'border',\n suffix: 'Width'\n});\nvar margin = directionFactory({\n types: [LENGTH, UNSUPPORTED_LENGTH_UNIT, PERCENT, AUTO],\n prefix: 'margin'\n});\nvar padding = directionFactory({\n prefix: 'padding'\n});\n\nvar fontWeight = function fontWeight(tokenStream) {\n return {\n fontWeight: tokenStream.expect(WORD) // Also match numbers as strings\n\n };\n};\n\nvar shadowOffset = function shadowOffset(tokenStream) {\n return {\n shadowOffset: parseShadowOffset(tokenStream)\n };\n};\n\nvar textShadowOffset = function textShadowOffset(tokenStream) {\n return {\n textShadowOffset: parseShadowOffset(tokenStream)\n };\n};\n\nvar transforms = {\n aspectRatio: aspectRatio,\n background: background,\n border: border,\n borderColor: borderColor,\n borderRadius: borderRadius,\n borderWidth: borderWidth,\n boxShadow: boxShadow,\n flex: flex,\n flexFlow: flexFlow,\n font: font,\n fontFamily: fontFamily,\n fontVariant: fontVariant,\n fontWeight: fontWeight,\n margin: margin,\n padding: padding,\n placeContent: placeContent,\n shadowOffset: shadowOffset,\n textShadow: textShadow,\n textShadowOffset: textShadowOffset,\n textDecoration: textDecoration,\n textDecorationLine: textDecorationLine,\n transform: transform\n};\nvar propertiesWithoutUnits;\n\nif (process.env.NODE_ENV !== 'production') {\n propertiesWithoutUnits = ['aspectRatio', 'elevation', 'flexGrow', 'flexShrink', 'opacity', 'shadowOpacity', 'zIndex'];\n}\n\nvar devPropertiesWithUnitsRegExp = propertiesWithoutUnits != null ? new RegExp(propertiesWithoutUnits.join('|')) : null;\nvar SYMBOL_MATCH = 'SYMBOL_MATCH';\n\nvar TokenStream =\n/*#__PURE__*/\nfunction () {\n function TokenStream(nodes, parent) {\n this.index = 0;\n this.nodes = nodes;\n this.functionName = parent != null ? parent.value : null;\n this.lastValue = null;\n this.rewindIndex = -1;\n }\n\n var _proto = TokenStream.prototype;\n\n _proto.hasTokens = function hasTokens() {\n return this.index <= this.nodes.length - 1;\n };\n\n _proto[SYMBOL_MATCH] = function () {\n if (!this.hasTokens()) return null;\n var node = this.nodes[this.index];\n\n for (var i = 0; i < arguments.length; i += 1) {\n var tokenDescriptor = i < 0 || arguments.length <= i ? undefined : arguments[i];\n var value = tokenDescriptor(node);\n\n if (value !== null) {\n this.index += 1;\n this.lastValue = value;\n return value;\n }\n }\n\n return null;\n };\n\n _proto.matches = function matches() {\n return this[SYMBOL_MATCH].apply(this, arguments) !== null;\n };\n\n _proto.expect = function expect() {\n var value = this[SYMBOL_MATCH].apply(this, arguments);\n return value !== null ? value : this[\"throw\"]();\n };\n\n _proto.matchesFunction = function matchesFunction() {\n var node = this.nodes[this.index];\n if (node.type !== 'function') return null;\n var value = new TokenStream(node.nodes, node);\n this.index += 1;\n this.lastValue = null;\n return value;\n };\n\n _proto.expectFunction = function expectFunction() {\n var value = this.matchesFunction();\n return value !== null ? value : this[\"throw\"]();\n };\n\n _proto.expectEmpty = function expectEmpty() {\n if (this.hasTokens()) this[\"throw\"]();\n };\n\n _proto[\"throw\"] = function _throw() {\n throw new Error(\"Unexpected token type: \" + this.nodes[this.index].type);\n };\n\n _proto.saveRewindPoint = function saveRewindPoint() {\n this.rewindIndex = this.index;\n };\n\n _proto.rewind = function rewind() {\n if (this.rewindIndex === -1) throw new Error('Internal error');\n this.index = this.rewindIndex;\n this.lastValue = null;\n };\n\n return TokenStream;\n}();\n/* eslint-disable no-param-reassign */\n// Note if this is wrong, you'll need to change tokenTypes.js too\n\n\nvar numberOrLengthRe = /^([+-]?(?:\\d*\\.)?\\d+(?:e[+-]?\\d+)?)(?:px)?$/i;\nvar numberOnlyRe = /^[+-]?(?:\\d*\\.\\d*|[1-9]\\d*)(?:e[+-]?\\d+)?$/i;\nvar boolRe = /^true|false$/i;\nvar nullRe = /^null$/i;\nvar undefinedRe = /^undefined$/i; // Undocumented export\n\nvar transformRawValue = function transformRawValue(propName, value) {\n if (process.env.NODE_ENV !== 'production') {\n var needsUnit = !devPropertiesWithUnitsRegExp.test(propName);\n var isNumberWithoutUnit = numberOnlyRe.test(value);\n\n if (needsUnit && isNumberWithoutUnit) {\n // eslint-disable-next-line no-console\n console.warn(\"Expected style \\\"\" + propName + \": \" + value + \"\\\" to contain units\");\n }\n\n if (!needsUnit && value !== '0' && !isNumberWithoutUnit) {\n // eslint-disable-next-line no-console\n console.warn(\"Expected style \\\"\" + propName + \": \" + value + \"\\\" to be unitless\");\n }\n }\n\n var numberMatch = value.match(numberOrLengthRe);\n if (numberMatch !== null) return Number(numberMatch[1]);\n var boolMatch = value.match(boolRe);\n if (boolMatch !== null) return boolMatch[0].toLowerCase() === 'true';\n var nullMatch = value.match(nullRe);\n if (nullMatch !== null) return null;\n var undefinedMatch = value.match(undefinedRe);\n if (undefinedMatch !== null) return undefined;\n return value;\n};\n\nvar baseTransformShorthandValue = function baseTransformShorthandValue(propName, value) {\n var ast = parse__default(value);\n var tokenStream = new TokenStream(ast.nodes);\n return transforms[propName](tokenStream);\n};\n\nvar transformShorthandValue = process.env.NODE_ENV === 'production' ? baseTransformShorthandValue : function (propName, value) {\n try {\n return baseTransformShorthandValue(propName, value);\n } catch (e) {\n throw new Error(\"Failed to parse declaration \\\"\" + propName + \": \" + value + \"\\\"\");\n }\n};\n\nvar getStylesForProperty = function getStylesForProperty(propName, inputValue, allowShorthand) {\n var _ref6;\n\n var isRawValue = allowShorthand === false || !(propName in transforms);\n var value = inputValue.trim();\n var propValues = isRawValue ? (_ref6 = {}, _ref6[propName] = transformRawValue(propName, value), _ref6) : transformShorthandValue(propName, value);\n return propValues;\n};\n\nvar getPropertyName = function getPropertyName(propName) {\n var isCustomProp = /^--\\w+/.test(propName);\n\n if (isCustomProp) {\n return propName;\n }\n\n return camelizeStyleName(propName);\n};\n\nvar index = function index(rules, shorthandBlacklist) {\n if (shorthandBlacklist === void 0) {\n shorthandBlacklist = [];\n }\n\n return rules.reduce(function (accum, rule) {\n var propertyName = getPropertyName(rule[0]);\n var value = rule[1];\n var allowShorthand = shorthandBlacklist.indexOf(propertyName) === -1;\n return Object.assign(accum, getStylesForProperty(propertyName, value, allowShorthand));\n }, {});\n};\n\nexports[\"default\"] = index;\nexports.getPropertyName = getPropertyName;\nexports.getStylesForProperty = getStylesForProperty;\nexports.transformRawValue = transformRawValue;\n","'use strict';\nvar token = '%[a-f0-9]{2}';\nvar singleMatcher = new RegExp('(' + token + ')|([^%]+?)', 'gi');\nvar multiMatcher = new RegExp('(' + token + ')+', 'gi');\n\nfunction decodeComponents(components, split) {\n\ttry {\n\t\t// Try to decode the entire string first\n\t\treturn [decodeURIComponent(components.join(''))];\n\t} catch (err) {\n\t\t// Do nothing\n\t}\n\n\tif (components.length === 1) {\n\t\treturn components;\n\t}\n\n\tsplit = split || 1;\n\n\t// Split the array in 2 parts\n\tvar left = components.slice(0, split);\n\tvar right = components.slice(split);\n\n\treturn Array.prototype.concat.call([], decodeComponents(left), decodeComponents(right));\n}\n\nfunction decode(input) {\n\ttry {\n\t\treturn decodeURIComponent(input);\n\t} catch (err) {\n\t\tvar tokens = input.match(singleMatcher) || [];\n\n\t\tfor (var i = 1; i < tokens.length; i++) {\n\t\t\tinput = decodeComponents(tokens, i).join('');\n\n\t\t\ttokens = input.match(singleMatcher) || [];\n\t\t}\n\n\t\treturn input;\n\t}\n}\n\nfunction customDecodeURIComponent(input) {\n\t// Keep track of all the replacements and prefill the map with the `BOM`\n\tvar replaceMap = {\n\t\t'%FE%FF': '\\uFFFD\\uFFFD',\n\t\t'%FF%FE': '\\uFFFD\\uFFFD'\n\t};\n\n\tvar match = multiMatcher.exec(input);\n\twhile (match) {\n\t\ttry {\n\t\t\t// Decode as big chunks as possible\n\t\t\treplaceMap[match[0]] = decodeURIComponent(match[0]);\n\t\t} catch (err) {\n\t\t\tvar result = decode(match[0]);\n\n\t\t\tif (result !== match[0]) {\n\t\t\t\treplaceMap[match[0]] = result;\n\t\t\t}\n\t\t}\n\n\t\tmatch = multiMatcher.exec(input);\n\t}\n\n\t// Add `%C2` at the end of the map to make sure it does not replace the combinator before everything else\n\treplaceMap['%C2'] = '\\uFFFD';\n\n\tvar entries = Object.keys(replaceMap);\n\n\tfor (var i = 0; i < entries.length; i++) {\n\t\t// Replace all decoded components\n\t\tvar key = entries[i];\n\t\tinput = input.replace(new RegExp(key, 'g'), replaceMap[key]);\n\t}\n\n\treturn input;\n}\n\nmodule.exports = function (encodedURI) {\n\tif (typeof encodedURI !== 'string') {\n\t\tthrow new TypeError('Expected `encodedURI` to be of type `string`, got `' + typeof encodedURI + '`');\n\t}\n\n\ttry {\n\t\tencodedURI = encodedURI.replace(/\\+/g, ' ');\n\n\t\t// Try the built in decoder first\n\t\treturn decodeURIComponent(encodedURI);\n\t} catch (err) {\n\t\t// Fallback to a more advanced decoder\n\t\treturn customDecodeURIComponent(encodedURI);\n\t}\n};\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.attributeNames = exports.elementNames = void 0;\nexports.elementNames = new Map([\n [\"altglyph\", \"altGlyph\"],\n [\"altglyphdef\", \"altGlyphDef\"],\n [\"altglyphitem\", \"altGlyphItem\"],\n [\"animatecolor\", \"animateColor\"],\n [\"animatemotion\", \"animateMotion\"],\n [\"animatetransform\", \"animateTransform\"],\n [\"clippath\", \"clipPath\"],\n [\"feblend\", \"feBlend\"],\n [\"fecolormatrix\", \"feColorMatrix\"],\n [\"fecomponenttransfer\", \"feComponentTransfer\"],\n [\"fecomposite\", \"feComposite\"],\n [\"feconvolvematrix\", \"feConvolveMatrix\"],\n [\"fediffuselighting\", \"feDiffuseLighting\"],\n [\"fedisplacementmap\", \"feDisplacementMap\"],\n [\"fedistantlight\", \"feDistantLight\"],\n [\"fedropshadow\", \"feDropShadow\"],\n [\"feflood\", \"feFlood\"],\n [\"fefunca\", \"feFuncA\"],\n [\"fefuncb\", \"feFuncB\"],\n [\"fefuncg\", \"feFuncG\"],\n [\"fefuncr\", \"feFuncR\"],\n [\"fegaussianblur\", \"feGaussianBlur\"],\n [\"feimage\", \"feImage\"],\n [\"femerge\", \"feMerge\"],\n [\"femergenode\", \"feMergeNode\"],\n [\"femorphology\", \"feMorphology\"],\n [\"feoffset\", \"feOffset\"],\n [\"fepointlight\", \"fePointLight\"],\n [\"fespecularlighting\", \"feSpecularLighting\"],\n [\"fespotlight\", \"feSpotLight\"],\n [\"fetile\", \"feTile\"],\n [\"feturbulence\", \"feTurbulence\"],\n [\"foreignobject\", \"foreignObject\"],\n [\"glyphref\", \"glyphRef\"],\n [\"lineargradient\", \"linearGradient\"],\n [\"radialgradient\", \"radialGradient\"],\n [\"textpath\", \"textPath\"],\n]);\nexports.attributeNames = new Map([\n [\"definitionurl\", \"definitionURL\"],\n [\"attributename\", \"attributeName\"],\n [\"attributetype\", \"attributeType\"],\n [\"basefrequency\", \"baseFrequency\"],\n [\"baseprofile\", \"baseProfile\"],\n [\"calcmode\", \"calcMode\"],\n [\"clippathunits\", \"clipPathUnits\"],\n [\"diffuseconstant\", \"diffuseConstant\"],\n [\"edgemode\", \"edgeMode\"],\n [\"filterunits\", \"filterUnits\"],\n [\"glyphref\", \"glyphRef\"],\n [\"gradienttransform\", \"gradientTransform\"],\n [\"gradientunits\", \"gradientUnits\"],\n [\"kernelmatrix\", \"kernelMatrix\"],\n [\"kernelunitlength\", \"kernelUnitLength\"],\n [\"keypoints\", \"keyPoints\"],\n [\"keysplines\", \"keySplines\"],\n [\"keytimes\", \"keyTimes\"],\n [\"lengthadjust\", \"lengthAdjust\"],\n [\"limitingconeangle\", \"limitingConeAngle\"],\n [\"markerheight\", \"markerHeight\"],\n [\"markerunits\", \"markerUnits\"],\n [\"markerwidth\", \"markerWidth\"],\n [\"maskcontentunits\", \"maskContentUnits\"],\n [\"maskunits\", \"maskUnits\"],\n [\"numoctaves\", \"numOctaves\"],\n [\"pathlength\", \"pathLength\"],\n [\"patterncontentunits\", \"patternContentUnits\"],\n [\"patterntransform\", \"patternTransform\"],\n [\"patternunits\", \"patternUnits\"],\n [\"pointsatx\", \"pointsAtX\"],\n [\"pointsaty\", \"pointsAtY\"],\n [\"pointsatz\", \"pointsAtZ\"],\n [\"preservealpha\", \"preserveAlpha\"],\n [\"preserveaspectratio\", \"preserveAspectRatio\"],\n [\"primitiveunits\", \"primitiveUnits\"],\n [\"refx\", \"refX\"],\n [\"refy\", \"refY\"],\n [\"repeatcount\", \"repeatCount\"],\n [\"repeatdur\", \"repeatDur\"],\n [\"requiredextensions\", \"requiredExtensions\"],\n [\"requiredfeatures\", \"requiredFeatures\"],\n [\"specularconstant\", \"specularConstant\"],\n [\"specularexponent\", \"specularExponent\"],\n [\"spreadmethod\", \"spreadMethod\"],\n [\"startoffset\", \"startOffset\"],\n [\"stddeviation\", \"stdDeviation\"],\n [\"stitchtiles\", \"stitchTiles\"],\n [\"surfacescale\", \"surfaceScale\"],\n [\"systemlanguage\", \"systemLanguage\"],\n [\"tablevalues\", \"tableValues\"],\n [\"targetx\", \"targetX\"],\n [\"targety\", \"targetY\"],\n [\"textlength\", \"textLength\"],\n [\"viewbox\", \"viewBox\"],\n [\"viewtarget\", \"viewTarget\"],\n [\"xchannelselector\", \"xChannelSelector\"],\n [\"ychannelselector\", \"yChannelSelector\"],\n [\"zoomandpan\", \"zoomAndPan\"],\n]);\n","\"use strict\";\nvar __assign = (this && this.__assign) || function () {\n __assign = Object.assign || function(t) {\n for (var s, i = 1, n = arguments.length; i < n; i++) {\n s = arguments[i];\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p))\n t[p] = s[p];\n }\n return t;\n };\n return __assign.apply(this, arguments);\n};\nvar __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {\n if (k2 === undefined) k2 = k;\n Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });\n}) : (function(o, m, k, k2) {\n if (k2 === undefined) k2 = k;\n o[k2] = m[k];\n}));\nvar __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\n}) : function(o, v) {\n o[\"default\"] = v;\n});\nvar __importStar = (this && this.__importStar) || function (mod) {\n if (mod && mod.__esModule) return mod;\n var result = {};\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\n __setModuleDefault(result, mod);\n return result;\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\n/*\n * Module dependencies\n */\nvar ElementType = __importStar(require(\"domelementtype\"));\nvar entities_1 = require(\"entities\");\n/**\n * Mixed-case SVG and MathML tags & attributes\n * recognized by the HTML parser.\n *\n * @see https://html.spec.whatwg.org/multipage/parsing.html#parsing-main-inforeign\n */\nvar foreignNames_1 = require(\"./foreignNames\");\nvar unencodedElements = new Set([\n \"style\",\n \"script\",\n \"xmp\",\n \"iframe\",\n \"noembed\",\n \"noframes\",\n \"plaintext\",\n \"noscript\",\n]);\n/**\n * Format attributes\n */\nfunction formatAttributes(attributes, opts) {\n if (!attributes)\n return;\n return Object.keys(attributes)\n .map(function (key) {\n var _a, _b;\n var value = (_a = attributes[key]) !== null && _a !== void 0 ? _a : \"\";\n if (opts.xmlMode === \"foreign\") {\n /* Fix up mixed-case attribute names */\n key = (_b = foreignNames_1.attributeNames.get(key)) !== null && _b !== void 0 ? _b : key;\n }\n if (!opts.emptyAttrs && !opts.xmlMode && value === \"\") {\n return key;\n }\n return key + \"=\\\"\" + (opts.decodeEntities !== false\n ? entities_1.encodeXML(value)\n : value.replace(/\"/g, \""\")) + \"\\\"\";\n })\n .join(\" \");\n}\n/**\n * Self-enclosing tags\n */\nvar singleTag = new Set([\n \"area\",\n \"base\",\n \"basefont\",\n \"br\",\n \"col\",\n \"command\",\n \"embed\",\n \"frame\",\n \"hr\",\n \"img\",\n \"input\",\n \"isindex\",\n \"keygen\",\n \"link\",\n \"meta\",\n \"param\",\n \"source\",\n \"track\",\n \"wbr\",\n]);\n/**\n * Renders a DOM node or an array of DOM nodes to a string.\n *\n * Can be thought of as the equivalent of the `outerHTML` of the passed node(s).\n *\n * @param node Node to be rendered.\n * @param options Changes serialization behavior\n */\nfunction render(node, options) {\n if (options === void 0) { options = {}; }\n var nodes = \"length\" in node ? node : [node];\n var output = \"\";\n for (var i = 0; i < nodes.length; i++) {\n output += renderNode(nodes[i], options);\n }\n return output;\n}\nexports.default = render;\nfunction renderNode(node, options) {\n switch (node.type) {\n case ElementType.Root:\n return render(node.children, options);\n case ElementType.Directive:\n case ElementType.Doctype:\n return renderDirective(node);\n case ElementType.Comment:\n return renderComment(node);\n case ElementType.CDATA:\n return renderCdata(node);\n case ElementType.Script:\n case ElementType.Style:\n case ElementType.Tag:\n return renderTag(node, options);\n case ElementType.Text:\n return renderText(node, options);\n }\n}\nvar foreignModeIntegrationPoints = new Set([\n \"mi\",\n \"mo\",\n \"mn\",\n \"ms\",\n \"mtext\",\n \"annotation-xml\",\n \"foreignObject\",\n \"desc\",\n \"title\",\n]);\nvar foreignElements = new Set([\"svg\", \"math\"]);\nfunction renderTag(elem, opts) {\n var _a;\n // Handle SVG / MathML in HTML\n if (opts.xmlMode === \"foreign\") {\n /* Fix up mixed-case element names */\n elem.name = (_a = foreignNames_1.elementNames.get(elem.name)) !== null && _a !== void 0 ? _a : elem.name;\n /* Exit foreign mode at integration points */\n if (elem.parent &&\n foreignModeIntegrationPoints.has(elem.parent.name)) {\n opts = __assign(__assign({}, opts), { xmlMode: false });\n }\n }\n if (!opts.xmlMode && foreignElements.has(elem.name)) {\n opts = __assign(__assign({}, opts), { xmlMode: \"foreign\" });\n }\n var tag = \"<\" + elem.name;\n var attribs = formatAttributes(elem.attribs, opts);\n if (attribs) {\n tag += \" \" + attribs;\n }\n if (elem.children.length === 0 &&\n (opts.xmlMode\n ? // In XML mode or foreign mode, and user hasn't explicitly turned off self-closing tags\n opts.selfClosingTags !== false\n : // User explicitly asked for self-closing tags, even in HTML mode\n opts.selfClosingTags && singleTag.has(elem.name))) {\n if (!opts.xmlMode)\n tag += \" \";\n tag += \"/>\";\n }\n else {\n tag += \">\";\n if (elem.children.length > 0) {\n tag += render(elem.children, opts);\n }\n if (opts.xmlMode || !singleTag.has(elem.name)) {\n tag += \"\" + elem.name + \">\";\n }\n }\n return tag;\n}\nfunction renderDirective(elem) {\n return \"<\" + elem.data + \">\";\n}\nfunction renderText(elem, opts) {\n var data = elem.data || \"\";\n // If entities weren't decoded, no need to encode them back\n if (opts.decodeEntities !== false &&\n !(!opts.xmlMode &&\n elem.parent &&\n unencodedElements.has(elem.parent.name))) {\n data = entities_1.encodeXML(data);\n }\n return data;\n}\nfunction renderCdata(elem) {\n return \"\";\n}\nfunction renderComment(elem) {\n return \"\";\n}\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.Doctype = exports.CDATA = exports.Tag = exports.Style = exports.Script = exports.Comment = exports.Directive = exports.Text = exports.Root = exports.isTag = exports.ElementType = void 0;\n/** Types of elements found in htmlparser2's DOM */\nvar ElementType;\n(function (ElementType) {\n /** Type for the root element of a document */\n ElementType[\"Root\"] = \"root\";\n /** Type for Text */\n ElementType[\"Text\"] = \"text\";\n /** Type for ... ?> */\n ElementType[\"Directive\"] = \"directive\";\n /** Type for */\n ElementType[\"Comment\"] = \"comment\";\n /** Type for `.\n this.sequenceIndex = Number(c === 60 /* Lt */);\n }\n };\n Tokenizer.prototype.stateCDATASequence = function (c) {\n if (c === Sequences.Cdata[this.sequenceIndex]) {\n if (++this.sequenceIndex === Sequences.Cdata.length) {\n this._state = 21 /* InCommentLike */;\n this.currentSequence = Sequences.CdataEnd;\n this.sequenceIndex = 0;\n this.sectionStart = this._index + 1;\n }\n }\n else {\n this.sequenceIndex = 0;\n this._state = 16 /* InDeclaration */;\n this.stateInDeclaration(c); // Reconsume the character\n }\n };\n /**\n * When we wait for one specific character, we can speed things up\n * by skipping through the buffer until we find it.\n *\n * @returns Whether the character was found.\n */\n Tokenizer.prototype.fastForwardTo = function (c) {\n while (++this._index < this.buffer.length) {\n if (this.buffer.charCodeAt(this._index) === c) {\n return true;\n }\n }\n /*\n * We increment the index at the end of the `parse` loop,\n * so set it to `buffer.length - 1` here.\n *\n * TODO: Refactor `parse` to increment index before calling states.\n */\n this._index = this.buffer.length - 1;\n return false;\n };\n /**\n * Comments and CDATA end with `-->` and `]]>`.\n *\n * Their common qualities are:\n * - Their end sequences have a distinct character they start with.\n * - That character is then repeated, so we have to check multiple repeats.\n * - All characters but the start character of the sequence can be skipped.\n */\n Tokenizer.prototype.stateInCommentLike = function (c) {\n if (c === this.currentSequence[this.sequenceIndex]) {\n if (++this.sequenceIndex === this.currentSequence.length) {\n // Remove 2 trailing chars\n var section = this.buffer.slice(this.sectionStart, this._index - 2);\n if (this.currentSequence === Sequences.CdataEnd) {\n this.cbs.oncdata(section);\n }\n else {\n this.cbs.oncomment(section);\n }\n this.sequenceIndex = 0;\n this.sectionStart = this._index + 1;\n this._state = 1 /* Text */;\n }\n }\n else if (this.sequenceIndex === 0) {\n // Fast-forward to the first character of the sequence\n if (this.fastForwardTo(this.currentSequence[0])) {\n this.sequenceIndex = 1;\n }\n }\n else if (c !== this.currentSequence[this.sequenceIndex - 1]) {\n // Allow long sequences, eg. --->, ]]]>\n this.sequenceIndex = 0;\n }\n };\n /**\n * HTML only allows ASCII alpha characters (a-z and A-Z) at the beginning of a tag name.\n *\n * XML allows a lot more characters here (@see https://www.w3.org/TR/REC-xml/#NT-NameStartChar).\n * We allow anything that wouldn't end the tag.\n */\n Tokenizer.prototype.isTagStartChar = function (c) {\n return this.xmlMode ? !isEndOfTagSection(c) : isASCIIAlpha(c);\n };\n Tokenizer.prototype.startSpecial = function (sequence, offset) {\n this.isSpecial = true;\n this.currentSequence = sequence;\n this.sequenceIndex = offset;\n this._state = 23 /* SpecialStartSequence */;\n };\n Tokenizer.prototype.stateBeforeTagName = function (c) {\n if (c === 33 /* ExclamationMark */) {\n this._state = 15 /* BeforeDeclaration */;\n this.sectionStart = this._index + 1;\n }\n else if (c === 63 /* Questionmark */) {\n this._state = 17 /* InProcessingInstruction */;\n this.sectionStart = this._index + 1;\n }\n else if (this.isTagStartChar(c)) {\n var lower = c | 0x20;\n this.sectionStart = this._index;\n if (!this.xmlMode && lower === Sequences.TitleEnd[2]) {\n this.startSpecial(Sequences.TitleEnd, 3);\n }\n else {\n this._state =\n !this.xmlMode && lower === Sequences.ScriptEnd[2]\n ? 22 /* BeforeSpecialS */\n : 3 /* InTagName */;\n }\n }\n else if (c === 47 /* Slash */) {\n this._state = 5 /* BeforeClosingTagName */;\n }\n else {\n this._state = 1 /* Text */;\n this.stateText(c);\n }\n };\n Tokenizer.prototype.stateInTagName = function (c) {\n if (isEndOfTagSection(c)) {\n this.cbs.onopentagname(this.getSection());\n this.sectionStart = -1;\n this._state = 8 /* BeforeAttributeName */;\n this.stateBeforeAttributeName(c);\n }\n };\n Tokenizer.prototype.stateBeforeClosingTagName = function (c) {\n if (isWhitespace(c)) {\n // Ignore\n }\n else if (c === 62 /* Gt */) {\n this._state = 1 /* Text */;\n }\n else {\n this._state = this.isTagStartChar(c)\n ? 6 /* InClosingTagName */\n : 20 /* InSpecialComment */;\n this.sectionStart = this._index;\n }\n };\n Tokenizer.prototype.stateInClosingTagName = function (c) {\n if (c === 62 /* Gt */ || isWhitespace(c)) {\n this.cbs.onclosetag(this.getSection());\n this.sectionStart = -1;\n this._state = 7 /* AfterClosingTagName */;\n this.stateAfterClosingTagName(c);\n }\n };\n Tokenizer.prototype.stateAfterClosingTagName = function (c) {\n // Skip everything until \">\"\n if (c === 62 /* Gt */ || this.fastForwardTo(62 /* Gt */)) {\n this._state = 1 /* Text */;\n this.sectionStart = this._index + 1;\n }\n };\n Tokenizer.prototype.stateBeforeAttributeName = function (c) {\n if (c === 62 /* Gt */) {\n this.cbs.onopentagend();\n if (this.isSpecial) {\n this._state = 24 /* InSpecialTag */;\n this.sequenceIndex = 0;\n }\n else {\n this._state = 1 /* Text */;\n }\n this.baseState = this._state;\n this.sectionStart = this._index + 1;\n }\n else if (c === 47 /* Slash */) {\n this._state = 4 /* InSelfClosingTag */;\n }\n else if (!isWhitespace(c)) {\n this._state = 9 /* InAttributeName */;\n this.sectionStart = this._index;\n }\n };\n Tokenizer.prototype.stateInSelfClosingTag = function (c) {\n if (c === 62 /* Gt */) {\n this.cbs.onselfclosingtag();\n this._state = 1 /* Text */;\n this.baseState = 1 /* Text */;\n this.sectionStart = this._index + 1;\n this.isSpecial = false; // Reset special state, in case of self-closing special tags\n }\n else if (!isWhitespace(c)) {\n this._state = 8 /* BeforeAttributeName */;\n this.stateBeforeAttributeName(c);\n }\n };\n Tokenizer.prototype.stateInAttributeName = function (c) {\n if (c === 61 /* Eq */ || isEndOfTagSection(c)) {\n this.cbs.onattribname(this.getSection());\n this.sectionStart = -1;\n this._state = 10 /* AfterAttributeName */;\n this.stateAfterAttributeName(c);\n }\n };\n Tokenizer.prototype.stateAfterAttributeName = function (c) {\n if (c === 61 /* Eq */) {\n this._state = 11 /* BeforeAttributeValue */;\n }\n else if (c === 47 /* Slash */ || c === 62 /* Gt */) {\n this.cbs.onattribend(undefined);\n this._state = 8 /* BeforeAttributeName */;\n this.stateBeforeAttributeName(c);\n }\n else if (!isWhitespace(c)) {\n this.cbs.onattribend(undefined);\n this._state = 9 /* InAttributeName */;\n this.sectionStart = this._index;\n }\n };\n Tokenizer.prototype.stateBeforeAttributeValue = function (c) {\n if (c === 34 /* DoubleQuote */) {\n this._state = 12 /* InAttributeValueDq */;\n this.sectionStart = this._index + 1;\n }\n else if (c === 39 /* SingleQuote */) {\n this._state = 13 /* InAttributeValueSq */;\n this.sectionStart = this._index + 1;\n }\n else if (!isWhitespace(c)) {\n this.sectionStart = this._index;\n this._state = 14 /* InAttributeValueNq */;\n this.stateInAttributeValueNoQuotes(c); // Reconsume token\n }\n };\n Tokenizer.prototype.handleInAttributeValue = function (c, quote) {\n if (c === quote ||\n (!this.decodeEntities && this.fastForwardTo(quote))) {\n this.cbs.onattribdata(this.getSection());\n this.sectionStart = -1;\n this.cbs.onattribend(String.fromCharCode(quote));\n this._state = 8 /* BeforeAttributeName */;\n }\n else if (this.decodeEntities && c === 38 /* Amp */) {\n this.baseState = this._state;\n this._state = 25 /* BeforeEntity */;\n }\n };\n Tokenizer.prototype.stateInAttributeValueDoubleQuotes = function (c) {\n this.handleInAttributeValue(c, 34 /* DoubleQuote */);\n };\n Tokenizer.prototype.stateInAttributeValueSingleQuotes = function (c) {\n this.handleInAttributeValue(c, 39 /* SingleQuote */);\n };\n Tokenizer.prototype.stateInAttributeValueNoQuotes = function (c) {\n if (isWhitespace(c) || c === 62 /* Gt */) {\n this.cbs.onattribdata(this.getSection());\n this.sectionStart = -1;\n this.cbs.onattribend(null);\n this._state = 8 /* BeforeAttributeName */;\n this.stateBeforeAttributeName(c);\n }\n else if (this.decodeEntities && c === 38 /* Amp */) {\n this.baseState = this._state;\n this._state = 25 /* BeforeEntity */;\n }\n };\n Tokenizer.prototype.stateBeforeDeclaration = function (c) {\n if (c === 91 /* OpeningSquareBracket */) {\n this._state = 19 /* CDATASequence */;\n this.sequenceIndex = 0;\n }\n else {\n this._state =\n c === 45 /* Dash */\n ? 18 /* BeforeComment */\n : 16 /* InDeclaration */;\n }\n };\n Tokenizer.prototype.stateInDeclaration = function (c) {\n if (c === 62 /* Gt */ || this.fastForwardTo(62 /* Gt */)) {\n this.cbs.ondeclaration(this.getSection());\n this._state = 1 /* Text */;\n this.sectionStart = this._index + 1;\n }\n };\n Tokenizer.prototype.stateInProcessingInstruction = function (c) {\n if (c === 62 /* Gt */ || this.fastForwardTo(62 /* Gt */)) {\n this.cbs.onprocessinginstruction(this.getSection());\n this._state = 1 /* Text */;\n this.sectionStart = this._index + 1;\n }\n };\n Tokenizer.prototype.stateBeforeComment = function (c) {\n if (c === 45 /* Dash */) {\n this._state = 21 /* InCommentLike */;\n this.currentSequence = Sequences.CommentEnd;\n // Allow short comments (eg. )\n this.sequenceIndex = 2;\n this.sectionStart = this._index + 1;\n }\n else {\n this._state = 16 /* InDeclaration */;\n }\n };\n Tokenizer.prototype.stateInSpecialComment = function (c) {\n if (c === 62 /* Gt */ || this.fastForwardTo(62 /* Gt */)) {\n this.cbs.oncomment(this.getSection());\n this._state = 1 /* Text */;\n this.sectionStart = this._index + 1;\n }\n };\n Tokenizer.prototype.stateBeforeSpecialS = function (c) {\n var lower = c | 0x20;\n if (lower === Sequences.ScriptEnd[3]) {\n this.startSpecial(Sequences.ScriptEnd, 4);\n }\n else if (lower === Sequences.StyleEnd[3]) {\n this.startSpecial(Sequences.StyleEnd, 4);\n }\n else {\n this._state = 3 /* InTagName */;\n this.stateInTagName(c); // Consume the token again\n }\n };\n Tokenizer.prototype.stateBeforeEntity = function (c) {\n // Start excess with 1 to include the '&'\n this.entityExcess = 1;\n if (c === 35 /* Num */) {\n this._state = 26 /* BeforeNumericEntity */;\n }\n else if (c === 38 /* Amp */) {\n // We have two `&` characters in a row. Stay in the current state.\n }\n else {\n this.trieIndex = 0;\n this.trieCurrent = this.entityTrie[0];\n this.trieResult = null;\n this._state = 27 /* InNamedEntity */;\n this.stateInNamedEntity(c);\n }\n };\n Tokenizer.prototype.stateInNamedEntity = function (c) {\n this.entityExcess += 1;\n this.trieIndex = (0, decode_1.determineBranch)(this.entityTrie, this.trieCurrent, this.trieIndex + 1, c);\n if (this.trieIndex < 0) {\n this.emitNamedEntity();\n this._index--;\n return;\n }\n this.trieCurrent = this.entityTrie[this.trieIndex];\n // If the branch is a value, store it and continue\n if (this.trieCurrent & decode_1.BinTrieFlags.HAS_VALUE) {\n // If we have a legacy entity while parsing strictly, just skip the number of bytes\n if (!this.allowLegacyEntity() && c !== 59 /* Semi */) {\n // No need to consider multi-byte values, as the legacy entity is always a single byte\n this.trieIndex += 1;\n }\n else {\n // Add 1 as we have already incremented the excess\n var entityStart = this._index - this.entityExcess + 1;\n if (entityStart > this.sectionStart) {\n this.emitPartial(this.buffer.substring(this.sectionStart, entityStart));\n }\n // If this is a surrogate pair, combine the higher bits from the node with the next byte\n this.trieResult =\n this.trieCurrent & decode_1.BinTrieFlags.MULTI_BYTE\n ? String.fromCharCode(this.entityTrie[++this.trieIndex], this.entityTrie[++this.trieIndex])\n : String.fromCharCode(this.entityTrie[++this.trieIndex]);\n this.entityExcess = 0;\n this.sectionStart = this._index + 1;\n }\n }\n };\n Tokenizer.prototype.emitNamedEntity = function () {\n if (this.trieResult) {\n this.emitPartial(this.trieResult);\n }\n this._state = this.baseState;\n };\n Tokenizer.prototype.stateBeforeNumericEntity = function (c) {\n if ((c | 0x20) === 120 /* LowerX */) {\n this.entityExcess++;\n this._state = 29 /* InHexEntity */;\n }\n else {\n this._state = 28 /* InNumericEntity */;\n this.stateInNumericEntity(c);\n }\n };\n Tokenizer.prototype.decodeNumericEntity = function (base, strict) {\n var entityStart = this._index - this.entityExcess - 1;\n var numberStart = entityStart + 2 + (base >> 4);\n if (numberStart !== this._index) {\n // Emit leading data if any\n if (entityStart > this.sectionStart) {\n this.emitPartial(this.buffer.substring(this.sectionStart, entityStart));\n }\n // Parse entity\n var entity = this.buffer.substring(numberStart, this._index);\n var parsed = parseInt(entity, base);\n this.emitPartial((0, decode_codepoint_1.default)(parsed));\n this.sectionStart = this._index + Number(strict);\n }\n this._state = this.baseState;\n };\n Tokenizer.prototype.stateInNumericEntity = function (c) {\n if (c === 59 /* Semi */) {\n this.decodeNumericEntity(10, true);\n }\n else if (!isNumber(c)) {\n if (this.allowLegacyEntity()) {\n this.decodeNumericEntity(10, false);\n }\n else {\n this._state = this.baseState;\n }\n this._index--;\n }\n else {\n this.entityExcess++;\n }\n };\n Tokenizer.prototype.stateInHexEntity = function (c) {\n if (c === 59 /* Semi */) {\n this.decodeNumericEntity(16, true);\n }\n else if ((c < 97 /* LowerA */ || c > 102 /* LowerF */) &&\n (c < 65 /* UpperA */ || c > 70 /* UpperF */) &&\n !isNumber(c)) {\n if (this.allowLegacyEntity()) {\n this.decodeNumericEntity(16, false);\n }\n else {\n this._state = this.baseState;\n }\n this._index--;\n }\n else {\n this.entityExcess++;\n }\n };\n Tokenizer.prototype.allowLegacyEntity = function () {\n return (!this.xmlMode &&\n (this.baseState === 1 /* Text */ ||\n this.baseState === 24 /* InSpecialTag */));\n };\n /**\n * Remove data that has already been consumed from the buffer.\n */\n Tokenizer.prototype.cleanup = function () {\n // If we are inside of text, emit what we already have.\n if (this.running &&\n this.sectionStart !== this._index &&\n (this._state === 1 /* Text */ ||\n (this._state === 24 /* InSpecialTag */ &&\n this.sequenceIndex === 0))) {\n // TODO: We could emit attribute data here as well.\n this.cbs.ontext(this.buffer.substr(this.sectionStart));\n this.sectionStart = this._index;\n }\n var start = this.sectionStart < 0 ? this._index : this.sectionStart;\n this.buffer =\n start === this.buffer.length ? \"\" : this.buffer.substr(start);\n this._index -= start;\n this.bufferOffset += start;\n if (this.sectionStart > 0) {\n this.sectionStart = 0;\n }\n };\n Tokenizer.prototype.shouldContinue = function () {\n return this._index < this.buffer.length && this.running;\n };\n /**\n * Iterates through the buffer, calling the function corresponding to the current state.\n *\n * States that are more likely to be hit are higher up, as a performance improvement.\n */\n Tokenizer.prototype.parse = function () {\n while (this.shouldContinue()) {\n var c = this.buffer.charCodeAt(this._index);\n if (this._state === 1 /* Text */) {\n this.stateText(c);\n }\n else if (this._state === 23 /* SpecialStartSequence */) {\n this.stateSpecialStartSequence(c);\n }\n else if (this._state === 24 /* InSpecialTag */) {\n this.stateInSpecialTag(c);\n }\n else if (this._state === 19 /* CDATASequence */) {\n this.stateCDATASequence(c);\n }\n else if (this._state === 12 /* InAttributeValueDq */) {\n this.stateInAttributeValueDoubleQuotes(c);\n }\n else if (this._state === 9 /* InAttributeName */) {\n this.stateInAttributeName(c);\n }\n else if (this._state === 21 /* InCommentLike */) {\n this.stateInCommentLike(c);\n }\n else if (this._state === 20 /* InSpecialComment */) {\n this.stateInSpecialComment(c);\n }\n else if (this._state === 8 /* BeforeAttributeName */) {\n this.stateBeforeAttributeName(c);\n }\n else if (this._state === 3 /* InTagName */) {\n this.stateInTagName(c);\n }\n else if (this._state === 6 /* InClosingTagName */) {\n this.stateInClosingTagName(c);\n }\n else if (this._state === 2 /* BeforeTagName */) {\n this.stateBeforeTagName(c);\n }\n else if (this._state === 10 /* AfterAttributeName */) {\n this.stateAfterAttributeName(c);\n }\n else if (this._state === 13 /* InAttributeValueSq */) {\n this.stateInAttributeValueSingleQuotes(c);\n }\n else if (this._state === 11 /* BeforeAttributeValue */) {\n this.stateBeforeAttributeValue(c);\n }\n else if (this._state === 5 /* BeforeClosingTagName */) {\n this.stateBeforeClosingTagName(c);\n }\n else if (this._state === 7 /* AfterClosingTagName */) {\n this.stateAfterClosingTagName(c);\n }\n else if (this._state === 22 /* BeforeSpecialS */) {\n this.stateBeforeSpecialS(c);\n }\n else if (this._state === 14 /* InAttributeValueNq */) {\n this.stateInAttributeValueNoQuotes(c);\n }\n else if (this._state === 4 /* InSelfClosingTag */) {\n this.stateInSelfClosingTag(c);\n }\n else if (this._state === 16 /* InDeclaration */) {\n this.stateInDeclaration(c);\n }\n else if (this._state === 15 /* BeforeDeclaration */) {\n this.stateBeforeDeclaration(c);\n }\n else if (this._state === 18 /* BeforeComment */) {\n this.stateBeforeComment(c);\n }\n else if (this._state === 17 /* InProcessingInstruction */) {\n this.stateInProcessingInstruction(c);\n }\n else if (this._state === 27 /* InNamedEntity */) {\n this.stateInNamedEntity(c);\n }\n else if (this._state === 25 /* BeforeEntity */) {\n this.stateBeforeEntity(c);\n }\n else if (this._state === 29 /* InHexEntity */) {\n this.stateInHexEntity(c);\n }\n else if (this._state === 28 /* InNumericEntity */) {\n this.stateInNumericEntity(c);\n }\n else {\n // `this._state === State.BeforeNumericEntity`\n this.stateBeforeNumericEntity(c);\n }\n this._index++;\n }\n this.cleanup();\n };\n Tokenizer.prototype.finish = function () {\n if (this._state === 27 /* InNamedEntity */) {\n this.emitNamedEntity();\n }\n // If there is remaining data, emit it in a reasonable way\n if (this.sectionStart < this._index) {\n this.handleTrailingData();\n }\n this.cbs.onend();\n };\n /** Handle any trailing data. */\n Tokenizer.prototype.handleTrailingData = function () {\n var data = this.buffer.substr(this.sectionStart);\n if (this._state === 21 /* InCommentLike */) {\n if (this.currentSequence === Sequences.CdataEnd) {\n this.cbs.oncdata(data);\n }\n else {\n this.cbs.oncomment(data);\n }\n }\n else if (this._state === 28 /* InNumericEntity */ &&\n this.allowLegacyEntity()) {\n this.decodeNumericEntity(10, false);\n // All trailing data will have been consumed\n }\n else if (this._state === 29 /* InHexEntity */ &&\n this.allowLegacyEntity()) {\n this.decodeNumericEntity(16, false);\n // All trailing data will have been consumed\n }\n else if (this._state === 3 /* InTagName */ ||\n this._state === 8 /* BeforeAttributeName */ ||\n this._state === 11 /* BeforeAttributeValue */ ||\n this._state === 10 /* AfterAttributeName */ ||\n this._state === 9 /* InAttributeName */ ||\n this._state === 13 /* InAttributeValueSq */ ||\n this._state === 12 /* InAttributeValueDq */ ||\n this._state === 14 /* InAttributeValueNq */ ||\n this._state === 6 /* InClosingTagName */) {\n /*\n * If we are currently in an opening or closing tag, us not calling the\n * respective callback signals that the tag should be ignored.\n */\n }\n else {\n this.cbs.ontext(data);\n }\n };\n Tokenizer.prototype.getSection = function () {\n return this.buffer.substring(this.sectionStart, this._index);\n };\n Tokenizer.prototype.emitPartial = function (value) {\n if (this.baseState !== 1 /* Text */ &&\n this.baseState !== 24 /* InSpecialTag */) {\n this.cbs.onattribdata(value);\n }\n else {\n this.cbs.ontext(value);\n }\n };\n return Tokenizer;\n}());\nexports.default = Tokenizer;\n","\"use strict\";\nvar __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {\n if (k2 === undefined) k2 = k;\n Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });\n}) : (function(o, m, k, k2) {\n if (k2 === undefined) k2 = k;\n o[k2] = m[k];\n}));\nvar __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\n}) : function(o, v) {\n o[\"default\"] = v;\n});\nvar __importStar = (this && this.__importStar) || function (mod) {\n if (mod && mod.__esModule) return mod;\n var result = {};\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\n __setModuleDefault(result, mod);\n return result;\n};\nvar __exportStar = (this && this.__exportStar) || function(m, exports) {\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p);\n};\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.RssHandler = exports.DefaultHandler = exports.DomUtils = exports.ElementType = exports.Tokenizer = exports.createDomStream = exports.parseDOM = exports.parseDocument = exports.DomHandler = exports.Parser = void 0;\nvar Parser_1 = require(\"./Parser\");\nObject.defineProperty(exports, \"Parser\", { enumerable: true, get: function () { return Parser_1.Parser; } });\nvar domhandler_1 = require(\"domhandler\");\nObject.defineProperty(exports, \"DomHandler\", { enumerable: true, get: function () { return domhandler_1.DomHandler; } });\nObject.defineProperty(exports, \"DefaultHandler\", { enumerable: true, get: function () { return domhandler_1.DomHandler; } });\n// Helper methods\n/**\n * Parses the data, returns the resulting document.\n *\n * @param data The data that should be parsed.\n * @param options Optional options for the parser and DOM builder.\n */\nfunction parseDocument(data, options) {\n var handler = new domhandler_1.DomHandler(undefined, options);\n new Parser_1.Parser(handler, options).end(data);\n return handler.root;\n}\nexports.parseDocument = parseDocument;\n/**\n * Parses data, returns an array of the root nodes.\n *\n * Note that the root nodes still have a `Document` node as their parent.\n * Use `parseDocument` to get the `Document` node instead.\n *\n * @param data The data that should be parsed.\n * @param options Optional options for the parser and DOM builder.\n * @deprecated Use `parseDocument` instead.\n */\nfunction parseDOM(data, options) {\n return parseDocument(data, options).children;\n}\nexports.parseDOM = parseDOM;\n/**\n * Creates a parser instance, with an attached DOM handler.\n *\n * @param cb A callback that will be called once parsing has been completed.\n * @param options Optional options for the parser and DOM builder.\n * @param elementCb An optional callback that will be called every time a tag has been completed inside of the DOM.\n */\nfunction createDomStream(cb, options, elementCb) {\n var handler = new domhandler_1.DomHandler(cb, options, elementCb);\n return new Parser_1.Parser(handler, options);\n}\nexports.createDomStream = createDomStream;\nvar Tokenizer_1 = require(\"./Tokenizer\");\nObject.defineProperty(exports, \"Tokenizer\", { enumerable: true, get: function () { return __importDefault(Tokenizer_1).default; } });\nvar ElementType = __importStar(require(\"domelementtype\"));\nexports.ElementType = ElementType;\n/*\n * All of the following exports exist for backwards-compatibility.\n * They should probably be removed eventually.\n */\n__exportStar(require(\"./FeedHandler\"), exports);\nexports.DomUtils = __importStar(require(\"domutils\"));\nvar FeedHandler_1 = require(\"./FeedHandler\");\nObject.defineProperty(exports, \"RssHandler\", { enumerable: true, get: function () { return FeedHandler_1.FeedHandler; } });\n","\"use strict\";\nvar __importDefault = (this && this.__importDefault) || function (mod) {\n return (mod && mod.__esModule) ? mod : { \"default\": mod };\n};\nObject.defineProperty(exports, \"__esModule\", { value: true });\nexports.decodeXML = exports.decodeHTMLStrict = exports.decodeHTML = exports.determineBranch = exports.JUMP_OFFSET_BASE = exports.BinTrieFlags = exports.xmlDecodeTree = exports.htmlDecodeTree = void 0;\nvar decode_data_html_1 = __importDefault(require(\"./generated/decode-data-html\"));\nexports.htmlDecodeTree = decode_data_html_1.default;\nvar decode_data_xml_1 = __importDefault(require(\"./generated/decode-data-xml\"));\nexports.xmlDecodeTree = decode_data_xml_1.default;\nvar decode_codepoint_1 = __importDefault(require(\"./decode_codepoint\"));\nvar BinTrieFlags;\n(function (BinTrieFlags) {\n BinTrieFlags[BinTrieFlags[\"HAS_VALUE\"] = 32768] = \"HAS_VALUE\";\n BinTrieFlags[BinTrieFlags[\"BRANCH_LENGTH\"] = 32512] = \"BRANCH_LENGTH\";\n BinTrieFlags[BinTrieFlags[\"MULTI_BYTE\"] = 128] = \"MULTI_BYTE\";\n BinTrieFlags[BinTrieFlags[\"JUMP_TABLE\"] = 127] = \"JUMP_TABLE\";\n})(BinTrieFlags = exports.BinTrieFlags || (exports.BinTrieFlags = {}));\nexports.JUMP_OFFSET_BASE = 48 /* ZERO */ - 1;\nfunction getDecoder(decodeTree) {\n return function decodeHTMLBinary(str, strict) {\n var ret = \"\";\n var lastIdx = 0;\n var strIdx = 0;\n while ((strIdx = str.indexOf(\"&\", strIdx)) >= 0) {\n ret += str.slice(lastIdx, strIdx);\n lastIdx = strIdx;\n // Skip the \"&\"\n strIdx += 1;\n // If we have a numeric entity, handle this separately.\n if (str.charCodeAt(strIdx) === 35 /* NUM */) {\n // Skip the leading \"\". For hex entities, also skip the leading \"x\".\n var start = strIdx + 1;\n var base = 10;\n var cp = str.charCodeAt(start);\n if ((cp | 32 /* To_LOWER_BIT */) === 120 /* LOWER_X */) {\n base = 16;\n strIdx += 1;\n start += 1;\n }\n while (((cp = str.charCodeAt(++strIdx)) >= 48 /* ZERO */ &&\n cp <= 57 /* NINE */) ||\n (base === 16 &&\n (cp | 32 /* To_LOWER_BIT */) >= 97 /* LOWER_A */ &&\n (cp | 32 /* To_LOWER_BIT */) <= 102 /* LOWER_F */))\n ;\n if (start !== strIdx) {\n var entity = str.substring(start, strIdx);\n var parsed = parseInt(entity, base);\n if (str.charCodeAt(strIdx) === 59 /* SEMI */) {\n strIdx += 1;\n }\n else if (strict) {\n continue;\n }\n ret += decode_codepoint_1.default(parsed);\n lastIdx = strIdx;\n }\n continue;\n }\n var result = null;\n var excess = 1;\n var treeIdx = 0;\n var current = decodeTree[treeIdx];\n for (; strIdx < str.length; strIdx++, excess++) {\n treeIdx = determineBranch(decodeTree, current, treeIdx + 1, str.charCodeAt(strIdx));\n if (treeIdx < 0)\n break;\n current = decodeTree[treeIdx];\n // If the branch is a value, store it and continue\n if (current & BinTrieFlags.HAS_VALUE) {\n // If we have a legacy entity while parsing strictly, just skip the number of bytes\n if (strict && str.charCodeAt(strIdx) !== 59 /* SEMI */) {\n // No need to consider multi-byte values, as the legacy entity is always a single byte\n treeIdx += 1;\n }\n else {\n // If this is a surrogate pair, combine the higher bits from the node with the next byte\n result =\n current & BinTrieFlags.MULTI_BYTE\n ? String.fromCharCode(decodeTree[++treeIdx], decodeTree[++treeIdx])\n : String.fromCharCode(decodeTree[++treeIdx]);\n excess = 0;\n }\n }\n }\n if (result != null) {\n ret += result;\n lastIdx = strIdx - excess + 1;\n }\n }\n return ret + str.slice(lastIdx);\n };\n}\nfunction determineBranch(decodeTree, current, nodeIdx, char) {\n if (current <= 128) {\n return char === current ? nodeIdx : -1;\n }\n var branchCount = (current & BinTrieFlags.BRANCH_LENGTH) >> 8;\n if (branchCount === 0) {\n return -1;\n }\n if (branchCount === 1) {\n return char === decodeTree[nodeIdx] ? nodeIdx + 1 : -1;\n }\n var jumpOffset = current & BinTrieFlags.JUMP_TABLE;\n if (jumpOffset) {\n var value = char - exports.JUMP_OFFSET_BASE - jumpOffset;\n return value < 0 || value > branchCount\n ? -1\n : decodeTree[nodeIdx + value] - 1;\n }\n // Binary search for the character.\n var lo = nodeIdx;\n var hi = lo + branchCount - 1;\n while (lo <= hi) {\n var mid = (lo + hi) >>> 1;\n var midVal = decodeTree[mid];\n if (midVal < char) {\n lo = mid + 1;\n }\n else if (midVal > char) {\n hi = mid - 1;\n }\n else {\n return decodeTree[mid + branchCount];\n }\n }\n return -1;\n}\nexports.determineBranch = determineBranch;\nvar htmlDecoder = getDecoder(decode_data_html_1.default);\nvar xmlDecoder = getDecoder(decode_data_xml_1.default);\nfunction decodeHTML(str) {\n return htmlDecoder(str, false);\n}\nexports.decodeHTML = decodeHTML;\nfunction decodeHTMLStrict(str) {\n return htmlDecoder(str, true);\n}\nexports.decodeHTMLStrict = decodeHTMLStrict;\nfunction decodeXML(str) {\n return xmlDecoder(str, true);\n}\nexports.decodeXML = decodeXML;\n","\"use strict\";\n// Adapted from https://github.com/mathiasbynens/he/blob/36afe179392226cf1b6ccdb16ebbb7a5a844d93a/src/he.js#L106-L134\nObject.defineProperty(exports, \"__esModule\", { value: true });\nvar decodeMap = new Map([\n [0, 65533],\n [128, 8364],\n [130, 8218],\n [131, 402],\n [132, 8222],\n [133, 8230],\n [134, 8224],\n [135, 8225],\n [136, 710],\n [137, 8240],\n [138, 352],\n [139, 8249],\n [140, 338],\n [142, 381],\n [145, 8216],\n [146, 8217],\n [147, 8220],\n [148, 8221],\n [149, 8226],\n [150, 8211],\n [151, 8212],\n [152, 732],\n [153, 8482],\n [154, 353],\n [155, 8250],\n [156, 339],\n [158, 382],\n [159, 376],\n]);\nvar fromCodePoint = \n// eslint-disable-next-line @typescript-eslint/no-unnecessary-condition, node/no-unsupported-features/es-builtins\nString.fromCodePoint ||\n function (codePoint) {\n var output = \"\";\n if (codePoint > 0xffff) {\n codePoint -= 0x10000;\n output += String.fromCharCode(((codePoint >>> 10) & 0x3ff) | 0xd800);\n codePoint = 0xdc00 | (codePoint & 0x3ff);\n }\n output += String.fromCharCode(codePoint);\n return output;\n };\nfunction decodeCodePoint(codePoint) {\n var _a;\n if ((codePoint >= 0xd800 && codePoint <= 0xdfff) || codePoint > 0x10ffff) {\n return \"\\uFFFD\";\n }\n return fromCodePoint((_a = decodeMap.get(codePoint)) !== null && _a !== void 0 ? _a : codePoint);\n}\nexports.default = decodeCodePoint;\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\n// Generated using scripts/write-decode-map.ts\n// prettier-ignore\nexports.default = new Uint16Array([14866, 60, 237, 340, 721, 1312, 1562, 1654, 1838, 1957, 2183, 2239, 2301, 2958, 3037, 3893, 4123, 4298, 4330, 4801, 5191, 5395, 5752, 5903, 5943, 5972, 6050, 0, 0, 0, 0, 0, 0, 6135, 6565, 7422, 8183, 8738, 9242, 9503, 9938, 10189, 10573, 10637, 10715, 11950, 12246, 13539, 13950, 14445, 14533, 15364, 16514, 16980, 17390, 17763, 17849, 18036, 18125, 4096, 69, 77, 97, 98, 99, 102, 103, 108, 109, 110, 111, 112, 114, 115, 116, 117, 92, 100, 106, 115, 122, 137, 142, 151, 157, 163, 167, 182, 196, 204, 220, 229, 108, 105, 103, 33024, 198, 59, 32768, 198, 80, 33024, 38, 59, 32768, 38, 99, 117, 116, 101, 33024, 193, 59, 32768, 193, 114, 101, 118, 101, 59, 32768, 258, 512, 105, 121, 127, 134, 114, 99, 33024, 194, 59, 32768, 194, 59, 32768, 1040, 114, 59, 32896, 55349, 56580, 114, 97, 118, 101, 33024, 192, 59, 32768, 192, 112, 104, 97, 59, 32768, 913, 97, 99, 114, 59, 32768, 256, 100, 59, 32768, 10835, 512, 103, 112, 172, 177, 111, 110, 59, 32768, 260, 102, 59, 32896, 55349, 56632, 112, 108, 121, 70, 117, 110, 99, 116, 105, 111, 110, 59, 32768, 8289, 105, 110, 103, 33024, 197, 59, 32768, 197, 512, 99, 115, 209, 214, 114, 59, 32896, 55349, 56476, 105, 103, 110, 59, 32768, 8788, 105, 108, 100, 101, 33024, 195, 59, 32768, 195, 109, 108, 33024, 196, 59, 32768, 196, 2048, 97, 99, 101, 102, 111, 114, 115, 117, 253, 278, 282, 310, 315, 321, 327, 332, 512, 99, 114, 258, 267, 107, 115, 108, 97, 115, 104, 59, 32768, 8726, 583, 271, 274, 59, 32768, 10983, 101, 100, 59, 32768, 8966, 121, 59, 32768, 1041, 768, 99, 114, 116, 289, 296, 306, 97, 117, 115, 101, 59, 32768, 8757, 110, 111, 117, 108, 108, 105, 115, 59, 32768, 8492, 97, 59, 32768, 914, 114, 59, 32896, 55349, 56581, 112, 102, 59, 32896, 55349, 56633, 101, 118, 101, 59, 32768, 728, 99, 114, 59, 32768, 8492, 109, 112, 101, 113, 59, 32768, 8782, 3584, 72, 79, 97, 99, 100, 101, 102, 104, 105, 108, 111, 114, 115, 117, 368, 373, 380, 426, 461, 466, 487, 491, 495, 533, 593, 695, 701, 707, 99, 121, 59, 32768, 1063, 80, 89, 33024, 169, 59, 32768, 169, 768, 99, 112, 121, 387, 393, 419, 117, 116, 101, 59, 32768, 262, 512, 59, 105, 398, 400, 32768, 8914, 116, 97, 108, 68, 105, 102, 102, 101, 114, 101, 110, 116, 105, 97, 108, 68, 59, 32768, 8517, 108, 101, 121, 115, 59, 32768, 8493, 1024, 97, 101, 105, 111, 435, 441, 449, 454, 114, 111, 110, 59, 32768, 268, 100, 105, 108, 33024, 199, 59, 32768, 199, 114, 99, 59, 32768, 264, 110, 105, 110, 116, 59, 32768, 8752, 111, 116, 59, 32768, 266, 512, 100, 110, 471, 478, 105, 108, 108, 97, 59, 32768, 184, 116, 101, 114, 68, 111, 116, 59, 32768, 183, 114, 59, 32768, 8493, 105, 59, 32768, 935, 114, 99, 108, 101, 1024, 68, 77, 80, 84, 508, 513, 520, 526, 111, 116, 59, 32768, 8857, 105, 110, 117, 115, 59, 32768, 8854, 108, 117, 115, 59, 32768, 8853, 105, 109, 101, 115, 59, 32768, 8855, 111, 512, 99, 115, 539, 562, 107, 119, 105, 115, 101, 67, 111, 110, 116, 111, 117, 114, 73, 110, 116, 101, 103, 114, 97, 108, 59, 32768, 8754, 101, 67, 117, 114, 108, 121, 512, 68, 81, 573, 586, 111, 117, 98, 108, 101, 81, 117, 111, 116, 101, 59, 32768, 8221, 117, 111, 116, 101, 59, 32768, 8217, 1024, 108, 110, 112, 117, 602, 614, 648, 664, 111, 110, 512, 59, 101, 609, 611, 32768, 8759, 59, 32768, 10868, 768, 103, 105, 116, 621, 629, 634, 114, 117, 101, 110, 116, 59, 32768, 8801, 110, 116, 59, 32768, 8751, 111, 117, 114, 73, 110, 116, 101, 103, 114, 97, 108, 59, 32768, 8750, 512, 102, 114, 653, 656, 59, 32768, 8450, 111, 100, 117, 99, 116, 59, 32768, 8720, 110, 116, 101, 114, 67, 108, 111, 99, 107, 119, 105, 115, 101, 67, 111, 110, 116, 111, 117, 114, 73, 110, 116, 101, 103, 114, 97, 108, 59, 32768, 8755, 111, 115, 115, 59, 32768, 10799, 99, 114, 59, 32896, 55349, 56478, 112, 512, 59, 67, 713, 715, 32768, 8915, 97, 112, 59, 32768, 8781, 2816, 68, 74, 83, 90, 97, 99, 101, 102, 105, 111, 115, 743, 758, 763, 768, 773, 795, 809, 821, 826, 910, 1295, 512, 59, 111, 748, 750, 32768, 8517, 116, 114, 97, 104, 100, 59, 32768, 10513, 99, 121, 59, 32768, 1026, 99, 121, 59, 32768, 1029, 99, 121, 59, 32768, 1039, 768, 103, 114, 115, 780, 786, 790, 103, 101, 114, 59, 32768, 8225, 114, 59, 32768, 8609, 104, 118, 59, 32768, 10980, 512, 97, 121, 800, 806, 114, 111, 110, 59, 32768, 270, 59, 32768, 1044, 108, 512, 59, 116, 815, 817, 32768, 8711, 97, 59, 32768, 916, 114, 59, 32896, 55349, 56583, 512, 97, 102, 831, 897, 512, 99, 109, 836, 891, 114, 105, 116, 105, 99, 97, 108, 1024, 65, 68, 71, 84, 852, 859, 877, 884, 99, 117, 116, 101, 59, 32768, 180, 111, 581, 864, 867, 59, 32768, 729, 98, 108, 101, 65, 99, 117, 116, 101, 59, 32768, 733, 114, 97, 118, 101, 59, 32768, 96, 105, 108, 100, 101, 59, 32768, 732, 111, 110, 100, 59, 32768, 8900, 102, 101, 114, 101, 110, 116, 105, 97, 108, 68, 59, 32768, 8518, 2113, 920, 0, 0, 0, 925, 946, 0, 1139, 102, 59, 32896, 55349, 56635, 768, 59, 68, 69, 931, 933, 938, 32768, 168, 111, 116, 59, 32768, 8412, 113, 117, 97, 108, 59, 32768, 8784, 98, 108, 101, 1536, 67, 68, 76, 82, 85, 86, 961, 978, 996, 1080, 1101, 1125, 111, 110, 116, 111, 117, 114, 73, 110, 116, 101, 103, 114, 97, 108, 59, 32768, 8751, 111, 1093, 985, 0, 0, 988, 59, 32768, 168, 110, 65, 114, 114, 111, 119, 59, 32768, 8659, 512, 101, 111, 1001, 1034, 102, 116, 768, 65, 82, 84, 1010, 1017, 1029, 114, 114, 111, 119, 59, 32768, 8656, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 8660, 101, 101, 59, 32768, 10980, 110, 103, 512, 76, 82, 1041, 1068, 101, 102, 116, 512, 65, 82, 1049, 1056, 114, 114, 111, 119, 59, 32768, 10232, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 10234, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 10233, 105, 103, 104, 116, 512, 65, 84, 1089, 1096, 114, 114, 111, 119, 59, 32768, 8658, 101, 101, 59, 32768, 8872, 112, 1042, 1108, 0, 0, 1115, 114, 114, 111, 119, 59, 32768, 8657, 111, 119, 110, 65, 114, 114, 111, 119, 59, 32768, 8661, 101, 114, 116, 105, 99, 97, 108, 66, 97, 114, 59, 32768, 8741, 110, 1536, 65, 66, 76, 82, 84, 97, 1152, 1179, 1186, 1236, 1272, 1288, 114, 114, 111, 119, 768, 59, 66, 85, 1163, 1165, 1170, 32768, 8595, 97, 114, 59, 32768, 10515, 112, 65, 114, 114, 111, 119, 59, 32768, 8693, 114, 101, 118, 101, 59, 32768, 785, 101, 102, 116, 1315, 1196, 0, 1209, 0, 1220, 105, 103, 104, 116, 86, 101, 99, 116, 111, 114, 59, 32768, 10576, 101, 101, 86, 101, 99, 116, 111, 114, 59, 32768, 10590, 101, 99, 116, 111, 114, 512, 59, 66, 1229, 1231, 32768, 8637, 97, 114, 59, 32768, 10582, 105, 103, 104, 116, 805, 1245, 0, 1256, 101, 101, 86, 101, 99, 116, 111, 114, 59, 32768, 10591, 101, 99, 116, 111, 114, 512, 59, 66, 1265, 1267, 32768, 8641, 97, 114, 59, 32768, 10583, 101, 101, 512, 59, 65, 1279, 1281, 32768, 8868, 114, 114, 111, 119, 59, 32768, 8615, 114, 114, 111, 119, 59, 32768, 8659, 512, 99, 116, 1300, 1305, 114, 59, 32896, 55349, 56479, 114, 111, 107, 59, 32768, 272, 4096, 78, 84, 97, 99, 100, 102, 103, 108, 109, 111, 112, 113, 115, 116, 117, 120, 1344, 1348, 1354, 1363, 1386, 1391, 1396, 1405, 1413, 1460, 1475, 1483, 1514, 1527, 1531, 1538, 71, 59, 32768, 330, 72, 33024, 208, 59, 32768, 208, 99, 117, 116, 101, 33024, 201, 59, 32768, 201, 768, 97, 105, 121, 1370, 1376, 1383, 114, 111, 110, 59, 32768, 282, 114, 99, 33024, 202, 59, 32768, 202, 59, 32768, 1069, 111, 116, 59, 32768, 278, 114, 59, 32896, 55349, 56584, 114, 97, 118, 101, 33024, 200, 59, 32768, 200, 101, 109, 101, 110, 116, 59, 32768, 8712, 512, 97, 112, 1418, 1423, 99, 114, 59, 32768, 274, 116, 121, 1060, 1431, 0, 0, 1444, 109, 97, 108, 108, 83, 113, 117, 97, 114, 101, 59, 32768, 9723, 101, 114, 121, 83, 109, 97, 108, 108, 83, 113, 117, 97, 114, 101, 59, 32768, 9643, 512, 103, 112, 1465, 1470, 111, 110, 59, 32768, 280, 102, 59, 32896, 55349, 56636, 115, 105, 108, 111, 110, 59, 32768, 917, 117, 512, 97, 105, 1489, 1504, 108, 512, 59, 84, 1495, 1497, 32768, 10869, 105, 108, 100, 101, 59, 32768, 8770, 108, 105, 98, 114, 105, 117, 109, 59, 32768, 8652, 512, 99, 105, 1519, 1523, 114, 59, 32768, 8496, 109, 59, 32768, 10867, 97, 59, 32768, 919, 109, 108, 33024, 203, 59, 32768, 203, 512, 105, 112, 1543, 1549, 115, 116, 115, 59, 32768, 8707, 111, 110, 101, 110, 116, 105, 97, 108, 69, 59, 32768, 8519, 1280, 99, 102, 105, 111, 115, 1572, 1576, 1581, 1620, 1648, 121, 59, 32768, 1060, 114, 59, 32896, 55349, 56585, 108, 108, 101, 100, 1060, 1591, 0, 0, 1604, 109, 97, 108, 108, 83, 113, 117, 97, 114, 101, 59, 32768, 9724, 101, 114, 121, 83, 109, 97, 108, 108, 83, 113, 117, 97, 114, 101, 59, 32768, 9642, 1601, 1628, 0, 1633, 0, 0, 1639, 102, 59, 32896, 55349, 56637, 65, 108, 108, 59, 32768, 8704, 114, 105, 101, 114, 116, 114, 102, 59, 32768, 8497, 99, 114, 59, 32768, 8497, 3072, 74, 84, 97, 98, 99, 100, 102, 103, 111, 114, 115, 116, 1678, 1683, 1688, 1701, 1708, 1729, 1734, 1739, 1742, 1748, 1828, 1834, 99, 121, 59, 32768, 1027, 33024, 62, 59, 32768, 62, 109, 109, 97, 512, 59, 100, 1696, 1698, 32768, 915, 59, 32768, 988, 114, 101, 118, 101, 59, 32768, 286, 768, 101, 105, 121, 1715, 1721, 1726, 100, 105, 108, 59, 32768, 290, 114, 99, 59, 32768, 284, 59, 32768, 1043, 111, 116, 59, 32768, 288, 114, 59, 32896, 55349, 56586, 59, 32768, 8921, 112, 102, 59, 32896, 55349, 56638, 101, 97, 116, 101, 114, 1536, 69, 70, 71, 76, 83, 84, 1766, 1783, 1794, 1803, 1809, 1821, 113, 117, 97, 108, 512, 59, 76, 1775, 1777, 32768, 8805, 101, 115, 115, 59, 32768, 8923, 117, 108, 108, 69, 113, 117, 97, 108, 59, 32768, 8807, 114, 101, 97, 116, 101, 114, 59, 32768, 10914, 101, 115, 115, 59, 32768, 8823, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32768, 10878, 105, 108, 100, 101, 59, 32768, 8819, 99, 114, 59, 32896, 55349, 56482, 59, 32768, 8811, 2048, 65, 97, 99, 102, 105, 111, 115, 117, 1854, 1861, 1874, 1880, 1884, 1897, 1919, 1934, 82, 68, 99, 121, 59, 32768, 1066, 512, 99, 116, 1866, 1871, 101, 107, 59, 32768, 711, 59, 32768, 94, 105, 114, 99, 59, 32768, 292, 114, 59, 32768, 8460, 108, 98, 101, 114, 116, 83, 112, 97, 99, 101, 59, 32768, 8459, 833, 1902, 0, 1906, 102, 59, 32768, 8461, 105, 122, 111, 110, 116, 97, 108, 76, 105, 110, 101, 59, 32768, 9472, 512, 99, 116, 1924, 1928, 114, 59, 32768, 8459, 114, 111, 107, 59, 32768, 294, 109, 112, 533, 1940, 1950, 111, 119, 110, 72, 117, 109, 112, 59, 32768, 8782, 113, 117, 97, 108, 59, 32768, 8783, 3584, 69, 74, 79, 97, 99, 100, 102, 103, 109, 110, 111, 115, 116, 117, 1985, 1990, 1996, 2001, 2010, 2025, 2030, 2034, 2043, 2077, 2134, 2155, 2160, 2167, 99, 121, 59, 32768, 1045, 108, 105, 103, 59, 32768, 306, 99, 121, 59, 32768, 1025, 99, 117, 116, 101, 33024, 205, 59, 32768, 205, 512, 105, 121, 2015, 2022, 114, 99, 33024, 206, 59, 32768, 206, 59, 32768, 1048, 111, 116, 59, 32768, 304, 114, 59, 32768, 8465, 114, 97, 118, 101, 33024, 204, 59, 32768, 204, 768, 59, 97, 112, 2050, 2052, 2070, 32768, 8465, 512, 99, 103, 2057, 2061, 114, 59, 32768, 298, 105, 110, 97, 114, 121, 73, 59, 32768, 8520, 108, 105, 101, 115, 59, 32768, 8658, 837, 2082, 0, 2110, 512, 59, 101, 2086, 2088, 32768, 8748, 512, 103, 114, 2093, 2099, 114, 97, 108, 59, 32768, 8747, 115, 101, 99, 116, 105, 111, 110, 59, 32768, 8898, 105, 115, 105, 98, 108, 101, 512, 67, 84, 2120, 2127, 111, 109, 109, 97, 59, 32768, 8291, 105, 109, 101, 115, 59, 32768, 8290, 768, 103, 112, 116, 2141, 2146, 2151, 111, 110, 59, 32768, 302, 102, 59, 32896, 55349, 56640, 97, 59, 32768, 921, 99, 114, 59, 32768, 8464, 105, 108, 100, 101, 59, 32768, 296, 828, 2172, 0, 2177, 99, 121, 59, 32768, 1030, 108, 33024, 207, 59, 32768, 207, 1280, 99, 102, 111, 115, 117, 2193, 2206, 2211, 2217, 2232, 512, 105, 121, 2198, 2203, 114, 99, 59, 32768, 308, 59, 32768, 1049, 114, 59, 32896, 55349, 56589, 112, 102, 59, 32896, 55349, 56641, 820, 2222, 0, 2227, 114, 59, 32896, 55349, 56485, 114, 99, 121, 59, 32768, 1032, 107, 99, 121, 59, 32768, 1028, 1792, 72, 74, 97, 99, 102, 111, 115, 2253, 2258, 2263, 2269, 2283, 2288, 2294, 99, 121, 59, 32768, 1061, 99, 121, 59, 32768, 1036, 112, 112, 97, 59, 32768, 922, 512, 101, 121, 2274, 2280, 100, 105, 108, 59, 32768, 310, 59, 32768, 1050, 114, 59, 32896, 55349, 56590, 112, 102, 59, 32896, 55349, 56642, 99, 114, 59, 32896, 55349, 56486, 2816, 74, 84, 97, 99, 101, 102, 108, 109, 111, 115, 116, 2323, 2328, 2333, 2374, 2396, 2775, 2780, 2797, 2804, 2934, 2954, 99, 121, 59, 32768, 1033, 33024, 60, 59, 32768, 60, 1280, 99, 109, 110, 112, 114, 2344, 2350, 2356, 2360, 2370, 117, 116, 101, 59, 32768, 313, 98, 100, 97, 59, 32768, 923, 103, 59, 32768, 10218, 108, 97, 99, 101, 116, 114, 102, 59, 32768, 8466, 114, 59, 32768, 8606, 768, 97, 101, 121, 2381, 2387, 2393, 114, 111, 110, 59, 32768, 317, 100, 105, 108, 59, 32768, 315, 59, 32768, 1051, 512, 102, 115, 2401, 2702, 116, 2560, 65, 67, 68, 70, 82, 84, 85, 86, 97, 114, 2423, 2470, 2479, 2530, 2537, 2561, 2618, 2666, 2683, 2690, 512, 110, 114, 2428, 2441, 103, 108, 101, 66, 114, 97, 99, 107, 101, 116, 59, 32768, 10216, 114, 111, 119, 768, 59, 66, 82, 2451, 2453, 2458, 32768, 8592, 97, 114, 59, 32768, 8676, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 8646, 101, 105, 108, 105, 110, 103, 59, 32768, 8968, 111, 838, 2485, 0, 2498, 98, 108, 101, 66, 114, 97, 99, 107, 101, 116, 59, 32768, 10214, 110, 805, 2503, 0, 2514, 101, 101, 86, 101, 99, 116, 111, 114, 59, 32768, 10593, 101, 99, 116, 111, 114, 512, 59, 66, 2523, 2525, 32768, 8643, 97, 114, 59, 32768, 10585, 108, 111, 111, 114, 59, 32768, 8970, 105, 103, 104, 116, 512, 65, 86, 2546, 2553, 114, 114, 111, 119, 59, 32768, 8596, 101, 99, 116, 111, 114, 59, 32768, 10574, 512, 101, 114, 2566, 2591, 101, 768, 59, 65, 86, 2574, 2576, 2583, 32768, 8867, 114, 114, 111, 119, 59, 32768, 8612, 101, 99, 116, 111, 114, 59, 32768, 10586, 105, 97, 110, 103, 108, 101, 768, 59, 66, 69, 2604, 2606, 2611, 32768, 8882, 97, 114, 59, 32768, 10703, 113, 117, 97, 108, 59, 32768, 8884, 112, 768, 68, 84, 86, 2626, 2638, 2649, 111, 119, 110, 86, 101, 99, 116, 111, 114, 59, 32768, 10577, 101, 101, 86, 101, 99, 116, 111, 114, 59, 32768, 10592, 101, 99, 116, 111, 114, 512, 59, 66, 2659, 2661, 32768, 8639, 97, 114, 59, 32768, 10584, 101, 99, 116, 111, 114, 512, 59, 66, 2676, 2678, 32768, 8636, 97, 114, 59, 32768, 10578, 114, 114, 111, 119, 59, 32768, 8656, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8660, 115, 1536, 69, 70, 71, 76, 83, 84, 2716, 2730, 2741, 2750, 2756, 2768, 113, 117, 97, 108, 71, 114, 101, 97, 116, 101, 114, 59, 32768, 8922, 117, 108, 108, 69, 113, 117, 97, 108, 59, 32768, 8806, 114, 101, 97, 116, 101, 114, 59, 32768, 8822, 101, 115, 115, 59, 32768, 10913, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32768, 10877, 105, 108, 100, 101, 59, 32768, 8818, 114, 59, 32896, 55349, 56591, 512, 59, 101, 2785, 2787, 32768, 8920, 102, 116, 97, 114, 114, 111, 119, 59, 32768, 8666, 105, 100, 111, 116, 59, 32768, 319, 768, 110, 112, 119, 2811, 2899, 2904, 103, 1024, 76, 82, 108, 114, 2821, 2848, 2860, 2887, 101, 102, 116, 512, 65, 82, 2829, 2836, 114, 114, 111, 119, 59, 32768, 10229, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 10231, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 10230, 101, 102, 116, 512, 97, 114, 2868, 2875, 114, 114, 111, 119, 59, 32768, 10232, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 10234, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 10233, 102, 59, 32896, 55349, 56643, 101, 114, 512, 76, 82, 2911, 2922, 101, 102, 116, 65, 114, 114, 111, 119, 59, 32768, 8601, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 8600, 768, 99, 104, 116, 2941, 2945, 2948, 114, 59, 32768, 8466, 59, 32768, 8624, 114, 111, 107, 59, 32768, 321, 59, 32768, 8810, 2048, 97, 99, 101, 102, 105, 111, 115, 117, 2974, 2978, 2982, 3007, 3012, 3022, 3028, 3033, 112, 59, 32768, 10501, 121, 59, 32768, 1052, 512, 100, 108, 2987, 2998, 105, 117, 109, 83, 112, 97, 99, 101, 59, 32768, 8287, 108, 105, 110, 116, 114, 102, 59, 32768, 8499, 114, 59, 32896, 55349, 56592, 110, 117, 115, 80, 108, 117, 115, 59, 32768, 8723, 112, 102, 59, 32896, 55349, 56644, 99, 114, 59, 32768, 8499, 59, 32768, 924, 2304, 74, 97, 99, 101, 102, 111, 115, 116, 117, 3055, 3060, 3067, 3089, 3201, 3206, 3874, 3880, 3889, 99, 121, 59, 32768, 1034, 99, 117, 116, 101, 59, 32768, 323, 768, 97, 101, 121, 3074, 3080, 3086, 114, 111, 110, 59, 32768, 327, 100, 105, 108, 59, 32768, 325, 59, 32768, 1053, 768, 103, 115, 119, 3096, 3160, 3194, 97, 116, 105, 118, 101, 768, 77, 84, 86, 3108, 3121, 3145, 101, 100, 105, 117, 109, 83, 112, 97, 99, 101, 59, 32768, 8203, 104, 105, 512, 99, 110, 3128, 3137, 107, 83, 112, 97, 99, 101, 59, 32768, 8203, 83, 112, 97, 99, 101, 59, 32768, 8203, 101, 114, 121, 84, 104, 105, 110, 83, 112, 97, 99, 101, 59, 32768, 8203, 116, 101, 100, 512, 71, 76, 3168, 3184, 114, 101, 97, 116, 101, 114, 71, 114, 101, 97, 116, 101, 114, 59, 32768, 8811, 101, 115, 115, 76, 101, 115, 115, 59, 32768, 8810, 76, 105, 110, 101, 59, 32768, 10, 114, 59, 32896, 55349, 56593, 1024, 66, 110, 112, 116, 3215, 3222, 3238, 3242, 114, 101, 97, 107, 59, 32768, 8288, 66, 114, 101, 97, 107, 105, 110, 103, 83, 112, 97, 99, 101, 59, 32768, 160, 102, 59, 32768, 8469, 3328, 59, 67, 68, 69, 71, 72, 76, 78, 80, 82, 83, 84, 86, 3269, 3271, 3293, 3312, 3352, 3430, 3455, 3551, 3589, 3625, 3678, 3821, 3861, 32768, 10988, 512, 111, 117, 3276, 3286, 110, 103, 114, 117, 101, 110, 116, 59, 32768, 8802, 112, 67, 97, 112, 59, 32768, 8813, 111, 117, 98, 108, 101, 86, 101, 114, 116, 105, 99, 97, 108, 66, 97, 114, 59, 32768, 8742, 768, 108, 113, 120, 3319, 3327, 3345, 101, 109, 101, 110, 116, 59, 32768, 8713, 117, 97, 108, 512, 59, 84, 3335, 3337, 32768, 8800, 105, 108, 100, 101, 59, 32896, 8770, 824, 105, 115, 116, 115, 59, 32768, 8708, 114, 101, 97, 116, 101, 114, 1792, 59, 69, 70, 71, 76, 83, 84, 3373, 3375, 3382, 3394, 3404, 3410, 3423, 32768, 8815, 113, 117, 97, 108, 59, 32768, 8817, 117, 108, 108, 69, 113, 117, 97, 108, 59, 32896, 8807, 824, 114, 101, 97, 116, 101, 114, 59, 32896, 8811, 824, 101, 115, 115, 59, 32768, 8825, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32896, 10878, 824, 105, 108, 100, 101, 59, 32768, 8821, 117, 109, 112, 533, 3437, 3448, 111, 119, 110, 72, 117, 109, 112, 59, 32896, 8782, 824, 113, 117, 97, 108, 59, 32896, 8783, 824, 101, 512, 102, 115, 3461, 3492, 116, 84, 114, 105, 97, 110, 103, 108, 101, 768, 59, 66, 69, 3477, 3479, 3485, 32768, 8938, 97, 114, 59, 32896, 10703, 824, 113, 117, 97, 108, 59, 32768, 8940, 115, 1536, 59, 69, 71, 76, 83, 84, 3506, 3508, 3515, 3524, 3531, 3544, 32768, 8814, 113, 117, 97, 108, 59, 32768, 8816, 114, 101, 97, 116, 101, 114, 59, 32768, 8824, 101, 115, 115, 59, 32896, 8810, 824, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32896, 10877, 824, 105, 108, 100, 101, 59, 32768, 8820, 101, 115, 116, 101, 100, 512, 71, 76, 3561, 3578, 114, 101, 97, 116, 101, 114, 71, 114, 101, 97, 116, 101, 114, 59, 32896, 10914, 824, 101, 115, 115, 76, 101, 115, 115, 59, 32896, 10913, 824, 114, 101, 99, 101, 100, 101, 115, 768, 59, 69, 83, 3603, 3605, 3613, 32768, 8832, 113, 117, 97, 108, 59, 32896, 10927, 824, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32768, 8928, 512, 101, 105, 3630, 3645, 118, 101, 114, 115, 101, 69, 108, 101, 109, 101, 110, 116, 59, 32768, 8716, 103, 104, 116, 84, 114, 105, 97, 110, 103, 108, 101, 768, 59, 66, 69, 3663, 3665, 3671, 32768, 8939, 97, 114, 59, 32896, 10704, 824, 113, 117, 97, 108, 59, 32768, 8941, 512, 113, 117, 3683, 3732, 117, 97, 114, 101, 83, 117, 512, 98, 112, 3694, 3712, 115, 101, 116, 512, 59, 69, 3702, 3705, 32896, 8847, 824, 113, 117, 97, 108, 59, 32768, 8930, 101, 114, 115, 101, 116, 512, 59, 69, 3722, 3725, 32896, 8848, 824, 113, 117, 97, 108, 59, 32768, 8931, 768, 98, 99, 112, 3739, 3757, 3801, 115, 101, 116, 512, 59, 69, 3747, 3750, 32896, 8834, 8402, 113, 117, 97, 108, 59, 32768, 8840, 99, 101, 101, 100, 115, 1024, 59, 69, 83, 84, 3771, 3773, 3781, 3793, 32768, 8833, 113, 117, 97, 108, 59, 32896, 10928, 824, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32768, 8929, 105, 108, 100, 101, 59, 32896, 8831, 824, 101, 114, 115, 101, 116, 512, 59, 69, 3811, 3814, 32896, 8835, 8402, 113, 117, 97, 108, 59, 32768, 8841, 105, 108, 100, 101, 1024, 59, 69, 70, 84, 3834, 3836, 3843, 3854, 32768, 8769, 113, 117, 97, 108, 59, 32768, 8772, 117, 108, 108, 69, 113, 117, 97, 108, 59, 32768, 8775, 105, 108, 100, 101, 59, 32768, 8777, 101, 114, 116, 105, 99, 97, 108, 66, 97, 114, 59, 32768, 8740, 99, 114, 59, 32896, 55349, 56489, 105, 108, 100, 101, 33024, 209, 59, 32768, 209, 59, 32768, 925, 3584, 69, 97, 99, 100, 102, 103, 109, 111, 112, 114, 115, 116, 117, 118, 3921, 3927, 3936, 3951, 3958, 3963, 3972, 3996, 4002, 4034, 4037, 4055, 4071, 4078, 108, 105, 103, 59, 32768, 338, 99, 117, 116, 101, 33024, 211, 59, 32768, 211, 512, 105, 121, 3941, 3948, 114, 99, 33024, 212, 59, 32768, 212, 59, 32768, 1054, 98, 108, 97, 99, 59, 32768, 336, 114, 59, 32896, 55349, 56594, 114, 97, 118, 101, 33024, 210, 59, 32768, 210, 768, 97, 101, 105, 3979, 3984, 3989, 99, 114, 59, 32768, 332, 103, 97, 59, 32768, 937, 99, 114, 111, 110, 59, 32768, 927, 112, 102, 59, 32896, 55349, 56646, 101, 110, 67, 117, 114, 108, 121, 512, 68, 81, 4014, 4027, 111, 117, 98, 108, 101, 81, 117, 111, 116, 101, 59, 32768, 8220, 117, 111, 116, 101, 59, 32768, 8216, 59, 32768, 10836, 512, 99, 108, 4042, 4047, 114, 59, 32896, 55349, 56490, 97, 115, 104, 33024, 216, 59, 32768, 216, 105, 573, 4060, 4067, 100, 101, 33024, 213, 59, 32768, 213, 101, 115, 59, 32768, 10807, 109, 108, 33024, 214, 59, 32768, 214, 101, 114, 512, 66, 80, 4085, 4109, 512, 97, 114, 4090, 4094, 114, 59, 32768, 8254, 97, 99, 512, 101, 107, 4101, 4104, 59, 32768, 9182, 101, 116, 59, 32768, 9140, 97, 114, 101, 110, 116, 104, 101, 115, 105, 115, 59, 32768, 9180, 2304, 97, 99, 102, 104, 105, 108, 111, 114, 115, 4141, 4150, 4154, 4159, 4163, 4166, 4176, 4198, 4284, 114, 116, 105, 97, 108, 68, 59, 32768, 8706, 121, 59, 32768, 1055, 114, 59, 32896, 55349, 56595, 105, 59, 32768, 934, 59, 32768, 928, 117, 115, 77, 105, 110, 117, 115, 59, 32768, 177, 512, 105, 112, 4181, 4194, 110, 99, 97, 114, 101, 112, 108, 97, 110, 101, 59, 32768, 8460, 102, 59, 32768, 8473, 1024, 59, 101, 105, 111, 4207, 4209, 4251, 4256, 32768, 10939, 99, 101, 100, 101, 115, 1024, 59, 69, 83, 84, 4223, 4225, 4232, 4244, 32768, 8826, 113, 117, 97, 108, 59, 32768, 10927, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32768, 8828, 105, 108, 100, 101, 59, 32768, 8830, 109, 101, 59, 32768, 8243, 512, 100, 112, 4261, 4267, 117, 99, 116, 59, 32768, 8719, 111, 114, 116, 105, 111, 110, 512, 59, 97, 4278, 4280, 32768, 8759, 108, 59, 32768, 8733, 512, 99, 105, 4289, 4294, 114, 59, 32896, 55349, 56491, 59, 32768, 936, 1024, 85, 102, 111, 115, 4306, 4313, 4318, 4323, 79, 84, 33024, 34, 59, 32768, 34, 114, 59, 32896, 55349, 56596, 112, 102, 59, 32768, 8474, 99, 114, 59, 32896, 55349, 56492, 3072, 66, 69, 97, 99, 101, 102, 104, 105, 111, 114, 115, 117, 4354, 4360, 4366, 4395, 4417, 4473, 4477, 4481, 4743, 4764, 4776, 4788, 97, 114, 114, 59, 32768, 10512, 71, 33024, 174, 59, 32768, 174, 768, 99, 110, 114, 4373, 4379, 4383, 117, 116, 101, 59, 32768, 340, 103, 59, 32768, 10219, 114, 512, 59, 116, 4389, 4391, 32768, 8608, 108, 59, 32768, 10518, 768, 97, 101, 121, 4402, 4408, 4414, 114, 111, 110, 59, 32768, 344, 100, 105, 108, 59, 32768, 342, 59, 32768, 1056, 512, 59, 118, 4422, 4424, 32768, 8476, 101, 114, 115, 101, 512, 69, 85, 4433, 4458, 512, 108, 113, 4438, 4446, 101, 109, 101, 110, 116, 59, 32768, 8715, 117, 105, 108, 105, 98, 114, 105, 117, 109, 59, 32768, 8651, 112, 69, 113, 117, 105, 108, 105, 98, 114, 105, 117, 109, 59, 32768, 10607, 114, 59, 32768, 8476, 111, 59, 32768, 929, 103, 104, 116, 2048, 65, 67, 68, 70, 84, 85, 86, 97, 4501, 4547, 4556, 4607, 4614, 4671, 4719, 4736, 512, 110, 114, 4506, 4519, 103, 108, 101, 66, 114, 97, 99, 107, 101, 116, 59, 32768, 10217, 114, 111, 119, 768, 59, 66, 76, 4529, 4531, 4536, 32768, 8594, 97, 114, 59, 32768, 8677, 101, 102, 116, 65, 114, 114, 111, 119, 59, 32768, 8644, 101, 105, 108, 105, 110, 103, 59, 32768, 8969, 111, 838, 4562, 0, 4575, 98, 108, 101, 66, 114, 97, 99, 107, 101, 116, 59, 32768, 10215, 110, 805, 4580, 0, 4591, 101, 101, 86, 101, 99, 116, 111, 114, 59, 32768, 10589, 101, 99, 116, 111, 114, 512, 59, 66, 4600, 4602, 32768, 8642, 97, 114, 59, 32768, 10581, 108, 111, 111, 114, 59, 32768, 8971, 512, 101, 114, 4619, 4644, 101, 768, 59, 65, 86, 4627, 4629, 4636, 32768, 8866, 114, 114, 111, 119, 59, 32768, 8614, 101, 99, 116, 111, 114, 59, 32768, 10587, 105, 97, 110, 103, 108, 101, 768, 59, 66, 69, 4657, 4659, 4664, 32768, 8883, 97, 114, 59, 32768, 10704, 113, 117, 97, 108, 59, 32768, 8885, 112, 768, 68, 84, 86, 4679, 4691, 4702, 111, 119, 110, 86, 101, 99, 116, 111, 114, 59, 32768, 10575, 101, 101, 86, 101, 99, 116, 111, 114, 59, 32768, 10588, 101, 99, 116, 111, 114, 512, 59, 66, 4712, 4714, 32768, 8638, 97, 114, 59, 32768, 10580, 101, 99, 116, 111, 114, 512, 59, 66, 4729, 4731, 32768, 8640, 97, 114, 59, 32768, 10579, 114, 114, 111, 119, 59, 32768, 8658, 512, 112, 117, 4748, 4752, 102, 59, 32768, 8477, 110, 100, 73, 109, 112, 108, 105, 101, 115, 59, 32768, 10608, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8667, 512, 99, 104, 4781, 4785, 114, 59, 32768, 8475, 59, 32768, 8625, 108, 101, 68, 101, 108, 97, 121, 101, 100, 59, 32768, 10740, 3328, 72, 79, 97, 99, 102, 104, 105, 109, 111, 113, 115, 116, 117, 4827, 4842, 4849, 4856, 4889, 4894, 4949, 4955, 4967, 4973, 5059, 5065, 5070, 512, 67, 99, 4832, 4838, 72, 99, 121, 59, 32768, 1065, 121, 59, 32768, 1064, 70, 84, 99, 121, 59, 32768, 1068, 99, 117, 116, 101, 59, 32768, 346, 1280, 59, 97, 101, 105, 121, 4867, 4869, 4875, 4881, 4886, 32768, 10940, 114, 111, 110, 59, 32768, 352, 100, 105, 108, 59, 32768, 350, 114, 99, 59, 32768, 348, 59, 32768, 1057, 114, 59, 32896, 55349, 56598, 111, 114, 116, 1024, 68, 76, 82, 85, 4906, 4917, 4928, 4940, 111, 119, 110, 65, 114, 114, 111, 119, 59, 32768, 8595, 101, 102, 116, 65, 114, 114, 111, 119, 59, 32768, 8592, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 8594, 112, 65, 114, 114, 111, 119, 59, 32768, 8593, 103, 109, 97, 59, 32768, 931, 97, 108, 108, 67, 105, 114, 99, 108, 101, 59, 32768, 8728, 112, 102, 59, 32896, 55349, 56650, 1091, 4979, 0, 0, 4983, 116, 59, 32768, 8730, 97, 114, 101, 1024, 59, 73, 83, 85, 4994, 4996, 5010, 5052, 32768, 9633, 110, 116, 101, 114, 115, 101, 99, 116, 105, 111, 110, 59, 32768, 8851, 117, 512, 98, 112, 5016, 5033, 115, 101, 116, 512, 59, 69, 5024, 5026, 32768, 8847, 113, 117, 97, 108, 59, 32768, 8849, 101, 114, 115, 101, 116, 512, 59, 69, 5043, 5045, 32768, 8848, 113, 117, 97, 108, 59, 32768, 8850, 110, 105, 111, 110, 59, 32768, 8852, 99, 114, 59, 32896, 55349, 56494, 97, 114, 59, 32768, 8902, 1024, 98, 99, 109, 112, 5079, 5102, 5155, 5158, 512, 59, 115, 5084, 5086, 32768, 8912, 101, 116, 512, 59, 69, 5093, 5095, 32768, 8912, 113, 117, 97, 108, 59, 32768, 8838, 512, 99, 104, 5107, 5148, 101, 101, 100, 115, 1024, 59, 69, 83, 84, 5120, 5122, 5129, 5141, 32768, 8827, 113, 117, 97, 108, 59, 32768, 10928, 108, 97, 110, 116, 69, 113, 117, 97, 108, 59, 32768, 8829, 105, 108, 100, 101, 59, 32768, 8831, 84, 104, 97, 116, 59, 32768, 8715, 59, 32768, 8721, 768, 59, 101, 115, 5165, 5167, 5185, 32768, 8913, 114, 115, 101, 116, 512, 59, 69, 5176, 5178, 32768, 8835, 113, 117, 97, 108, 59, 32768, 8839, 101, 116, 59, 32768, 8913, 2816, 72, 82, 83, 97, 99, 102, 104, 105, 111, 114, 115, 5213, 5221, 5227, 5241, 5252, 5274, 5279, 5323, 5362, 5368, 5378, 79, 82, 78, 33024, 222, 59, 32768, 222, 65, 68, 69, 59, 32768, 8482, 512, 72, 99, 5232, 5237, 99, 121, 59, 32768, 1035, 121, 59, 32768, 1062, 512, 98, 117, 5246, 5249, 59, 32768, 9, 59, 32768, 932, 768, 97, 101, 121, 5259, 5265, 5271, 114, 111, 110, 59, 32768, 356, 100, 105, 108, 59, 32768, 354, 59, 32768, 1058, 114, 59, 32896, 55349, 56599, 512, 101, 105, 5284, 5300, 835, 5289, 0, 5297, 101, 102, 111, 114, 101, 59, 32768, 8756, 97, 59, 32768, 920, 512, 99, 110, 5305, 5315, 107, 83, 112, 97, 99, 101, 59, 32896, 8287, 8202, 83, 112, 97, 99, 101, 59, 32768, 8201, 108, 100, 101, 1024, 59, 69, 70, 84, 5335, 5337, 5344, 5355, 32768, 8764, 113, 117, 97, 108, 59, 32768, 8771, 117, 108, 108, 69, 113, 117, 97, 108, 59, 32768, 8773, 105, 108, 100, 101, 59, 32768, 8776, 112, 102, 59, 32896, 55349, 56651, 105, 112, 108, 101, 68, 111, 116, 59, 32768, 8411, 512, 99, 116, 5383, 5388, 114, 59, 32896, 55349, 56495, 114, 111, 107, 59, 32768, 358, 5426, 5417, 5444, 5458, 5473, 0, 5480, 5485, 0, 0, 0, 0, 0, 5494, 5500, 5564, 5579, 0, 5726, 5732, 5738, 5745, 512, 99, 114, 5421, 5429, 117, 116, 101, 33024, 218, 59, 32768, 218, 114, 512, 59, 111, 5435, 5437, 32768, 8607, 99, 105, 114, 59, 32768, 10569, 114, 820, 5449, 0, 5453, 121, 59, 32768, 1038, 118, 101, 59, 32768, 364, 512, 105, 121, 5462, 5469, 114, 99, 33024, 219, 59, 32768, 219, 59, 32768, 1059, 98, 108, 97, 99, 59, 32768, 368, 114, 59, 32896, 55349, 56600, 114, 97, 118, 101, 33024, 217, 59, 32768, 217, 97, 99, 114, 59, 32768, 362, 512, 100, 105, 5504, 5548, 101, 114, 512, 66, 80, 5511, 5535, 512, 97, 114, 5516, 5520, 114, 59, 32768, 95, 97, 99, 512, 101, 107, 5527, 5530, 59, 32768, 9183, 101, 116, 59, 32768, 9141, 97, 114, 101, 110, 116, 104, 101, 115, 105, 115, 59, 32768, 9181, 111, 110, 512, 59, 80, 5555, 5557, 32768, 8899, 108, 117, 115, 59, 32768, 8846, 512, 103, 112, 5568, 5573, 111, 110, 59, 32768, 370, 102, 59, 32896, 55349, 56652, 2048, 65, 68, 69, 84, 97, 100, 112, 115, 5595, 5624, 5635, 5648, 5664, 5671, 5682, 5712, 114, 114, 111, 119, 768, 59, 66, 68, 5606, 5608, 5613, 32768, 8593, 97, 114, 59, 32768, 10514, 111, 119, 110, 65, 114, 114, 111, 119, 59, 32768, 8645, 111, 119, 110, 65, 114, 114, 111, 119, 59, 32768, 8597, 113, 117, 105, 108, 105, 98, 114, 105, 117, 109, 59, 32768, 10606, 101, 101, 512, 59, 65, 5655, 5657, 32768, 8869, 114, 114, 111, 119, 59, 32768, 8613, 114, 114, 111, 119, 59, 32768, 8657, 111, 119, 110, 97, 114, 114, 111, 119, 59, 32768, 8661, 101, 114, 512, 76, 82, 5689, 5700, 101, 102, 116, 65, 114, 114, 111, 119, 59, 32768, 8598, 105, 103, 104, 116, 65, 114, 114, 111, 119, 59, 32768, 8599, 105, 512, 59, 108, 5718, 5720, 32768, 978, 111, 110, 59, 32768, 933, 105, 110, 103, 59, 32768, 366, 99, 114, 59, 32896, 55349, 56496, 105, 108, 100, 101, 59, 32768, 360, 109, 108, 33024, 220, 59, 32768, 220, 2304, 68, 98, 99, 100, 101, 102, 111, 115, 118, 5770, 5776, 5781, 5785, 5798, 5878, 5883, 5889, 5895, 97, 115, 104, 59, 32768, 8875, 97, 114, 59, 32768, 10987, 121, 59, 32768, 1042, 97, 115, 104, 512, 59, 108, 5793, 5795, 32768, 8873, 59, 32768, 10982, 512, 101, 114, 5803, 5806, 59, 32768, 8897, 768, 98, 116, 121, 5813, 5818, 5866, 97, 114, 59, 32768, 8214, 512, 59, 105, 5823, 5825, 32768, 8214, 99, 97, 108, 1024, 66, 76, 83, 84, 5837, 5842, 5848, 5859, 97, 114, 59, 32768, 8739, 105, 110, 101, 59, 32768, 124, 101, 112, 97, 114, 97, 116, 111, 114, 59, 32768, 10072, 105, 108, 100, 101, 59, 32768, 8768, 84, 104, 105, 110, 83, 112, 97, 99, 101, 59, 32768, 8202, 114, 59, 32896, 55349, 56601, 112, 102, 59, 32896, 55349, 56653, 99, 114, 59, 32896, 55349, 56497, 100, 97, 115, 104, 59, 32768, 8874, 1280, 99, 101, 102, 111, 115, 5913, 5919, 5925, 5930, 5936, 105, 114, 99, 59, 32768, 372, 100, 103, 101, 59, 32768, 8896, 114, 59, 32896, 55349, 56602, 112, 102, 59, 32896, 55349, 56654, 99, 114, 59, 32896, 55349, 56498, 1024, 102, 105, 111, 115, 5951, 5956, 5959, 5965, 114, 59, 32896, 55349, 56603, 59, 32768, 926, 112, 102, 59, 32896, 55349, 56655, 99, 114, 59, 32896, 55349, 56499, 2304, 65, 73, 85, 97, 99, 102, 111, 115, 117, 5990, 5995, 6000, 6005, 6014, 6027, 6032, 6038, 6044, 99, 121, 59, 32768, 1071, 99, 121, 59, 32768, 1031, 99, 121, 59, 32768, 1070, 99, 117, 116, 101, 33024, 221, 59, 32768, 221, 512, 105, 121, 6019, 6024, 114, 99, 59, 32768, 374, 59, 32768, 1067, 114, 59, 32896, 55349, 56604, 112, 102, 59, 32896, 55349, 56656, 99, 114, 59, 32896, 55349, 56500, 109, 108, 59, 32768, 376, 2048, 72, 97, 99, 100, 101, 102, 111, 115, 6066, 6071, 6078, 6092, 6097, 6119, 6123, 6128, 99, 121, 59, 32768, 1046, 99, 117, 116, 101, 59, 32768, 377, 512, 97, 121, 6083, 6089, 114, 111, 110, 59, 32768, 381, 59, 32768, 1047, 111, 116, 59, 32768, 379, 835, 6102, 0, 6116, 111, 87, 105, 100, 116, 104, 83, 112, 97, 99, 101, 59, 32768, 8203, 97, 59, 32768, 918, 114, 59, 32768, 8488, 112, 102, 59, 32768, 8484, 99, 114, 59, 32896, 55349, 56501, 5938, 6159, 6168, 6175, 0, 6214, 6222, 6233, 0, 0, 0, 0, 6242, 6267, 6290, 6429, 6444, 0, 6495, 6503, 6531, 6540, 0, 6547, 99, 117, 116, 101, 33024, 225, 59, 32768, 225, 114, 101, 118, 101, 59, 32768, 259, 1536, 59, 69, 100, 105, 117, 121, 6187, 6189, 6193, 6196, 6203, 6210, 32768, 8766, 59, 32896, 8766, 819, 59, 32768, 8767, 114, 99, 33024, 226, 59, 32768, 226, 116, 101, 33024, 180, 59, 32768, 180, 59, 32768, 1072, 108, 105, 103, 33024, 230, 59, 32768, 230, 512, 59, 114, 6226, 6228, 32768, 8289, 59, 32896, 55349, 56606, 114, 97, 118, 101, 33024, 224, 59, 32768, 224, 512, 101, 112, 6246, 6261, 512, 102, 112, 6251, 6257, 115, 121, 109, 59, 32768, 8501, 104, 59, 32768, 8501, 104, 97, 59, 32768, 945, 512, 97, 112, 6271, 6284, 512, 99, 108, 6276, 6280, 114, 59, 32768, 257, 103, 59, 32768, 10815, 33024, 38, 59, 32768, 38, 1077, 6295, 0, 0, 6326, 1280, 59, 97, 100, 115, 118, 6305, 6307, 6312, 6315, 6322, 32768, 8743, 110, 100, 59, 32768, 10837, 59, 32768, 10844, 108, 111, 112, 101, 59, 32768, 10840, 59, 32768, 10842, 1792, 59, 101, 108, 109, 114, 115, 122, 6340, 6342, 6345, 6349, 6391, 6410, 6422, 32768, 8736, 59, 32768, 10660, 101, 59, 32768, 8736, 115, 100, 512, 59, 97, 6356, 6358, 32768, 8737, 2098, 6368, 6371, 6374, 6377, 6380, 6383, 6386, 6389, 59, 32768, 10664, 59, 32768, 10665, 59, 32768, 10666, 59, 32768, 10667, 59, 32768, 10668, 59, 32768, 10669, 59, 32768, 10670, 59, 32768, 10671, 116, 512, 59, 118, 6397, 6399, 32768, 8735, 98, 512, 59, 100, 6405, 6407, 32768, 8894, 59, 32768, 10653, 512, 112, 116, 6415, 6419, 104, 59, 32768, 8738, 59, 32768, 197, 97, 114, 114, 59, 32768, 9084, 512, 103, 112, 6433, 6438, 111, 110, 59, 32768, 261, 102, 59, 32896, 55349, 56658, 1792, 59, 69, 97, 101, 105, 111, 112, 6458, 6460, 6463, 6469, 6472, 6476, 6480, 32768, 8776, 59, 32768, 10864, 99, 105, 114, 59, 32768, 10863, 59, 32768, 8778, 100, 59, 32768, 8779, 115, 59, 32768, 39, 114, 111, 120, 512, 59, 101, 6488, 6490, 32768, 8776, 113, 59, 32768, 8778, 105, 110, 103, 33024, 229, 59, 32768, 229, 768, 99, 116, 121, 6509, 6514, 6517, 114, 59, 32896, 55349, 56502, 59, 32768, 42, 109, 112, 512, 59, 101, 6524, 6526, 32768, 8776, 113, 59, 32768, 8781, 105, 108, 100, 101, 33024, 227, 59, 32768, 227, 109, 108, 33024, 228, 59, 32768, 228, 512, 99, 105, 6551, 6559, 111, 110, 105, 110, 116, 59, 32768, 8755, 110, 116, 59, 32768, 10769, 4096, 78, 97, 98, 99, 100, 101, 102, 105, 107, 108, 110, 111, 112, 114, 115, 117, 6597, 6602, 6673, 6688, 6701, 6707, 6768, 6773, 6891, 6898, 6999, 7023, 7309, 7316, 7334, 7383, 111, 116, 59, 32768, 10989, 512, 99, 114, 6607, 6652, 107, 1024, 99, 101, 112, 115, 6617, 6623, 6632, 6639, 111, 110, 103, 59, 32768, 8780, 112, 115, 105, 108, 111, 110, 59, 32768, 1014, 114, 105, 109, 101, 59, 32768, 8245, 105, 109, 512, 59, 101, 6646, 6648, 32768, 8765, 113, 59, 32768, 8909, 583, 6656, 6661, 101, 101, 59, 32768, 8893, 101, 100, 512, 59, 103, 6667, 6669, 32768, 8965, 101, 59, 32768, 8965, 114, 107, 512, 59, 116, 6680, 6682, 32768, 9141, 98, 114, 107, 59, 32768, 9142, 512, 111, 121, 6693, 6698, 110, 103, 59, 32768, 8780, 59, 32768, 1073, 113, 117, 111, 59, 32768, 8222, 1280, 99, 109, 112, 114, 116, 6718, 6731, 6738, 6743, 6749, 97, 117, 115, 512, 59, 101, 6726, 6728, 32768, 8757, 59, 32768, 8757, 112, 116, 121, 118, 59, 32768, 10672, 115, 105, 59, 32768, 1014, 110, 111, 117, 59, 32768, 8492, 768, 97, 104, 119, 6756, 6759, 6762, 59, 32768, 946, 59, 32768, 8502, 101, 101, 110, 59, 32768, 8812, 114, 59, 32896, 55349, 56607, 103, 1792, 99, 111, 115, 116, 117, 118, 119, 6789, 6809, 6834, 6850, 6872, 6879, 6884, 768, 97, 105, 117, 6796, 6800, 6805, 112, 59, 32768, 8898, 114, 99, 59, 32768, 9711, 112, 59, 32768, 8899, 768, 100, 112, 116, 6816, 6821, 6827, 111, 116, 59, 32768, 10752, 108, 117, 115, 59, 32768, 10753, 105, 109, 101, 115, 59, 32768, 10754, 1090, 6840, 0, 0, 6846, 99, 117, 112, 59, 32768, 10758, 97, 114, 59, 32768, 9733, 114, 105, 97, 110, 103, 108, 101, 512, 100, 117, 6862, 6868, 111, 119, 110, 59, 32768, 9661, 112, 59, 32768, 9651, 112, 108, 117, 115, 59, 32768, 10756, 101, 101, 59, 32768, 8897, 101, 100, 103, 101, 59, 32768, 8896, 97, 114, 111, 119, 59, 32768, 10509, 768, 97, 107, 111, 6905, 6976, 6994, 512, 99, 110, 6910, 6972, 107, 768, 108, 115, 116, 6918, 6927, 6935, 111, 122, 101, 110, 103, 101, 59, 32768, 10731, 113, 117, 97, 114, 101, 59, 32768, 9642, 114, 105, 97, 110, 103, 108, 101, 1024, 59, 100, 108, 114, 6951, 6953, 6959, 6965, 32768, 9652, 111, 119, 110, 59, 32768, 9662, 101, 102, 116, 59, 32768, 9666, 105, 103, 104, 116, 59, 32768, 9656, 107, 59, 32768, 9251, 770, 6981, 0, 6991, 771, 6985, 0, 6988, 59, 32768, 9618, 59, 32768, 9617, 52, 59, 32768, 9619, 99, 107, 59, 32768, 9608, 512, 101, 111, 7004, 7019, 512, 59, 113, 7009, 7012, 32896, 61, 8421, 117, 105, 118, 59, 32896, 8801, 8421, 116, 59, 32768, 8976, 1024, 112, 116, 119, 120, 7032, 7037, 7049, 7055, 102, 59, 32896, 55349, 56659, 512, 59, 116, 7042, 7044, 32768, 8869, 111, 109, 59, 32768, 8869, 116, 105, 101, 59, 32768, 8904, 3072, 68, 72, 85, 86, 98, 100, 104, 109, 112, 116, 117, 118, 7080, 7101, 7126, 7147, 7182, 7187, 7208, 7233, 7240, 7246, 7253, 7274, 1024, 76, 82, 108, 114, 7089, 7092, 7095, 7098, 59, 32768, 9559, 59, 32768, 9556, 59, 32768, 9558, 59, 32768, 9555, 1280, 59, 68, 85, 100, 117, 7112, 7114, 7117, 7120, 7123, 32768, 9552, 59, 32768, 9574, 59, 32768, 9577, 59, 32768, 9572, 59, 32768, 9575, 1024, 76, 82, 108, 114, 7135, 7138, 7141, 7144, 59, 32768, 9565, 59, 32768, 9562, 59, 32768, 9564, 59, 32768, 9561, 1792, 59, 72, 76, 82, 104, 108, 114, 7162, 7164, 7167, 7170, 7173, 7176, 7179, 32768, 9553, 59, 32768, 9580, 59, 32768, 9571, 59, 32768, 9568, 59, 32768, 9579, 59, 32768, 9570, 59, 32768, 9567, 111, 120, 59, 32768, 10697, 1024, 76, 82, 108, 114, 7196, 7199, 7202, 7205, 59, 32768, 9557, 59, 32768, 9554, 59, 32768, 9488, 59, 32768, 9484, 1280, 59, 68, 85, 100, 117, 7219, 7221, 7224, 7227, 7230, 32768, 9472, 59, 32768, 9573, 59, 32768, 9576, 59, 32768, 9516, 59, 32768, 9524, 105, 110, 117, 115, 59, 32768, 8863, 108, 117, 115, 59, 32768, 8862, 105, 109, 101, 115, 59, 32768, 8864, 1024, 76, 82, 108, 114, 7262, 7265, 7268, 7271, 59, 32768, 9563, 59, 32768, 9560, 59, 32768, 9496, 59, 32768, 9492, 1792, 59, 72, 76, 82, 104, 108, 114, 7289, 7291, 7294, 7297, 7300, 7303, 7306, 32768, 9474, 59, 32768, 9578, 59, 32768, 9569, 59, 32768, 9566, 59, 32768, 9532, 59, 32768, 9508, 59, 32768, 9500, 114, 105, 109, 101, 59, 32768, 8245, 512, 101, 118, 7321, 7326, 118, 101, 59, 32768, 728, 98, 97, 114, 33024, 166, 59, 32768, 166, 1024, 99, 101, 105, 111, 7343, 7348, 7353, 7364, 114, 59, 32896, 55349, 56503, 109, 105, 59, 32768, 8271, 109, 512, 59, 101, 7359, 7361, 32768, 8765, 59, 32768, 8909, 108, 768, 59, 98, 104, 7372, 7374, 7377, 32768, 92, 59, 32768, 10693, 115, 117, 98, 59, 32768, 10184, 573, 7387, 7399, 108, 512, 59, 101, 7392, 7394, 32768, 8226, 116, 59, 32768, 8226, 112, 768, 59, 69, 101, 7406, 7408, 7411, 32768, 8782, 59, 32768, 10926, 512, 59, 113, 7416, 7418, 32768, 8783, 59, 32768, 8783, 6450, 7448, 0, 7523, 7571, 7576, 7613, 0, 7618, 7647, 0, 0, 7764, 0, 0, 7779, 0, 0, 7899, 7914, 7949, 7955, 0, 8158, 0, 8176, 768, 99, 112, 114, 7454, 7460, 7509, 117, 116, 101, 59, 32768, 263, 1536, 59, 97, 98, 99, 100, 115, 7473, 7475, 7480, 7487, 7500, 7505, 32768, 8745, 110, 100, 59, 32768, 10820, 114, 99, 117, 112, 59, 32768, 10825, 512, 97, 117, 7492, 7496, 112, 59, 32768, 10827, 112, 59, 32768, 10823, 111, 116, 59, 32768, 10816, 59, 32896, 8745, 65024, 512, 101, 111, 7514, 7518, 116, 59, 32768, 8257, 110, 59, 32768, 711, 1024, 97, 101, 105, 117, 7531, 7544, 7552, 7557, 833, 7536, 0, 7540, 115, 59, 32768, 10829, 111, 110, 59, 32768, 269, 100, 105, 108, 33024, 231, 59, 32768, 231, 114, 99, 59, 32768, 265, 112, 115, 512, 59, 115, 7564, 7566, 32768, 10828, 109, 59, 32768, 10832, 111, 116, 59, 32768, 267, 768, 100, 109, 110, 7582, 7589, 7596, 105, 108, 33024, 184, 59, 32768, 184, 112, 116, 121, 118, 59, 32768, 10674, 116, 33280, 162, 59, 101, 7603, 7605, 32768, 162, 114, 100, 111, 116, 59, 32768, 183, 114, 59, 32896, 55349, 56608, 768, 99, 101, 105, 7624, 7628, 7643, 121, 59, 32768, 1095, 99, 107, 512, 59, 109, 7635, 7637, 32768, 10003, 97, 114, 107, 59, 32768, 10003, 59, 32768, 967, 114, 1792, 59, 69, 99, 101, 102, 109, 115, 7662, 7664, 7667, 7742, 7745, 7752, 7757, 32768, 9675, 59, 32768, 10691, 768, 59, 101, 108, 7674, 7676, 7680, 32768, 710, 113, 59, 32768, 8791, 101, 1074, 7687, 0, 0, 7709, 114, 114, 111, 119, 512, 108, 114, 7695, 7701, 101, 102, 116, 59, 32768, 8634, 105, 103, 104, 116, 59, 32768, 8635, 1280, 82, 83, 97, 99, 100, 7719, 7722, 7725, 7730, 7736, 59, 32768, 174, 59, 32768, 9416, 115, 116, 59, 32768, 8859, 105, 114, 99, 59, 32768, 8858, 97, 115, 104, 59, 32768, 8861, 59, 32768, 8791, 110, 105, 110, 116, 59, 32768, 10768, 105, 100, 59, 32768, 10991, 99, 105, 114, 59, 32768, 10690, 117, 98, 115, 512, 59, 117, 7771, 7773, 32768, 9827, 105, 116, 59, 32768, 9827, 1341, 7785, 7804, 7850, 0, 7871, 111, 110, 512, 59, 101, 7791, 7793, 32768, 58, 512, 59, 113, 7798, 7800, 32768, 8788, 59, 32768, 8788, 1086, 7809, 0, 0, 7820, 97, 512, 59, 116, 7814, 7816, 32768, 44, 59, 32768, 64, 768, 59, 102, 108, 7826, 7828, 7832, 32768, 8705, 110, 59, 32768, 8728, 101, 512, 109, 120, 7838, 7844, 101, 110, 116, 59, 32768, 8705, 101, 115, 59, 32768, 8450, 824, 7854, 0, 7866, 512, 59, 100, 7858, 7860, 32768, 8773, 111, 116, 59, 32768, 10861, 110, 116, 59, 32768, 8750, 768, 102, 114, 121, 7877, 7881, 7886, 59, 32896, 55349, 56660, 111, 100, 59, 32768, 8720, 33280, 169, 59, 115, 7892, 7894, 32768, 169, 114, 59, 32768, 8471, 512, 97, 111, 7903, 7908, 114, 114, 59, 32768, 8629, 115, 115, 59, 32768, 10007, 512, 99, 117, 7918, 7923, 114, 59, 32896, 55349, 56504, 512, 98, 112, 7928, 7938, 512, 59, 101, 7933, 7935, 32768, 10959, 59, 32768, 10961, 512, 59, 101, 7943, 7945, 32768, 10960, 59, 32768, 10962, 100, 111, 116, 59, 32768, 8943, 1792, 100, 101, 108, 112, 114, 118, 119, 7969, 7983, 7996, 8009, 8057, 8147, 8152, 97, 114, 114, 512, 108, 114, 7977, 7980, 59, 32768, 10552, 59, 32768, 10549, 1089, 7989, 0, 0, 7993, 114, 59, 32768, 8926, 99, 59, 32768, 8927, 97, 114, 114, 512, 59, 112, 8004, 8006, 32768, 8630, 59, 32768, 10557, 1536, 59, 98, 99, 100, 111, 115, 8022, 8024, 8031, 8044, 8049, 8053, 32768, 8746, 114, 99, 97, 112, 59, 32768, 10824, 512, 97, 117, 8036, 8040, 112, 59, 32768, 10822, 112, 59, 32768, 10826, 111, 116, 59, 32768, 8845, 114, 59, 32768, 10821, 59, 32896, 8746, 65024, 1024, 97, 108, 114, 118, 8066, 8078, 8116, 8123, 114, 114, 512, 59, 109, 8073, 8075, 32768, 8631, 59, 32768, 10556, 121, 768, 101, 118, 119, 8086, 8104, 8109, 113, 1089, 8093, 0, 0, 8099, 114, 101, 99, 59, 32768, 8926, 117, 99, 99, 59, 32768, 8927, 101, 101, 59, 32768, 8910, 101, 100, 103, 101, 59, 32768, 8911, 101, 110, 33024, 164, 59, 32768, 164, 101, 97, 114, 114, 111, 119, 512, 108, 114, 8134, 8140, 101, 102, 116, 59, 32768, 8630, 105, 103, 104, 116, 59, 32768, 8631, 101, 101, 59, 32768, 8910, 101, 100, 59, 32768, 8911, 512, 99, 105, 8162, 8170, 111, 110, 105, 110, 116, 59, 32768, 8754, 110, 116, 59, 32768, 8753, 108, 99, 116, 121, 59, 32768, 9005, 4864, 65, 72, 97, 98, 99, 100, 101, 102, 104, 105, 106, 108, 111, 114, 115, 116, 117, 119, 122, 8221, 8226, 8231, 8267, 8282, 8296, 8327, 8351, 8366, 8379, 8466, 8471, 8487, 8621, 8647, 8676, 8697, 8712, 8720, 114, 114, 59, 32768, 8659, 97, 114, 59, 32768, 10597, 1024, 103, 108, 114, 115, 8240, 8246, 8252, 8256, 103, 101, 114, 59, 32768, 8224, 101, 116, 104, 59, 32768, 8504, 114, 59, 32768, 8595, 104, 512, 59, 118, 8262, 8264, 32768, 8208, 59, 32768, 8867, 572, 8271, 8278, 97, 114, 111, 119, 59, 32768, 10511, 97, 99, 59, 32768, 733, 512, 97, 121, 8287, 8293, 114, 111, 110, 59, 32768, 271, 59, 32768, 1076, 768, 59, 97, 111, 8303, 8305, 8320, 32768, 8518, 512, 103, 114, 8310, 8316, 103, 101, 114, 59, 32768, 8225, 114, 59, 32768, 8650, 116, 115, 101, 113, 59, 32768, 10871, 768, 103, 108, 109, 8334, 8339, 8344, 33024, 176, 59, 32768, 176, 116, 97, 59, 32768, 948, 112, 116, 121, 118, 59, 32768, 10673, 512, 105, 114, 8356, 8362, 115, 104, 116, 59, 32768, 10623, 59, 32896, 55349, 56609, 97, 114, 512, 108, 114, 8373, 8376, 59, 32768, 8643, 59, 32768, 8642, 1280, 97, 101, 103, 115, 118, 8390, 8418, 8421, 8428, 8433, 109, 768, 59, 111, 115, 8398, 8400, 8415, 32768, 8900, 110, 100, 512, 59, 115, 8407, 8409, 32768, 8900, 117, 105, 116, 59, 32768, 9830, 59, 32768, 9830, 59, 32768, 168, 97, 109, 109, 97, 59, 32768, 989, 105, 110, 59, 32768, 8946, 768, 59, 105, 111, 8440, 8442, 8461, 32768, 247, 100, 101, 33280, 247, 59, 111, 8450, 8452, 32768, 247, 110, 116, 105, 109, 101, 115, 59, 32768, 8903, 110, 120, 59, 32768, 8903, 99, 121, 59, 32768, 1106, 99, 1088, 8478, 0, 0, 8483, 114, 110, 59, 32768, 8990, 111, 112, 59, 32768, 8973, 1280, 108, 112, 116, 117, 119, 8498, 8504, 8509, 8556, 8570, 108, 97, 114, 59, 32768, 36, 102, 59, 32896, 55349, 56661, 1280, 59, 101, 109, 112, 115, 8520, 8522, 8535, 8542, 8548, 32768, 729, 113, 512, 59, 100, 8528, 8530, 32768, 8784, 111, 116, 59, 32768, 8785, 105, 110, 117, 115, 59, 32768, 8760, 108, 117, 115, 59, 32768, 8724, 113, 117, 97, 114, 101, 59, 32768, 8865, 98, 108, 101, 98, 97, 114, 119, 101, 100, 103, 101, 59, 32768, 8966, 110, 768, 97, 100, 104, 8578, 8585, 8597, 114, 114, 111, 119, 59, 32768, 8595, 111, 119, 110, 97, 114, 114, 111, 119, 115, 59, 32768, 8650, 97, 114, 112, 111, 111, 110, 512, 108, 114, 8608, 8614, 101, 102, 116, 59, 32768, 8643, 105, 103, 104, 116, 59, 32768, 8642, 563, 8625, 8633, 107, 97, 114, 111, 119, 59, 32768, 10512, 1088, 8638, 0, 0, 8643, 114, 110, 59, 32768, 8991, 111, 112, 59, 32768, 8972, 768, 99, 111, 116, 8654, 8666, 8670, 512, 114, 121, 8659, 8663, 59, 32896, 55349, 56505, 59, 32768, 1109, 108, 59, 32768, 10742, 114, 111, 107, 59, 32768, 273, 512, 100, 114, 8681, 8686, 111, 116, 59, 32768, 8945, 105, 512, 59, 102, 8692, 8694, 32768, 9663, 59, 32768, 9662, 512, 97, 104, 8702, 8707, 114, 114, 59, 32768, 8693, 97, 114, 59, 32768, 10607, 97, 110, 103, 108, 101, 59, 32768, 10662, 512, 99, 105, 8725, 8729, 121, 59, 32768, 1119, 103, 114, 97, 114, 114, 59, 32768, 10239, 4608, 68, 97, 99, 100, 101, 102, 103, 108, 109, 110, 111, 112, 113, 114, 115, 116, 117, 120, 8774, 8788, 8807, 8844, 8849, 8852, 8866, 8895, 8929, 8977, 8989, 9004, 9046, 9136, 9151, 9171, 9184, 9199, 512, 68, 111, 8779, 8784, 111, 116, 59, 32768, 10871, 116, 59, 32768, 8785, 512, 99, 115, 8793, 8801, 117, 116, 101, 33024, 233, 59, 32768, 233, 116, 101, 114, 59, 32768, 10862, 1024, 97, 105, 111, 121, 8816, 8822, 8835, 8841, 114, 111, 110, 59, 32768, 283, 114, 512, 59, 99, 8828, 8830, 32768, 8790, 33024, 234, 59, 32768, 234, 108, 111, 110, 59, 32768, 8789, 59, 32768, 1101, 111, 116, 59, 32768, 279, 59, 32768, 8519, 512, 68, 114, 8857, 8862, 111, 116, 59, 32768, 8786, 59, 32896, 55349, 56610, 768, 59, 114, 115, 8873, 8875, 8883, 32768, 10906, 97, 118, 101, 33024, 232, 59, 32768, 232, 512, 59, 100, 8888, 8890, 32768, 10902, 111, 116, 59, 32768, 10904, 1024, 59, 105, 108, 115, 8904, 8906, 8914, 8917, 32768, 10905, 110, 116, 101, 114, 115, 59, 32768, 9191, 59, 32768, 8467, 512, 59, 100, 8922, 8924, 32768, 10901, 111, 116, 59, 32768, 10903, 768, 97, 112, 115, 8936, 8941, 8960, 99, 114, 59, 32768, 275, 116, 121, 768, 59, 115, 118, 8950, 8952, 8957, 32768, 8709, 101, 116, 59, 32768, 8709, 59, 32768, 8709, 112, 512, 49, 59, 8966, 8975, 516, 8970, 8973, 59, 32768, 8196, 59, 32768, 8197, 32768, 8195, 512, 103, 115, 8982, 8985, 59, 32768, 331, 112, 59, 32768, 8194, 512, 103, 112, 8994, 8999, 111, 110, 59, 32768, 281, 102, 59, 32896, 55349, 56662, 768, 97, 108, 115, 9011, 9023, 9028, 114, 512, 59, 115, 9017, 9019, 32768, 8917, 108, 59, 32768, 10723, 117, 115, 59, 32768, 10865, 105, 768, 59, 108, 118, 9036, 9038, 9043, 32768, 949, 111, 110, 59, 32768, 949, 59, 32768, 1013, 1024, 99, 115, 117, 118, 9055, 9071, 9099, 9128, 512, 105, 111, 9060, 9065, 114, 99, 59, 32768, 8790, 108, 111, 110, 59, 32768, 8789, 1082, 9077, 0, 0, 9081, 109, 59, 32768, 8770, 97, 110, 116, 512, 103, 108, 9088, 9093, 116, 114, 59, 32768, 10902, 101, 115, 115, 59, 32768, 10901, 768, 97, 101, 105, 9106, 9111, 9116, 108, 115, 59, 32768, 61, 115, 116, 59, 32768, 8799, 118, 512, 59, 68, 9122, 9124, 32768, 8801, 68, 59, 32768, 10872, 112, 97, 114, 115, 108, 59, 32768, 10725, 512, 68, 97, 9141, 9146, 111, 116, 59, 32768, 8787, 114, 114, 59, 32768, 10609, 768, 99, 100, 105, 9158, 9162, 9167, 114, 59, 32768, 8495, 111, 116, 59, 32768, 8784, 109, 59, 32768, 8770, 512, 97, 104, 9176, 9179, 59, 32768, 951, 33024, 240, 59, 32768, 240, 512, 109, 114, 9189, 9195, 108, 33024, 235, 59, 32768, 235, 111, 59, 32768, 8364, 768, 99, 105, 112, 9206, 9210, 9215, 108, 59, 32768, 33, 115, 116, 59, 32768, 8707, 512, 101, 111, 9220, 9230, 99, 116, 97, 116, 105, 111, 110, 59, 32768, 8496, 110, 101, 110, 116, 105, 97, 108, 101, 59, 32768, 8519, 4914, 9262, 0, 9276, 0, 9280, 9287, 0, 0, 9318, 9324, 0, 9331, 0, 9352, 9357, 9386, 0, 9395, 9497, 108, 108, 105, 110, 103, 100, 111, 116, 115, 101, 113, 59, 32768, 8786, 121, 59, 32768, 1092, 109, 97, 108, 101, 59, 32768, 9792, 768, 105, 108, 114, 9293, 9299, 9313, 108, 105, 103, 59, 32768, 64259, 1082, 9305, 0, 0, 9309, 103, 59, 32768, 64256, 105, 103, 59, 32768, 64260, 59, 32896, 55349, 56611, 108, 105, 103, 59, 32768, 64257, 108, 105, 103, 59, 32896, 102, 106, 768, 97, 108, 116, 9337, 9341, 9346, 116, 59, 32768, 9837, 105, 103, 59, 32768, 64258, 110, 115, 59, 32768, 9649, 111, 102, 59, 32768, 402, 833, 9361, 0, 9366, 102, 59, 32896, 55349, 56663, 512, 97, 107, 9370, 9375, 108, 108, 59, 32768, 8704, 512, 59, 118, 9380, 9382, 32768, 8916, 59, 32768, 10969, 97, 114, 116, 105, 110, 116, 59, 32768, 10765, 512, 97, 111, 9399, 9491, 512, 99, 115, 9404, 9487, 1794, 9413, 9443, 9453, 9470, 9474, 0, 9484, 1795, 9421, 9426, 9429, 9434, 9437, 0, 9440, 33024, 189, 59, 32768, 189, 59, 32768, 8531, 33024, 188, 59, 32768, 188, 59, 32768, 8533, 59, 32768, 8537, 59, 32768, 8539, 772, 9447, 0, 9450, 59, 32768, 8532, 59, 32768, 8534, 1285, 9459, 9464, 0, 0, 9467, 33024, 190, 59, 32768, 190, 59, 32768, 8535, 59, 32768, 8540, 53, 59, 32768, 8536, 775, 9478, 0, 9481, 59, 32768, 8538, 59, 32768, 8541, 56, 59, 32768, 8542, 108, 59, 32768, 8260, 119, 110, 59, 32768, 8994, 99, 114, 59, 32896, 55349, 56507, 4352, 69, 97, 98, 99, 100, 101, 102, 103, 105, 106, 108, 110, 111, 114, 115, 116, 118, 9537, 9547, 9575, 9582, 9595, 9600, 9679, 9684, 9694, 9700, 9705, 9725, 9773, 9779, 9785, 9810, 9917, 512, 59, 108, 9542, 9544, 32768, 8807, 59, 32768, 10892, 768, 99, 109, 112, 9554, 9560, 9572, 117, 116, 101, 59, 32768, 501, 109, 97, 512, 59, 100, 9567, 9569, 32768, 947, 59, 32768, 989, 59, 32768, 10886, 114, 101, 118, 101, 59, 32768, 287, 512, 105, 121, 9587, 9592, 114, 99, 59, 32768, 285, 59, 32768, 1075, 111, 116, 59, 32768, 289, 1024, 59, 108, 113, 115, 9609, 9611, 9614, 9633, 32768, 8805, 59, 32768, 8923, 768, 59, 113, 115, 9621, 9623, 9626, 32768, 8805, 59, 32768, 8807, 108, 97, 110, 116, 59, 32768, 10878, 1024, 59, 99, 100, 108, 9642, 9644, 9648, 9667, 32768, 10878, 99, 59, 32768, 10921, 111, 116, 512, 59, 111, 9655, 9657, 32768, 10880, 512, 59, 108, 9662, 9664, 32768, 10882, 59, 32768, 10884, 512, 59, 101, 9672, 9675, 32896, 8923, 65024, 115, 59, 32768, 10900, 114, 59, 32896, 55349, 56612, 512, 59, 103, 9689, 9691, 32768, 8811, 59, 32768, 8921, 109, 101, 108, 59, 32768, 8503, 99, 121, 59, 32768, 1107, 1024, 59, 69, 97, 106, 9714, 9716, 9719, 9722, 32768, 8823, 59, 32768, 10898, 59, 32768, 10917, 59, 32768, 10916, 1024, 69, 97, 101, 115, 9734, 9737, 9751, 9768, 59, 32768, 8809, 112, 512, 59, 112, 9743, 9745, 32768, 10890, 114, 111, 120, 59, 32768, 10890, 512, 59, 113, 9756, 9758, 32768, 10888, 512, 59, 113, 9763, 9765, 32768, 10888, 59, 32768, 8809, 105, 109, 59, 32768, 8935, 112, 102, 59, 32896, 55349, 56664, 97, 118, 101, 59, 32768, 96, 512, 99, 105, 9790, 9794, 114, 59, 32768, 8458, 109, 768, 59, 101, 108, 9802, 9804, 9807, 32768, 8819, 59, 32768, 10894, 59, 32768, 10896, 34304, 62, 59, 99, 100, 108, 113, 114, 9824, 9826, 9838, 9843, 9849, 9856, 32768, 62, 512, 99, 105, 9831, 9834, 59, 32768, 10919, 114, 59, 32768, 10874, 111, 116, 59, 32768, 8919, 80, 97, 114, 59, 32768, 10645, 117, 101, 115, 116, 59, 32768, 10876, 1280, 97, 100, 101, 108, 115, 9867, 9882, 9887, 9906, 9912, 833, 9872, 0, 9879, 112, 114, 111, 120, 59, 32768, 10886, 114, 59, 32768, 10616, 111, 116, 59, 32768, 8919, 113, 512, 108, 113, 9893, 9899, 101, 115, 115, 59, 32768, 8923, 108, 101, 115, 115, 59, 32768, 10892, 101, 115, 115, 59, 32768, 8823, 105, 109, 59, 32768, 8819, 512, 101, 110, 9922, 9932, 114, 116, 110, 101, 113, 113, 59, 32896, 8809, 65024, 69, 59, 32896, 8809, 65024, 2560, 65, 97, 98, 99, 101, 102, 107, 111, 115, 121, 9958, 9963, 10015, 10020, 10026, 10060, 10065, 10085, 10147, 10171, 114, 114, 59, 32768, 8660, 1024, 105, 108, 109, 114, 9972, 9978, 9982, 9988, 114, 115, 112, 59, 32768, 8202, 102, 59, 32768, 189, 105, 108, 116, 59, 32768, 8459, 512, 100, 114, 9993, 9998, 99, 121, 59, 32768, 1098, 768, 59, 99, 119, 10005, 10007, 10012, 32768, 8596, 105, 114, 59, 32768, 10568, 59, 32768, 8621, 97, 114, 59, 32768, 8463, 105, 114, 99, 59, 32768, 293, 768, 97, 108, 114, 10033, 10048, 10054, 114, 116, 115, 512, 59, 117, 10041, 10043, 32768, 9829, 105, 116, 59, 32768, 9829, 108, 105, 112, 59, 32768, 8230, 99, 111, 110, 59, 32768, 8889, 114, 59, 32896, 55349, 56613, 115, 512, 101, 119, 10071, 10078, 97, 114, 111, 119, 59, 32768, 10533, 97, 114, 111, 119, 59, 32768, 10534, 1280, 97, 109, 111, 112, 114, 10096, 10101, 10107, 10136, 10141, 114, 114, 59, 32768, 8703, 116, 104, 116, 59, 32768, 8763, 107, 512, 108, 114, 10113, 10124, 101, 102, 116, 97, 114, 114, 111, 119, 59, 32768, 8617, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8618, 102, 59, 32896, 55349, 56665, 98, 97, 114, 59, 32768, 8213, 768, 99, 108, 116, 10154, 10159, 10165, 114, 59, 32896, 55349, 56509, 97, 115, 104, 59, 32768, 8463, 114, 111, 107, 59, 32768, 295, 512, 98, 112, 10176, 10182, 117, 108, 108, 59, 32768, 8259, 104, 101, 110, 59, 32768, 8208, 5426, 10211, 0, 10220, 0, 10239, 10255, 10267, 0, 10276, 10312, 0, 0, 10318, 10371, 10458, 10485, 10491, 0, 10500, 10545, 10558, 99, 117, 116, 101, 33024, 237, 59, 32768, 237, 768, 59, 105, 121, 10226, 10228, 10235, 32768, 8291, 114, 99, 33024, 238, 59, 32768, 238, 59, 32768, 1080, 512, 99, 120, 10243, 10247, 121, 59, 32768, 1077, 99, 108, 33024, 161, 59, 32768, 161, 512, 102, 114, 10259, 10262, 59, 32768, 8660, 59, 32896, 55349, 56614, 114, 97, 118, 101, 33024, 236, 59, 32768, 236, 1024, 59, 105, 110, 111, 10284, 10286, 10300, 10306, 32768, 8520, 512, 105, 110, 10291, 10296, 110, 116, 59, 32768, 10764, 116, 59, 32768, 8749, 102, 105, 110, 59, 32768, 10716, 116, 97, 59, 32768, 8489, 108, 105, 103, 59, 32768, 307, 768, 97, 111, 112, 10324, 10361, 10365, 768, 99, 103, 116, 10331, 10335, 10357, 114, 59, 32768, 299, 768, 101, 108, 112, 10342, 10345, 10351, 59, 32768, 8465, 105, 110, 101, 59, 32768, 8464, 97, 114, 116, 59, 32768, 8465, 104, 59, 32768, 305, 102, 59, 32768, 8887, 101, 100, 59, 32768, 437, 1280, 59, 99, 102, 111, 116, 10381, 10383, 10389, 10403, 10409, 32768, 8712, 97, 114, 101, 59, 32768, 8453, 105, 110, 512, 59, 116, 10396, 10398, 32768, 8734, 105, 101, 59, 32768, 10717, 100, 111, 116, 59, 32768, 305, 1280, 59, 99, 101, 108, 112, 10420, 10422, 10427, 10444, 10451, 32768, 8747, 97, 108, 59, 32768, 8890, 512, 103, 114, 10432, 10438, 101, 114, 115, 59, 32768, 8484, 99, 97, 108, 59, 32768, 8890, 97, 114, 104, 107, 59, 32768, 10775, 114, 111, 100, 59, 32768, 10812, 1024, 99, 103, 112, 116, 10466, 10470, 10475, 10480, 121, 59, 32768, 1105, 111, 110, 59, 32768, 303, 102, 59, 32896, 55349, 56666, 97, 59, 32768, 953, 114, 111, 100, 59, 32768, 10812, 117, 101, 115, 116, 33024, 191, 59, 32768, 191, 512, 99, 105, 10504, 10509, 114, 59, 32896, 55349, 56510, 110, 1280, 59, 69, 100, 115, 118, 10521, 10523, 10526, 10531, 10541, 32768, 8712, 59, 32768, 8953, 111, 116, 59, 32768, 8949, 512, 59, 118, 10536, 10538, 32768, 8948, 59, 32768, 8947, 59, 32768, 8712, 512, 59, 105, 10549, 10551, 32768, 8290, 108, 100, 101, 59, 32768, 297, 828, 10562, 0, 10567, 99, 121, 59, 32768, 1110, 108, 33024, 239, 59, 32768, 239, 1536, 99, 102, 109, 111, 115, 117, 10585, 10598, 10603, 10609, 10615, 10630, 512, 105, 121, 10590, 10595, 114, 99, 59, 32768, 309, 59, 32768, 1081, 114, 59, 32896, 55349, 56615, 97, 116, 104, 59, 32768, 567, 112, 102, 59, 32896, 55349, 56667, 820, 10620, 0, 10625, 114, 59, 32896, 55349, 56511, 114, 99, 121, 59, 32768, 1112, 107, 99, 121, 59, 32768, 1108, 2048, 97, 99, 102, 103, 104, 106, 111, 115, 10653, 10666, 10680, 10685, 10692, 10697, 10702, 10708, 112, 112, 97, 512, 59, 118, 10661, 10663, 32768, 954, 59, 32768, 1008, 512, 101, 121, 10671, 10677, 100, 105, 108, 59, 32768, 311, 59, 32768, 1082, 114, 59, 32896, 55349, 56616, 114, 101, 101, 110, 59, 32768, 312, 99, 121, 59, 32768, 1093, 99, 121, 59, 32768, 1116, 112, 102, 59, 32896, 55349, 56668, 99, 114, 59, 32896, 55349, 56512, 5888, 65, 66, 69, 72, 97, 98, 99, 100, 101, 102, 103, 104, 106, 108, 109, 110, 111, 112, 114, 115, 116, 117, 118, 10761, 10783, 10789, 10799, 10804, 10957, 11011, 11047, 11094, 11349, 11372, 11382, 11409, 11414, 11451, 11478, 11526, 11698, 11711, 11755, 11823, 11910, 11929, 768, 97, 114, 116, 10768, 10773, 10777, 114, 114, 59, 32768, 8666, 114, 59, 32768, 8656, 97, 105, 108, 59, 32768, 10523, 97, 114, 114, 59, 32768, 10510, 512, 59, 103, 10794, 10796, 32768, 8806, 59, 32768, 10891, 97, 114, 59, 32768, 10594, 4660, 10824, 0, 10830, 0, 10838, 0, 0, 0, 0, 0, 10844, 10850, 0, 10867, 10870, 10877, 0, 10933, 117, 116, 101, 59, 32768, 314, 109, 112, 116, 121, 118, 59, 32768, 10676, 114, 97, 110, 59, 32768, 8466, 98, 100, 97, 59, 32768, 955, 103, 768, 59, 100, 108, 10857, 10859, 10862, 32768, 10216, 59, 32768, 10641, 101, 59, 32768, 10216, 59, 32768, 10885, 117, 111, 33024, 171, 59, 32768, 171, 114, 2048, 59, 98, 102, 104, 108, 112, 115, 116, 10894, 10896, 10907, 10911, 10915, 10919, 10923, 10928, 32768, 8592, 512, 59, 102, 10901, 10903, 32768, 8676, 115, 59, 32768, 10527, 115, 59, 32768, 10525, 107, 59, 32768, 8617, 112, 59, 32768, 8619, 108, 59, 32768, 10553, 105, 109, 59, 32768, 10611, 108, 59, 32768, 8610, 768, 59, 97, 101, 10939, 10941, 10946, 32768, 10923, 105, 108, 59, 32768, 10521, 512, 59, 115, 10951, 10953, 32768, 10925, 59, 32896, 10925, 65024, 768, 97, 98, 114, 10964, 10969, 10974, 114, 114, 59, 32768, 10508, 114, 107, 59, 32768, 10098, 512, 97, 107, 10979, 10991, 99, 512, 101, 107, 10985, 10988, 59, 32768, 123, 59, 32768, 91, 512, 101, 115, 10996, 10999, 59, 32768, 10635, 108, 512, 100, 117, 11005, 11008, 59, 32768, 10639, 59, 32768, 10637, 1024, 97, 101, 117, 121, 11020, 11026, 11040, 11044, 114, 111, 110, 59, 32768, 318, 512, 100, 105, 11031, 11036, 105, 108, 59, 32768, 316, 108, 59, 32768, 8968, 98, 59, 32768, 123, 59, 32768, 1083, 1024, 99, 113, 114, 115, 11056, 11060, 11072, 11090, 97, 59, 32768, 10550, 117, 111, 512, 59, 114, 11067, 11069, 32768, 8220, 59, 32768, 8222, 512, 100, 117, 11077, 11083, 104, 97, 114, 59, 32768, 10599, 115, 104, 97, 114, 59, 32768, 10571, 104, 59, 32768, 8626, 1280, 59, 102, 103, 113, 115, 11105, 11107, 11228, 11231, 11250, 32768, 8804, 116, 1280, 97, 104, 108, 114, 116, 11119, 11136, 11157, 11169, 11216, 114, 114, 111, 119, 512, 59, 116, 11128, 11130, 32768, 8592, 97, 105, 108, 59, 32768, 8610, 97, 114, 112, 111, 111, 110, 512, 100, 117, 11147, 11153, 111, 119, 110, 59, 32768, 8637, 112, 59, 32768, 8636, 101, 102, 116, 97, 114, 114, 111, 119, 115, 59, 32768, 8647, 105, 103, 104, 116, 768, 97, 104, 115, 11180, 11194, 11204, 114, 114, 111, 119, 512, 59, 115, 11189, 11191, 32768, 8596, 59, 32768, 8646, 97, 114, 112, 111, 111, 110, 115, 59, 32768, 8651, 113, 117, 105, 103, 97, 114, 114, 111, 119, 59, 32768, 8621, 104, 114, 101, 101, 116, 105, 109, 101, 115, 59, 32768, 8907, 59, 32768, 8922, 768, 59, 113, 115, 11238, 11240, 11243, 32768, 8804, 59, 32768, 8806, 108, 97, 110, 116, 59, 32768, 10877, 1280, 59, 99, 100, 103, 115, 11261, 11263, 11267, 11286, 11298, 32768, 10877, 99, 59, 32768, 10920, 111, 116, 512, 59, 111, 11274, 11276, 32768, 10879, 512, 59, 114, 11281, 11283, 32768, 10881, 59, 32768, 10883, 512, 59, 101, 11291, 11294, 32896, 8922, 65024, 115, 59, 32768, 10899, 1280, 97, 100, 101, 103, 115, 11309, 11317, 11322, 11339, 11344, 112, 112, 114, 111, 120, 59, 32768, 10885, 111, 116, 59, 32768, 8918, 113, 512, 103, 113, 11328, 11333, 116, 114, 59, 32768, 8922, 103, 116, 114, 59, 32768, 10891, 116, 114, 59, 32768, 8822, 105, 109, 59, 32768, 8818, 768, 105, 108, 114, 11356, 11362, 11368, 115, 104, 116, 59, 32768, 10620, 111, 111, 114, 59, 32768, 8970, 59, 32896, 55349, 56617, 512, 59, 69, 11377, 11379, 32768, 8822, 59, 32768, 10897, 562, 11386, 11405, 114, 512, 100, 117, 11391, 11394, 59, 32768, 8637, 512, 59, 108, 11399, 11401, 32768, 8636, 59, 32768, 10602, 108, 107, 59, 32768, 9604, 99, 121, 59, 32768, 1113, 1280, 59, 97, 99, 104, 116, 11425, 11427, 11432, 11440, 11446, 32768, 8810, 114, 114, 59, 32768, 8647, 111, 114, 110, 101, 114, 59, 32768, 8990, 97, 114, 100, 59, 32768, 10603, 114, 105, 59, 32768, 9722, 512, 105, 111, 11456, 11462, 100, 111, 116, 59, 32768, 320, 117, 115, 116, 512, 59, 97, 11470, 11472, 32768, 9136, 99, 104, 101, 59, 32768, 9136, 1024, 69, 97, 101, 115, 11487, 11490, 11504, 11521, 59, 32768, 8808, 112, 512, 59, 112, 11496, 11498, 32768, 10889, 114, 111, 120, 59, 32768, 10889, 512, 59, 113, 11509, 11511, 32768, 10887, 512, 59, 113, 11516, 11518, 32768, 10887, 59, 32768, 8808, 105, 109, 59, 32768, 8934, 2048, 97, 98, 110, 111, 112, 116, 119, 122, 11543, 11556, 11561, 11616, 11640, 11660, 11667, 11680, 512, 110, 114, 11548, 11552, 103, 59, 32768, 10220, 114, 59, 32768, 8701, 114, 107, 59, 32768, 10214, 103, 768, 108, 109, 114, 11569, 11596, 11604, 101, 102, 116, 512, 97, 114, 11577, 11584, 114, 114, 111, 119, 59, 32768, 10229, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 10231, 97, 112, 115, 116, 111, 59, 32768, 10236, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 10230, 112, 97, 114, 114, 111, 119, 512, 108, 114, 11627, 11633, 101, 102, 116, 59, 32768, 8619, 105, 103, 104, 116, 59, 32768, 8620, 768, 97, 102, 108, 11647, 11651, 11655, 114, 59, 32768, 10629, 59, 32896, 55349, 56669, 117, 115, 59, 32768, 10797, 105, 109, 101, 115, 59, 32768, 10804, 562, 11671, 11676, 115, 116, 59, 32768, 8727, 97, 114, 59, 32768, 95, 768, 59, 101, 102, 11687, 11689, 11695, 32768, 9674, 110, 103, 101, 59, 32768, 9674, 59, 32768, 10731, 97, 114, 512, 59, 108, 11705, 11707, 32768, 40, 116, 59, 32768, 10643, 1280, 97, 99, 104, 109, 116, 11722, 11727, 11735, 11747, 11750, 114, 114, 59, 32768, 8646, 111, 114, 110, 101, 114, 59, 32768, 8991, 97, 114, 512, 59, 100, 11742, 11744, 32768, 8651, 59, 32768, 10605, 59, 32768, 8206, 114, 105, 59, 32768, 8895, 1536, 97, 99, 104, 105, 113, 116, 11768, 11774, 11779, 11782, 11798, 11817, 113, 117, 111, 59, 32768, 8249, 114, 59, 32896, 55349, 56513, 59, 32768, 8624, 109, 768, 59, 101, 103, 11790, 11792, 11795, 32768, 8818, 59, 32768, 10893, 59, 32768, 10895, 512, 98, 117, 11803, 11806, 59, 32768, 91, 111, 512, 59, 114, 11812, 11814, 32768, 8216, 59, 32768, 8218, 114, 111, 107, 59, 32768, 322, 34816, 60, 59, 99, 100, 104, 105, 108, 113, 114, 11841, 11843, 11855, 11860, 11866, 11872, 11878, 11885, 32768, 60, 512, 99, 105, 11848, 11851, 59, 32768, 10918, 114, 59, 32768, 10873, 111, 116, 59, 32768, 8918, 114, 101, 101, 59, 32768, 8907, 109, 101, 115, 59, 32768, 8905, 97, 114, 114, 59, 32768, 10614, 117, 101, 115, 116, 59, 32768, 10875, 512, 80, 105, 11890, 11895, 97, 114, 59, 32768, 10646, 768, 59, 101, 102, 11902, 11904, 11907, 32768, 9667, 59, 32768, 8884, 59, 32768, 9666, 114, 512, 100, 117, 11916, 11923, 115, 104, 97, 114, 59, 32768, 10570, 104, 97, 114, 59, 32768, 10598, 512, 101, 110, 11934, 11944, 114, 116, 110, 101, 113, 113, 59, 32896, 8808, 65024, 69, 59, 32896, 8808, 65024, 3584, 68, 97, 99, 100, 101, 102, 104, 105, 108, 110, 111, 112, 115, 117, 11978, 11984, 12061, 12075, 12081, 12095, 12100, 12104, 12170, 12181, 12188, 12204, 12207, 12223, 68, 111, 116, 59, 32768, 8762, 1024, 99, 108, 112, 114, 11993, 11999, 12019, 12055, 114, 33024, 175, 59, 32768, 175, 512, 101, 116, 12004, 12007, 59, 32768, 9794, 512, 59, 101, 12012, 12014, 32768, 10016, 115, 101, 59, 32768, 10016, 512, 59, 115, 12024, 12026, 32768, 8614, 116, 111, 1024, 59, 100, 108, 117, 12037, 12039, 12045, 12051, 32768, 8614, 111, 119, 110, 59, 32768, 8615, 101, 102, 116, 59, 32768, 8612, 112, 59, 32768, 8613, 107, 101, 114, 59, 32768, 9646, 512, 111, 121, 12066, 12072, 109, 109, 97, 59, 32768, 10793, 59, 32768, 1084, 97, 115, 104, 59, 32768, 8212, 97, 115, 117, 114, 101, 100, 97, 110, 103, 108, 101, 59, 32768, 8737, 114, 59, 32896, 55349, 56618, 111, 59, 32768, 8487, 768, 99, 100, 110, 12111, 12118, 12146, 114, 111, 33024, 181, 59, 32768, 181, 1024, 59, 97, 99, 100, 12127, 12129, 12134, 12139, 32768, 8739, 115, 116, 59, 32768, 42, 105, 114, 59, 32768, 10992, 111, 116, 33024, 183, 59, 32768, 183, 117, 115, 768, 59, 98, 100, 12155, 12157, 12160, 32768, 8722, 59, 32768, 8863, 512, 59, 117, 12165, 12167, 32768, 8760, 59, 32768, 10794, 564, 12174, 12178, 112, 59, 32768, 10971, 114, 59, 32768, 8230, 112, 108, 117, 115, 59, 32768, 8723, 512, 100, 112, 12193, 12199, 101, 108, 115, 59, 32768, 8871, 102, 59, 32896, 55349, 56670, 59, 32768, 8723, 512, 99, 116, 12212, 12217, 114, 59, 32896, 55349, 56514, 112, 111, 115, 59, 32768, 8766, 768, 59, 108, 109, 12230, 12232, 12240, 32768, 956, 116, 105, 109, 97, 112, 59, 32768, 8888, 97, 112, 59, 32768, 8888, 6144, 71, 76, 82, 86, 97, 98, 99, 100, 101, 102, 103, 104, 105, 106, 108, 109, 111, 112, 114, 115, 116, 117, 118, 119, 12294, 12315, 12364, 12376, 12393, 12472, 12496, 12547, 12553, 12636, 12641, 12703, 12725, 12747, 12752, 12876, 12881, 12957, 13033, 13089, 13294, 13359, 13384, 13499, 512, 103, 116, 12299, 12303, 59, 32896, 8921, 824, 512, 59, 118, 12308, 12311, 32896, 8811, 8402, 59, 32896, 8811, 824, 768, 101, 108, 116, 12322, 12348, 12352, 102, 116, 512, 97, 114, 12329, 12336, 114, 114, 111, 119, 59, 32768, 8653, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8654, 59, 32896, 8920, 824, 512, 59, 118, 12357, 12360, 32896, 8810, 8402, 59, 32896, 8810, 824, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8655, 512, 68, 100, 12381, 12387, 97, 115, 104, 59, 32768, 8879, 97, 115, 104, 59, 32768, 8878, 1280, 98, 99, 110, 112, 116, 12404, 12409, 12415, 12420, 12452, 108, 97, 59, 32768, 8711, 117, 116, 101, 59, 32768, 324, 103, 59, 32896, 8736, 8402, 1280, 59, 69, 105, 111, 112, 12431, 12433, 12437, 12442, 12446, 32768, 8777, 59, 32896, 10864, 824, 100, 59, 32896, 8779, 824, 115, 59, 32768, 329, 114, 111, 120, 59, 32768, 8777, 117, 114, 512, 59, 97, 12459, 12461, 32768, 9838, 108, 512, 59, 115, 12467, 12469, 32768, 9838, 59, 32768, 8469, 836, 12477, 0, 12483, 112, 33024, 160, 59, 32768, 160, 109, 112, 512, 59, 101, 12489, 12492, 32896, 8782, 824, 59, 32896, 8783, 824, 1280, 97, 101, 111, 117, 121, 12507, 12519, 12525, 12540, 12544, 833, 12512, 0, 12515, 59, 32768, 10819, 111, 110, 59, 32768, 328, 100, 105, 108, 59, 32768, 326, 110, 103, 512, 59, 100, 12532, 12534, 32768, 8775, 111, 116, 59, 32896, 10861, 824, 112, 59, 32768, 10818, 59, 32768, 1085, 97, 115, 104, 59, 32768, 8211, 1792, 59, 65, 97, 100, 113, 115, 120, 12568, 12570, 12575, 12596, 12602, 12608, 12623, 32768, 8800, 114, 114, 59, 32768, 8663, 114, 512, 104, 114, 12581, 12585, 107, 59, 32768, 10532, 512, 59, 111, 12590, 12592, 32768, 8599, 119, 59, 32768, 8599, 111, 116, 59, 32896, 8784, 824, 117, 105, 118, 59, 32768, 8802, 512, 101, 105, 12613, 12618, 97, 114, 59, 32768, 10536, 109, 59, 32896, 8770, 824, 105, 115, 116, 512, 59, 115, 12631, 12633, 32768, 8708, 59, 32768, 8708, 114, 59, 32896, 55349, 56619, 1024, 69, 101, 115, 116, 12650, 12654, 12688, 12693, 59, 32896, 8807, 824, 768, 59, 113, 115, 12661, 12663, 12684, 32768, 8817, 768, 59, 113, 115, 12670, 12672, 12676, 32768, 8817, 59, 32896, 8807, 824, 108, 97, 110, 116, 59, 32896, 10878, 824, 59, 32896, 10878, 824, 105, 109, 59, 32768, 8821, 512, 59, 114, 12698, 12700, 32768, 8815, 59, 32768, 8815, 768, 65, 97, 112, 12710, 12715, 12720, 114, 114, 59, 32768, 8654, 114, 114, 59, 32768, 8622, 97, 114, 59, 32768, 10994, 768, 59, 115, 118, 12732, 12734, 12744, 32768, 8715, 512, 59, 100, 12739, 12741, 32768, 8956, 59, 32768, 8954, 59, 32768, 8715, 99, 121, 59, 32768, 1114, 1792, 65, 69, 97, 100, 101, 115, 116, 12767, 12772, 12776, 12781, 12785, 12853, 12858, 114, 114, 59, 32768, 8653, 59, 32896, 8806, 824, 114, 114, 59, 32768, 8602, 114, 59, 32768, 8229, 1024, 59, 102, 113, 115, 12794, 12796, 12821, 12842, 32768, 8816, 116, 512, 97, 114, 12802, 12809, 114, 114, 111, 119, 59, 32768, 8602, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8622, 768, 59, 113, 115, 12828, 12830, 12834, 32768, 8816, 59, 32896, 8806, 824, 108, 97, 110, 116, 59, 32896, 10877, 824, 512, 59, 115, 12847, 12850, 32896, 10877, 824, 59, 32768, 8814, 105, 109, 59, 32768, 8820, 512, 59, 114, 12863, 12865, 32768, 8814, 105, 512, 59, 101, 12871, 12873, 32768, 8938, 59, 32768, 8940, 105, 100, 59, 32768, 8740, 512, 112, 116, 12886, 12891, 102, 59, 32896, 55349, 56671, 33536, 172, 59, 105, 110, 12899, 12901, 12936, 32768, 172, 110, 1024, 59, 69, 100, 118, 12911, 12913, 12917, 12923, 32768, 8713, 59, 32896, 8953, 824, 111, 116, 59, 32896, 8949, 824, 818, 12928, 12931, 12934, 59, 32768, 8713, 59, 32768, 8951, 59, 32768, 8950, 105, 512, 59, 118, 12942, 12944, 32768, 8716, 818, 12949, 12952, 12955, 59, 32768, 8716, 59, 32768, 8958, 59, 32768, 8957, 768, 97, 111, 114, 12964, 12992, 12999, 114, 1024, 59, 97, 115, 116, 12974, 12976, 12983, 12988, 32768, 8742, 108, 108, 101, 108, 59, 32768, 8742, 108, 59, 32896, 11005, 8421, 59, 32896, 8706, 824, 108, 105, 110, 116, 59, 32768, 10772, 768, 59, 99, 101, 13006, 13008, 13013, 32768, 8832, 117, 101, 59, 32768, 8928, 512, 59, 99, 13018, 13021, 32896, 10927, 824, 512, 59, 101, 13026, 13028, 32768, 8832, 113, 59, 32896, 10927, 824, 1024, 65, 97, 105, 116, 13042, 13047, 13066, 13077, 114, 114, 59, 32768, 8655, 114, 114, 768, 59, 99, 119, 13056, 13058, 13062, 32768, 8603, 59, 32896, 10547, 824, 59, 32896, 8605, 824, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8603, 114, 105, 512, 59, 101, 13084, 13086, 32768, 8939, 59, 32768, 8941, 1792, 99, 104, 105, 109, 112, 113, 117, 13104, 13128, 13151, 13169, 13174, 13179, 13194, 1024, 59, 99, 101, 114, 13113, 13115, 13120, 13124, 32768, 8833, 117, 101, 59, 32768, 8929, 59, 32896, 10928, 824, 59, 32896, 55349, 56515, 111, 114, 116, 1086, 13137, 0, 0, 13142, 105, 100, 59, 32768, 8740, 97, 114, 97, 108, 108, 101, 108, 59, 32768, 8742, 109, 512, 59, 101, 13157, 13159, 32768, 8769, 512, 59, 113, 13164, 13166, 32768, 8772, 59, 32768, 8772, 105, 100, 59, 32768, 8740, 97, 114, 59, 32768, 8742, 115, 117, 512, 98, 112, 13186, 13190, 101, 59, 32768, 8930, 101, 59, 32768, 8931, 768, 98, 99, 112, 13201, 13241, 13254, 1024, 59, 69, 101, 115, 13210, 13212, 13216, 13219, 32768, 8836, 59, 32896, 10949, 824, 59, 32768, 8840, 101, 116, 512, 59, 101, 13226, 13229, 32896, 8834, 8402, 113, 512, 59, 113, 13235, 13237, 32768, 8840, 59, 32896, 10949, 824, 99, 512, 59, 101, 13247, 13249, 32768, 8833, 113, 59, 32896, 10928, 824, 1024, 59, 69, 101, 115, 13263, 13265, 13269, 13272, 32768, 8837, 59, 32896, 10950, 824, 59, 32768, 8841, 101, 116, 512, 59, 101, 13279, 13282, 32896, 8835, 8402, 113, 512, 59, 113, 13288, 13290, 32768, 8841, 59, 32896, 10950, 824, 1024, 103, 105, 108, 114, 13303, 13307, 13315, 13319, 108, 59, 32768, 8825, 108, 100, 101, 33024, 241, 59, 32768, 241, 103, 59, 32768, 8824, 105, 97, 110, 103, 108, 101, 512, 108, 114, 13330, 13344, 101, 102, 116, 512, 59, 101, 13338, 13340, 32768, 8938, 113, 59, 32768, 8940, 105, 103, 104, 116, 512, 59, 101, 13353, 13355, 32768, 8939, 113, 59, 32768, 8941, 512, 59, 109, 13364, 13366, 32768, 957, 768, 59, 101, 115, 13373, 13375, 13380, 32768, 35, 114, 111, 59, 32768, 8470, 112, 59, 32768, 8199, 2304, 68, 72, 97, 100, 103, 105, 108, 114, 115, 13403, 13409, 13415, 13420, 13426, 13439, 13446, 13476, 13493, 97, 115, 104, 59, 32768, 8877, 97, 114, 114, 59, 32768, 10500, 112, 59, 32896, 8781, 8402, 97, 115, 104, 59, 32768, 8876, 512, 101, 116, 13431, 13435, 59, 32896, 8805, 8402, 59, 32896, 62, 8402, 110, 102, 105, 110, 59, 32768, 10718, 768, 65, 101, 116, 13453, 13458, 13462, 114, 114, 59, 32768, 10498, 59, 32896, 8804, 8402, 512, 59, 114, 13467, 13470, 32896, 60, 8402, 105, 101, 59, 32896, 8884, 8402, 512, 65, 116, 13481, 13486, 114, 114, 59, 32768, 10499, 114, 105, 101, 59, 32896, 8885, 8402, 105, 109, 59, 32896, 8764, 8402, 768, 65, 97, 110, 13506, 13511, 13532, 114, 114, 59, 32768, 8662, 114, 512, 104, 114, 13517, 13521, 107, 59, 32768, 10531, 512, 59, 111, 13526, 13528, 32768, 8598, 119, 59, 32768, 8598, 101, 97, 114, 59, 32768, 10535, 9252, 13576, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 13579, 0, 13596, 13617, 13653, 13659, 13673, 13695, 13708, 0, 0, 13713, 13750, 0, 13788, 13794, 0, 13815, 13890, 13913, 13937, 13944, 59, 32768, 9416, 512, 99, 115, 13583, 13591, 117, 116, 101, 33024, 243, 59, 32768, 243, 116, 59, 32768, 8859, 512, 105, 121, 13600, 13613, 114, 512, 59, 99, 13606, 13608, 32768, 8858, 33024, 244, 59, 32768, 244, 59, 32768, 1086, 1280, 97, 98, 105, 111, 115, 13627, 13632, 13638, 13642, 13646, 115, 104, 59, 32768, 8861, 108, 97, 99, 59, 32768, 337, 118, 59, 32768, 10808, 116, 59, 32768, 8857, 111, 108, 100, 59, 32768, 10684, 108, 105, 103, 59, 32768, 339, 512, 99, 114, 13663, 13668, 105, 114, 59, 32768, 10687, 59, 32896, 55349, 56620, 1600, 13680, 0, 0, 13684, 0, 13692, 110, 59, 32768, 731, 97, 118, 101, 33024, 242, 59, 32768, 242, 59, 32768, 10689, 512, 98, 109, 13699, 13704, 97, 114, 59, 32768, 10677, 59, 32768, 937, 110, 116, 59, 32768, 8750, 1024, 97, 99, 105, 116, 13721, 13726, 13741, 13746, 114, 114, 59, 32768, 8634, 512, 105, 114, 13731, 13735, 114, 59, 32768, 10686, 111, 115, 115, 59, 32768, 10683, 110, 101, 59, 32768, 8254, 59, 32768, 10688, 768, 97, 101, 105, 13756, 13761, 13766, 99, 114, 59, 32768, 333, 103, 97, 59, 32768, 969, 768, 99, 100, 110, 13773, 13779, 13782, 114, 111, 110, 59, 32768, 959, 59, 32768, 10678, 117, 115, 59, 32768, 8854, 112, 102, 59, 32896, 55349, 56672, 768, 97, 101, 108, 13800, 13804, 13809, 114, 59, 32768, 10679, 114, 112, 59, 32768, 10681, 117, 115, 59, 32768, 8853, 1792, 59, 97, 100, 105, 111, 115, 118, 13829, 13831, 13836, 13869, 13875, 13879, 13886, 32768, 8744, 114, 114, 59, 32768, 8635, 1024, 59, 101, 102, 109, 13845, 13847, 13859, 13864, 32768, 10845, 114, 512, 59, 111, 13853, 13855, 32768, 8500, 102, 59, 32768, 8500, 33024, 170, 59, 32768, 170, 33024, 186, 59, 32768, 186, 103, 111, 102, 59, 32768, 8886, 114, 59, 32768, 10838, 108, 111, 112, 101, 59, 32768, 10839, 59, 32768, 10843, 768, 99, 108, 111, 13896, 13900, 13908, 114, 59, 32768, 8500, 97, 115, 104, 33024, 248, 59, 32768, 248, 108, 59, 32768, 8856, 105, 573, 13917, 13924, 100, 101, 33024, 245, 59, 32768, 245, 101, 115, 512, 59, 97, 13930, 13932, 32768, 8855, 115, 59, 32768, 10806, 109, 108, 33024, 246, 59, 32768, 246, 98, 97, 114, 59, 32768, 9021, 5426, 13972, 0, 14013, 0, 14017, 14053, 0, 14058, 14086, 0, 0, 14107, 14199, 0, 14202, 0, 0, 14229, 14425, 0, 14438, 114, 1024, 59, 97, 115, 116, 13981, 13983, 13997, 14009, 32768, 8741, 33280, 182, 59, 108, 13989, 13991, 32768, 182, 108, 101, 108, 59, 32768, 8741, 1082, 14003, 0, 0, 14007, 109, 59, 32768, 10995, 59, 32768, 11005, 59, 32768, 8706, 121, 59, 32768, 1087, 114, 1280, 99, 105, 109, 112, 116, 14028, 14033, 14038, 14043, 14046, 110, 116, 59, 32768, 37, 111, 100, 59, 32768, 46, 105, 108, 59, 32768, 8240, 59, 32768, 8869, 101, 110, 107, 59, 32768, 8241, 114, 59, 32896, 55349, 56621, 768, 105, 109, 111, 14064, 14074, 14080, 512, 59, 118, 14069, 14071, 32768, 966, 59, 32768, 981, 109, 97, 116, 59, 32768, 8499, 110, 101, 59, 32768, 9742, 768, 59, 116, 118, 14092, 14094, 14103, 32768, 960, 99, 104, 102, 111, 114, 107, 59, 32768, 8916, 59, 32768, 982, 512, 97, 117, 14111, 14132, 110, 512, 99, 107, 14117, 14128, 107, 512, 59, 104, 14123, 14125, 32768, 8463, 59, 32768, 8462, 118, 59, 32768, 8463, 115, 2304, 59, 97, 98, 99, 100, 101, 109, 115, 116, 14152, 14154, 14160, 14163, 14168, 14179, 14182, 14188, 14193, 32768, 43, 99, 105, 114, 59, 32768, 10787, 59, 32768, 8862, 105, 114, 59, 32768, 10786, 512, 111, 117, 14173, 14176, 59, 32768, 8724, 59, 32768, 10789, 59, 32768, 10866, 110, 33024, 177, 59, 32768, 177, 105, 109, 59, 32768, 10790, 119, 111, 59, 32768, 10791, 59, 32768, 177, 768, 105, 112, 117, 14208, 14216, 14221, 110, 116, 105, 110, 116, 59, 32768, 10773, 102, 59, 32896, 55349, 56673, 110, 100, 33024, 163, 59, 32768, 163, 2560, 59, 69, 97, 99, 101, 105, 110, 111, 115, 117, 14249, 14251, 14254, 14258, 14263, 14336, 14348, 14367, 14413, 14418, 32768, 8826, 59, 32768, 10931, 112, 59, 32768, 10935, 117, 101, 59, 32768, 8828, 512, 59, 99, 14268, 14270, 32768, 10927, 1536, 59, 97, 99, 101, 110, 115, 14283, 14285, 14293, 14302, 14306, 14331, 32768, 8826, 112, 112, 114, 111, 120, 59, 32768, 10935, 117, 114, 108, 121, 101, 113, 59, 32768, 8828, 113, 59, 32768, 10927, 768, 97, 101, 115, 14313, 14321, 14326, 112, 112, 114, 111, 120, 59, 32768, 10937, 113, 113, 59, 32768, 10933, 105, 109, 59, 32768, 8936, 105, 109, 59, 32768, 8830, 109, 101, 512, 59, 115, 14343, 14345, 32768, 8242, 59, 32768, 8473, 768, 69, 97, 115, 14355, 14358, 14362, 59, 32768, 10933, 112, 59, 32768, 10937, 105, 109, 59, 32768, 8936, 768, 100, 102, 112, 14374, 14377, 14402, 59, 32768, 8719, 768, 97, 108, 115, 14384, 14390, 14396, 108, 97, 114, 59, 32768, 9006, 105, 110, 101, 59, 32768, 8978, 117, 114, 102, 59, 32768, 8979, 512, 59, 116, 14407, 14409, 32768, 8733, 111, 59, 32768, 8733, 105, 109, 59, 32768, 8830, 114, 101, 108, 59, 32768, 8880, 512, 99, 105, 14429, 14434, 114, 59, 32896, 55349, 56517, 59, 32768, 968, 110, 99, 115, 112, 59, 32768, 8200, 1536, 102, 105, 111, 112, 115, 117, 14457, 14462, 14467, 14473, 14480, 14486, 114, 59, 32896, 55349, 56622, 110, 116, 59, 32768, 10764, 112, 102, 59, 32896, 55349, 56674, 114, 105, 109, 101, 59, 32768, 8279, 99, 114, 59, 32896, 55349, 56518, 768, 97, 101, 111, 14493, 14513, 14526, 116, 512, 101, 105, 14499, 14508, 114, 110, 105, 111, 110, 115, 59, 32768, 8461, 110, 116, 59, 32768, 10774, 115, 116, 512, 59, 101, 14520, 14522, 32768, 63, 113, 59, 32768, 8799, 116, 33024, 34, 59, 32768, 34, 5376, 65, 66, 72, 97, 98, 99, 100, 101, 102, 104, 105, 108, 109, 110, 111, 112, 114, 115, 116, 117, 120, 14575, 14597, 14603, 14608, 14775, 14829, 14865, 14901, 14943, 14966, 15000, 15139, 15159, 15176, 15182, 15236, 15261, 15267, 15309, 15352, 15360, 768, 97, 114, 116, 14582, 14587, 14591, 114, 114, 59, 32768, 8667, 114, 59, 32768, 8658, 97, 105, 108, 59, 32768, 10524, 97, 114, 114, 59, 32768, 10511, 97, 114, 59, 32768, 10596, 1792, 99, 100, 101, 110, 113, 114, 116, 14623, 14637, 14642, 14650, 14672, 14679, 14751, 512, 101, 117, 14628, 14632, 59, 32896, 8765, 817, 116, 101, 59, 32768, 341, 105, 99, 59, 32768, 8730, 109, 112, 116, 121, 118, 59, 32768, 10675, 103, 1024, 59, 100, 101, 108, 14660, 14662, 14665, 14668, 32768, 10217, 59, 32768, 10642, 59, 32768, 10661, 101, 59, 32768, 10217, 117, 111, 33024, 187, 59, 32768, 187, 114, 2816, 59, 97, 98, 99, 102, 104, 108, 112, 115, 116, 119, 14703, 14705, 14709, 14720, 14723, 14727, 14731, 14735, 14739, 14744, 14748, 32768, 8594, 112, 59, 32768, 10613, 512, 59, 102, 14714, 14716, 32768, 8677, 115, 59, 32768, 10528, 59, 32768, 10547, 115, 59, 32768, 10526, 107, 59, 32768, 8618, 112, 59, 32768, 8620, 108, 59, 32768, 10565, 105, 109, 59, 32768, 10612, 108, 59, 32768, 8611, 59, 32768, 8605, 512, 97, 105, 14756, 14761, 105, 108, 59, 32768, 10522, 111, 512, 59, 110, 14767, 14769, 32768, 8758, 97, 108, 115, 59, 32768, 8474, 768, 97, 98, 114, 14782, 14787, 14792, 114, 114, 59, 32768, 10509, 114, 107, 59, 32768, 10099, 512, 97, 107, 14797, 14809, 99, 512, 101, 107, 14803, 14806, 59, 32768, 125, 59, 32768, 93, 512, 101, 115, 14814, 14817, 59, 32768, 10636, 108, 512, 100, 117, 14823, 14826, 59, 32768, 10638, 59, 32768, 10640, 1024, 97, 101, 117, 121, 14838, 14844, 14858, 14862, 114, 111, 110, 59, 32768, 345, 512, 100, 105, 14849, 14854, 105, 108, 59, 32768, 343, 108, 59, 32768, 8969, 98, 59, 32768, 125, 59, 32768, 1088, 1024, 99, 108, 113, 115, 14874, 14878, 14885, 14897, 97, 59, 32768, 10551, 100, 104, 97, 114, 59, 32768, 10601, 117, 111, 512, 59, 114, 14892, 14894, 32768, 8221, 59, 32768, 8221, 104, 59, 32768, 8627, 768, 97, 99, 103, 14908, 14934, 14938, 108, 1024, 59, 105, 112, 115, 14918, 14920, 14925, 14931, 32768, 8476, 110, 101, 59, 32768, 8475, 97, 114, 116, 59, 32768, 8476, 59, 32768, 8477, 116, 59, 32768, 9645, 33024, 174, 59, 32768, 174, 768, 105, 108, 114, 14950, 14956, 14962, 115, 104, 116, 59, 32768, 10621, 111, 111, 114, 59, 32768, 8971, 59, 32896, 55349, 56623, 512, 97, 111, 14971, 14990, 114, 512, 100, 117, 14977, 14980, 59, 32768, 8641, 512, 59, 108, 14985, 14987, 32768, 8640, 59, 32768, 10604, 512, 59, 118, 14995, 14997, 32768, 961, 59, 32768, 1009, 768, 103, 110, 115, 15007, 15123, 15127, 104, 116, 1536, 97, 104, 108, 114, 115, 116, 15022, 15039, 15060, 15086, 15099, 15111, 114, 114, 111, 119, 512, 59, 116, 15031, 15033, 32768, 8594, 97, 105, 108, 59, 32768, 8611, 97, 114, 112, 111, 111, 110, 512, 100, 117, 15050, 15056, 111, 119, 110, 59, 32768, 8641, 112, 59, 32768, 8640, 101, 102, 116, 512, 97, 104, 15068, 15076, 114, 114, 111, 119, 115, 59, 32768, 8644, 97, 114, 112, 111, 111, 110, 115, 59, 32768, 8652, 105, 103, 104, 116, 97, 114, 114, 111, 119, 115, 59, 32768, 8649, 113, 117, 105, 103, 97, 114, 114, 111, 119, 59, 32768, 8605, 104, 114, 101, 101, 116, 105, 109, 101, 115, 59, 32768, 8908, 103, 59, 32768, 730, 105, 110, 103, 100, 111, 116, 115, 101, 113, 59, 32768, 8787, 768, 97, 104, 109, 15146, 15151, 15156, 114, 114, 59, 32768, 8644, 97, 114, 59, 32768, 8652, 59, 32768, 8207, 111, 117, 115, 116, 512, 59, 97, 15168, 15170, 32768, 9137, 99, 104, 101, 59, 32768, 9137, 109, 105, 100, 59, 32768, 10990, 1024, 97, 98, 112, 116, 15191, 15204, 15209, 15229, 512, 110, 114, 15196, 15200, 103, 59, 32768, 10221, 114, 59, 32768, 8702, 114, 107, 59, 32768, 10215, 768, 97, 102, 108, 15216, 15220, 15224, 114, 59, 32768, 10630, 59, 32896, 55349, 56675, 117, 115, 59, 32768, 10798, 105, 109, 101, 115, 59, 32768, 10805, 512, 97, 112, 15241, 15253, 114, 512, 59, 103, 15247, 15249, 32768, 41, 116, 59, 32768, 10644, 111, 108, 105, 110, 116, 59, 32768, 10770, 97, 114, 114, 59, 32768, 8649, 1024, 97, 99, 104, 113, 15276, 15282, 15287, 15290, 113, 117, 111, 59, 32768, 8250, 114, 59, 32896, 55349, 56519, 59, 32768, 8625, 512, 98, 117, 15295, 15298, 59, 32768, 93, 111, 512, 59, 114, 15304, 15306, 32768, 8217, 59, 32768, 8217, 768, 104, 105, 114, 15316, 15322, 15328, 114, 101, 101, 59, 32768, 8908, 109, 101, 115, 59, 32768, 8906, 105, 1024, 59, 101, 102, 108, 15338, 15340, 15343, 15346, 32768, 9657, 59, 32768, 8885, 59, 32768, 9656, 116, 114, 105, 59, 32768, 10702, 108, 117, 104, 97, 114, 59, 32768, 10600, 59, 32768, 8478, 6706, 15391, 15398, 15404, 15499, 15516, 15592, 0, 15606, 15660, 0, 0, 15752, 15758, 0, 15827, 15863, 15886, 16000, 16006, 16038, 16086, 0, 16467, 0, 0, 16506, 99, 117, 116, 101, 59, 32768, 347, 113, 117, 111, 59, 32768, 8218, 2560, 59, 69, 97, 99, 101, 105, 110, 112, 115, 121, 15424, 15426, 15429, 15441, 15446, 15458, 15463, 15482, 15490, 15495, 32768, 8827, 59, 32768, 10932, 833, 15434, 0, 15437, 59, 32768, 10936, 111, 110, 59, 32768, 353, 117, 101, 59, 32768, 8829, 512, 59, 100, 15451, 15453, 32768, 10928, 105, 108, 59, 32768, 351, 114, 99, 59, 32768, 349, 768, 69, 97, 115, 15470, 15473, 15477, 59, 32768, 10934, 112, 59, 32768, 10938, 105, 109, 59, 32768, 8937, 111, 108, 105, 110, 116, 59, 32768, 10771, 105, 109, 59, 32768, 8831, 59, 32768, 1089, 111, 116, 768, 59, 98, 101, 15507, 15509, 15512, 32768, 8901, 59, 32768, 8865, 59, 32768, 10854, 1792, 65, 97, 99, 109, 115, 116, 120, 15530, 15535, 15556, 15562, 15566, 15572, 15587, 114, 114, 59, 32768, 8664, 114, 512, 104, 114, 15541, 15545, 107, 59, 32768, 10533, 512, 59, 111, 15550, 15552, 32768, 8600, 119, 59, 32768, 8600, 116, 33024, 167, 59, 32768, 167, 105, 59, 32768, 59, 119, 97, 114, 59, 32768, 10537, 109, 512, 105, 110, 15578, 15584, 110, 117, 115, 59, 32768, 8726, 59, 32768, 8726, 116, 59, 32768, 10038, 114, 512, 59, 111, 15597, 15600, 32896, 55349, 56624, 119, 110, 59, 32768, 8994, 1024, 97, 99, 111, 121, 15614, 15619, 15632, 15654, 114, 112, 59, 32768, 9839, 512, 104, 121, 15624, 15629, 99, 121, 59, 32768, 1097, 59, 32768, 1096, 114, 116, 1086, 15640, 0, 0, 15645, 105, 100, 59, 32768, 8739, 97, 114, 97, 108, 108, 101, 108, 59, 32768, 8741, 33024, 173, 59, 32768, 173, 512, 103, 109, 15664, 15681, 109, 97, 768, 59, 102, 118, 15673, 15675, 15678, 32768, 963, 59, 32768, 962, 59, 32768, 962, 2048, 59, 100, 101, 103, 108, 110, 112, 114, 15698, 15700, 15705, 15715, 15725, 15735, 15739, 15745, 32768, 8764, 111, 116, 59, 32768, 10858, 512, 59, 113, 15710, 15712, 32768, 8771, 59, 32768, 8771, 512, 59, 69, 15720, 15722, 32768, 10910, 59, 32768, 10912, 512, 59, 69, 15730, 15732, 32768, 10909, 59, 32768, 10911, 101, 59, 32768, 8774, 108, 117, 115, 59, 32768, 10788, 97, 114, 114, 59, 32768, 10610, 97, 114, 114, 59, 32768, 8592, 1024, 97, 101, 105, 116, 15766, 15788, 15796, 15808, 512, 108, 115, 15771, 15783, 108, 115, 101, 116, 109, 105, 110, 117, 115, 59, 32768, 8726, 104, 112, 59, 32768, 10803, 112, 97, 114, 115, 108, 59, 32768, 10724, 512, 100, 108, 15801, 15804, 59, 32768, 8739, 101, 59, 32768, 8995, 512, 59, 101, 15813, 15815, 32768, 10922, 512, 59, 115, 15820, 15822, 32768, 10924, 59, 32896, 10924, 65024, 768, 102, 108, 112, 15833, 15839, 15857, 116, 99, 121, 59, 32768, 1100, 512, 59, 98, 15844, 15846, 32768, 47, 512, 59, 97, 15851, 15853, 32768, 10692, 114, 59, 32768, 9023, 102, 59, 32896, 55349, 56676, 97, 512, 100, 114, 15868, 15882, 101, 115, 512, 59, 117, 15875, 15877, 32768, 9824, 105, 116, 59, 32768, 9824, 59, 32768, 8741, 768, 99, 115, 117, 15892, 15921, 15977, 512, 97, 117, 15897, 15909, 112, 512, 59, 115, 15903, 15905, 32768, 8851, 59, 32896, 8851, 65024, 112, 512, 59, 115, 15915, 15917, 32768, 8852, 59, 32896, 8852, 65024, 117, 512, 98, 112, 15927, 15952, 768, 59, 101, 115, 15934, 15936, 15939, 32768, 8847, 59, 32768, 8849, 101, 116, 512, 59, 101, 15946, 15948, 32768, 8847, 113, 59, 32768, 8849, 768, 59, 101, 115, 15959, 15961, 15964, 32768, 8848, 59, 32768, 8850, 101, 116, 512, 59, 101, 15971, 15973, 32768, 8848, 113, 59, 32768, 8850, 768, 59, 97, 102, 15984, 15986, 15996, 32768, 9633, 114, 566, 15991, 15994, 59, 32768, 9633, 59, 32768, 9642, 59, 32768, 9642, 97, 114, 114, 59, 32768, 8594, 1024, 99, 101, 109, 116, 16014, 16019, 16025, 16031, 114, 59, 32896, 55349, 56520, 116, 109, 110, 59, 32768, 8726, 105, 108, 101, 59, 32768, 8995, 97, 114, 102, 59, 32768, 8902, 512, 97, 114, 16042, 16053, 114, 512, 59, 102, 16048, 16050, 32768, 9734, 59, 32768, 9733, 512, 97, 110, 16058, 16081, 105, 103, 104, 116, 512, 101, 112, 16067, 16076, 112, 115, 105, 108, 111, 110, 59, 32768, 1013, 104, 105, 59, 32768, 981, 115, 59, 32768, 175, 1280, 98, 99, 109, 110, 112, 16096, 16221, 16288, 16291, 16295, 2304, 59, 69, 100, 101, 109, 110, 112, 114, 115, 16115, 16117, 16120, 16125, 16137, 16143, 16154, 16160, 16166, 32768, 8834, 59, 32768, 10949, 111, 116, 59, 32768, 10941, 512, 59, 100, 16130, 16132, 32768, 8838, 111, 116, 59, 32768, 10947, 117, 108, 116, 59, 32768, 10945, 512, 69, 101, 16148, 16151, 59, 32768, 10955, 59, 32768, 8842, 108, 117, 115, 59, 32768, 10943, 97, 114, 114, 59, 32768, 10617, 768, 101, 105, 117, 16173, 16206, 16210, 116, 768, 59, 101, 110, 16181, 16183, 16194, 32768, 8834, 113, 512, 59, 113, 16189, 16191, 32768, 8838, 59, 32768, 10949, 101, 113, 512, 59, 113, 16201, 16203, 32768, 8842, 59, 32768, 10955, 109, 59, 32768, 10951, 512, 98, 112, 16215, 16218, 59, 32768, 10965, 59, 32768, 10963, 99, 1536, 59, 97, 99, 101, 110, 115, 16235, 16237, 16245, 16254, 16258, 16283, 32768, 8827, 112, 112, 114, 111, 120, 59, 32768, 10936, 117, 114, 108, 121, 101, 113, 59, 32768, 8829, 113, 59, 32768, 10928, 768, 97, 101, 115, 16265, 16273, 16278, 112, 112, 114, 111, 120, 59, 32768, 10938, 113, 113, 59, 32768, 10934, 105, 109, 59, 32768, 8937, 105, 109, 59, 32768, 8831, 59, 32768, 8721, 103, 59, 32768, 9834, 3328, 49, 50, 51, 59, 69, 100, 101, 104, 108, 109, 110, 112, 115, 16322, 16327, 16332, 16337, 16339, 16342, 16356, 16368, 16382, 16388, 16394, 16405, 16411, 33024, 185, 59, 32768, 185, 33024, 178, 59, 32768, 178, 33024, 179, 59, 32768, 179, 32768, 8835, 59, 32768, 10950, 512, 111, 115, 16347, 16351, 116, 59, 32768, 10942, 117, 98, 59, 32768, 10968, 512, 59, 100, 16361, 16363, 32768, 8839, 111, 116, 59, 32768, 10948, 115, 512, 111, 117, 16374, 16378, 108, 59, 32768, 10185, 98, 59, 32768, 10967, 97, 114, 114, 59, 32768, 10619, 117, 108, 116, 59, 32768, 10946, 512, 69, 101, 16399, 16402, 59, 32768, 10956, 59, 32768, 8843, 108, 117, 115, 59, 32768, 10944, 768, 101, 105, 117, 16418, 16451, 16455, 116, 768, 59, 101, 110, 16426, 16428, 16439, 32768, 8835, 113, 512, 59, 113, 16434, 16436, 32768, 8839, 59, 32768, 10950, 101, 113, 512, 59, 113, 16446, 16448, 32768, 8843, 59, 32768, 10956, 109, 59, 32768, 10952, 512, 98, 112, 16460, 16463, 59, 32768, 10964, 59, 32768, 10966, 768, 65, 97, 110, 16473, 16478, 16499, 114, 114, 59, 32768, 8665, 114, 512, 104, 114, 16484, 16488, 107, 59, 32768, 10534, 512, 59, 111, 16493, 16495, 32768, 8601, 119, 59, 32768, 8601, 119, 97, 114, 59, 32768, 10538, 108, 105, 103, 33024, 223, 59, 32768, 223, 5938, 16538, 16552, 16557, 16579, 16584, 16591, 0, 16596, 16692, 0, 0, 0, 0, 0, 16731, 16780, 0, 16787, 16908, 0, 0, 0, 16938, 1091, 16543, 0, 0, 16549, 103, 101, 116, 59, 32768, 8982, 59, 32768, 964, 114, 107, 59, 32768, 9140, 768, 97, 101, 121, 16563, 16569, 16575, 114, 111, 110, 59, 32768, 357, 100, 105, 108, 59, 32768, 355, 59, 32768, 1090, 111, 116, 59, 32768, 8411, 108, 114, 101, 99, 59, 32768, 8981, 114, 59, 32896, 55349, 56625, 1024, 101, 105, 107, 111, 16604, 16641, 16670, 16684, 835, 16609, 0, 16624, 101, 512, 52, 102, 16614, 16617, 59, 32768, 8756, 111, 114, 101, 59, 32768, 8756, 97, 768, 59, 115, 118, 16631, 16633, 16638, 32768, 952, 121, 109, 59, 32768, 977, 59, 32768, 977, 512, 99, 110, 16646, 16665, 107, 512, 97, 115, 16652, 16660, 112, 112, 114, 111, 120, 59, 32768, 8776, 105, 109, 59, 32768, 8764, 115, 112, 59, 32768, 8201, 512, 97, 115, 16675, 16679, 112, 59, 32768, 8776, 105, 109, 59, 32768, 8764, 114, 110, 33024, 254, 59, 32768, 254, 829, 16696, 16701, 16727, 100, 101, 59, 32768, 732, 101, 115, 33536, 215, 59, 98, 100, 16710, 16712, 16723, 32768, 215, 512, 59, 97, 16717, 16719, 32768, 8864, 114, 59, 32768, 10801, 59, 32768, 10800, 116, 59, 32768, 8749, 768, 101, 112, 115, 16737, 16741, 16775, 97, 59, 32768, 10536, 1024, 59, 98, 99, 102, 16750, 16752, 16757, 16762, 32768, 8868, 111, 116, 59, 32768, 9014, 105, 114, 59, 32768, 10993, 512, 59, 111, 16767, 16770, 32896, 55349, 56677, 114, 107, 59, 32768, 10970, 97, 59, 32768, 10537, 114, 105, 109, 101, 59, 32768, 8244, 768, 97, 105, 112, 16793, 16798, 16899, 100, 101, 59, 32768, 8482, 1792, 97, 100, 101, 109, 112, 115, 116, 16813, 16868, 16873, 16876, 16883, 16889, 16893, 110, 103, 108, 101, 1280, 59, 100, 108, 113, 114, 16828, 16830, 16836, 16850, 16853, 32768, 9653, 111, 119, 110, 59, 32768, 9663, 101, 102, 116, 512, 59, 101, 16844, 16846, 32768, 9667, 113, 59, 32768, 8884, 59, 32768, 8796, 105, 103, 104, 116, 512, 59, 101, 16862, 16864, 32768, 9657, 113, 59, 32768, 8885, 111, 116, 59, 32768, 9708, 59, 32768, 8796, 105, 110, 117, 115, 59, 32768, 10810, 108, 117, 115, 59, 32768, 10809, 98, 59, 32768, 10701, 105, 109, 101, 59, 32768, 10811, 101, 122, 105, 117, 109, 59, 32768, 9186, 768, 99, 104, 116, 16914, 16926, 16931, 512, 114, 121, 16919, 16923, 59, 32896, 55349, 56521, 59, 32768, 1094, 99, 121, 59, 32768, 1115, 114, 111, 107, 59, 32768, 359, 512, 105, 111, 16942, 16947, 120, 116, 59, 32768, 8812, 104, 101, 97, 100, 512, 108, 114, 16956, 16967, 101, 102, 116, 97, 114, 114, 111, 119, 59, 32768, 8606, 105, 103, 104, 116, 97, 114, 114, 111, 119, 59, 32768, 8608, 4608, 65, 72, 97, 98, 99, 100, 102, 103, 104, 108, 109, 111, 112, 114, 115, 116, 117, 119, 17016, 17021, 17026, 17043, 17057, 17072, 17095, 17110, 17119, 17139, 17172, 17187, 17202, 17290, 17330, 17336, 17365, 17381, 114, 114, 59, 32768, 8657, 97, 114, 59, 32768, 10595, 512, 99, 114, 17031, 17039, 117, 116, 101, 33024, 250, 59, 32768, 250, 114, 59, 32768, 8593, 114, 820, 17049, 0, 17053, 121, 59, 32768, 1118, 118, 101, 59, 32768, 365, 512, 105, 121, 17062, 17069, 114, 99, 33024, 251, 59, 32768, 251, 59, 32768, 1091, 768, 97, 98, 104, 17079, 17084, 17090, 114, 114, 59, 32768, 8645, 108, 97, 99, 59, 32768, 369, 97, 114, 59, 32768, 10606, 512, 105, 114, 17100, 17106, 115, 104, 116, 59, 32768, 10622, 59, 32896, 55349, 56626, 114, 97, 118, 101, 33024, 249, 59, 32768, 249, 562, 17123, 17135, 114, 512, 108, 114, 17128, 17131, 59, 32768, 8639, 59, 32768, 8638, 108, 107, 59, 32768, 9600, 512, 99, 116, 17144, 17167, 1088, 17150, 0, 0, 17163, 114, 110, 512, 59, 101, 17156, 17158, 32768, 8988, 114, 59, 32768, 8988, 111, 112, 59, 32768, 8975, 114, 105, 59, 32768, 9720, 512, 97, 108, 17177, 17182, 99, 114, 59, 32768, 363, 33024, 168, 59, 32768, 168, 512, 103, 112, 17192, 17197, 111, 110, 59, 32768, 371, 102, 59, 32896, 55349, 56678, 1536, 97, 100, 104, 108, 115, 117, 17215, 17222, 17233, 17257, 17262, 17280, 114, 114, 111, 119, 59, 32768, 8593, 111, 119, 110, 97, 114, 114, 111, 119, 59, 32768, 8597, 97, 114, 112, 111, 111, 110, 512, 108, 114, 17244, 17250, 101, 102, 116, 59, 32768, 8639, 105, 103, 104, 116, 59, 32768, 8638, 117, 115, 59, 32768, 8846, 105, 768, 59, 104, 108, 17270, 17272, 17275, 32768, 965, 59, 32768, 978, 111, 110, 59, 32768, 965, 112, 97, 114, 114, 111, 119, 115, 59, 32768, 8648, 768, 99, 105, 116, 17297, 17320, 17325, 1088, 17303, 0, 0, 17316, 114, 110, 512, 59, 101, 17309, 17311, 32768, 8989, 114, 59, 32768, 8989, 111, 112, 59, 32768, 8974, 110, 103, 59, 32768, 367, 114, 105, 59, 32768, 9721, 99, 114, 59, 32896, 55349, 56522, 768, 100, 105, 114, 17343, 17348, 17354, 111, 116, 59, 32768, 8944, 108, 100, 101, 59, 32768, 361, 105, 512, 59, 102, 17360, 17362, 32768, 9653, 59, 32768, 9652, 512, 97, 109, 17370, 17375, 114, 114, 59, 32768, 8648, 108, 33024, 252, 59, 32768, 252, 97, 110, 103, 108, 101, 59, 32768, 10663, 3840, 65, 66, 68, 97, 99, 100, 101, 102, 108, 110, 111, 112, 114, 115, 122, 17420, 17425, 17437, 17443, 17613, 17617, 17623, 17667, 17672, 17678, 17693, 17699, 17705, 17711, 17754, 114, 114, 59, 32768, 8661, 97, 114, 512, 59, 118, 17432, 17434, 32768, 10984, 59, 32768, 10985, 97, 115, 104, 59, 32768, 8872, 512, 110, 114, 17448, 17454, 103, 114, 116, 59, 32768, 10652, 1792, 101, 107, 110, 112, 114, 115, 116, 17469, 17478, 17485, 17494, 17515, 17526, 17578, 112, 115, 105, 108, 111, 110, 59, 32768, 1013, 97, 112, 112, 97, 59, 32768, 1008, 111, 116, 104, 105, 110, 103, 59, 32768, 8709, 768, 104, 105, 114, 17501, 17505, 17508, 105, 59, 32768, 981, 59, 32768, 982, 111, 112, 116, 111, 59, 32768, 8733, 512, 59, 104, 17520, 17522, 32768, 8597, 111, 59, 32768, 1009, 512, 105, 117, 17531, 17537, 103, 109, 97, 59, 32768, 962, 512, 98, 112, 17542, 17560, 115, 101, 116, 110, 101, 113, 512, 59, 113, 17553, 17556, 32896, 8842, 65024, 59, 32896, 10955, 65024, 115, 101, 116, 110, 101, 113, 512, 59, 113, 17571, 17574, 32896, 8843, 65024, 59, 32896, 10956, 65024, 512, 104, 114, 17583, 17589, 101, 116, 97, 59, 32768, 977, 105, 97, 110, 103, 108, 101, 512, 108, 114, 17600, 17606, 101, 102, 116, 59, 32768, 8882, 105, 103, 104, 116, 59, 32768, 8883, 121, 59, 32768, 1074, 97, 115, 104, 59, 32768, 8866, 768, 101, 108, 114, 17630, 17648, 17654, 768, 59, 98, 101, 17637, 17639, 17644, 32768, 8744, 97, 114, 59, 32768, 8891, 113, 59, 32768, 8794, 108, 105, 112, 59, 32768, 8942, 512, 98, 116, 17659, 17664, 97, 114, 59, 32768, 124, 59, 32768, 124, 114, 59, 32896, 55349, 56627, 116, 114, 105, 59, 32768, 8882, 115, 117, 512, 98, 112, 17685, 17689, 59, 32896, 8834, 8402, 59, 32896, 8835, 8402, 112, 102, 59, 32896, 55349, 56679, 114, 111, 112, 59, 32768, 8733, 116, 114, 105, 59, 32768, 8883, 512, 99, 117, 17716, 17721, 114, 59, 32896, 55349, 56523, 512, 98, 112, 17726, 17740, 110, 512, 69, 101, 17732, 17736, 59, 32896, 10955, 65024, 59, 32896, 8842, 65024, 110, 512, 69, 101, 17746, 17750, 59, 32896, 10956, 65024, 59, 32896, 8843, 65024, 105, 103, 122, 97, 103, 59, 32768, 10650, 1792, 99, 101, 102, 111, 112, 114, 115, 17777, 17783, 17815, 17820, 17826, 17829, 17842, 105, 114, 99, 59, 32768, 373, 512, 100, 105, 17788, 17809, 512, 98, 103, 17793, 17798, 97, 114, 59, 32768, 10847, 101, 512, 59, 113, 17804, 17806, 32768, 8743, 59, 32768, 8793, 101, 114, 112, 59, 32768, 8472, 114, 59, 32896, 55349, 56628, 112, 102, 59, 32896, 55349, 56680, 59, 32768, 8472, 512, 59, 101, 17834, 17836, 32768, 8768, 97, 116, 104, 59, 32768, 8768, 99, 114, 59, 32896, 55349, 56524, 5428, 17871, 17891, 0, 17897, 0, 17902, 17917, 0, 0, 17920, 17935, 17940, 17945, 0, 0, 17977, 17992, 0, 18008, 18024, 18029, 768, 97, 105, 117, 17877, 17881, 17886, 112, 59, 32768, 8898, 114, 99, 59, 32768, 9711, 112, 59, 32768, 8899, 116, 114, 105, 59, 32768, 9661, 114, 59, 32896, 55349, 56629, 512, 65, 97, 17906, 17911, 114, 114, 59, 32768, 10234, 114, 114, 59, 32768, 10231, 59, 32768, 958, 512, 65, 97, 17924, 17929, 114, 114, 59, 32768, 10232, 114, 114, 59, 32768, 10229, 97, 112, 59, 32768, 10236, 105, 115, 59, 32768, 8955, 768, 100, 112, 116, 17951, 17956, 17970, 111, 116, 59, 32768, 10752, 512, 102, 108, 17961, 17965, 59, 32896, 55349, 56681, 117, 115, 59, 32768, 10753, 105, 109, 101, 59, 32768, 10754, 512, 65, 97, 17981, 17986, 114, 114, 59, 32768, 10233, 114, 114, 59, 32768, 10230, 512, 99, 113, 17996, 18001, 114, 59, 32896, 55349, 56525, 99, 117, 112, 59, 32768, 10758, 512, 112, 116, 18012, 18018, 108, 117, 115, 59, 32768, 10756, 114, 105, 59, 32768, 9651, 101, 101, 59, 32768, 8897, 101, 100, 103, 101, 59, 32768, 8896, 2048, 97, 99, 101, 102, 105, 111, 115, 117, 18052, 18068, 18081, 18087, 18092, 18097, 18103, 18109, 99, 512, 117, 121, 18058, 18065, 116, 101, 33024, 253, 59, 32768, 253, 59, 32768, 1103, 512, 105, 121, 18073, 18078, 114, 99, 59, 32768, 375, 59, 32768, 1099, 110, 33024, 165, 59, 32768, 165, 114, 59, 32896, 55349, 56630, 99, 121, 59, 32768, 1111, 112, 102, 59, 32896, 55349, 56682, 99, 114, 59, 32896, 55349, 56526, 512, 99, 109, 18114, 18118, 121, 59, 32768, 1102, 108, 33024, 255, 59, 32768, 255, 2560, 97, 99, 100, 101, 102, 104, 105, 111, 115, 119, 18145, 18152, 18166, 18171, 18186, 18191, 18196, 18204, 18210, 18216, 99, 117, 116, 101, 59, 32768, 378, 512, 97, 121, 18157, 18163, 114, 111, 110, 59, 32768, 382, 59, 32768, 1079, 111, 116, 59, 32768, 380, 512, 101, 116, 18176, 18182, 116, 114, 102, 59, 32768, 8488, 97, 59, 32768, 950, 114, 59, 32896, 55349, 56631, 99, 121, 59, 32768, 1078, 103, 114, 97, 114, 114, 59, 32768, 8669, 112, 102, 59, 32896, 55349, 56683, 99, 114, 59, 32896, 55349, 56527, 512, 106, 110, 18221, 18224, 59, 32768, 8205, 106, 59, 32768, 8204]);\n","\"use strict\";\nObject.defineProperty(exports, \"__esModule\", { value: true });\n// Generated using scripts/write-decode-map.ts\n// prettier-ignore\nexports.default = new Uint16Array([1024, 97, 103, 108, 113, 9, 23, 27, 31, 1086, 15, 0, 0, 19, 112, 59, 32768, 38, 111, 115, 59, 32768, 39, 116, 59, 32768, 62, 116, 59, 32768, 60, 117, 111, 116, 59, 32768, 34]);\n","/* eslint-disable no-var, prefer-template */\nvar uppercasePattern = /[A-Z]/g\nvar msPattern = /^ms-/\nvar cache = {}\n\nfunction toHyphenLower(match) {\n return '-' + match.toLowerCase()\n}\n\nfunction hyphenateStyleName(name) {\n if (cache.hasOwnProperty(name)) {\n return cache[name]\n }\n\n var hName = name.replace(uppercasePattern, toHyphenLower)\n return (cache[name] = msPattern.test(hName) ? '-' + hName : hName)\n}\n\nexport default hyphenateStyleName\n","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = createPrefixer;\n\nvar _prefixProperty = require('./utils/prefixProperty');\n\nvar _prefixProperty2 = _interopRequireDefault(_prefixProperty);\n\nvar _prefixValue = require('./utils/prefixValue');\n\nvar _prefixValue2 = _interopRequireDefault(_prefixValue);\n\nvar _addNewValuesOnly = require('./utils/addNewValuesOnly');\n\nvar _addNewValuesOnly2 = _interopRequireDefault(_addNewValuesOnly);\n\nvar _isObject = require('./utils/isObject');\n\nvar _isObject2 = _interopRequireDefault(_isObject);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nfunction createPrefixer(_ref) {\n var prefixMap = _ref.prefixMap,\n plugins = _ref.plugins;\n\n return function prefix(style) {\n for (var property in style) {\n var value = style[property];\n\n // handle nested objects\n if ((0, _isObject2.default)(value)) {\n style[property] = prefix(value);\n // handle array values\n } else if (Array.isArray(value)) {\n var combinedValue = [];\n\n for (var i = 0, len = value.length; i < len; ++i) {\n var processedValue = (0, _prefixValue2.default)(plugins, property, value[i], style, prefixMap);\n\n (0, _addNewValuesOnly2.default)(combinedValue, processedValue || value[i]);\n }\n\n // only modify the value if it was touched\n // by any plugin to prevent unnecessary mutations\n if (combinedValue.length > 0) {\n style[property] = combinedValue;\n }\n } else {\n var _processedValue = (0, _prefixValue2.default)(plugins, property, value, style, prefixMap);\n\n // only modify the value if it was touched\n // by any plugin to prevent unnecessary mutations\n if (_processedValue) {\n style[property] = _processedValue;\n }\n\n style = (0, _prefixProperty2.default)(prefixMap, property, style);\n }\n }\n\n return style;\n };\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = backgroundClip;\nfunction backgroundClip() {\n return null;\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = crossFade;\n\nvar _cssInJsUtils = require('css-in-js-utils');\n\nvar CROSS_FADE_REGEX = /cross-fade\\(/g;\n// http://caniuse.com/#search=cross-fade\nvar prefixes = ['-webkit-', ''];\n\nfunction crossFade(property, value) {\n if (typeof value === 'string' && !(0, _cssInJsUtils.isPrefixedValue)(value) && value.indexOf('cross-fade(') !== -1) {\n return prefixes.map(function (prefix) {\n return value.replace(CROSS_FADE_REGEX, prefix + 'cross-fade(');\n });\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = cursor;\nvar prefixes = ['-webkit-', '-moz-', ''];\n\nvar values = {\n 'zoom-in': true,\n 'zoom-out': true,\n grab: true,\n grabbing: true\n};\n\nfunction cursor(property, value) {\n if (property === 'cursor' && values.hasOwnProperty(value)) {\n return prefixes.map(function (prefix) {\n return prefix + value;\n });\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = filter;\n\nvar _cssInJsUtils = require('css-in-js-utils');\n\nvar FILTER_REGEX = /filter\\(/g;\n// http://caniuse.com/#feat=css-filter-function\nvar prefixes = ['-webkit-', ''];\n\nfunction filter(property, value) {\n if (typeof value === 'string' && !(0, _cssInJsUtils.isPrefixedValue)(value) && value.indexOf('filter(') !== -1) {\n return prefixes.map(function (prefix) {\n return value.replace(FILTER_REGEX, prefix + 'filter(');\n });\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = imageSet;\n\nvar _isPrefixedValue = require('css-in-js-utils/lib/isPrefixedValue');\n\nvar _isPrefixedValue2 = _interopRequireDefault(_isPrefixedValue);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\n// http://caniuse.com/#feat=css-image-set\nvar prefixes = ['-webkit-', ''];\n\nfunction imageSet(property, value) {\n if (typeof value === 'string' && !(0, _isPrefixedValue2.default)(value) && value.indexOf('image-set(') > -1) {\n return prefixes.map(function (prefix) {\n return value.replace(/image-set\\(/g, prefix + 'image-set(');\n });\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = logical;\nvar alternativeProps = {\n marginBlockStart: ['WebkitMarginBefore'],\n marginBlockEnd: ['WebkitMarginAfter'],\n marginInlineStart: ['WebkitMarginStart', 'MozMarginStart'],\n marginInlineEnd: ['WebkitMarginEnd', 'MozMarginEnd'],\n paddingBlockStart: ['WebkitPaddingBefore'],\n paddingBlockEnd: ['WebkitPaddingAfter'],\n paddingInlineStart: ['WebkitPaddingStart', 'MozPaddingStart'],\n paddingInlineEnd: ['WebkitPaddingEnd', 'MozPaddingEnd'],\n borderBlockStart: ['WebkitBorderBefore'],\n borderBlockStartColor: ['WebkitBorderBeforeColor'],\n borderBlockStartStyle: ['WebkitBorderBeforeStyle'],\n borderBlockStartWidth: ['WebkitBorderBeforeWidth'],\n borderBlockEnd: ['WebkitBorderAfter'],\n borderBlockEndColor: ['WebkitBorderAfterColor'],\n borderBlockEndStyle: ['WebkitBorderAfterStyle'],\n borderBlockEndWidth: ['WebkitBorderAfterWidth'],\n borderInlineStart: ['WebkitBorderStart', 'MozBorderStart'],\n borderInlineStartColor: ['WebkitBorderStartColor', 'MozBorderStartColor'],\n borderInlineStartStyle: ['WebkitBorderStartStyle', 'MozBorderStartStyle'],\n borderInlineStartWidth: ['WebkitBorderStartWidth', 'MozBorderStartWidth'],\n borderInlineEnd: ['WebkitBorderEnd', 'MozBorderEnd'],\n borderInlineEndColor: ['WebkitBorderEndColor', 'MozBorderEndColor'],\n borderInlineEndStyle: ['WebkitBorderEndStyle', 'MozBorderEndStyle'],\n borderInlineEndWidth: ['WebkitBorderEndWidth', 'MozBorderEndWidth']\n};\n\nfunction logical(property, value, style) {\n if (Object.prototype.hasOwnProperty.call(alternativeProps, property)) {\n var alternativePropList = alternativeProps[property];\n for (var i = 0, len = alternativePropList.length; i < len; ++i) {\n style[alternativePropList[i]] = value;\n }\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = position;\nfunction position(property, value) {\n if (property === 'position' && value === 'sticky') {\n return ['-webkit-sticky', 'sticky'];\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = sizing;\nvar prefixes = ['-webkit-', '-moz-', ''];\n\nvar properties = {\n maxHeight: true,\n maxWidth: true,\n width: true,\n height: true,\n columnWidth: true,\n minWidth: true,\n minHeight: true\n};\nvar values = {\n 'min-content': true,\n 'max-content': true,\n 'fill-available': true,\n 'fit-content': true,\n 'contain-floats': true\n};\n\nfunction sizing(property, value) {\n if (properties.hasOwnProperty(property) && values.hasOwnProperty(value)) {\n return prefixes.map(function (prefix) {\n return prefix + value;\n });\n }\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = transition;\n\nvar _hyphenateProperty = require('css-in-js-utils/lib/hyphenateProperty');\n\nvar _hyphenateProperty2 = _interopRequireDefault(_hyphenateProperty);\n\nvar _isPrefixedValue = require('css-in-js-utils/lib/isPrefixedValue');\n\nvar _isPrefixedValue2 = _interopRequireDefault(_isPrefixedValue);\n\nvar _capitalizeString = require('../utils/capitalizeString');\n\nvar _capitalizeString2 = _interopRequireDefault(_capitalizeString);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nvar properties = {\n transition: true,\n transitionProperty: true,\n WebkitTransition: true,\n WebkitTransitionProperty: true,\n MozTransition: true,\n MozTransitionProperty: true\n};\n\nvar prefixMapping = {\n Webkit: '-webkit-',\n Moz: '-moz-',\n ms: '-ms-'\n};\n\nfunction prefixValue(value, propertyPrefixMap) {\n if ((0, _isPrefixedValue2.default)(value)) {\n return value;\n }\n\n // only split multi values, not cubic beziers\n var multipleValues = value.split(/,(?![^()]*(?:\\([^()]*\\))?\\))/g);\n\n for (var i = 0, len = multipleValues.length; i < len; ++i) {\n var singleValue = multipleValues[i];\n var values = [singleValue];\n for (var property in propertyPrefixMap) {\n var dashCaseProperty = (0, _hyphenateProperty2.default)(property);\n\n if (singleValue.indexOf(dashCaseProperty) > -1 && dashCaseProperty !== 'order') {\n var prefixes = propertyPrefixMap[property];\n for (var j = 0, pLen = prefixes.length; j < pLen; ++j) {\n // join all prefixes and create a new value\n values.unshift(singleValue.replace(dashCaseProperty, prefixMapping[prefixes[j]] + dashCaseProperty));\n }\n }\n }\n\n multipleValues[i] = values.join(',');\n }\n\n return multipleValues.join(',');\n}\n\nfunction transition(property, value, style, propertyPrefixMap) {\n // also check for already prefixed transitions\n if (typeof value === 'string' && properties.hasOwnProperty(property)) {\n var outputValue = prefixValue(value, propertyPrefixMap);\n // if the property is already prefixed\n var webkitOutput = outputValue.split(/,(?![^()]*(?:\\([^()]*\\))?\\))/g).filter(function (val) {\n return !/-moz-|-ms-/.test(val);\n }).join(',');\n\n if (property.indexOf('Webkit') > -1) {\n return webkitOutput;\n }\n\n var mozOutput = outputValue.split(/,(?![^()]*(?:\\([^()]*\\))?\\))/g).filter(function (val) {\n return !/-webkit-|-ms-/.test(val);\n }).join(',');\n\n if (property.indexOf('Moz') > -1) {\n return mozOutput;\n }\n\n style['Webkit' + (0, _capitalizeString2.default)(property)] = webkitOutput;\n style['Moz' + (0, _capitalizeString2.default)(property)] = mozOutput;\n return outputValue;\n }\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = addNewValuesOnly;\nfunction addIfNew(list, value) {\n if (list.indexOf(value) === -1) {\n list.push(value);\n }\n}\n\nfunction addNewValuesOnly(list, values) {\n if (Array.isArray(values)) {\n for (var i = 0, len = values.length; i < len; ++i) {\n addIfNew(list, values[i]);\n }\n } else {\n addIfNew(list, values);\n }\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = capitalizeString;\nfunction capitalizeString(str) {\n return str.charAt(0).toUpperCase() + str.slice(1);\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = isObject;\nfunction isObject(value) {\n return value instanceof Object && !Array.isArray(value);\n}","'use strict';\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = prefixProperty;\n\nvar _capitalizeString = require('./capitalizeString');\n\nvar _capitalizeString2 = _interopRequireDefault(_capitalizeString);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nfunction prefixProperty(prefixProperties, property, style) {\n var requiredPrefixes = prefixProperties[property];\n\n if (requiredPrefixes && style.hasOwnProperty(property)) {\n var capitalizedProperty = (0, _capitalizeString2.default)(property);\n\n for (var i = 0; i < requiredPrefixes.length; ++i) {\n var prefixedProperty = requiredPrefixes[i] + capitalizedProperty;\n\n if (!style[prefixedProperty]) {\n style[prefixedProperty] = style[property];\n }\n }\n }\n\n return style;\n}","\"use strict\";\n\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = prefixValue;\nfunction prefixValue(plugins, property, value, style, metaData) {\n for (var i = 0, len = plugins.length; i < len; ++i) {\n var processedValue = plugins[i](property, value, style, metaData);\n\n // we can stop processing if a value is returned\n // as all plugin criteria are unique\n if (processedValue) {\n return processedValue;\n }\n }\n}","/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\n'use strict';\n\n/**\n * Use invariant() to assert state which your program assumes to be true.\n *\n * Provide sprintf-style format (only %s is supported) and arguments\n * to provide information about what broke and what you were\n * expecting.\n *\n * The invariant message will be stripped in production, but the invariant\n * will remain to ensure logic does not differ in production.\n */\n\nvar invariant = function(condition, format, a, b, c, d, e, f) {\n if (process.env.NODE_ENV !== 'production') {\n if (format === undefined) {\n throw new Error('invariant requires an error message argument');\n }\n }\n\n if (!condition) {\n var error;\n if (format === undefined) {\n error = new Error(\n 'Minified exception occurred; use the non-minified dev environment ' +\n 'for the full error message and additional helpful warnings.'\n );\n } else {\n var args = [a, b, c, d, e, f];\n var argIndex = 0;\n error = new Error(\n format.replace(/%s/g, function() { return args[argIndex++]; })\n );\n error.name = 'Invariant Violation';\n }\n\n error.framesToPop = 1; // we don't care about invariant's own frame\n throw error;\n }\n};\n\nmodule.exports = invariant;\n","'use strict';\n\nmodule.exports = value => {\n\tif (Object.prototype.toString.call(value) !== '[object Object]') {\n\t\treturn false;\n\t}\n\n\tconst prototype = Object.getPrototypeOf(value);\n\treturn prototype === null || prototype === Object.prototype;\n};\n","/**\n * lodash (Custom Build) \n * Build: `lodash modularize exports=\"npm\" -o ./`\n * Copyright jQuery Foundation and other contributors \n * Released under MIT license \n * Based on Underscore.js 1.8.3 \n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n\n/** Used as the `TypeError` message for \"Functions\" methods. */\nvar FUNC_ERROR_TEXT = 'Expected a function';\n\n/** Used as references for various `Number` constants. */\nvar NAN = 0 / 0;\n\n/** `Object#toString` result references. */\nvar symbolTag = '[object Symbol]';\n\n/** Used to match leading and trailing whitespace. */\nvar reTrim = /^\\s+|\\s+$/g;\n\n/** Used to detect bad signed hexadecimal string values. */\nvar reIsBadHex = /^[-+]0x[0-9a-f]+$/i;\n\n/** Used to detect binary string values. */\nvar reIsBinary = /^0b[01]+$/i;\n\n/** Used to detect octal string values. */\nvar reIsOctal = /^0o[0-7]+$/i;\n\n/** Built-in method references without a dependency on `root`. */\nvar freeParseInt = parseInt;\n\n/** Detect free variable `global` from Node.js. */\nvar freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\n/** Detect free variable `self`. */\nvar freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n/** Used as a reference to the global object. */\nvar root = freeGlobal || freeSelf || Function('return this')();\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\nvar objectToString = objectProto.toString;\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeMax = Math.max,\n nativeMin = Math.min;\n\n/**\n * Gets the timestamp of the number of milliseconds that have elapsed since\n * the Unix epoch (1 January 1970 00:00:00 UTC).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Date\n * @returns {number} Returns the timestamp.\n * @example\n *\n * _.defer(function(stamp) {\n * console.log(_.now() - stamp);\n * }, _.now());\n * // => Logs the number of milliseconds it took for the deferred invocation.\n */\nvar now = function() {\n return root.Date.now();\n};\n\n/**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\nfunction debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n result = wait - timeSinceLastCall;\n\n return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n}\n\n/**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\nfunction isObject(value) {\n var type = typeof value;\n return !!value && (type == 'object' || type == 'function');\n}\n\n/**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\nfunction isObjectLike(value) {\n return !!value && typeof value == 'object';\n}\n\n/**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\nfunction isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && objectToString.call(value) == symbolTag);\n}\n\n/**\n * Converts `value` to a number.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n * @example\n *\n * _.toNumber(3.2);\n * // => 3.2\n *\n * _.toNumber(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toNumber(Infinity);\n * // => Infinity\n *\n * _.toNumber('3.2');\n * // => 3.2\n */\nfunction toNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n if (isObject(value)) {\n var other = typeof value.valueOf == 'function' ? value.valueOf() : value;\n value = isObject(other) ? (other + '') : other;\n }\n if (typeof value != 'string') {\n return value === 0 ? value : +value;\n }\n value = value.replace(reTrim, '');\n var isBinary = reIsBinary.test(value);\n return (isBinary || reIsOctal.test(value))\n ? freeParseInt(value.slice(2), isBinary ? 2 : 8)\n : (reIsBadHex.test(value) ? NAN : +value);\n}\n\nmodule.exports = debounce;\n","var getNative = require('./_getNative'),\n root = require('./_root');\n\n/* Built-in method references that are verified to be native. */\nvar DataView = getNative(root, 'DataView');\n\nmodule.exports = DataView;\n","var hashClear = require('./_hashClear'),\n hashDelete = require('./_hashDelete'),\n hashGet = require('./_hashGet'),\n hashHas = require('./_hashHas'),\n hashSet = require('./_hashSet');\n\n/**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Hash(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n}\n\n// Add methods to `Hash`.\nHash.prototype.clear = hashClear;\nHash.prototype['delete'] = hashDelete;\nHash.prototype.get = hashGet;\nHash.prototype.has = hashHas;\nHash.prototype.set = hashSet;\n\nmodule.exports = Hash;\n","var listCacheClear = require('./_listCacheClear'),\n listCacheDelete = require('./_listCacheDelete'),\n listCacheGet = require('./_listCacheGet'),\n listCacheHas = require('./_listCacheHas'),\n listCacheSet = require('./_listCacheSet');\n\n/**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n}\n\n// Add methods to `ListCache`.\nListCache.prototype.clear = listCacheClear;\nListCache.prototype['delete'] = listCacheDelete;\nListCache.prototype.get = listCacheGet;\nListCache.prototype.has = listCacheHas;\nListCache.prototype.set = listCacheSet;\n\nmodule.exports = ListCache;\n","var getNative = require('./_getNative'),\n root = require('./_root');\n\n/* Built-in method references that are verified to be native. */\nvar Map = getNative(root, 'Map');\n\nmodule.exports = Map;\n","var mapCacheClear = require('./_mapCacheClear'),\n mapCacheDelete = require('./_mapCacheDelete'),\n mapCacheGet = require('./_mapCacheGet'),\n mapCacheHas = require('./_mapCacheHas'),\n mapCacheSet = require('./_mapCacheSet');\n\n/**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction MapCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n}\n\n// Add methods to `MapCache`.\nMapCache.prototype.clear = mapCacheClear;\nMapCache.prototype['delete'] = mapCacheDelete;\nMapCache.prototype.get = mapCacheGet;\nMapCache.prototype.has = mapCacheHas;\nMapCache.prototype.set = mapCacheSet;\n\nmodule.exports = MapCache;\n","var getNative = require('./_getNative'),\n root = require('./_root');\n\n/* Built-in method references that are verified to be native. */\nvar Promise = getNative(root, 'Promise');\n\nmodule.exports = Promise;\n","var getNative = require('./_getNative'),\n root = require('./_root');\n\n/* Built-in method references that are verified to be native. */\nvar Set = getNative(root, 'Set');\n\nmodule.exports = Set;\n","var MapCache = require('./_MapCache'),\n setCacheAdd = require('./_setCacheAdd'),\n setCacheHas = require('./_setCacheHas');\n\n/**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\nfunction SetCache(values) {\n var index = -1,\n length = values == null ? 0 : values.length;\n\n this.__data__ = new MapCache;\n while (++index < length) {\n this.add(values[index]);\n }\n}\n\n// Add methods to `SetCache`.\nSetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\nSetCache.prototype.has = setCacheHas;\n\nmodule.exports = SetCache;\n","var ListCache = require('./_ListCache'),\n stackClear = require('./_stackClear'),\n stackDelete = require('./_stackDelete'),\n stackGet = require('./_stackGet'),\n stackHas = require('./_stackHas'),\n stackSet = require('./_stackSet');\n\n/**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\nfunction Stack(entries) {\n var data = this.__data__ = new ListCache(entries);\n this.size = data.size;\n}\n\n// Add methods to `Stack`.\nStack.prototype.clear = stackClear;\nStack.prototype['delete'] = stackDelete;\nStack.prototype.get = stackGet;\nStack.prototype.has = stackHas;\nStack.prototype.set = stackSet;\n\nmodule.exports = Stack;\n","var root = require('./_root');\n\n/** Built-in value references. */\nvar Symbol = root.Symbol;\n\nmodule.exports = Symbol;\n","var root = require('./_root');\n\n/** Built-in value references. */\nvar Uint8Array = root.Uint8Array;\n\nmodule.exports = Uint8Array;\n","var getNative = require('./_getNative'),\n root = require('./_root');\n\n/* Built-in method references that are verified to be native. */\nvar WeakMap = getNative(root, 'WeakMap');\n\nmodule.exports = WeakMap;\n","/**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\nfunction arrayFilter(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result[resIndex++] = value;\n }\n }\n return result;\n}\n\nmodule.exports = arrayFilter;\n","var baseTimes = require('./_baseTimes'),\n isArguments = require('./isArguments'),\n isArray = require('./isArray'),\n isBuffer = require('./isBuffer'),\n isIndex = require('./_isIndex'),\n isTypedArray = require('./isTypedArray');\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\nfunction arrayLikeKeys(value, inherited) {\n var isArr = isArray(value),\n isArg = !isArr && isArguments(value),\n isBuff = !isArr && !isArg && isBuffer(value),\n isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n skipIndexes = isArr || isArg || isBuff || isType,\n result = skipIndexes ? baseTimes(value.length, String) : [],\n length = result.length;\n\n for (var key in value) {\n if ((inherited || hasOwnProperty.call(value, key)) &&\n !(skipIndexes && (\n // Safari 9 has enumerable `arguments.length` in strict mode.\n key == 'length' ||\n // Node.js 0.10 has enumerable non-index properties on buffers.\n (isBuff && (key == 'offset' || key == 'parent')) ||\n // PhantomJS 2 has enumerable non-index properties on typed arrays.\n (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n // Skip index properties.\n isIndex(key, length)\n ))) {\n result.push(key);\n }\n }\n return result;\n}\n\nmodule.exports = arrayLikeKeys;\n","/**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\nfunction arrayPush(array, values) {\n var index = -1,\n length = values.length,\n offset = array.length;\n\n while (++index < length) {\n array[offset + index] = values[index];\n }\n return array;\n}\n\nmodule.exports = arrayPush;\n","/**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\nfunction arraySome(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (predicate(array[index], index, array)) {\n return true;\n }\n }\n return false;\n}\n\nmodule.exports = arraySome;\n","var eq = require('./eq');\n\n/**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\nfunction assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n}\n\nmodule.exports = assocIndexOf;\n","var arrayPush = require('./_arrayPush'),\n isArray = require('./isArray');\n\n/**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\nfunction baseGetAllKeys(object, keysFunc, symbolsFunc) {\n var result = keysFunc(object);\n return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n}\n\nmodule.exports = baseGetAllKeys;\n","var Symbol = require('./_Symbol'),\n getRawTag = require('./_getRawTag'),\n objectToString = require('./_objectToString');\n\n/** `Object#toString` result references. */\nvar nullTag = '[object Null]',\n undefinedTag = '[object Undefined]';\n\n/** Built-in value references. */\nvar symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n/**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nfunction baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n}\n\nmodule.exports = baseGetTag;\n","var baseGetTag = require('./_baseGetTag'),\n isObjectLike = require('./isObjectLike');\n\n/** `Object#toString` result references. */\nvar argsTag = '[object Arguments]';\n\n/**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\nfunction baseIsArguments(value) {\n return isObjectLike(value) && baseGetTag(value) == argsTag;\n}\n\nmodule.exports = baseIsArguments;\n","var baseIsEqualDeep = require('./_baseIsEqualDeep'),\n isObjectLike = require('./isObjectLike');\n\n/**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Unordered comparison\n * 2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\nfunction baseIsEqual(value, other, bitmask, customizer, stack) {\n if (value === other) {\n return true;\n }\n if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n return value !== value && other !== other;\n }\n return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n}\n\nmodule.exports = baseIsEqual;\n","var Stack = require('./_Stack'),\n equalArrays = require('./_equalArrays'),\n equalByTag = require('./_equalByTag'),\n equalObjects = require('./_equalObjects'),\n getTag = require('./_getTag'),\n isArray = require('./isArray'),\n isBuffer = require('./isBuffer'),\n isTypedArray = require('./isTypedArray');\n\n/** Used to compose bitmasks for value comparisons. */\nvar COMPARE_PARTIAL_FLAG = 1;\n\n/** `Object#toString` result references. */\nvar argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n objectTag = '[object Object]';\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\nfunction baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n var objIsArr = isArray(object),\n othIsArr = isArray(other),\n objTag = objIsArr ? arrayTag : getTag(object),\n othTag = othIsArr ? arrayTag : getTag(other);\n\n objTag = objTag == argsTag ? objectTag : objTag;\n othTag = othTag == argsTag ? objectTag : othTag;\n\n var objIsObj = objTag == objectTag,\n othIsObj = othTag == objectTag,\n isSameTag = objTag == othTag;\n\n if (isSameTag && isBuffer(object)) {\n if (!isBuffer(other)) {\n return false;\n }\n objIsArr = true;\n objIsObj = false;\n }\n if (isSameTag && !objIsObj) {\n stack || (stack = new Stack);\n return (objIsArr || isTypedArray(object))\n ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n }\n if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n if (objIsWrapped || othIsWrapped) {\n var objUnwrapped = objIsWrapped ? object.value() : object,\n othUnwrapped = othIsWrapped ? other.value() : other;\n\n stack || (stack = new Stack);\n return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n }\n }\n if (!isSameTag) {\n return false;\n }\n stack || (stack = new Stack);\n return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n}\n\nmodule.exports = baseIsEqualDeep;\n","var isFunction = require('./isFunction'),\n isMasked = require('./_isMasked'),\n isObject = require('./isObject'),\n toSource = require('./_toSource');\n\n/**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\nvar reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g;\n\n/** Used to detect host constructors (Safari). */\nvar reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n/** Used for built-in method references. */\nvar funcProto = Function.prototype,\n objectProto = Object.prototype;\n\n/** Used to resolve the decompiled source of functions. */\nvar funcToString = funcProto.toString;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/** Used to detect if a method is native. */\nvar reIsNative = RegExp('^' +\n funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n);\n\n/**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n */\nfunction baseIsNative(value) {\n if (!isObject(value) || isMasked(value)) {\n return false;\n }\n var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n return pattern.test(toSource(value));\n}\n\nmodule.exports = baseIsNative;\n","var baseGetTag = require('./_baseGetTag'),\n isLength = require('./isLength'),\n isObjectLike = require('./isObjectLike');\n\n/** `Object#toString` result references. */\nvar argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n errorTag = '[object Error]',\n funcTag = '[object Function]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n objectTag = '[object Object]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n weakMapTag = '[object WeakMap]';\n\nvar arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]',\n float32Tag = '[object Float32Array]',\n float64Tag = '[object Float64Array]',\n int8Tag = '[object Int8Array]',\n int16Tag = '[object Int16Array]',\n int32Tag = '[object Int32Array]',\n uint8Tag = '[object Uint8Array]',\n uint8ClampedTag = '[object Uint8ClampedArray]',\n uint16Tag = '[object Uint16Array]',\n uint32Tag = '[object Uint32Array]';\n\n/** Used to identify `toStringTag` values of typed arrays. */\nvar typedArrayTags = {};\ntypedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\ntypedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\ntypedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\ntypedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\ntypedArrayTags[uint32Tag] = true;\ntypedArrayTags[argsTag] = typedArrayTags[arrayTag] =\ntypedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\ntypedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\ntypedArrayTags[errorTag] = typedArrayTags[funcTag] =\ntypedArrayTags[mapTag] = typedArrayTags[numberTag] =\ntypedArrayTags[objectTag] = typedArrayTags[regexpTag] =\ntypedArrayTags[setTag] = typedArrayTags[stringTag] =\ntypedArrayTags[weakMapTag] = false;\n\n/**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\nfunction baseIsTypedArray(value) {\n return isObjectLike(value) &&\n isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n}\n\nmodule.exports = baseIsTypedArray;\n","var isPrototype = require('./_isPrototype'),\n nativeKeys = require('./_nativeKeys');\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\nfunction baseKeys(object) {\n if (!isPrototype(object)) {\n return nativeKeys(object);\n }\n var result = [];\n for (var key in Object(object)) {\n if (hasOwnProperty.call(object, key) && key != 'constructor') {\n result.push(key);\n }\n }\n return result;\n}\n\nmodule.exports = baseKeys;\n","/**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\nfunction baseTimes(n, iteratee) {\n var index = -1,\n result = Array(n);\n\n while (++index < n) {\n result[index] = iteratee(index);\n }\n return result;\n}\n\nmodule.exports = baseTimes;\n","/**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\nfunction baseUnary(func) {\n return function(value) {\n return func(value);\n };\n}\n\nmodule.exports = baseUnary;\n","/**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction cacheHas(cache, key) {\n return cache.has(key);\n}\n\nmodule.exports = cacheHas;\n","var root = require('./_root');\n\n/** Used to detect overreaching core-js shims. */\nvar coreJsData = root['__core-js_shared__'];\n\nmodule.exports = coreJsData;\n","var SetCache = require('./_SetCache'),\n arraySome = require('./_arraySome'),\n cacheHas = require('./_cacheHas');\n\n/** Used to compose bitmasks for value comparisons. */\nvar COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n/**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\nfunction equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n arrLength = array.length,\n othLength = other.length;\n\n if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n return false;\n }\n // Check that cyclic values are equal.\n var arrStacked = stack.get(array);\n var othStacked = stack.get(other);\n if (arrStacked && othStacked) {\n return arrStacked == other && othStacked == array;\n }\n var index = -1,\n result = true,\n seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n stack.set(array, other);\n stack.set(other, array);\n\n // Ignore non-index properties.\n while (++index < arrLength) {\n var arrValue = array[index],\n othValue = other[index];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, arrValue, index, other, array, stack)\n : customizer(arrValue, othValue, index, array, other, stack);\n }\n if (compared !== undefined) {\n if (compared) {\n continue;\n }\n result = false;\n break;\n }\n // Recursively compare arrays (susceptible to call stack limits).\n if (seen) {\n if (!arraySome(other, function(othValue, othIndex) {\n if (!cacheHas(seen, othIndex) &&\n (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n return seen.push(othIndex);\n }\n })) {\n result = false;\n break;\n }\n } else if (!(\n arrValue === othValue ||\n equalFunc(arrValue, othValue, bitmask, customizer, stack)\n )) {\n result = false;\n break;\n }\n }\n stack['delete'](array);\n stack['delete'](other);\n return result;\n}\n\nmodule.exports = equalArrays;\n","var Symbol = require('./_Symbol'),\n Uint8Array = require('./_Uint8Array'),\n eq = require('./eq'),\n equalArrays = require('./_equalArrays'),\n mapToArray = require('./_mapToArray'),\n setToArray = require('./_setToArray');\n\n/** Used to compose bitmasks for value comparisons. */\nvar COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n/** `Object#toString` result references. */\nvar boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n errorTag = '[object Error]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n symbolTag = '[object Symbol]';\n\nvar arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]';\n\n/** Used to convert symbols to primitives and strings. */\nvar symbolProto = Symbol ? Symbol.prototype : undefined,\n symbolValueOf = symbolProto ? symbolProto.valueOf : undefined;\n\n/**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\nfunction equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n switch (tag) {\n case dataViewTag:\n if ((object.byteLength != other.byteLength) ||\n (object.byteOffset != other.byteOffset)) {\n return false;\n }\n object = object.buffer;\n other = other.buffer;\n\n case arrayBufferTag:\n if ((object.byteLength != other.byteLength) ||\n !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n return false;\n }\n return true;\n\n case boolTag:\n case dateTag:\n case numberTag:\n // Coerce booleans to `1` or `0` and dates to milliseconds.\n // Invalid dates are coerced to `NaN`.\n return eq(+object, +other);\n\n case errorTag:\n return object.name == other.name && object.message == other.message;\n\n case regexpTag:\n case stringTag:\n // Coerce regexes to strings and treat strings, primitives and objects,\n // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n // for more details.\n return object == (other + '');\n\n case mapTag:\n var convert = mapToArray;\n\n case setTag:\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n convert || (convert = setToArray);\n\n if (object.size != other.size && !isPartial) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked) {\n return stacked == other;\n }\n bitmask |= COMPARE_UNORDERED_FLAG;\n\n // Recursively compare objects (susceptible to call stack limits).\n stack.set(object, other);\n var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n stack['delete'](object);\n return result;\n\n case symbolTag:\n if (symbolValueOf) {\n return symbolValueOf.call(object) == symbolValueOf.call(other);\n }\n }\n return false;\n}\n\nmodule.exports = equalByTag;\n","var getAllKeys = require('./_getAllKeys');\n\n/** Used to compose bitmasks for value comparisons. */\nvar COMPARE_PARTIAL_FLAG = 1;\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\nfunction equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n objProps = getAllKeys(object),\n objLength = objProps.length,\n othProps = getAllKeys(other),\n othLength = othProps.length;\n\n if (objLength != othLength && !isPartial) {\n return false;\n }\n var index = objLength;\n while (index--) {\n var key = objProps[index];\n if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n return false;\n }\n }\n // Check that cyclic values are equal.\n var objStacked = stack.get(object);\n var othStacked = stack.get(other);\n if (objStacked && othStacked) {\n return objStacked == other && othStacked == object;\n }\n var result = true;\n stack.set(object, other);\n stack.set(other, object);\n\n var skipCtor = isPartial;\n while (++index < objLength) {\n key = objProps[index];\n var objValue = object[key],\n othValue = other[key];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, objValue, key, other, object, stack)\n : customizer(objValue, othValue, key, object, other, stack);\n }\n // Recursively compare objects (susceptible to call stack limits).\n if (!(compared === undefined\n ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n : compared\n )) {\n result = false;\n break;\n }\n skipCtor || (skipCtor = key == 'constructor');\n }\n if (result && !skipCtor) {\n var objCtor = object.constructor,\n othCtor = other.constructor;\n\n // Non `Object` object instances with different constructors are not equal.\n if (objCtor != othCtor &&\n ('constructor' in object && 'constructor' in other) &&\n !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n result = false;\n }\n }\n stack['delete'](object);\n stack['delete'](other);\n return result;\n}\n\nmodule.exports = equalObjects;\n","/** Detect free variable `global` from Node.js. */\nvar freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\nmodule.exports = freeGlobal;\n","var baseGetAllKeys = require('./_baseGetAllKeys'),\n getSymbols = require('./_getSymbols'),\n keys = require('./keys');\n\n/**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\nfunction getAllKeys(object) {\n return baseGetAllKeys(object, keys, getSymbols);\n}\n\nmodule.exports = getAllKeys;\n","var isKeyable = require('./_isKeyable');\n\n/**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\nfunction getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n}\n\nmodule.exports = getMapData;\n","var baseIsNative = require('./_baseIsNative'),\n getValue = require('./_getValue');\n\n/**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\nfunction getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n}\n\nmodule.exports = getNative;\n","var Symbol = require('./_Symbol');\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\nvar nativeObjectToString = objectProto.toString;\n\n/** Built-in value references. */\nvar symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n/**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\nfunction getRawTag(value) {\n var isOwn = hasOwnProperty.call(value, symToStringTag),\n tag = value[symToStringTag];\n\n try {\n value[symToStringTag] = undefined;\n var unmasked = true;\n } catch (e) {}\n\n var result = nativeObjectToString.call(value);\n if (unmasked) {\n if (isOwn) {\n value[symToStringTag] = tag;\n } else {\n delete value[symToStringTag];\n }\n }\n return result;\n}\n\nmodule.exports = getRawTag;\n","var arrayFilter = require('./_arrayFilter'),\n stubArray = require('./stubArray');\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Built-in value references. */\nvar propertyIsEnumerable = objectProto.propertyIsEnumerable;\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeGetSymbols = Object.getOwnPropertySymbols;\n\n/**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\nvar getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n if (object == null) {\n return [];\n }\n object = Object(object);\n return arrayFilter(nativeGetSymbols(object), function(symbol) {\n return propertyIsEnumerable.call(object, symbol);\n });\n};\n\nmodule.exports = getSymbols;\n","var DataView = require('./_DataView'),\n Map = require('./_Map'),\n Promise = require('./_Promise'),\n Set = require('./_Set'),\n WeakMap = require('./_WeakMap'),\n baseGetTag = require('./_baseGetTag'),\n toSource = require('./_toSource');\n\n/** `Object#toString` result references. */\nvar mapTag = '[object Map]',\n objectTag = '[object Object]',\n promiseTag = '[object Promise]',\n setTag = '[object Set]',\n weakMapTag = '[object WeakMap]';\n\nvar dataViewTag = '[object DataView]';\n\n/** Used to detect maps, sets, and weakmaps. */\nvar dataViewCtorString = toSource(DataView),\n mapCtorString = toSource(Map),\n promiseCtorString = toSource(Promise),\n setCtorString = toSource(Set),\n weakMapCtorString = toSource(WeakMap);\n\n/**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\nvar getTag = baseGetTag;\n\n// Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\nif ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n (Map && getTag(new Map) != mapTag) ||\n (Promise && getTag(Promise.resolve()) != promiseTag) ||\n (Set && getTag(new Set) != setTag) ||\n (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n getTag = function(value) {\n var result = baseGetTag(value),\n Ctor = result == objectTag ? value.constructor : undefined,\n ctorString = Ctor ? toSource(Ctor) : '';\n\n if (ctorString) {\n switch (ctorString) {\n case dataViewCtorString: return dataViewTag;\n case mapCtorString: return mapTag;\n case promiseCtorString: return promiseTag;\n case setCtorString: return setTag;\n case weakMapCtorString: return weakMapTag;\n }\n }\n return result;\n };\n}\n\nmodule.exports = getTag;\n","/**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\nfunction getValue(object, key) {\n return object == null ? undefined : object[key];\n}\n\nmodule.exports = getValue;\n","var nativeCreate = require('./_nativeCreate');\n\n/**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\nfunction hashClear() {\n this.__data__ = nativeCreate ? nativeCreate(null) : {};\n this.size = 0;\n}\n\nmodule.exports = hashClear;\n","/**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction hashDelete(key) {\n var result = this.has(key) && delete this.__data__[key];\n this.size -= result ? 1 : 0;\n return result;\n}\n\nmodule.exports = hashDelete;\n","var nativeCreate = require('./_nativeCreate');\n\n/** Used to stand-in for `undefined` hash values. */\nvar HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction hashGet(key) {\n var data = this.__data__;\n if (nativeCreate) {\n var result = data[key];\n return result === HASH_UNDEFINED ? undefined : result;\n }\n return hasOwnProperty.call(data, key) ? data[key] : undefined;\n}\n\nmodule.exports = hashGet;\n","var nativeCreate = require('./_nativeCreate');\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction hashHas(key) {\n var data = this.__data__;\n return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n}\n\nmodule.exports = hashHas;\n","var nativeCreate = require('./_nativeCreate');\n\n/** Used to stand-in for `undefined` hash values. */\nvar HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n/**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\nfunction hashSet(key, value) {\n var data = this.__data__;\n this.size += this.has(key) ? 0 : 1;\n data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n return this;\n}\n\nmodule.exports = hashSet;\n","/** Used as references for various `Number` constants. */\nvar MAX_SAFE_INTEGER = 9007199254740991;\n\n/** Used to detect unsigned integer values. */\nvar reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n/**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\nfunction isIndex(value, length) {\n var type = typeof value;\n length = length == null ? MAX_SAFE_INTEGER : length;\n\n return !!length &&\n (type == 'number' ||\n (type != 'symbol' && reIsUint.test(value))) &&\n (value > -1 && value % 1 == 0 && value < length);\n}\n\nmodule.exports = isIndex;\n","/**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\nfunction isKeyable(value) {\n var type = typeof value;\n return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n ? (value !== '__proto__')\n : (value === null);\n}\n\nmodule.exports = isKeyable;\n","var coreJsData = require('./_coreJsData');\n\n/** Used to detect methods masquerading as native. */\nvar maskSrcKey = (function() {\n var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n return uid ? ('Symbol(src)_1.' + uid) : '';\n}());\n\n/**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\nfunction isMasked(func) {\n return !!maskSrcKey && (maskSrcKey in func);\n}\n\nmodule.exports = isMasked;\n","/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\nfunction isPrototype(value) {\n var Ctor = value && value.constructor,\n proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n return value === proto;\n}\n\nmodule.exports = isPrototype;\n","/**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\nfunction listCacheClear() {\n this.__data__ = [];\n this.size = 0;\n}\n\nmodule.exports = listCacheClear;\n","var assocIndexOf = require('./_assocIndexOf');\n\n/** Used for built-in method references. */\nvar arrayProto = Array.prototype;\n\n/** Built-in value references. */\nvar splice = arrayProto.splice;\n\n/**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction listCacheDelete(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n return false;\n }\n var lastIndex = data.length - 1;\n if (index == lastIndex) {\n data.pop();\n } else {\n splice.call(data, index, 1);\n }\n --this.size;\n return true;\n}\n\nmodule.exports = listCacheDelete;\n","var assocIndexOf = require('./_assocIndexOf');\n\n/**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction listCacheGet(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n return index < 0 ? undefined : data[index][1];\n}\n\nmodule.exports = listCacheGet;\n","var assocIndexOf = require('./_assocIndexOf');\n\n/**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction listCacheHas(key) {\n return assocIndexOf(this.__data__, key) > -1;\n}\n\nmodule.exports = listCacheHas;\n","var assocIndexOf = require('./_assocIndexOf');\n\n/**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\nfunction listCacheSet(key, value) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n ++this.size;\n data.push([key, value]);\n } else {\n data[index][1] = value;\n }\n return this;\n}\n\nmodule.exports = listCacheSet;\n","var Hash = require('./_Hash'),\n ListCache = require('./_ListCache'),\n Map = require('./_Map');\n\n/**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\nfunction mapCacheClear() {\n this.size = 0;\n this.__data__ = {\n 'hash': new Hash,\n 'map': new (Map || ListCache),\n 'string': new Hash\n };\n}\n\nmodule.exports = mapCacheClear;\n","var getMapData = require('./_getMapData');\n\n/**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction mapCacheDelete(key) {\n var result = getMapData(this, key)['delete'](key);\n this.size -= result ? 1 : 0;\n return result;\n}\n\nmodule.exports = mapCacheDelete;\n","var getMapData = require('./_getMapData');\n\n/**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction mapCacheGet(key) {\n return getMapData(this, key).get(key);\n}\n\nmodule.exports = mapCacheGet;\n","var getMapData = require('./_getMapData');\n\n/**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction mapCacheHas(key) {\n return getMapData(this, key).has(key);\n}\n\nmodule.exports = mapCacheHas;\n","var getMapData = require('./_getMapData');\n\n/**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\nfunction mapCacheSet(key, value) {\n var data = getMapData(this, key),\n size = data.size;\n\n data.set(key, value);\n this.size += data.size == size ? 0 : 1;\n return this;\n}\n\nmodule.exports = mapCacheSet;\n","/**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\nfunction mapToArray(map) {\n var index = -1,\n result = Array(map.size);\n\n map.forEach(function(value, key) {\n result[++index] = [key, value];\n });\n return result;\n}\n\nmodule.exports = mapToArray;\n","var getNative = require('./_getNative');\n\n/* Built-in method references that are verified to be native. */\nvar nativeCreate = getNative(Object, 'create');\n\nmodule.exports = nativeCreate;\n","var overArg = require('./_overArg');\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeKeys = overArg(Object.keys, Object);\n\nmodule.exports = nativeKeys;\n","var freeGlobal = require('./_freeGlobal');\n\n/** Detect free variable `exports`. */\nvar freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n/** Detect free variable `module`. */\nvar freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n/** Detect the popular CommonJS extension `module.exports`. */\nvar moduleExports = freeModule && freeModule.exports === freeExports;\n\n/** Detect free variable `process` from Node.js. */\nvar freeProcess = moduleExports && freeGlobal.process;\n\n/** Used to access faster Node.js helpers. */\nvar nodeUtil = (function() {\n try {\n // Use `util.types` for Node.js 10+.\n var types = freeModule && freeModule.require && freeModule.require('util').types;\n\n if (types) {\n return types;\n }\n\n // Legacy `process.binding('util')` for Node.js < 10.\n return freeProcess && freeProcess.binding && freeProcess.binding('util');\n } catch (e) {}\n}());\n\nmodule.exports = nodeUtil;\n","/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\nvar nativeObjectToString = objectProto.toString;\n\n/**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\nfunction objectToString(value) {\n return nativeObjectToString.call(value);\n}\n\nmodule.exports = objectToString;\n","/**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\nfunction overArg(func, transform) {\n return function(arg) {\n return func(transform(arg));\n };\n}\n\nmodule.exports = overArg;\n","var freeGlobal = require('./_freeGlobal');\n\n/** Detect free variable `self`. */\nvar freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n/** Used as a reference to the global object. */\nvar root = freeGlobal || freeSelf || Function('return this')();\n\nmodule.exports = root;\n","/** Used to stand-in for `undefined` hash values. */\nvar HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n/**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\nfunction setCacheAdd(value) {\n this.__data__.set(value, HASH_UNDEFINED);\n return this;\n}\n\nmodule.exports = setCacheAdd;\n","/**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\nfunction setCacheHas(value) {\n return this.__data__.has(value);\n}\n\nmodule.exports = setCacheHas;\n","/**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\nfunction setToArray(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = value;\n });\n return result;\n}\n\nmodule.exports = setToArray;\n","var ListCache = require('./_ListCache');\n\n/**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\nfunction stackClear() {\n this.__data__ = new ListCache;\n this.size = 0;\n}\n\nmodule.exports = stackClear;\n","/**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\nfunction stackDelete(key) {\n var data = this.__data__,\n result = data['delete'](key);\n\n this.size = data.size;\n return result;\n}\n\nmodule.exports = stackDelete;\n","/**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\nfunction stackGet(key) {\n return this.__data__.get(key);\n}\n\nmodule.exports = stackGet;\n","/**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\nfunction stackHas(key) {\n return this.__data__.has(key);\n}\n\nmodule.exports = stackHas;\n","var ListCache = require('./_ListCache'),\n Map = require('./_Map'),\n MapCache = require('./_MapCache');\n\n/** Used as the size to enable large array optimizations. */\nvar LARGE_ARRAY_SIZE = 200;\n\n/**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\nfunction stackSet(key, value) {\n var data = this.__data__;\n if (data instanceof ListCache) {\n var pairs = data.__data__;\n if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n pairs.push([key, value]);\n this.size = ++data.size;\n return this;\n }\n data = this.__data__ = new MapCache(pairs);\n }\n data.set(key, value);\n this.size = data.size;\n return this;\n}\n\nmodule.exports = stackSet;\n","/** Used for built-in method references. */\nvar funcProto = Function.prototype;\n\n/** Used to resolve the decompiled source of functions. */\nvar funcToString = funcProto.toString;\n\n/**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\nfunction toSource(func) {\n if (func != null) {\n try {\n return funcToString.call(func);\n } catch (e) {}\n try {\n return (func + '');\n } catch (e) {}\n }\n return '';\n}\n\nmodule.exports = toSource;\n","/**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\nfunction eq(value, other) {\n return value === other || (value !== value && other !== other);\n}\n\nmodule.exports = eq;\n","var baseIsArguments = require('./_baseIsArguments'),\n isObjectLike = require('./isObjectLike');\n\n/** Used for built-in method references. */\nvar objectProto = Object.prototype;\n\n/** Used to check objects for own properties. */\nvar hasOwnProperty = objectProto.hasOwnProperty;\n\n/** Built-in value references. */\nvar propertyIsEnumerable = objectProto.propertyIsEnumerable;\n\n/**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n * else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\nvar isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n !propertyIsEnumerable.call(value, 'callee');\n};\n\nmodule.exports = isArguments;\n","/**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\nvar isArray = Array.isArray;\n\nmodule.exports = isArray;\n","var isFunction = require('./isFunction'),\n isLength = require('./isLength');\n\n/**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\nfunction isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n}\n\nmodule.exports = isArrayLike;\n","var root = require('./_root'),\n stubFalse = require('./stubFalse');\n\n/** Detect free variable `exports`. */\nvar freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n/** Detect free variable `module`. */\nvar freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n/** Detect the popular CommonJS extension `module.exports`. */\nvar moduleExports = freeModule && freeModule.exports === freeExports;\n\n/** Built-in value references. */\nvar Buffer = moduleExports ? root.Buffer : undefined;\n\n/* Built-in method references for those with the same name as other `lodash` methods. */\nvar nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined;\n\n/**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\nvar isBuffer = nativeIsBuffer || stubFalse;\n\nmodule.exports = isBuffer;\n","var baseIsEqual = require('./_baseIsEqual');\n\n/**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\nfunction isEqual(value, other) {\n return baseIsEqual(value, other);\n}\n\nmodule.exports = isEqual;\n","var baseGetTag = require('./_baseGetTag'),\n isObject = require('./isObject');\n\n/** `Object#toString` result references. */\nvar asyncTag = '[object AsyncFunction]',\n funcTag = '[object Function]',\n genTag = '[object GeneratorFunction]',\n proxyTag = '[object Proxy]';\n\n/**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\nfunction isFunction(value) {\n if (!isObject(value)) {\n return false;\n }\n // The use of `Object#toString` avoids issues with the `typeof` operator\n // in Safari 9 which returns 'object' for typed arrays and other constructors.\n var tag = baseGetTag(value);\n return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n}\n\nmodule.exports = isFunction;\n","/** Used as references for various `Number` constants. */\nvar MAX_SAFE_INTEGER = 9007199254740991;\n\n/**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\nfunction isLength(value) {\n return typeof value == 'number' &&\n value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n}\n\nmodule.exports = isLength;\n","/**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\nfunction isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n}\n\nmodule.exports = isObject;\n","/**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\nfunction isObjectLike(value) {\n return value != null && typeof value == 'object';\n}\n\nmodule.exports = isObjectLike;\n","var baseIsTypedArray = require('./_baseIsTypedArray'),\n baseUnary = require('./_baseUnary'),\n nodeUtil = require('./_nodeUtil');\n\n/* Node.js helper references. */\nvar nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n/**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\nvar isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\nmodule.exports = isTypedArray;\n","var arrayLikeKeys = require('./_arrayLikeKeys'),\n baseKeys = require('./_baseKeys'),\n isArrayLike = require('./isArrayLike');\n\n/**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\nfunction keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n}\n\nmodule.exports = keys;\n","/**\n * @license\n * Lodash \n * Copyright OpenJS Foundation and other contributors \n * Released under MIT license \n * Based on Underscore.js 1.8.3 \n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n;(function() {\n\n /** Used as a safe reference for `undefined` in pre-ES5 environments. */\n var undefined;\n\n /** Used as the semantic version number. */\n var VERSION = '4.17.21';\n\n /** Used as the size to enable large array optimizations. */\n var LARGE_ARRAY_SIZE = 200;\n\n /** Error message constants. */\n var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',\n FUNC_ERROR_TEXT = 'Expected a function',\n INVALID_TEMPL_VAR_ERROR_TEXT = 'Invalid `variable` option passed into `_.template`';\n\n /** Used to stand-in for `undefined` hash values. */\n var HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n /** Used as the maximum memoize cache size. */\n var MAX_MEMOIZE_SIZE = 500;\n\n /** Used as the internal argument placeholder. */\n var PLACEHOLDER = '__lodash_placeholder__';\n\n /** Used to compose bitmasks for cloning. */\n var CLONE_DEEP_FLAG = 1,\n CLONE_FLAT_FLAG = 2,\n CLONE_SYMBOLS_FLAG = 4;\n\n /** Used to compose bitmasks for value comparisons. */\n var COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n /** Used to compose bitmasks for function metadata. */\n var WRAP_BIND_FLAG = 1,\n WRAP_BIND_KEY_FLAG = 2,\n WRAP_CURRY_BOUND_FLAG = 4,\n WRAP_CURRY_FLAG = 8,\n WRAP_CURRY_RIGHT_FLAG = 16,\n WRAP_PARTIAL_FLAG = 32,\n WRAP_PARTIAL_RIGHT_FLAG = 64,\n WRAP_ARY_FLAG = 128,\n WRAP_REARG_FLAG = 256,\n WRAP_FLIP_FLAG = 512;\n\n /** Used as default options for `_.truncate`. */\n var DEFAULT_TRUNC_LENGTH = 30,\n DEFAULT_TRUNC_OMISSION = '...';\n\n /** Used to detect hot functions by number of calls within a span of milliseconds. */\n var HOT_COUNT = 800,\n HOT_SPAN = 16;\n\n /** Used to indicate the type of lazy iteratees. */\n var LAZY_FILTER_FLAG = 1,\n LAZY_MAP_FLAG = 2,\n LAZY_WHILE_FLAG = 3;\n\n /** Used as references for various `Number` constants. */\n var INFINITY = 1 / 0,\n MAX_SAFE_INTEGER = 9007199254740991,\n MAX_INTEGER = 1.7976931348623157e+308,\n NAN = 0 / 0;\n\n /** Used as references for the maximum length and index of an array. */\n var MAX_ARRAY_LENGTH = 4294967295,\n MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,\n HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;\n\n /** Used to associate wrap methods with their bit flags. */\n var wrapFlags = [\n ['ary', WRAP_ARY_FLAG],\n ['bind', WRAP_BIND_FLAG],\n ['bindKey', WRAP_BIND_KEY_FLAG],\n ['curry', WRAP_CURRY_FLAG],\n ['curryRight', WRAP_CURRY_RIGHT_FLAG],\n ['flip', WRAP_FLIP_FLAG],\n ['partial', WRAP_PARTIAL_FLAG],\n ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],\n ['rearg', WRAP_REARG_FLAG]\n ];\n\n /** `Object#toString` result references. */\n var argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n asyncTag = '[object AsyncFunction]',\n boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n domExcTag = '[object DOMException]',\n errorTag = '[object Error]',\n funcTag = '[object Function]',\n genTag = '[object GeneratorFunction]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n nullTag = '[object Null]',\n objectTag = '[object Object]',\n promiseTag = '[object Promise]',\n proxyTag = '[object Proxy]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n symbolTag = '[object Symbol]',\n undefinedTag = '[object Undefined]',\n weakMapTag = '[object WeakMap]',\n weakSetTag = '[object WeakSet]';\n\n var arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]',\n float32Tag = '[object Float32Array]',\n float64Tag = '[object Float64Array]',\n int8Tag = '[object Int8Array]',\n int16Tag = '[object Int16Array]',\n int32Tag = '[object Int32Array]',\n uint8Tag = '[object Uint8Array]',\n uint8ClampedTag = '[object Uint8ClampedArray]',\n uint16Tag = '[object Uint16Array]',\n uint32Tag = '[object Uint32Array]';\n\n /** Used to match empty string literals in compiled template source. */\n var reEmptyStringLeading = /\\b__p \\+= '';/g,\n reEmptyStringMiddle = /\\b(__p \\+=) '' \\+/g,\n reEmptyStringTrailing = /(__e\\(.*?\\)|\\b__t\\)) \\+\\n'';/g;\n\n /** Used to match HTML entities and HTML characters. */\n var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,\n reUnescapedHtml = /[&<>\"']/g,\n reHasEscapedHtml = RegExp(reEscapedHtml.source),\n reHasUnescapedHtml = RegExp(reUnescapedHtml.source);\n\n /** Used to match template delimiters. */\n var reEscape = /<%-([\\s\\S]+?)%>/g,\n reEvaluate = /<%([\\s\\S]+?)%>/g,\n reInterpolate = /<%=([\\s\\S]+?)%>/g;\n\n /** Used to match property names within property paths. */\n var reIsDeepProp = /\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,\n reIsPlainProp = /^\\w*$/,\n rePropName = /[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g;\n\n /**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\n var reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g,\n reHasRegExpChar = RegExp(reRegExpChar.source);\n\n /** Used to match leading whitespace. */\n var reTrimStart = /^\\s+/;\n\n /** Used to match a single whitespace character. */\n var reWhitespace = /\\s/;\n\n /** Used to match wrap detail comments. */\n var reWrapComment = /\\{(?:\\n\\/\\* \\[wrapped with .+\\] \\*\\/)?\\n?/,\n reWrapDetails = /\\{\\n\\/\\* \\[wrapped with (.+)\\] \\*/,\n reSplitDetails = /,? & /;\n\n /** Used to match words composed of alphanumeric characters. */\n var reAsciiWord = /[^\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\x7f]+/g;\n\n /**\n * Used to validate the `validate` option in `_.template` variable.\n *\n * Forbids characters which could potentially change the meaning of the function argument definition:\n * - \"(),\" (modification of function parameters)\n * - \"=\" (default value)\n * - \"[]{}\" (destructuring of function parameters)\n * - \"/\" (beginning of a comment)\n * - whitespace\n */\n var reForbiddenIdentifierChars = /[()=,{}\\[\\]\\/\\s]/;\n\n /** Used to match backslashes in property paths. */\n var reEscapeChar = /\\\\(\\\\)?/g;\n\n /**\n * Used to match\n * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).\n */\n var reEsTemplate = /\\$\\{([^\\\\}]*(?:\\\\.[^\\\\}]*)*)\\}/g;\n\n /** Used to match `RegExp` flags from their coerced string values. */\n var reFlags = /\\w*$/;\n\n /** Used to detect bad signed hexadecimal string values. */\n var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;\n\n /** Used to detect binary string values. */\n var reIsBinary = /^0b[01]+$/i;\n\n /** Used to detect host constructors (Safari). */\n var reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n /** Used to detect octal string values. */\n var reIsOctal = /^0o[0-7]+$/i;\n\n /** Used to detect unsigned integer values. */\n var reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n /** Used to match Latin Unicode letters (excluding mathematical operators). */\n var reLatin = /[\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\xff\\u0100-\\u017f]/g;\n\n /** Used to ensure capturing order of template delimiters. */\n var reNoMatch = /($^)/;\n\n /** Used to match unescaped characters in compiled string literals. */\n var reUnescapedString = /['\\n\\r\\u2028\\u2029\\\\]/g;\n\n /** Used to compose unicode character classes. */\n var rsAstralRange = '\\\\ud800-\\\\udfff',\n rsComboMarksRange = '\\\\u0300-\\\\u036f',\n reComboHalfMarksRange = '\\\\ufe20-\\\\ufe2f',\n rsComboSymbolsRange = '\\\\u20d0-\\\\u20ff',\n rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,\n rsDingbatRange = '\\\\u2700-\\\\u27bf',\n rsLowerRange = 'a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff',\n rsMathOpRange = '\\\\xac\\\\xb1\\\\xd7\\\\xf7',\n rsNonCharRange = '\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf',\n rsPunctuationRange = '\\\\u2000-\\\\u206f',\n rsSpaceRange = ' \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000',\n rsUpperRange = 'A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde',\n rsVarRange = '\\\\ufe0e\\\\ufe0f',\n rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;\n\n /** Used to compose unicode capture groups. */\n var rsApos = \"['\\u2019]\",\n rsAstral = '[' + rsAstralRange + ']',\n rsBreak = '[' + rsBreakRange + ']',\n rsCombo = '[' + rsComboRange + ']',\n rsDigits = '\\\\d+',\n rsDingbat = '[' + rsDingbatRange + ']',\n rsLower = '[' + rsLowerRange + ']',\n rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',\n rsFitz = '\\\\ud83c[\\\\udffb-\\\\udfff]',\n rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',\n rsNonAstral = '[^' + rsAstralRange + ']',\n rsRegional = '(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}',\n rsSurrPair = '[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff]',\n rsUpper = '[' + rsUpperRange + ']',\n rsZWJ = '\\\\u200d';\n\n /** Used to compose unicode regexes. */\n var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',\n rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',\n rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',\n rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',\n reOptMod = rsModifier + '?',\n rsOptVar = '[' + rsVarRange + ']?',\n rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',\n rsOrdLower = '\\\\d*(?:1st|2nd|3rd|(?![123])\\\\dth)(?=\\\\b|[A-Z_])',\n rsOrdUpper = '\\\\d*(?:1ST|2ND|3RD|(?![123])\\\\dTH)(?=\\\\b|[a-z_])',\n rsSeq = rsOptVar + reOptMod + rsOptJoin,\n rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,\n rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';\n\n /** Used to match apostrophes. */\n var reApos = RegExp(rsApos, 'g');\n\n /**\n * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and\n * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).\n */\n var reComboMark = RegExp(rsCombo, 'g');\n\n /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */\n var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');\n\n /** Used to match complex or compound words. */\n var reUnicodeWord = RegExp([\n rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',\n rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',\n rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,\n rsUpper + '+' + rsOptContrUpper,\n rsOrdUpper,\n rsOrdLower,\n rsDigits,\n rsEmoji\n ].join('|'), 'g');\n\n /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */\n var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');\n\n /** Used to detect strings that need a more robust regexp to match words. */\n var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;\n\n /** Used to assign default `context` object properties. */\n var contextProps = [\n 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',\n 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',\n 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',\n 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',\n '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'\n ];\n\n /** Used to make template sourceURLs easier to identify. */\n var templateCounter = -1;\n\n /** Used to identify `toStringTag` values of typed arrays. */\n var typedArrayTags = {};\n typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\n typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\n typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\n typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\n typedArrayTags[uint32Tag] = true;\n typedArrayTags[argsTag] = typedArrayTags[arrayTag] =\n typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\n typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\n typedArrayTags[errorTag] = typedArrayTags[funcTag] =\n typedArrayTags[mapTag] = typedArrayTags[numberTag] =\n typedArrayTags[objectTag] = typedArrayTags[regexpTag] =\n typedArrayTags[setTag] = typedArrayTags[stringTag] =\n typedArrayTags[weakMapTag] = false;\n\n /** Used to identify `toStringTag` values supported by `_.clone`. */\n var cloneableTags = {};\n cloneableTags[argsTag] = cloneableTags[arrayTag] =\n cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =\n cloneableTags[boolTag] = cloneableTags[dateTag] =\n cloneableTags[float32Tag] = cloneableTags[float64Tag] =\n cloneableTags[int8Tag] = cloneableTags[int16Tag] =\n cloneableTags[int32Tag] = cloneableTags[mapTag] =\n cloneableTags[numberTag] = cloneableTags[objectTag] =\n cloneableTags[regexpTag] = cloneableTags[setTag] =\n cloneableTags[stringTag] = cloneableTags[symbolTag] =\n cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =\n cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;\n cloneableTags[errorTag] = cloneableTags[funcTag] =\n cloneableTags[weakMapTag] = false;\n\n /** Used to map Latin Unicode letters to basic Latin letters. */\n var deburredLetters = {\n // Latin-1 Supplement block.\n '\\xc0': 'A', '\\xc1': 'A', '\\xc2': 'A', '\\xc3': 'A', '\\xc4': 'A', '\\xc5': 'A',\n '\\xe0': 'a', '\\xe1': 'a', '\\xe2': 'a', '\\xe3': 'a', '\\xe4': 'a', '\\xe5': 'a',\n '\\xc7': 'C', '\\xe7': 'c',\n '\\xd0': 'D', '\\xf0': 'd',\n '\\xc8': 'E', '\\xc9': 'E', '\\xca': 'E', '\\xcb': 'E',\n '\\xe8': 'e', '\\xe9': 'e', '\\xea': 'e', '\\xeb': 'e',\n '\\xcc': 'I', '\\xcd': 'I', '\\xce': 'I', '\\xcf': 'I',\n '\\xec': 'i', '\\xed': 'i', '\\xee': 'i', '\\xef': 'i',\n '\\xd1': 'N', '\\xf1': 'n',\n '\\xd2': 'O', '\\xd3': 'O', '\\xd4': 'O', '\\xd5': 'O', '\\xd6': 'O', '\\xd8': 'O',\n '\\xf2': 'o', '\\xf3': 'o', '\\xf4': 'o', '\\xf5': 'o', '\\xf6': 'o', '\\xf8': 'o',\n '\\xd9': 'U', '\\xda': 'U', '\\xdb': 'U', '\\xdc': 'U',\n '\\xf9': 'u', '\\xfa': 'u', '\\xfb': 'u', '\\xfc': 'u',\n '\\xdd': 'Y', '\\xfd': 'y', '\\xff': 'y',\n '\\xc6': 'Ae', '\\xe6': 'ae',\n '\\xde': 'Th', '\\xfe': 'th',\n '\\xdf': 'ss',\n // Latin Extended-A block.\n '\\u0100': 'A', '\\u0102': 'A', '\\u0104': 'A',\n '\\u0101': 'a', '\\u0103': 'a', '\\u0105': 'a',\n '\\u0106': 'C', '\\u0108': 'C', '\\u010a': 'C', '\\u010c': 'C',\n '\\u0107': 'c', '\\u0109': 'c', '\\u010b': 'c', '\\u010d': 'c',\n '\\u010e': 'D', '\\u0110': 'D', '\\u010f': 'd', '\\u0111': 'd',\n '\\u0112': 'E', '\\u0114': 'E', '\\u0116': 'E', '\\u0118': 'E', '\\u011a': 'E',\n '\\u0113': 'e', '\\u0115': 'e', '\\u0117': 'e', '\\u0119': 'e', '\\u011b': 'e',\n '\\u011c': 'G', '\\u011e': 'G', '\\u0120': 'G', '\\u0122': 'G',\n '\\u011d': 'g', '\\u011f': 'g', '\\u0121': 'g', '\\u0123': 'g',\n '\\u0124': 'H', '\\u0126': 'H', '\\u0125': 'h', '\\u0127': 'h',\n '\\u0128': 'I', '\\u012a': 'I', '\\u012c': 'I', '\\u012e': 'I', '\\u0130': 'I',\n '\\u0129': 'i', '\\u012b': 'i', '\\u012d': 'i', '\\u012f': 'i', '\\u0131': 'i',\n '\\u0134': 'J', '\\u0135': 'j',\n '\\u0136': 'K', '\\u0137': 'k', '\\u0138': 'k',\n '\\u0139': 'L', '\\u013b': 'L', '\\u013d': 'L', '\\u013f': 'L', '\\u0141': 'L',\n '\\u013a': 'l', '\\u013c': 'l', '\\u013e': 'l', '\\u0140': 'l', '\\u0142': 'l',\n '\\u0143': 'N', '\\u0145': 'N', '\\u0147': 'N', '\\u014a': 'N',\n '\\u0144': 'n', '\\u0146': 'n', '\\u0148': 'n', '\\u014b': 'n',\n '\\u014c': 'O', '\\u014e': 'O', '\\u0150': 'O',\n '\\u014d': 'o', '\\u014f': 'o', '\\u0151': 'o',\n '\\u0154': 'R', '\\u0156': 'R', '\\u0158': 'R',\n '\\u0155': 'r', '\\u0157': 'r', '\\u0159': 'r',\n '\\u015a': 'S', '\\u015c': 'S', '\\u015e': 'S', '\\u0160': 'S',\n '\\u015b': 's', '\\u015d': 's', '\\u015f': 's', '\\u0161': 's',\n '\\u0162': 'T', '\\u0164': 'T', '\\u0166': 'T',\n '\\u0163': 't', '\\u0165': 't', '\\u0167': 't',\n '\\u0168': 'U', '\\u016a': 'U', '\\u016c': 'U', '\\u016e': 'U', '\\u0170': 'U', '\\u0172': 'U',\n '\\u0169': 'u', '\\u016b': 'u', '\\u016d': 'u', '\\u016f': 'u', '\\u0171': 'u', '\\u0173': 'u',\n '\\u0174': 'W', '\\u0175': 'w',\n '\\u0176': 'Y', '\\u0177': 'y', '\\u0178': 'Y',\n '\\u0179': 'Z', '\\u017b': 'Z', '\\u017d': 'Z',\n '\\u017a': 'z', '\\u017c': 'z', '\\u017e': 'z',\n '\\u0132': 'IJ', '\\u0133': 'ij',\n '\\u0152': 'Oe', '\\u0153': 'oe',\n '\\u0149': \"'n\", '\\u017f': 's'\n };\n\n /** Used to map characters to HTML entities. */\n var htmlEscapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '\"': '"',\n \"'\": '''\n };\n\n /** Used to map HTML entities to characters. */\n var htmlUnescapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '"': '\"',\n ''': \"'\"\n };\n\n /** Used to escape characters for inclusion in compiled string literals. */\n var stringEscapes = {\n '\\\\': '\\\\',\n \"'\": \"'\",\n '\\n': 'n',\n '\\r': 'r',\n '\\u2028': 'u2028',\n '\\u2029': 'u2029'\n };\n\n /** Built-in method references without a dependency on `root`. */\n var freeParseFloat = parseFloat,\n freeParseInt = parseInt;\n\n /** Detect free variable `global` from Node.js. */\n var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\n /** Detect free variable `self`. */\n var freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n /** Used as a reference to the global object. */\n var root = freeGlobal || freeSelf || Function('return this')();\n\n /** Detect free variable `exports`. */\n var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n /** Detect free variable `module`. */\n var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n /** Detect the popular CommonJS extension `module.exports`. */\n var moduleExports = freeModule && freeModule.exports === freeExports;\n\n /** Detect free variable `process` from Node.js. */\n var freeProcess = moduleExports && freeGlobal.process;\n\n /** Used to access faster Node.js helpers. */\n var nodeUtil = (function() {\n try {\n // Use `util.types` for Node.js 10+.\n var types = freeModule && freeModule.require && freeModule.require('util').types;\n\n if (types) {\n return types;\n }\n\n // Legacy `process.binding('util')` for Node.js < 10.\n return freeProcess && freeProcess.binding && freeProcess.binding('util');\n } catch (e) {}\n }());\n\n /* Node.js helper references. */\n var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,\n nodeIsDate = nodeUtil && nodeUtil.isDate,\n nodeIsMap = nodeUtil && nodeUtil.isMap,\n nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,\n nodeIsSet = nodeUtil && nodeUtil.isSet,\n nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * A faster alternative to `Function#apply`, this function invokes `func`\n * with the `this` binding of `thisArg` and the arguments of `args`.\n *\n * @private\n * @param {Function} func The function to invoke.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} args The arguments to invoke `func` with.\n * @returns {*} Returns the result of `func`.\n */\n function apply(func, thisArg, args) {\n switch (args.length) {\n case 0: return func.call(thisArg);\n case 1: return func.call(thisArg, args[0]);\n case 2: return func.call(thisArg, args[0], args[1]);\n case 3: return func.call(thisArg, args[0], args[1], args[2]);\n }\n return func.apply(thisArg, args);\n }\n\n /**\n * A specialized version of `baseAggregator` for arrays.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function arrayAggregator(array, setter, iteratee, accumulator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n var value = array[index];\n setter(accumulator, value, iteratee(value), array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.forEach` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEach(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (iteratee(array[index], index, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.forEachRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEachRight(array, iteratee) {\n var length = array == null ? 0 : array.length;\n\n while (length--) {\n if (iteratee(array[length], length, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.every` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n */\n function arrayEvery(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (!predicate(array[index], index, array)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function arrayFilter(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.includes` for arrays without support for\n * specifying an index to search from.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludes(array, value) {\n var length = array == null ? 0 : array.length;\n return !!length && baseIndexOf(array, value, 0) > -1;\n }\n\n /**\n * This function is like `arrayIncludes` except that it accepts a comparator.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludesWith(array, value, comparator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (comparator(value, array[index])) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `_.map` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function arrayMap(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length,\n result = Array(length);\n\n while (++index < length) {\n result[index] = iteratee(array[index], index, array);\n }\n return result;\n }\n\n /**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\n function arrayPush(array, values) {\n var index = -1,\n length = values.length,\n offset = array.length;\n\n while (++index < length) {\n array[offset + index] = values[index];\n }\n return array;\n }\n\n /**\n * A specialized version of `_.reduce` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the first element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduce(array, iteratee, accumulator, initAccum) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n if (initAccum && length) {\n accumulator = array[++index];\n }\n while (++index < length) {\n accumulator = iteratee(accumulator, array[index], index, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.reduceRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the last element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduceRight(array, iteratee, accumulator, initAccum) {\n var length = array == null ? 0 : array.length;\n if (initAccum && length) {\n accumulator = array[--length];\n }\n while (length--) {\n accumulator = iteratee(accumulator, array[length], length, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function arraySome(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (predicate(array[index], index, array)) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * Gets the size of an ASCII `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n var asciiSize = baseProperty('length');\n\n /**\n * Converts an ASCII `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function asciiToArray(string) {\n return string.split('');\n }\n\n /**\n * Splits an ASCII `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function asciiWords(string) {\n return string.match(reAsciiWord) || [];\n }\n\n /**\n * The base implementation of methods like `_.findKey` and `_.findLastKey`,\n * without support for iteratee shorthands, which iterates over `collection`\n * using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the found element or its key, else `undefined`.\n */\n function baseFindKey(collection, predicate, eachFunc) {\n var result;\n eachFunc(collection, function(value, key, collection) {\n if (predicate(value, key, collection)) {\n result = key;\n return false;\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.findIndex` and `_.findLastIndex` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {number} fromIndex The index to search from.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseFindIndex(array, predicate, fromIndex, fromRight) {\n var length = array.length,\n index = fromIndex + (fromRight ? 1 : -1);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (predicate(array[index], index, array)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.indexOf` without `fromIndex` bounds checks.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOf(array, value, fromIndex) {\n return value === value\n ? strictIndexOf(array, value, fromIndex)\n : baseFindIndex(array, baseIsNaN, fromIndex);\n }\n\n /**\n * This function is like `baseIndexOf` except that it accepts a comparator.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOfWith(array, value, fromIndex, comparator) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (comparator(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.isNaN` without support for number objects.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n */\n function baseIsNaN(value) {\n return value !== value;\n }\n\n /**\n * The base implementation of `_.mean` and `_.meanBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the mean.\n */\n function baseMean(array, iteratee) {\n var length = array == null ? 0 : array.length;\n return length ? (baseSum(array, iteratee) / length) : NAN;\n }\n\n /**\n * The base implementation of `_.property` without support for deep paths.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function baseProperty(key) {\n return function(object) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.propertyOf` without support for deep paths.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyOf(object) {\n return function(key) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.reduce` and `_.reduceRight`, without support\n * for iteratee shorthands, which iterates over `collection` using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} accumulator The initial value.\n * @param {boolean} initAccum Specify using the first or last element of\n * `collection` as the initial value.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the accumulated value.\n */\n function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {\n eachFunc(collection, function(value, index, collection) {\n accumulator = initAccum\n ? (initAccum = false, value)\n : iteratee(accumulator, value, index, collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.sortBy` which uses `comparer` to define the\n * sort order of `array` and replaces criteria objects with their corresponding\n * values.\n *\n * @private\n * @param {Array} array The array to sort.\n * @param {Function} comparer The function to define sort order.\n * @returns {Array} Returns `array`.\n */\n function baseSortBy(array, comparer) {\n var length = array.length;\n\n array.sort(comparer);\n while (length--) {\n array[length] = array[length].value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.sum` and `_.sumBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the sum.\n */\n function baseSum(array, iteratee) {\n var result,\n index = -1,\n length = array.length;\n\n while (++index < length) {\n var current = iteratee(array[index]);\n if (current !== undefined) {\n result = result === undefined ? current : (result + current);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\n function baseTimes(n, iteratee) {\n var index = -1,\n result = Array(n);\n\n while (++index < n) {\n result[index] = iteratee(index);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array\n * of key-value pairs for `object` corresponding to the property names of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the key-value pairs.\n */\n function baseToPairs(object, props) {\n return arrayMap(props, function(key) {\n return [key, object[key]];\n });\n }\n\n /**\n * The base implementation of `_.trim`.\n *\n * @private\n * @param {string} string The string to trim.\n * @returns {string} Returns the trimmed string.\n */\n function baseTrim(string) {\n return string\n ? string.slice(0, trimmedEndIndex(string) + 1).replace(reTrimStart, '')\n : string;\n }\n\n /**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\n function baseUnary(func) {\n return function(value) {\n return func(value);\n };\n }\n\n /**\n * The base implementation of `_.values` and `_.valuesIn` which creates an\n * array of `object` property values corresponding to the property names\n * of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the array of property values.\n */\n function baseValues(object, props) {\n return arrayMap(props, function(key) {\n return object[key];\n });\n }\n\n /**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function cacheHas(cache, key) {\n return cache.has(key);\n }\n\n /**\n * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the first unmatched string symbol.\n */\n function charsStartIndex(strSymbols, chrSymbols) {\n var index = -1,\n length = strSymbols.length;\n\n while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the last unmatched string symbol.\n */\n function charsEndIndex(strSymbols, chrSymbols) {\n var index = strSymbols.length;\n\n while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Gets the number of `placeholder` occurrences in `array`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} placeholder The placeholder to search for.\n * @returns {number} Returns the placeholder count.\n */\n function countHolders(array, placeholder) {\n var length = array.length,\n result = 0;\n\n while (length--) {\n if (array[length] === placeholder) {\n ++result;\n }\n }\n return result;\n }\n\n /**\n * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A\n * letters to basic Latin letters.\n *\n * @private\n * @param {string} letter The matched letter to deburr.\n * @returns {string} Returns the deburred letter.\n */\n var deburrLetter = basePropertyOf(deburredLetters);\n\n /**\n * Used by `_.escape` to convert characters to HTML entities.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n var escapeHtmlChar = basePropertyOf(htmlEscapes);\n\n /**\n * Used by `_.template` to escape characters for inclusion in compiled string literals.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n function escapeStringChar(chr) {\n return '\\\\' + stringEscapes[chr];\n }\n\n /**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function getValue(object, key) {\n return object == null ? undefined : object[key];\n }\n\n /**\n * Checks if `string` contains Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a symbol is found, else `false`.\n */\n function hasUnicode(string) {\n return reHasUnicode.test(string);\n }\n\n /**\n * Checks if `string` contains a word composed of Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a word is found, else `false`.\n */\n function hasUnicodeWord(string) {\n return reHasUnicodeWord.test(string);\n }\n\n /**\n * Converts `iterator` to an array.\n *\n * @private\n * @param {Object} iterator The iterator to convert.\n * @returns {Array} Returns the converted array.\n */\n function iteratorToArray(iterator) {\n var data,\n result = [];\n\n while (!(data = iterator.next()).done) {\n result.push(data.value);\n }\n return result;\n }\n\n /**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\n function mapToArray(map) {\n var index = -1,\n result = Array(map.size);\n\n map.forEach(function(value, key) {\n result[++index] = [key, value];\n });\n return result;\n }\n\n /**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\n function overArg(func, transform) {\n return function(arg) {\n return func(transform(arg));\n };\n }\n\n /**\n * Replaces all `placeholder` elements in `array` with an internal placeholder\n * and returns an array of their indexes.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {*} placeholder The placeholder to replace.\n * @returns {Array} Returns the new array of placeholder indexes.\n */\n function replaceHolders(array, placeholder) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value === placeholder || value === PLACEHOLDER) {\n array[index] = PLACEHOLDER;\n result[resIndex++] = index;\n }\n }\n return result;\n }\n\n /**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\n function setToArray(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = value;\n });\n return result;\n }\n\n /**\n * Converts `set` to its value-value pairs.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the value-value pairs.\n */\n function setToPairs(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = [value, value];\n });\n return result;\n }\n\n /**\n * A specialized version of `_.indexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictIndexOf(array, value, fromIndex) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (array[index] === value) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * A specialized version of `_.lastIndexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictLastIndexOf(array, value, fromIndex) {\n var index = fromIndex + 1;\n while (index--) {\n if (array[index] === value) {\n return index;\n }\n }\n return index;\n }\n\n /**\n * Gets the number of symbols in `string`.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {number} Returns the string size.\n */\n function stringSize(string) {\n return hasUnicode(string)\n ? unicodeSize(string)\n : asciiSize(string);\n }\n\n /**\n * Converts `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function stringToArray(string) {\n return hasUnicode(string)\n ? unicodeToArray(string)\n : asciiToArray(string);\n }\n\n /**\n * Used by `_.trim` and `_.trimEnd` to get the index of the last non-whitespace\n * character of `string`.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {number} Returns the index of the last non-whitespace character.\n */\n function trimmedEndIndex(string) {\n var index = string.length;\n\n while (index-- && reWhitespace.test(string.charAt(index))) {}\n return index;\n }\n\n /**\n * Used by `_.unescape` to convert HTML entities to characters.\n *\n * @private\n * @param {string} chr The matched character to unescape.\n * @returns {string} Returns the unescaped character.\n */\n var unescapeHtmlChar = basePropertyOf(htmlUnescapes);\n\n /**\n * Gets the size of a Unicode `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n function unicodeSize(string) {\n var result = reUnicode.lastIndex = 0;\n while (reUnicode.test(string)) {\n ++result;\n }\n return result;\n }\n\n /**\n * Converts a Unicode `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function unicodeToArray(string) {\n return string.match(reUnicode) || [];\n }\n\n /**\n * Splits a Unicode `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function unicodeWords(string) {\n return string.match(reUnicodeWord) || [];\n }\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Create a new pristine `lodash` function using the `context` object.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Util\n * @param {Object} [context=root] The context object.\n * @returns {Function} Returns a new `lodash` function.\n * @example\n *\n * _.mixin({ 'foo': _.constant('foo') });\n *\n * var lodash = _.runInContext();\n * lodash.mixin({ 'bar': lodash.constant('bar') });\n *\n * _.isFunction(_.foo);\n * // => true\n * _.isFunction(_.bar);\n * // => false\n *\n * lodash.isFunction(lodash.foo);\n * // => false\n * lodash.isFunction(lodash.bar);\n * // => true\n *\n * // Create a suped-up `defer` in Node.js.\n * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;\n */\n var runInContext = (function runInContext(context) {\n context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));\n\n /** Built-in constructor references. */\n var Array = context.Array,\n Date = context.Date,\n Error = context.Error,\n Function = context.Function,\n Math = context.Math,\n Object = context.Object,\n RegExp = context.RegExp,\n String = context.String,\n TypeError = context.TypeError;\n\n /** Used for built-in method references. */\n var arrayProto = Array.prototype,\n funcProto = Function.prototype,\n objectProto = Object.prototype;\n\n /** Used to detect overreaching core-js shims. */\n var coreJsData = context['__core-js_shared__'];\n\n /** Used to resolve the decompiled source of functions. */\n var funcToString = funcProto.toString;\n\n /** Used to check objects for own properties. */\n var hasOwnProperty = objectProto.hasOwnProperty;\n\n /** Used to generate unique IDs. */\n var idCounter = 0;\n\n /** Used to detect methods masquerading as native. */\n var maskSrcKey = (function() {\n var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n return uid ? ('Symbol(src)_1.' + uid) : '';\n }());\n\n /**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\n var nativeObjectToString = objectProto.toString;\n\n /** Used to infer the `Object` constructor. */\n var objectCtorString = funcToString.call(Object);\n\n /** Used to restore the original `_` reference in `_.noConflict`. */\n var oldDash = root._;\n\n /** Used to detect if a method is native. */\n var reIsNative = RegExp('^' +\n funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n );\n\n /** Built-in value references. */\n var Buffer = moduleExports ? context.Buffer : undefined,\n Symbol = context.Symbol,\n Uint8Array = context.Uint8Array,\n allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,\n getPrototype = overArg(Object.getPrototypeOf, Object),\n objectCreate = Object.create,\n propertyIsEnumerable = objectProto.propertyIsEnumerable,\n splice = arrayProto.splice,\n spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,\n symIterator = Symbol ? Symbol.iterator : undefined,\n symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n var defineProperty = (function() {\n try {\n var func = getNative(Object, 'defineProperty');\n func({}, '', {});\n return func;\n } catch (e) {}\n }());\n\n /** Mocked built-ins. */\n var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,\n ctxNow = Date && Date.now !== root.Date.now && Date.now,\n ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;\n\n /* Built-in method references for those with the same name as other `lodash` methods. */\n var nativeCeil = Math.ceil,\n nativeFloor = Math.floor,\n nativeGetSymbols = Object.getOwnPropertySymbols,\n nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n nativeIsFinite = context.isFinite,\n nativeJoin = arrayProto.join,\n nativeKeys = overArg(Object.keys, Object),\n nativeMax = Math.max,\n nativeMin = Math.min,\n nativeNow = Date.now,\n nativeParseInt = context.parseInt,\n nativeRandom = Math.random,\n nativeReverse = arrayProto.reverse;\n\n /* Built-in method references that are verified to be native. */\n var DataView = getNative(context, 'DataView'),\n Map = getNative(context, 'Map'),\n Promise = getNative(context, 'Promise'),\n Set = getNative(context, 'Set'),\n WeakMap = getNative(context, 'WeakMap'),\n nativeCreate = getNative(Object, 'create');\n\n /** Used to store function metadata. */\n var metaMap = WeakMap && new WeakMap;\n\n /** Used to lookup unminified function names. */\n var realNames = {};\n\n /** Used to detect maps, sets, and weakmaps. */\n var dataViewCtorString = toSource(DataView),\n mapCtorString = toSource(Map),\n promiseCtorString = toSource(Promise),\n setCtorString = toSource(Set),\n weakMapCtorString = toSource(WeakMap);\n\n /** Used to convert symbols to primitives and strings. */\n var symbolProto = Symbol ? Symbol.prototype : undefined,\n symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,\n symbolToString = symbolProto ? symbolProto.toString : undefined;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` object which wraps `value` to enable implicit method\n * chain sequences. Methods that operate on and return arrays, collections,\n * and functions can be chained together. Methods that retrieve a single value\n * or may return a primitive value will automatically end the chain sequence\n * and return the unwrapped value. Otherwise, the value must be unwrapped\n * with `_#value`.\n *\n * Explicit chain sequences, which must be unwrapped with `_#value`, may be\n * enabled using `_.chain`.\n *\n * The execution of chained methods is lazy, that is, it's deferred until\n * `_#value` is implicitly or explicitly called.\n *\n * Lazy evaluation allows several methods to support shortcut fusion.\n * Shortcut fusion is an optimization to merge iteratee calls; this avoids\n * the creation of intermediate arrays and can greatly reduce the number of\n * iteratee executions. Sections of a chain sequence qualify for shortcut\n * fusion if the section is applied to an array and iteratees accept only\n * one argument. The heuristic for whether a section qualifies for shortcut\n * fusion is subject to change.\n *\n * Chaining is supported in custom builds as long as the `_#value` method is\n * directly or indirectly included in the build.\n *\n * In addition to lodash methods, wrappers have `Array` and `String` methods.\n *\n * The wrapper `Array` methods are:\n * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`\n *\n * The wrapper `String` methods are:\n * `replace` and `split`\n *\n * The wrapper methods that support shortcut fusion are:\n * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,\n * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,\n * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`\n *\n * The chainable wrapper methods are:\n * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,\n * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,\n * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,\n * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,\n * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,\n * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,\n * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,\n * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,\n * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,\n * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,\n * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,\n * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,\n * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,\n * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,\n * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,\n * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,\n * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,\n * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,\n * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,\n * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,\n * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,\n * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,\n * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,\n * `zipObject`, `zipObjectDeep`, and `zipWith`\n *\n * The wrapper methods that are **not** chainable by default are:\n * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,\n * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,\n * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,\n * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,\n * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,\n * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,\n * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,\n * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,\n * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,\n * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,\n * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,\n * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,\n * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,\n * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,\n * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,\n * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,\n * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,\n * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,\n * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,\n * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,\n * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,\n * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,\n * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,\n * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,\n * `upperFirst`, `value`, and `words`\n *\n * @name _\n * @constructor\n * @category Seq\n * @param {*} value The value to wrap in a `lodash` instance.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2, 3]);\n *\n * // Returns an unwrapped value.\n * wrapped.reduce(_.add);\n * // => 6\n *\n * // Returns a wrapped value.\n * var squares = wrapped.map(square);\n *\n * _.isArray(squares);\n * // => false\n *\n * _.isArray(squares.value());\n * // => true\n */\n function lodash(value) {\n if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {\n if (value instanceof LodashWrapper) {\n return value;\n }\n if (hasOwnProperty.call(value, '__wrapped__')) {\n return wrapperClone(value);\n }\n }\n return new LodashWrapper(value);\n }\n\n /**\n * The base implementation of `_.create` without support for assigning\n * properties to the created object.\n *\n * @private\n * @param {Object} proto The object to inherit from.\n * @returns {Object} Returns the new object.\n */\n var baseCreate = (function() {\n function object() {}\n return function(proto) {\n if (!isObject(proto)) {\n return {};\n }\n if (objectCreate) {\n return objectCreate(proto);\n }\n object.prototype = proto;\n var result = new object;\n object.prototype = undefined;\n return result;\n };\n }());\n\n /**\n * The function whose prototype chain sequence wrappers inherit from.\n *\n * @private\n */\n function baseLodash() {\n // No operation performed.\n }\n\n /**\n * The base constructor for creating `lodash` wrapper objects.\n *\n * @private\n * @param {*} value The value to wrap.\n * @param {boolean} [chainAll] Enable explicit method chain sequences.\n */\n function LodashWrapper(value, chainAll) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__chain__ = !!chainAll;\n this.__index__ = 0;\n this.__values__ = undefined;\n }\n\n /**\n * By default, the template delimiters used by lodash are like those in\n * embedded Ruby (ERB) as well as ES2015 template strings. Change the\n * following template settings to use alternative delimiters.\n *\n * @static\n * @memberOf _\n * @type {Object}\n */\n lodash.templateSettings = {\n\n /**\n * Used to detect `data` property values to be HTML-escaped.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'escape': reEscape,\n\n /**\n * Used to detect code to be evaluated.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'evaluate': reEvaluate,\n\n /**\n * Used to detect `data` property values to inject.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'interpolate': reInterpolate,\n\n /**\n * Used to reference the data object in the template text.\n *\n * @memberOf _.templateSettings\n * @type {string}\n */\n 'variable': '',\n\n /**\n * Used to import variables into the compiled template.\n *\n * @memberOf _.templateSettings\n * @type {Object}\n */\n 'imports': {\n\n /**\n * A reference to the `lodash` function.\n *\n * @memberOf _.templateSettings.imports\n * @type {Function}\n */\n '_': lodash\n }\n };\n\n // Ensure wrappers are instances of `baseLodash`.\n lodash.prototype = baseLodash.prototype;\n lodash.prototype.constructor = lodash;\n\n LodashWrapper.prototype = baseCreate(baseLodash.prototype);\n LodashWrapper.prototype.constructor = LodashWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.\n *\n * @private\n * @constructor\n * @param {*} value The value to wrap.\n */\n function LazyWrapper(value) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__dir__ = 1;\n this.__filtered__ = false;\n this.__iteratees__ = [];\n this.__takeCount__ = MAX_ARRAY_LENGTH;\n this.__views__ = [];\n }\n\n /**\n * Creates a clone of the lazy wrapper object.\n *\n * @private\n * @name clone\n * @memberOf LazyWrapper\n * @returns {Object} Returns the cloned `LazyWrapper` object.\n */\n function lazyClone() {\n var result = new LazyWrapper(this.__wrapped__);\n result.__actions__ = copyArray(this.__actions__);\n result.__dir__ = this.__dir__;\n result.__filtered__ = this.__filtered__;\n result.__iteratees__ = copyArray(this.__iteratees__);\n result.__takeCount__ = this.__takeCount__;\n result.__views__ = copyArray(this.__views__);\n return result;\n }\n\n /**\n * Reverses the direction of lazy iteration.\n *\n * @private\n * @name reverse\n * @memberOf LazyWrapper\n * @returns {Object} Returns the new reversed `LazyWrapper` object.\n */\n function lazyReverse() {\n if (this.__filtered__) {\n var result = new LazyWrapper(this);\n result.__dir__ = -1;\n result.__filtered__ = true;\n } else {\n result = this.clone();\n result.__dir__ *= -1;\n }\n return result;\n }\n\n /**\n * Extracts the unwrapped value from its lazy wrapper.\n *\n * @private\n * @name value\n * @memberOf LazyWrapper\n * @returns {*} Returns the unwrapped value.\n */\n function lazyValue() {\n var array = this.__wrapped__.value(),\n dir = this.__dir__,\n isArr = isArray(array),\n isRight = dir < 0,\n arrLength = isArr ? array.length : 0,\n view = getView(0, arrLength, this.__views__),\n start = view.start,\n end = view.end,\n length = end - start,\n index = isRight ? end : (start - 1),\n iteratees = this.__iteratees__,\n iterLength = iteratees.length,\n resIndex = 0,\n takeCount = nativeMin(length, this.__takeCount__);\n\n if (!isArr || (!isRight && arrLength == length && takeCount == length)) {\n return baseWrapperValue(array, this.__actions__);\n }\n var result = [];\n\n outer:\n while (length-- && resIndex < takeCount) {\n index += dir;\n\n var iterIndex = -1,\n value = array[index];\n\n while (++iterIndex < iterLength) {\n var data = iteratees[iterIndex],\n iteratee = data.iteratee,\n type = data.type,\n computed = iteratee(value);\n\n if (type == LAZY_MAP_FLAG) {\n value = computed;\n } else if (!computed) {\n if (type == LAZY_FILTER_FLAG) {\n continue outer;\n } else {\n break outer;\n }\n }\n }\n result[resIndex++] = value;\n }\n return result;\n }\n\n // Ensure `LazyWrapper` is an instance of `baseLodash`.\n LazyWrapper.prototype = baseCreate(baseLodash.prototype);\n LazyWrapper.prototype.constructor = LazyWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Hash(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\n function hashClear() {\n this.__data__ = nativeCreate ? nativeCreate(null) : {};\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function hashDelete(key) {\n var result = this.has(key) && delete this.__data__[key];\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function hashGet(key) {\n var data = this.__data__;\n if (nativeCreate) {\n var result = data[key];\n return result === HASH_UNDEFINED ? undefined : result;\n }\n return hasOwnProperty.call(data, key) ? data[key] : undefined;\n }\n\n /**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function hashHas(key) {\n var data = this.__data__;\n return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n }\n\n /**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\n function hashSet(key, value) {\n var data = this.__data__;\n this.size += this.has(key) ? 0 : 1;\n data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n return this;\n }\n\n // Add methods to `Hash`.\n Hash.prototype.clear = hashClear;\n Hash.prototype['delete'] = hashDelete;\n Hash.prototype.get = hashGet;\n Hash.prototype.has = hashHas;\n Hash.prototype.set = hashSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\n function listCacheClear() {\n this.__data__ = [];\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function listCacheDelete(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n return false;\n }\n var lastIndex = data.length - 1;\n if (index == lastIndex) {\n data.pop();\n } else {\n splice.call(data, index, 1);\n }\n --this.size;\n return true;\n }\n\n /**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function listCacheGet(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n return index < 0 ? undefined : data[index][1];\n }\n\n /**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function listCacheHas(key) {\n return assocIndexOf(this.__data__, key) > -1;\n }\n\n /**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\n function listCacheSet(key, value) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n ++this.size;\n data.push([key, value]);\n } else {\n data[index][1] = value;\n }\n return this;\n }\n\n // Add methods to `ListCache`.\n ListCache.prototype.clear = listCacheClear;\n ListCache.prototype['delete'] = listCacheDelete;\n ListCache.prototype.get = listCacheGet;\n ListCache.prototype.has = listCacheHas;\n ListCache.prototype.set = listCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function MapCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\n function mapCacheClear() {\n this.size = 0;\n this.__data__ = {\n 'hash': new Hash,\n 'map': new (Map || ListCache),\n 'string': new Hash\n };\n }\n\n /**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function mapCacheDelete(key) {\n var result = getMapData(this, key)['delete'](key);\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function mapCacheGet(key) {\n return getMapData(this, key).get(key);\n }\n\n /**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function mapCacheHas(key) {\n return getMapData(this, key).has(key);\n }\n\n /**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\n function mapCacheSet(key, value) {\n var data = getMapData(this, key),\n size = data.size;\n\n data.set(key, value);\n this.size += data.size == size ? 0 : 1;\n return this;\n }\n\n // Add methods to `MapCache`.\n MapCache.prototype.clear = mapCacheClear;\n MapCache.prototype['delete'] = mapCacheDelete;\n MapCache.prototype.get = mapCacheGet;\n MapCache.prototype.has = mapCacheHas;\n MapCache.prototype.set = mapCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\n function SetCache(values) {\n var index = -1,\n length = values == null ? 0 : values.length;\n\n this.__data__ = new MapCache;\n while (++index < length) {\n this.add(values[index]);\n }\n }\n\n /**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\n function setCacheAdd(value) {\n this.__data__.set(value, HASH_UNDEFINED);\n return this;\n }\n\n /**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\n function setCacheHas(value) {\n return this.__data__.has(value);\n }\n\n // Add methods to `SetCache`.\n SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\n SetCache.prototype.has = setCacheHas;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Stack(entries) {\n var data = this.__data__ = new ListCache(entries);\n this.size = data.size;\n }\n\n /**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\n function stackClear() {\n this.__data__ = new ListCache;\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function stackDelete(key) {\n var data = this.__data__,\n result = data['delete'](key);\n\n this.size = data.size;\n return result;\n }\n\n /**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function stackGet(key) {\n return this.__data__.get(key);\n }\n\n /**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function stackHas(key) {\n return this.__data__.has(key);\n }\n\n /**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\n function stackSet(key, value) {\n var data = this.__data__;\n if (data instanceof ListCache) {\n var pairs = data.__data__;\n if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n pairs.push([key, value]);\n this.size = ++data.size;\n return this;\n }\n data = this.__data__ = new MapCache(pairs);\n }\n data.set(key, value);\n this.size = data.size;\n return this;\n }\n\n // Add methods to `Stack`.\n Stack.prototype.clear = stackClear;\n Stack.prototype['delete'] = stackDelete;\n Stack.prototype.get = stackGet;\n Stack.prototype.has = stackHas;\n Stack.prototype.set = stackSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\n function arrayLikeKeys(value, inherited) {\n var isArr = isArray(value),\n isArg = !isArr && isArguments(value),\n isBuff = !isArr && !isArg && isBuffer(value),\n isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n skipIndexes = isArr || isArg || isBuff || isType,\n result = skipIndexes ? baseTimes(value.length, String) : [],\n length = result.length;\n\n for (var key in value) {\n if ((inherited || hasOwnProperty.call(value, key)) &&\n !(skipIndexes && (\n // Safari 9 has enumerable `arguments.length` in strict mode.\n key == 'length' ||\n // Node.js 0.10 has enumerable non-index properties on buffers.\n (isBuff && (key == 'offset' || key == 'parent')) ||\n // PhantomJS 2 has enumerable non-index properties on typed arrays.\n (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n // Skip index properties.\n isIndex(key, length)\n ))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.sample` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @returns {*} Returns the random element.\n */\n function arraySample(array) {\n var length = array.length;\n return length ? array[baseRandom(0, length - 1)] : undefined;\n }\n\n /**\n * A specialized version of `_.sampleSize` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function arraySampleSize(array, n) {\n return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));\n }\n\n /**\n * A specialized version of `_.shuffle` for arrays.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function arrayShuffle(array) {\n return shuffleSelf(copyArray(array));\n }\n\n /**\n * This function is like `assignValue` except that it doesn't assign\n * `undefined` values.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignMergeValue(object, key, value) {\n if ((value !== undefined && !eq(object[key], value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Assigns `value` to `key` of `object` if the existing value is not equivalent\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignValue(object, key, value) {\n var objValue = object[key];\n if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n }\n\n /**\n * Aggregates elements of `collection` on `accumulator` with keys transformed\n * by `iteratee` and values set by `setter`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseAggregator(collection, setter, iteratee, accumulator) {\n baseEach(collection, function(value, key, collection) {\n setter(accumulator, value, iteratee(value), collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.assign` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssign(object, source) {\n return object && copyObject(source, keys(source), object);\n }\n\n /**\n * The base implementation of `_.assignIn` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssignIn(object, source) {\n return object && copyObject(source, keysIn(source), object);\n }\n\n /**\n * The base implementation of `assignValue` and `assignMergeValue` without\n * value checks.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function baseAssignValue(object, key, value) {\n if (key == '__proto__' && defineProperty) {\n defineProperty(object, key, {\n 'configurable': true,\n 'enumerable': true,\n 'value': value,\n 'writable': true\n });\n } else {\n object[key] = value;\n }\n }\n\n /**\n * The base implementation of `_.at` without support for individual paths.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {string[]} paths The property paths to pick.\n * @returns {Array} Returns the picked elements.\n */\n function baseAt(object, paths) {\n var index = -1,\n length = paths.length,\n result = Array(length),\n skip = object == null;\n\n while (++index < length) {\n result[index] = skip ? undefined : get(object, paths[index]);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.clamp` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n */\n function baseClamp(number, lower, upper) {\n if (number === number) {\n if (upper !== undefined) {\n number = number <= upper ? number : upper;\n }\n if (lower !== undefined) {\n number = number >= lower ? number : lower;\n }\n }\n return number;\n }\n\n /**\n * The base implementation of `_.clone` and `_.cloneDeep` which tracks\n * traversed objects.\n *\n * @private\n * @param {*} value The value to clone.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Deep clone\n * 2 - Flatten inherited properties\n * 4 - Clone symbols\n * @param {Function} [customizer] The function to customize cloning.\n * @param {string} [key] The key of `value`.\n * @param {Object} [object] The parent object of `value`.\n * @param {Object} [stack] Tracks traversed objects and their clone counterparts.\n * @returns {*} Returns the cloned value.\n */\n function baseClone(value, bitmask, customizer, key, object, stack) {\n var result,\n isDeep = bitmask & CLONE_DEEP_FLAG,\n isFlat = bitmask & CLONE_FLAT_FLAG,\n isFull = bitmask & CLONE_SYMBOLS_FLAG;\n\n if (customizer) {\n result = object ? customizer(value, key, object, stack) : customizer(value);\n }\n if (result !== undefined) {\n return result;\n }\n if (!isObject(value)) {\n return value;\n }\n var isArr = isArray(value);\n if (isArr) {\n result = initCloneArray(value);\n if (!isDeep) {\n return copyArray(value, result);\n }\n } else {\n var tag = getTag(value),\n isFunc = tag == funcTag || tag == genTag;\n\n if (isBuffer(value)) {\n return cloneBuffer(value, isDeep);\n }\n if (tag == objectTag || tag == argsTag || (isFunc && !object)) {\n result = (isFlat || isFunc) ? {} : initCloneObject(value);\n if (!isDeep) {\n return isFlat\n ? copySymbolsIn(value, baseAssignIn(result, value))\n : copySymbols(value, baseAssign(result, value));\n }\n } else {\n if (!cloneableTags[tag]) {\n return object ? value : {};\n }\n result = initCloneByTag(value, tag, isDeep);\n }\n }\n // Check for circular references and return its corresponding clone.\n stack || (stack = new Stack);\n var stacked = stack.get(value);\n if (stacked) {\n return stacked;\n }\n stack.set(value, result);\n\n if (isSet(value)) {\n value.forEach(function(subValue) {\n result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));\n });\n } else if (isMap(value)) {\n value.forEach(function(subValue, key) {\n result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n }\n\n var keysFunc = isFull\n ? (isFlat ? getAllKeysIn : getAllKeys)\n : (isFlat ? keysIn : keys);\n\n var props = isArr ? undefined : keysFunc(value);\n arrayEach(props || value, function(subValue, key) {\n if (props) {\n key = subValue;\n subValue = value[key];\n }\n // Recursively populate clone (susceptible to call stack limits).\n assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n return result;\n }\n\n /**\n * The base implementation of `_.conforms` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property predicates to conform to.\n * @returns {Function} Returns the new spec function.\n */\n function baseConforms(source) {\n var props = keys(source);\n return function(object) {\n return baseConformsTo(object, source, props);\n };\n }\n\n /**\n * The base implementation of `_.conformsTo` which accepts `props` to check.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n */\n function baseConformsTo(object, source, props) {\n var length = props.length;\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (length--) {\n var key = props[length],\n predicate = source[key],\n value = object[key];\n\n if ((value === undefined && !(key in object)) || !predicate(value)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.delay` and `_.defer` which accepts `args`\n * to provide to `func`.\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {Array} args The arguments to provide to `func`.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n function baseDelay(func, wait, args) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return setTimeout(function() { func.apply(undefined, args); }, wait);\n }\n\n /**\n * The base implementation of methods like `_.difference` without support\n * for excluding multiple arrays or iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Array} values The values to exclude.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n */\n function baseDifference(array, values, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n isCommon = true,\n length = array.length,\n result = [],\n valuesLength = values.length;\n\n if (!length) {\n return result;\n }\n if (iteratee) {\n values = arrayMap(values, baseUnary(iteratee));\n }\n if (comparator) {\n includes = arrayIncludesWith;\n isCommon = false;\n }\n else if (values.length >= LARGE_ARRAY_SIZE) {\n includes = cacheHas;\n isCommon = false;\n values = new SetCache(values);\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee == null ? value : iteratee(value);\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var valuesIndex = valuesLength;\n while (valuesIndex--) {\n if (values[valuesIndex] === computed) {\n continue outer;\n }\n }\n result.push(value);\n }\n else if (!includes(values, computed, comparator)) {\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.forEach` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEach = createBaseEach(baseForOwn);\n\n /**\n * The base implementation of `_.forEachRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEachRight = createBaseEach(baseForOwnRight, true);\n\n /**\n * The base implementation of `_.every` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`\n */\n function baseEvery(collection, predicate) {\n var result = true;\n baseEach(collection, function(value, index, collection) {\n result = !!predicate(value, index, collection);\n return result;\n });\n return result;\n }\n\n /**\n * The base implementation of methods like `_.max` and `_.min` which accepts a\n * `comparator` to determine the extremum value.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The iteratee invoked per iteration.\n * @param {Function} comparator The comparator used to compare values.\n * @returns {*} Returns the extremum value.\n */\n function baseExtremum(array, iteratee, comparator) {\n var index = -1,\n length = array.length;\n\n while (++index < length) {\n var value = array[index],\n current = iteratee(value);\n\n if (current != null && (computed === undefined\n ? (current === current && !isSymbol(current))\n : comparator(current, computed)\n )) {\n var computed = current,\n result = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.fill` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n */\n function baseFill(array, value, start, end) {\n var length = array.length;\n\n start = toInteger(start);\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = (end === undefined || end > length) ? length : toInteger(end);\n if (end < 0) {\n end += length;\n }\n end = start > end ? 0 : toLength(end);\n while (start < end) {\n array[start++] = value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.filter` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function baseFilter(collection, predicate) {\n var result = [];\n baseEach(collection, function(value, index, collection) {\n if (predicate(value, index, collection)) {\n result.push(value);\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.flatten` with support for restricting flattening.\n *\n * @private\n * @param {Array} array The array to flatten.\n * @param {number} depth The maximum recursion depth.\n * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.\n * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.\n * @param {Array} [result=[]] The initial result value.\n * @returns {Array} Returns the new flattened array.\n */\n function baseFlatten(array, depth, predicate, isStrict, result) {\n var index = -1,\n length = array.length;\n\n predicate || (predicate = isFlattenable);\n result || (result = []);\n\n while (++index < length) {\n var value = array[index];\n if (depth > 0 && predicate(value)) {\n if (depth > 1) {\n // Recursively flatten arrays (susceptible to call stack limits).\n baseFlatten(value, depth - 1, predicate, isStrict, result);\n } else {\n arrayPush(result, value);\n }\n } else if (!isStrict) {\n result[result.length] = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `baseForOwn` which iterates over `object`\n * properties returned by `keysFunc` and invokes `iteratee` for each property.\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseFor = createBaseFor();\n\n /**\n * This function is like `baseFor` except that it iterates over properties\n * in the opposite order.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseForRight = createBaseFor(true);\n\n /**\n * The base implementation of `_.forOwn` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwn(object, iteratee) {\n return object && baseFor(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.forOwnRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwnRight(object, iteratee) {\n return object && baseForRight(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.functions` which creates an array of\n * `object` function property names filtered from `props`.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Array} props The property names to filter.\n * @returns {Array} Returns the function names.\n */\n function baseFunctions(object, props) {\n return arrayFilter(props, function(key) {\n return isFunction(object[key]);\n });\n }\n\n /**\n * The base implementation of `_.get` without support for default values.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @returns {*} Returns the resolved value.\n */\n function baseGet(object, path) {\n path = castPath(path, object);\n\n var index = 0,\n length = path.length;\n\n while (object != null && index < length) {\n object = object[toKey(path[index++])];\n }\n return (index && index == length) ? object : undefined;\n }\n\n /**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function baseGetAllKeys(object, keysFunc, symbolsFunc) {\n var result = keysFunc(object);\n return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n }\n\n /**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n function baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n }\n\n /**\n * The base implementation of `_.gt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n */\n function baseGt(value, other) {\n return value > other;\n }\n\n /**\n * The base implementation of `_.has` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHas(object, key) {\n return object != null && hasOwnProperty.call(object, key);\n }\n\n /**\n * The base implementation of `_.hasIn` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHasIn(object, key) {\n return object != null && key in Object(object);\n }\n\n /**\n * The base implementation of `_.inRange` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to check.\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n */\n function baseInRange(number, start, end) {\n return number >= nativeMin(start, end) && number < nativeMax(start, end);\n }\n\n /**\n * The base implementation of methods like `_.intersection`, without support\n * for iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of shared values.\n */\n function baseIntersection(arrays, iteratee, comparator) {\n var includes = comparator ? arrayIncludesWith : arrayIncludes,\n length = arrays[0].length,\n othLength = arrays.length,\n othIndex = othLength,\n caches = Array(othLength),\n maxLength = Infinity,\n result = [];\n\n while (othIndex--) {\n var array = arrays[othIndex];\n if (othIndex && iteratee) {\n array = arrayMap(array, baseUnary(iteratee));\n }\n maxLength = nativeMin(array.length, maxLength);\n caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))\n ? new SetCache(othIndex && array)\n : undefined;\n }\n array = arrays[0];\n\n var index = -1,\n seen = caches[0];\n\n outer:\n while (++index < length && result.length < maxLength) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (!(seen\n ? cacheHas(seen, computed)\n : includes(result, computed, comparator)\n )) {\n othIndex = othLength;\n while (--othIndex) {\n var cache = caches[othIndex];\n if (!(cache\n ? cacheHas(cache, computed)\n : includes(arrays[othIndex], computed, comparator))\n ) {\n continue outer;\n }\n }\n if (seen) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.invert` and `_.invertBy` which inverts\n * `object` with values transformed by `iteratee` and set by `setter`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform values.\n * @param {Object} accumulator The initial inverted object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseInverter(object, setter, iteratee, accumulator) {\n baseForOwn(object, function(value, key, object) {\n setter(accumulator, iteratee(value), key, object);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.invoke` without support for individual\n * method arguments.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {Array} args The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n */\n function baseInvoke(object, path, args) {\n path = castPath(path, object);\n object = parent(object, path);\n var func = object == null ? object : object[toKey(last(path))];\n return func == null ? undefined : apply(func, object, args);\n }\n\n /**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\n function baseIsArguments(value) {\n return isObjectLike(value) && baseGetTag(value) == argsTag;\n }\n\n /**\n * The base implementation of `_.isArrayBuffer` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n */\n function baseIsArrayBuffer(value) {\n return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;\n }\n\n /**\n * The base implementation of `_.isDate` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n */\n function baseIsDate(value) {\n return isObjectLike(value) && baseGetTag(value) == dateTag;\n }\n\n /**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Unordered comparison\n * 2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\n function baseIsEqual(value, other, bitmask, customizer, stack) {\n if (value === other) {\n return true;\n }\n if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n return value !== value && other !== other;\n }\n return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n }\n\n /**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n var objIsArr = isArray(object),\n othIsArr = isArray(other),\n objTag = objIsArr ? arrayTag : getTag(object),\n othTag = othIsArr ? arrayTag : getTag(other);\n\n objTag = objTag == argsTag ? objectTag : objTag;\n othTag = othTag == argsTag ? objectTag : othTag;\n\n var objIsObj = objTag == objectTag,\n othIsObj = othTag == objectTag,\n isSameTag = objTag == othTag;\n\n if (isSameTag && isBuffer(object)) {\n if (!isBuffer(other)) {\n return false;\n }\n objIsArr = true;\n objIsObj = false;\n }\n if (isSameTag && !objIsObj) {\n stack || (stack = new Stack);\n return (objIsArr || isTypedArray(object))\n ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n }\n if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n if (objIsWrapped || othIsWrapped) {\n var objUnwrapped = objIsWrapped ? object.value() : object,\n othUnwrapped = othIsWrapped ? other.value() : other;\n\n stack || (stack = new Stack);\n return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n }\n }\n if (!isSameTag) {\n return false;\n }\n stack || (stack = new Stack);\n return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n }\n\n /**\n * The base implementation of `_.isMap` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n */\n function baseIsMap(value) {\n return isObjectLike(value) && getTag(value) == mapTag;\n }\n\n /**\n * The base implementation of `_.isMatch` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Array} matchData The property names, values, and compare flags to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n */\n function baseIsMatch(object, source, matchData, customizer) {\n var index = matchData.length,\n length = index,\n noCustomizer = !customizer;\n\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (index--) {\n var data = matchData[index];\n if ((noCustomizer && data[2])\n ? data[1] !== object[data[0]]\n : !(data[0] in object)\n ) {\n return false;\n }\n }\n while (++index < length) {\n data = matchData[index];\n var key = data[0],\n objValue = object[key],\n srcValue = data[1];\n\n if (noCustomizer && data[2]) {\n if (objValue === undefined && !(key in object)) {\n return false;\n }\n } else {\n var stack = new Stack;\n if (customizer) {\n var result = customizer(objValue, srcValue, key, object, source, stack);\n }\n if (!(result === undefined\n ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)\n : result\n )) {\n return false;\n }\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n */\n function baseIsNative(value) {\n if (!isObject(value) || isMasked(value)) {\n return false;\n }\n var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n return pattern.test(toSource(value));\n }\n\n /**\n * The base implementation of `_.isRegExp` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n */\n function baseIsRegExp(value) {\n return isObjectLike(value) && baseGetTag(value) == regexpTag;\n }\n\n /**\n * The base implementation of `_.isSet` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n */\n function baseIsSet(value) {\n return isObjectLike(value) && getTag(value) == setTag;\n }\n\n /**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\n function baseIsTypedArray(value) {\n return isObjectLike(value) &&\n isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n }\n\n /**\n * The base implementation of `_.iteratee`.\n *\n * @private\n * @param {*} [value=_.identity] The value to convert to an iteratee.\n * @returns {Function} Returns the iteratee.\n */\n function baseIteratee(value) {\n // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.\n // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.\n if (typeof value == 'function') {\n return value;\n }\n if (value == null) {\n return identity;\n }\n if (typeof value == 'object') {\n return isArray(value)\n ? baseMatchesProperty(value[0], value[1])\n : baseMatches(value);\n }\n return property(value);\n }\n\n /**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeys(object) {\n if (!isPrototype(object)) {\n return nativeKeys(object);\n }\n var result = [];\n for (var key in Object(object)) {\n if (hasOwnProperty.call(object, key) && key != 'constructor') {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeysIn(object) {\n if (!isObject(object)) {\n return nativeKeysIn(object);\n }\n var isProto = isPrototype(object),\n result = [];\n\n for (var key in object) {\n if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.lt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n */\n function baseLt(value, other) {\n return value < other;\n }\n\n /**\n * The base implementation of `_.map` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function baseMap(collection, iteratee) {\n var index = -1,\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value, key, collection) {\n result[++index] = iteratee(value, key, collection);\n });\n return result;\n }\n\n /**\n * The base implementation of `_.matches` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property values to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatches(source) {\n var matchData = getMatchData(source);\n if (matchData.length == 1 && matchData[0][2]) {\n return matchesStrictComparable(matchData[0][0], matchData[0][1]);\n }\n return function(object) {\n return object === source || baseIsMatch(object, source, matchData);\n };\n }\n\n /**\n * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.\n *\n * @private\n * @param {string} path The path of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatchesProperty(path, srcValue) {\n if (isKey(path) && isStrictComparable(srcValue)) {\n return matchesStrictComparable(toKey(path), srcValue);\n }\n return function(object) {\n var objValue = get(object, path);\n return (objValue === undefined && objValue === srcValue)\n ? hasIn(object, path)\n : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);\n };\n }\n\n /**\n * The base implementation of `_.merge` without support for multiple sources.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} [customizer] The function to customize merged values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMerge(object, source, srcIndex, customizer, stack) {\n if (object === source) {\n return;\n }\n baseFor(source, function(srcValue, key) {\n stack || (stack = new Stack);\n if (isObject(srcValue)) {\n baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);\n }\n else {\n var newValue = customizer\n ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)\n : undefined;\n\n if (newValue === undefined) {\n newValue = srcValue;\n }\n assignMergeValue(object, key, newValue);\n }\n }, keysIn);\n }\n\n /**\n * A specialized version of `baseMerge` for arrays and objects which performs\n * deep merges and tracks traversed objects enabling objects with circular\n * references to be merged.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {string} key The key of the value to merge.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} mergeFunc The function to merge values.\n * @param {Function} [customizer] The function to customize assigned values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {\n var objValue = safeGet(object, key),\n srcValue = safeGet(source, key),\n stacked = stack.get(srcValue);\n\n if (stacked) {\n assignMergeValue(object, key, stacked);\n return;\n }\n var newValue = customizer\n ? customizer(objValue, srcValue, (key + ''), object, source, stack)\n : undefined;\n\n var isCommon = newValue === undefined;\n\n if (isCommon) {\n var isArr = isArray(srcValue),\n isBuff = !isArr && isBuffer(srcValue),\n isTyped = !isArr && !isBuff && isTypedArray(srcValue);\n\n newValue = srcValue;\n if (isArr || isBuff || isTyped) {\n if (isArray(objValue)) {\n newValue = objValue;\n }\n else if (isArrayLikeObject(objValue)) {\n newValue = copyArray(objValue);\n }\n else if (isBuff) {\n isCommon = false;\n newValue = cloneBuffer(srcValue, true);\n }\n else if (isTyped) {\n isCommon = false;\n newValue = cloneTypedArray(srcValue, true);\n }\n else {\n newValue = [];\n }\n }\n else if (isPlainObject(srcValue) || isArguments(srcValue)) {\n newValue = objValue;\n if (isArguments(objValue)) {\n newValue = toPlainObject(objValue);\n }\n else if (!isObject(objValue) || isFunction(objValue)) {\n newValue = initCloneObject(srcValue);\n }\n }\n else {\n isCommon = false;\n }\n }\n if (isCommon) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, newValue);\n mergeFunc(newValue, srcValue, srcIndex, customizer, stack);\n stack['delete'](srcValue);\n }\n assignMergeValue(object, key, newValue);\n }\n\n /**\n * The base implementation of `_.nth` which doesn't coerce arguments.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {number} n The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n */\n function baseNth(array, n) {\n var length = array.length;\n if (!length) {\n return;\n }\n n += n < 0 ? length : 0;\n return isIndex(n, length) ? array[n] : undefined;\n }\n\n /**\n * The base implementation of `_.orderBy` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.\n * @param {string[]} orders The sort orders of `iteratees`.\n * @returns {Array} Returns the new sorted array.\n */\n function baseOrderBy(collection, iteratees, orders) {\n if (iteratees.length) {\n iteratees = arrayMap(iteratees, function(iteratee) {\n if (isArray(iteratee)) {\n return function(value) {\n return baseGet(value, iteratee.length === 1 ? iteratee[0] : iteratee);\n }\n }\n return iteratee;\n });\n } else {\n iteratees = [identity];\n }\n\n var index = -1;\n iteratees = arrayMap(iteratees, baseUnary(getIteratee()));\n\n var result = baseMap(collection, function(value, key, collection) {\n var criteria = arrayMap(iteratees, function(iteratee) {\n return iteratee(value);\n });\n return { 'criteria': criteria, 'index': ++index, 'value': value };\n });\n\n return baseSortBy(result, function(object, other) {\n return compareMultiple(object, other, orders);\n });\n }\n\n /**\n * The base implementation of `_.pick` without support for individual\n * property identifiers.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @returns {Object} Returns the new object.\n */\n function basePick(object, paths) {\n return basePickBy(object, paths, function(value, path) {\n return hasIn(object, path);\n });\n }\n\n /**\n * The base implementation of `_.pickBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @param {Function} predicate The function invoked per property.\n * @returns {Object} Returns the new object.\n */\n function basePickBy(object, paths, predicate) {\n var index = -1,\n length = paths.length,\n result = {};\n\n while (++index < length) {\n var path = paths[index],\n value = baseGet(object, path);\n\n if (predicate(value, path)) {\n baseSet(result, castPath(path, object), value);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `baseProperty` which supports deep paths.\n *\n * @private\n * @param {Array|string} path The path of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyDeep(path) {\n return function(object) {\n return baseGet(object, path);\n };\n }\n\n /**\n * The base implementation of `_.pullAllBy` without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n */\n function basePullAll(array, values, iteratee, comparator) {\n var indexOf = comparator ? baseIndexOfWith : baseIndexOf,\n index = -1,\n length = values.length,\n seen = array;\n\n if (array === values) {\n values = copyArray(values);\n }\n if (iteratee) {\n seen = arrayMap(array, baseUnary(iteratee));\n }\n while (++index < length) {\n var fromIndex = 0,\n value = values[index],\n computed = iteratee ? iteratee(value) : value;\n\n while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {\n if (seen !== array) {\n splice.call(seen, fromIndex, 1);\n }\n splice.call(array, fromIndex, 1);\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.pullAt` without support for individual\n * indexes or capturing the removed elements.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {number[]} indexes The indexes of elements to remove.\n * @returns {Array} Returns `array`.\n */\n function basePullAt(array, indexes) {\n var length = array ? indexes.length : 0,\n lastIndex = length - 1;\n\n while (length--) {\n var index = indexes[length];\n if (length == lastIndex || index !== previous) {\n var previous = index;\n if (isIndex(index)) {\n splice.call(array, index, 1);\n } else {\n baseUnset(array, index);\n }\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.random` without support for returning\n * floating-point numbers.\n *\n * @private\n * @param {number} lower The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the random number.\n */\n function baseRandom(lower, upper) {\n return lower + nativeFloor(nativeRandom() * (upper - lower + 1));\n }\n\n /**\n * The base implementation of `_.range` and `_.rangeRight` which doesn't\n * coerce arguments.\n *\n * @private\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @param {number} step The value to increment or decrement by.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the range of numbers.\n */\n function baseRange(start, end, step, fromRight) {\n var index = -1,\n length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),\n result = Array(length);\n\n while (length--) {\n result[fromRight ? length : ++index] = start;\n start += step;\n }\n return result;\n }\n\n /**\n * The base implementation of `_.repeat` which doesn't coerce arguments.\n *\n * @private\n * @param {string} string The string to repeat.\n * @param {number} n The number of times to repeat the string.\n * @returns {string} Returns the repeated string.\n */\n function baseRepeat(string, n) {\n var result = '';\n if (!string || n < 1 || n > MAX_SAFE_INTEGER) {\n return result;\n }\n // Leverage the exponentiation by squaring algorithm for a faster repeat.\n // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.\n do {\n if (n % 2) {\n result += string;\n }\n n = nativeFloor(n / 2);\n if (n) {\n string += string;\n }\n } while (n);\n\n return result;\n }\n\n /**\n * The base implementation of `_.rest` which doesn't validate or coerce arguments.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n */\n function baseRest(func, start) {\n return setToString(overRest(func, start, identity), func + '');\n }\n\n /**\n * The base implementation of `_.sample`.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n */\n function baseSample(collection) {\n return arraySample(values(collection));\n }\n\n /**\n * The base implementation of `_.sampleSize` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function baseSampleSize(collection, n) {\n var array = values(collection);\n return shuffleSelf(array, baseClamp(n, 0, array.length));\n }\n\n /**\n * The base implementation of `_.set`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseSet(object, path, value, customizer) {\n if (!isObject(object)) {\n return object;\n }\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n lastIndex = length - 1,\n nested = object;\n\n while (nested != null && ++index < length) {\n var key = toKey(path[index]),\n newValue = value;\n\n if (key === '__proto__' || key === 'constructor' || key === 'prototype') {\n return object;\n }\n\n if (index != lastIndex) {\n var objValue = nested[key];\n newValue = customizer ? customizer(objValue, key, nested) : undefined;\n if (newValue === undefined) {\n newValue = isObject(objValue)\n ? objValue\n : (isIndex(path[index + 1]) ? [] : {});\n }\n }\n assignValue(nested, key, newValue);\n nested = nested[key];\n }\n return object;\n }\n\n /**\n * The base implementation of `setData` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var baseSetData = !metaMap ? identity : function(func, data) {\n metaMap.set(func, data);\n return func;\n };\n\n /**\n * The base implementation of `setToString` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var baseSetToString = !defineProperty ? identity : function(func, string) {\n return defineProperty(func, 'toString', {\n 'configurable': true,\n 'enumerable': false,\n 'value': constant(string),\n 'writable': true\n });\n };\n\n /**\n * The base implementation of `_.shuffle`.\n *\n * @private\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function baseShuffle(collection) {\n return shuffleSelf(values(collection));\n }\n\n /**\n * The base implementation of `_.slice` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseSlice(array, start, end) {\n var index = -1,\n length = array.length;\n\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = end > length ? length : end;\n if (end < 0) {\n end += length;\n }\n length = start > end ? 0 : ((end - start) >>> 0);\n start >>>= 0;\n\n var result = Array(length);\n while (++index < length) {\n result[index] = array[index + start];\n }\n return result;\n }\n\n /**\n * The base implementation of `_.some` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function baseSome(collection, predicate) {\n var result;\n\n baseEach(collection, function(value, index, collection) {\n result = predicate(value, index, collection);\n return !result;\n });\n return !!result;\n }\n\n /**\n * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which\n * performs a binary search of `array` to determine the index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndex(array, value, retHighest) {\n var low = 0,\n high = array == null ? low : array.length;\n\n if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {\n while (low < high) {\n var mid = (low + high) >>> 1,\n computed = array[mid];\n\n if (computed !== null && !isSymbol(computed) &&\n (retHighest ? (computed <= value) : (computed < value))) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return high;\n }\n return baseSortedIndexBy(array, value, identity, retHighest);\n }\n\n /**\n * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`\n * which invokes `iteratee` for `value` and each element of `array` to compute\n * their sort ranking. The iteratee is invoked with one argument; (value).\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} iteratee The iteratee invoked per element.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndexBy(array, value, iteratee, retHighest) {\n var low = 0,\n high = array == null ? 0 : array.length;\n if (high === 0) {\n return 0;\n }\n\n value = iteratee(value);\n var valIsNaN = value !== value,\n valIsNull = value === null,\n valIsSymbol = isSymbol(value),\n valIsUndefined = value === undefined;\n\n while (low < high) {\n var mid = nativeFloor((low + high) / 2),\n computed = iteratee(array[mid]),\n othIsDefined = computed !== undefined,\n othIsNull = computed === null,\n othIsReflexive = computed === computed,\n othIsSymbol = isSymbol(computed);\n\n if (valIsNaN) {\n var setLow = retHighest || othIsReflexive;\n } else if (valIsUndefined) {\n setLow = othIsReflexive && (retHighest || othIsDefined);\n } else if (valIsNull) {\n setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);\n } else if (valIsSymbol) {\n setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);\n } else if (othIsNull || othIsSymbol) {\n setLow = false;\n } else {\n setLow = retHighest ? (computed <= value) : (computed < value);\n }\n if (setLow) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return nativeMin(high, MAX_ARRAY_INDEX);\n }\n\n /**\n * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseSortedUniq(array, iteratee) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n if (!index || !eq(computed, seen)) {\n var seen = computed;\n result[resIndex++] = value === 0 ? 0 : value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toNumber` which doesn't ensure correct\n * conversions of binary, hexadecimal, or octal string values.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n */\n function baseToNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n return +value;\n }\n\n /**\n * The base implementation of `_.toString` which doesn't convert nullish\n * values to empty strings.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n */\n function baseToString(value) {\n // Exit early for strings to avoid a performance hit in some environments.\n if (typeof value == 'string') {\n return value;\n }\n if (isArray(value)) {\n // Recursively convert values (susceptible to call stack limits).\n return arrayMap(value, baseToString) + '';\n }\n if (isSymbol(value)) {\n return symbolToString ? symbolToString.call(value) : '';\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * The base implementation of `_.uniqBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseUniq(array, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n length = array.length,\n isCommon = true,\n result = [],\n seen = result;\n\n if (comparator) {\n isCommon = false;\n includes = arrayIncludesWith;\n }\n else if (length >= LARGE_ARRAY_SIZE) {\n var set = iteratee ? null : createSet(array);\n if (set) {\n return setToArray(set);\n }\n isCommon = false;\n includes = cacheHas;\n seen = new SetCache;\n }\n else {\n seen = iteratee ? [] : result;\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var seenIndex = seen.length;\n while (seenIndex--) {\n if (seen[seenIndex] === computed) {\n continue outer;\n }\n }\n if (iteratee) {\n seen.push(computed);\n }\n result.push(value);\n }\n else if (!includes(seen, computed, comparator)) {\n if (seen !== result) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.unset`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The property path to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n */\n function baseUnset(object, path) {\n path = castPath(path, object);\n object = parent(object, path);\n return object == null || delete object[toKey(last(path))];\n }\n\n /**\n * The base implementation of `_.update`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to update.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseUpdate(object, path, updater, customizer) {\n return baseSet(object, path, updater(baseGet(object, path)), customizer);\n }\n\n /**\n * The base implementation of methods like `_.dropWhile` and `_.takeWhile`\n * without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {Function} predicate The function invoked per iteration.\n * @param {boolean} [isDrop] Specify dropping elements instead of taking them.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseWhile(array, predicate, isDrop, fromRight) {\n var length = array.length,\n index = fromRight ? length : -1;\n\n while ((fromRight ? index-- : ++index < length) &&\n predicate(array[index], index, array)) {}\n\n return isDrop\n ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))\n : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));\n }\n\n /**\n * The base implementation of `wrapperValue` which returns the result of\n * performing a sequence of actions on the unwrapped `value`, where each\n * successive action is supplied the return value of the previous.\n *\n * @private\n * @param {*} value The unwrapped value.\n * @param {Array} actions Actions to perform to resolve the unwrapped value.\n * @returns {*} Returns the resolved value.\n */\n function baseWrapperValue(value, actions) {\n var result = value;\n if (result instanceof LazyWrapper) {\n result = result.value();\n }\n return arrayReduce(actions, function(result, action) {\n return action.func.apply(action.thisArg, arrayPush([result], action.args));\n }, result);\n }\n\n /**\n * The base implementation of methods like `_.xor`, without support for\n * iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of values.\n */\n function baseXor(arrays, iteratee, comparator) {\n var length = arrays.length;\n if (length < 2) {\n return length ? baseUniq(arrays[0]) : [];\n }\n var index = -1,\n result = Array(length);\n\n while (++index < length) {\n var array = arrays[index],\n othIndex = -1;\n\n while (++othIndex < length) {\n if (othIndex != index) {\n result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);\n }\n }\n }\n return baseUniq(baseFlatten(result, 1), iteratee, comparator);\n }\n\n /**\n * This base implementation of `_.zipObject` which assigns values using `assignFunc`.\n *\n * @private\n * @param {Array} props The property identifiers.\n * @param {Array} values The property values.\n * @param {Function} assignFunc The function to assign values.\n * @returns {Object} Returns the new object.\n */\n function baseZipObject(props, values, assignFunc) {\n var index = -1,\n length = props.length,\n valsLength = values.length,\n result = {};\n\n while (++index < length) {\n var value = index < valsLength ? values[index] : undefined;\n assignFunc(result, props[index], value);\n }\n return result;\n }\n\n /**\n * Casts `value` to an empty array if it's not an array like object.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Array|Object} Returns the cast array-like object.\n */\n function castArrayLikeObject(value) {\n return isArrayLikeObject(value) ? value : [];\n }\n\n /**\n * Casts `value` to `identity` if it's not a function.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Function} Returns cast function.\n */\n function castFunction(value) {\n return typeof value == 'function' ? value : identity;\n }\n\n /**\n * Casts `value` to a path array if it's not one.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {Object} [object] The object to query keys on.\n * @returns {Array} Returns the cast property path array.\n */\n function castPath(value, object) {\n if (isArray(value)) {\n return value;\n }\n return isKey(value, object) ? [value] : stringToPath(toString(value));\n }\n\n /**\n * A `baseRest` alias which can be replaced with `identity` by module\n * replacement plugins.\n *\n * @private\n * @type {Function}\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n var castRest = baseRest;\n\n /**\n * Casts `array` to a slice if it's needed.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {number} start The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the cast slice.\n */\n function castSlice(array, start, end) {\n var length = array.length;\n end = end === undefined ? length : end;\n return (!start && end >= length) ? array : baseSlice(array, start, end);\n }\n\n /**\n * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).\n *\n * @private\n * @param {number|Object} id The timer id or timeout object of the timer to clear.\n */\n var clearTimeout = ctxClearTimeout || function(id) {\n return root.clearTimeout(id);\n };\n\n /**\n * Creates a clone of `buffer`.\n *\n * @private\n * @param {Buffer} buffer The buffer to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Buffer} Returns the cloned buffer.\n */\n function cloneBuffer(buffer, isDeep) {\n if (isDeep) {\n return buffer.slice();\n }\n var length = buffer.length,\n result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);\n\n buffer.copy(result);\n return result;\n }\n\n /**\n * Creates a clone of `arrayBuffer`.\n *\n * @private\n * @param {ArrayBuffer} arrayBuffer The array buffer to clone.\n * @returns {ArrayBuffer} Returns the cloned array buffer.\n */\n function cloneArrayBuffer(arrayBuffer) {\n var result = new arrayBuffer.constructor(arrayBuffer.byteLength);\n new Uint8Array(result).set(new Uint8Array(arrayBuffer));\n return result;\n }\n\n /**\n * Creates a clone of `dataView`.\n *\n * @private\n * @param {Object} dataView The data view to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned data view.\n */\n function cloneDataView(dataView, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;\n return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);\n }\n\n /**\n * Creates a clone of `regexp`.\n *\n * @private\n * @param {Object} regexp The regexp to clone.\n * @returns {Object} Returns the cloned regexp.\n */\n function cloneRegExp(regexp) {\n var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));\n result.lastIndex = regexp.lastIndex;\n return result;\n }\n\n /**\n * Creates a clone of the `symbol` object.\n *\n * @private\n * @param {Object} symbol The symbol object to clone.\n * @returns {Object} Returns the cloned symbol object.\n */\n function cloneSymbol(symbol) {\n return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};\n }\n\n /**\n * Creates a clone of `typedArray`.\n *\n * @private\n * @param {Object} typedArray The typed array to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned typed array.\n */\n function cloneTypedArray(typedArray, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;\n return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);\n }\n\n /**\n * Compares values to sort them in ascending order.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {number} Returns the sort order indicator for `value`.\n */\n function compareAscending(value, other) {\n if (value !== other) {\n var valIsDefined = value !== undefined,\n valIsNull = value === null,\n valIsReflexive = value === value,\n valIsSymbol = isSymbol(value);\n\n var othIsDefined = other !== undefined,\n othIsNull = other === null,\n othIsReflexive = other === other,\n othIsSymbol = isSymbol(other);\n\n if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||\n (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||\n (valIsNull && othIsDefined && othIsReflexive) ||\n (!valIsDefined && othIsReflexive) ||\n !valIsReflexive) {\n return 1;\n }\n if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||\n (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||\n (othIsNull && valIsDefined && valIsReflexive) ||\n (!othIsDefined && valIsReflexive) ||\n !othIsReflexive) {\n return -1;\n }\n }\n return 0;\n }\n\n /**\n * Used by `_.orderBy` to compare multiple properties of a value to another\n * and stable sort them.\n *\n * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,\n * specify an order of \"desc\" for descending or \"asc\" for ascending sort order\n * of corresponding values.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {boolean[]|string[]} orders The order to sort by for each property.\n * @returns {number} Returns the sort order indicator for `object`.\n */\n function compareMultiple(object, other, orders) {\n var index = -1,\n objCriteria = object.criteria,\n othCriteria = other.criteria,\n length = objCriteria.length,\n ordersLength = orders.length;\n\n while (++index < length) {\n var result = compareAscending(objCriteria[index], othCriteria[index]);\n if (result) {\n if (index >= ordersLength) {\n return result;\n }\n var order = orders[index];\n return result * (order == 'desc' ? -1 : 1);\n }\n }\n // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications\n // that causes it, under certain circumstances, to provide the same value for\n // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247\n // for more details.\n //\n // This also ensures a stable sort in V8 and other engines.\n // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.\n return object.index - other.index;\n }\n\n /**\n * Creates an array that is the composition of partially applied arguments,\n * placeholders, and provided arguments into a single array of arguments.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to prepend to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgs(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersLength = holders.length,\n leftIndex = -1,\n leftLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(leftLength + rangeLength),\n isUncurried = !isCurried;\n\n while (++leftIndex < leftLength) {\n result[leftIndex] = partials[leftIndex];\n }\n while (++argsIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[holders[argsIndex]] = args[argsIndex];\n }\n }\n while (rangeLength--) {\n result[leftIndex++] = args[argsIndex++];\n }\n return result;\n }\n\n /**\n * This function is like `composeArgs` except that the arguments composition\n * is tailored for `_.partialRight`.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to append to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgsRight(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersIndex = -1,\n holdersLength = holders.length,\n rightIndex = -1,\n rightLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(rangeLength + rightLength),\n isUncurried = !isCurried;\n\n while (++argsIndex < rangeLength) {\n result[argsIndex] = args[argsIndex];\n }\n var offset = argsIndex;\n while (++rightIndex < rightLength) {\n result[offset + rightIndex] = partials[rightIndex];\n }\n while (++holdersIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[offset + holders[holdersIndex]] = args[argsIndex++];\n }\n }\n return result;\n }\n\n /**\n * Copies the values of `source` to `array`.\n *\n * @private\n * @param {Array} source The array to copy values from.\n * @param {Array} [array=[]] The array to copy values to.\n * @returns {Array} Returns `array`.\n */\n function copyArray(source, array) {\n var index = -1,\n length = source.length;\n\n array || (array = Array(length));\n while (++index < length) {\n array[index] = source[index];\n }\n return array;\n }\n\n /**\n * Copies properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy properties from.\n * @param {Array} props The property identifiers to copy.\n * @param {Object} [object={}] The object to copy properties to.\n * @param {Function} [customizer] The function to customize copied values.\n * @returns {Object} Returns `object`.\n */\n function copyObject(source, props, object, customizer) {\n var isNew = !object;\n object || (object = {});\n\n var index = -1,\n length = props.length;\n\n while (++index < length) {\n var key = props[index];\n\n var newValue = customizer\n ? customizer(object[key], source[key], key, object, source)\n : undefined;\n\n if (newValue === undefined) {\n newValue = source[key];\n }\n if (isNew) {\n baseAssignValue(object, key, newValue);\n } else {\n assignValue(object, key, newValue);\n }\n }\n return object;\n }\n\n /**\n * Copies own symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbols(source, object) {\n return copyObject(source, getSymbols(source), object);\n }\n\n /**\n * Copies own and inherited symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbolsIn(source, object) {\n return copyObject(source, getSymbolsIn(source), object);\n }\n\n /**\n * Creates a function like `_.groupBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} [initializer] The accumulator object initializer.\n * @returns {Function} Returns the new aggregator function.\n */\n function createAggregator(setter, initializer) {\n return function(collection, iteratee) {\n var func = isArray(collection) ? arrayAggregator : baseAggregator,\n accumulator = initializer ? initializer() : {};\n\n return func(collection, setter, getIteratee(iteratee, 2), accumulator);\n };\n }\n\n /**\n * Creates a function like `_.assign`.\n *\n * @private\n * @param {Function} assigner The function to assign values.\n * @returns {Function} Returns the new assigner function.\n */\n function createAssigner(assigner) {\n return baseRest(function(object, sources) {\n var index = -1,\n length = sources.length,\n customizer = length > 1 ? sources[length - 1] : undefined,\n guard = length > 2 ? sources[2] : undefined;\n\n customizer = (assigner.length > 3 && typeof customizer == 'function')\n ? (length--, customizer)\n : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n customizer = length < 3 ? undefined : customizer;\n length = 1;\n }\n object = Object(object);\n while (++index < length) {\n var source = sources[index];\n if (source) {\n assigner(object, source, index, customizer);\n }\n }\n return object;\n });\n }\n\n /**\n * Creates a `baseEach` or `baseEachRight` function.\n *\n * @private\n * @param {Function} eachFunc The function to iterate over a collection.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseEach(eachFunc, fromRight) {\n return function(collection, iteratee) {\n if (collection == null) {\n return collection;\n }\n if (!isArrayLike(collection)) {\n return eachFunc(collection, iteratee);\n }\n var length = collection.length,\n index = fromRight ? length : -1,\n iterable = Object(collection);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (iteratee(iterable[index], index, iterable) === false) {\n break;\n }\n }\n return collection;\n };\n }\n\n /**\n * Creates a base function for methods like `_.forIn` and `_.forOwn`.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseFor(fromRight) {\n return function(object, iteratee, keysFunc) {\n var index = -1,\n iterable = Object(object),\n props = keysFunc(object),\n length = props.length;\n\n while (length--) {\n var key = props[fromRight ? length : ++index];\n if (iteratee(iterable[key], key, iterable) === false) {\n break;\n }\n }\n return object;\n };\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the optional `this`\n * binding of `thisArg`.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createBind(func, bitmask, thisArg) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return fn.apply(isBind ? thisArg : this, arguments);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.lowerFirst`.\n *\n * @private\n * @param {string} methodName The name of the `String` case method to use.\n * @returns {Function} Returns the new case function.\n */\n function createCaseFirst(methodName) {\n return function(string) {\n string = toString(string);\n\n var strSymbols = hasUnicode(string)\n ? stringToArray(string)\n : undefined;\n\n var chr = strSymbols\n ? strSymbols[0]\n : string.charAt(0);\n\n var trailing = strSymbols\n ? castSlice(strSymbols, 1).join('')\n : string.slice(1);\n\n return chr[methodName]() + trailing;\n };\n }\n\n /**\n * Creates a function like `_.camelCase`.\n *\n * @private\n * @param {Function} callback The function to combine each word.\n * @returns {Function} Returns the new compounder function.\n */\n function createCompounder(callback) {\n return function(string) {\n return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');\n };\n }\n\n /**\n * Creates a function that produces an instance of `Ctor` regardless of\n * whether it was invoked as part of a `new` expression or by `call` or `apply`.\n *\n * @private\n * @param {Function} Ctor The constructor to wrap.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCtor(Ctor) {\n return function() {\n // Use a `switch` statement to work with class constructors. See\n // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist\n // for more details.\n var args = arguments;\n switch (args.length) {\n case 0: return new Ctor;\n case 1: return new Ctor(args[0]);\n case 2: return new Ctor(args[0], args[1]);\n case 3: return new Ctor(args[0], args[1], args[2]);\n case 4: return new Ctor(args[0], args[1], args[2], args[3]);\n case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);\n case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);\n case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);\n }\n var thisBinding = baseCreate(Ctor.prototype),\n result = Ctor.apply(thisBinding, args);\n\n // Mimic the constructor's `return` behavior.\n // See https://es5.github.io/#x13.2.2 for more details.\n return isObject(result) ? result : thisBinding;\n };\n }\n\n /**\n * Creates a function that wraps `func` to enable currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {number} arity The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCurry(func, bitmask, arity) {\n var Ctor = createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length,\n placeholder = getHolder(wrapper);\n\n while (index--) {\n args[index] = arguments[index];\n }\n var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)\n ? []\n : replaceHolders(args, placeholder);\n\n length -= holders.length;\n if (length < arity) {\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, undefined,\n args, holders, undefined, undefined, arity - length);\n }\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return apply(fn, this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.find` or `_.findLast` function.\n *\n * @private\n * @param {Function} findIndexFunc The function to find the collection index.\n * @returns {Function} Returns the new find function.\n */\n function createFind(findIndexFunc) {\n return function(collection, predicate, fromIndex) {\n var iterable = Object(collection);\n if (!isArrayLike(collection)) {\n var iteratee = getIteratee(predicate, 3);\n collection = keys(collection);\n predicate = function(key) { return iteratee(iterable[key], key, iterable); };\n }\n var index = findIndexFunc(collection, predicate, fromIndex);\n return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;\n };\n }\n\n /**\n * Creates a `_.flow` or `_.flowRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new flow function.\n */\n function createFlow(fromRight) {\n return flatRest(function(funcs) {\n var length = funcs.length,\n index = length,\n prereq = LodashWrapper.prototype.thru;\n\n if (fromRight) {\n funcs.reverse();\n }\n while (index--) {\n var func = funcs[index];\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (prereq && !wrapper && getFuncName(func) == 'wrapper') {\n var wrapper = new LodashWrapper([], true);\n }\n }\n index = wrapper ? index : length;\n while (++index < length) {\n func = funcs[index];\n\n var funcName = getFuncName(func),\n data = funcName == 'wrapper' ? getData(func) : undefined;\n\n if (data && isLaziable(data[0]) &&\n data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&\n !data[4].length && data[9] == 1\n ) {\n wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);\n } else {\n wrapper = (func.length == 1 && isLaziable(func))\n ? wrapper[funcName]()\n : wrapper.thru(func);\n }\n }\n return function() {\n var args = arguments,\n value = args[0];\n\n if (wrapper && args.length == 1 && isArray(value)) {\n return wrapper.plant(value).value();\n }\n var index = 0,\n result = length ? funcs[index].apply(this, args) : value;\n\n while (++index < length) {\n result = funcs[index].call(this, result);\n }\n return result;\n };\n });\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with optional `this`\n * binding of `thisArg`, partial application, and currying.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [partialsRight] The arguments to append to those provided\n * to the new function.\n * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {\n var isAry = bitmask & WRAP_ARY_FLAG,\n isBind = bitmask & WRAP_BIND_FLAG,\n isBindKey = bitmask & WRAP_BIND_KEY_FLAG,\n isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),\n isFlip = bitmask & WRAP_FLIP_FLAG,\n Ctor = isBindKey ? undefined : createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length;\n\n while (index--) {\n args[index] = arguments[index];\n }\n if (isCurried) {\n var placeholder = getHolder(wrapper),\n holdersCount = countHolders(args, placeholder);\n }\n if (partials) {\n args = composeArgs(args, partials, holders, isCurried);\n }\n if (partialsRight) {\n args = composeArgsRight(args, partialsRight, holdersRight, isCurried);\n }\n length -= holdersCount;\n if (isCurried && length < arity) {\n var newHolders = replaceHolders(args, placeholder);\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, thisArg,\n args, newHolders, argPos, ary, arity - length\n );\n }\n var thisBinding = isBind ? thisArg : this,\n fn = isBindKey ? thisBinding[func] : func;\n\n length = args.length;\n if (argPos) {\n args = reorder(args, argPos);\n } else if (isFlip && length > 1) {\n args.reverse();\n }\n if (isAry && ary < length) {\n args.length = ary;\n }\n if (this && this !== root && this instanceof wrapper) {\n fn = Ctor || createCtor(fn);\n }\n return fn.apply(thisBinding, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.invertBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} toIteratee The function to resolve iteratees.\n * @returns {Function} Returns the new inverter function.\n */\n function createInverter(setter, toIteratee) {\n return function(object, iteratee) {\n return baseInverter(object, setter, toIteratee(iteratee), {});\n };\n }\n\n /**\n * Creates a function that performs a mathematical operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @param {number} [defaultValue] The value used for `undefined` arguments.\n * @returns {Function} Returns the new mathematical operation function.\n */\n function createMathOperation(operator, defaultValue) {\n return function(value, other) {\n var result;\n if (value === undefined && other === undefined) {\n return defaultValue;\n }\n if (value !== undefined) {\n result = value;\n }\n if (other !== undefined) {\n if (result === undefined) {\n return other;\n }\n if (typeof value == 'string' || typeof other == 'string') {\n value = baseToString(value);\n other = baseToString(other);\n } else {\n value = baseToNumber(value);\n other = baseToNumber(other);\n }\n result = operator(value, other);\n }\n return result;\n };\n }\n\n /**\n * Creates a function like `_.over`.\n *\n * @private\n * @param {Function} arrayFunc The function to iterate over iteratees.\n * @returns {Function} Returns the new over function.\n */\n function createOver(arrayFunc) {\n return flatRest(function(iteratees) {\n iteratees = arrayMap(iteratees, baseUnary(getIteratee()));\n return baseRest(function(args) {\n var thisArg = this;\n return arrayFunc(iteratees, function(iteratee) {\n return apply(iteratee, thisArg, args);\n });\n });\n });\n }\n\n /**\n * Creates the padding for `string` based on `length`. The `chars` string\n * is truncated if the number of characters exceeds `length`.\n *\n * @private\n * @param {number} length The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padding for `string`.\n */\n function createPadding(length, chars) {\n chars = chars === undefined ? ' ' : baseToString(chars);\n\n var charsLength = chars.length;\n if (charsLength < 2) {\n return charsLength ? baseRepeat(chars, length) : chars;\n }\n var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));\n return hasUnicode(chars)\n ? castSlice(stringToArray(result), 0, length).join('')\n : result.slice(0, length);\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the `this` binding\n * of `thisArg` and `partials` prepended to the arguments it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} partials The arguments to prepend to those provided to\n * the new function.\n * @returns {Function} Returns the new wrapped function.\n */\n function createPartial(func, bitmask, thisArg, partials) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var argsIndex = -1,\n argsLength = arguments.length,\n leftIndex = -1,\n leftLength = partials.length,\n args = Array(leftLength + argsLength),\n fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n\n while (++leftIndex < leftLength) {\n args[leftIndex] = partials[leftIndex];\n }\n while (argsLength--) {\n args[leftIndex++] = arguments[++argsIndex];\n }\n return apply(fn, isBind ? thisArg : this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.range` or `_.rangeRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new range function.\n */\n function createRange(fromRight) {\n return function(start, end, step) {\n if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {\n end = step = undefined;\n }\n // Ensure the sign of `-0` is preserved.\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);\n return baseRange(start, end, step, fromRight);\n };\n }\n\n /**\n * Creates a function that performs a relational operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @returns {Function} Returns the new relational operation function.\n */\n function createRelationalOperation(operator) {\n return function(value, other) {\n if (!(typeof value == 'string' && typeof other == 'string')) {\n value = toNumber(value);\n other = toNumber(other);\n }\n return operator(value, other);\n };\n }\n\n /**\n * Creates a function that wraps `func` to continue currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {Function} wrapFunc The function to create the `func` wrapper.\n * @param {*} placeholder The placeholder value.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {\n var isCurry = bitmask & WRAP_CURRY_FLAG,\n newHolders = isCurry ? holders : undefined,\n newHoldersRight = isCurry ? undefined : holders,\n newPartials = isCurry ? partials : undefined,\n newPartialsRight = isCurry ? undefined : partials;\n\n bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);\n bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);\n\n if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {\n bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);\n }\n var newData = [\n func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,\n newHoldersRight, argPos, ary, arity\n ];\n\n var result = wrapFunc.apply(undefined, newData);\n if (isLaziable(func)) {\n setData(result, newData);\n }\n result.placeholder = placeholder;\n return setWrapToString(result, func, bitmask);\n }\n\n /**\n * Creates a function like `_.round`.\n *\n * @private\n * @param {string} methodName The name of the `Math` method to use when rounding.\n * @returns {Function} Returns the new round function.\n */\n function createRound(methodName) {\n var func = Math[methodName];\n return function(number, precision) {\n number = toNumber(number);\n precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);\n if (precision && nativeIsFinite(number)) {\n // Shift with exponential notation to avoid floating-point issues.\n // See [MDN](https://mdn.io/round#Examples) for more details.\n var pair = (toString(number) + 'e').split('e'),\n value = func(pair[0] + 'e' + (+pair[1] + precision));\n\n pair = (toString(value) + 'e').split('e');\n return +(pair[0] + 'e' + (+pair[1] - precision));\n }\n return func(number);\n };\n }\n\n /**\n * Creates a set object of `values`.\n *\n * @private\n * @param {Array} values The values to add to the set.\n * @returns {Object} Returns the new set.\n */\n var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {\n return new Set(values);\n };\n\n /**\n * Creates a `_.toPairs` or `_.toPairsIn` function.\n *\n * @private\n * @param {Function} keysFunc The function to get the keys of a given object.\n * @returns {Function} Returns the new pairs function.\n */\n function createToPairs(keysFunc) {\n return function(object) {\n var tag = getTag(object);\n if (tag == mapTag) {\n return mapToArray(object);\n }\n if (tag == setTag) {\n return setToPairs(object);\n }\n return baseToPairs(object, keysFunc(object));\n };\n }\n\n /**\n * Creates a function that either curries or invokes `func` with optional\n * `this` binding and partially applied arguments.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags.\n * 1 - `_.bind`\n * 2 - `_.bindKey`\n * 4 - `_.curry` or `_.curryRight` of a bound function\n * 8 - `_.curry`\n * 16 - `_.curryRight`\n * 32 - `_.partial`\n * 64 - `_.partialRight`\n * 128 - `_.rearg`\n * 256 - `_.ary`\n * 512 - `_.flip`\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to be partially applied.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {\n var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;\n if (!isBindKey && typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var length = partials ? partials.length : 0;\n if (!length) {\n bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);\n partials = holders = undefined;\n }\n ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);\n arity = arity === undefined ? arity : toInteger(arity);\n length -= holders ? holders.length : 0;\n\n if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {\n var partialsRight = partials,\n holdersRight = holders;\n\n partials = holders = undefined;\n }\n var data = isBindKey ? undefined : getData(func);\n\n var newData = [\n func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,\n argPos, ary, arity\n ];\n\n if (data) {\n mergeData(newData, data);\n }\n func = newData[0];\n bitmask = newData[1];\n thisArg = newData[2];\n partials = newData[3];\n holders = newData[4];\n arity = newData[9] = newData[9] === undefined\n ? (isBindKey ? 0 : func.length)\n : nativeMax(newData[9] - length, 0);\n\n if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {\n bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);\n }\n if (!bitmask || bitmask == WRAP_BIND_FLAG) {\n var result = createBind(func, bitmask, thisArg);\n } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {\n result = createCurry(func, bitmask, arity);\n } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {\n result = createPartial(func, bitmask, thisArg, partials);\n } else {\n result = createHybrid.apply(undefined, newData);\n }\n var setter = data ? baseSetData : setData;\n return setWrapToString(setter(result, newData), func, bitmask);\n }\n\n /**\n * Used by `_.defaults` to customize its `_.assignIn` use to assign properties\n * of source objects to the destination object for all destination properties\n * that resolve to `undefined`.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to assign.\n * @param {Object} object The parent object of `objValue`.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsAssignIn(objValue, srcValue, key, object) {\n if (objValue === undefined ||\n (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n return srcValue;\n }\n return objValue;\n }\n\n /**\n * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source\n * objects into destination objects that are passed thru.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to merge.\n * @param {Object} object The parent object of `objValue`.\n * @param {Object} source The parent object of `srcValue`.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {\n if (isObject(objValue) && isObject(srcValue)) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, objValue);\n baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);\n stack['delete'](srcValue);\n }\n return objValue;\n }\n\n /**\n * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain\n * objects.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {string} key The key of the property to inspect.\n * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.\n */\n function customOmitClone(value) {\n return isPlainObject(value) ? undefined : value;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\n function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n arrLength = array.length,\n othLength = other.length;\n\n if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n return false;\n }\n // Check that cyclic values are equal.\n var arrStacked = stack.get(array);\n var othStacked = stack.get(other);\n if (arrStacked && othStacked) {\n return arrStacked == other && othStacked == array;\n }\n var index = -1,\n result = true,\n seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n stack.set(array, other);\n stack.set(other, array);\n\n // Ignore non-index properties.\n while (++index < arrLength) {\n var arrValue = array[index],\n othValue = other[index];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, arrValue, index, other, array, stack)\n : customizer(arrValue, othValue, index, array, other, stack);\n }\n if (compared !== undefined) {\n if (compared) {\n continue;\n }\n result = false;\n break;\n }\n // Recursively compare arrays (susceptible to call stack limits).\n if (seen) {\n if (!arraySome(other, function(othValue, othIndex) {\n if (!cacheHas(seen, othIndex) &&\n (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n return seen.push(othIndex);\n }\n })) {\n result = false;\n break;\n }\n } else if (!(\n arrValue === othValue ||\n equalFunc(arrValue, othValue, bitmask, customizer, stack)\n )) {\n result = false;\n break;\n }\n }\n stack['delete'](array);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n switch (tag) {\n case dataViewTag:\n if ((object.byteLength != other.byteLength) ||\n (object.byteOffset != other.byteOffset)) {\n return false;\n }\n object = object.buffer;\n other = other.buffer;\n\n case arrayBufferTag:\n if ((object.byteLength != other.byteLength) ||\n !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n return false;\n }\n return true;\n\n case boolTag:\n case dateTag:\n case numberTag:\n // Coerce booleans to `1` or `0` and dates to milliseconds.\n // Invalid dates are coerced to `NaN`.\n return eq(+object, +other);\n\n case errorTag:\n return object.name == other.name && object.message == other.message;\n\n case regexpTag:\n case stringTag:\n // Coerce regexes to strings and treat strings, primitives and objects,\n // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n // for more details.\n return object == (other + '');\n\n case mapTag:\n var convert = mapToArray;\n\n case setTag:\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n convert || (convert = setToArray);\n\n if (object.size != other.size && !isPartial) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked) {\n return stacked == other;\n }\n bitmask |= COMPARE_UNORDERED_FLAG;\n\n // Recursively compare objects (susceptible to call stack limits).\n stack.set(object, other);\n var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n stack['delete'](object);\n return result;\n\n case symbolTag:\n if (symbolValueOf) {\n return symbolValueOf.call(object) == symbolValueOf.call(other);\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n objProps = getAllKeys(object),\n objLength = objProps.length,\n othProps = getAllKeys(other),\n othLength = othProps.length;\n\n if (objLength != othLength && !isPartial) {\n return false;\n }\n var index = objLength;\n while (index--) {\n var key = objProps[index];\n if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n return false;\n }\n }\n // Check that cyclic values are equal.\n var objStacked = stack.get(object);\n var othStacked = stack.get(other);\n if (objStacked && othStacked) {\n return objStacked == other && othStacked == object;\n }\n var result = true;\n stack.set(object, other);\n stack.set(other, object);\n\n var skipCtor = isPartial;\n while (++index < objLength) {\n key = objProps[index];\n var objValue = object[key],\n othValue = other[key];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, objValue, key, other, object, stack)\n : customizer(objValue, othValue, key, object, other, stack);\n }\n // Recursively compare objects (susceptible to call stack limits).\n if (!(compared === undefined\n ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n : compared\n )) {\n result = false;\n break;\n }\n skipCtor || (skipCtor = key == 'constructor');\n }\n if (result && !skipCtor) {\n var objCtor = object.constructor,\n othCtor = other.constructor;\n\n // Non `Object` object instances with different constructors are not equal.\n if (objCtor != othCtor &&\n ('constructor' in object && 'constructor' in other) &&\n !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n result = false;\n }\n }\n stack['delete'](object);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseRest` which flattens the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n function flatRest(func) {\n return setToString(overRest(func, undefined, flatten), func + '');\n }\n\n /**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeys(object) {\n return baseGetAllKeys(object, keys, getSymbols);\n }\n\n /**\n * Creates an array of own and inherited enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeysIn(object) {\n return baseGetAllKeys(object, keysIn, getSymbolsIn);\n }\n\n /**\n * Gets metadata for `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {*} Returns the metadata for `func`.\n */\n var getData = !metaMap ? noop : function(func) {\n return metaMap.get(func);\n };\n\n /**\n * Gets the name of `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {string} Returns the function name.\n */\n function getFuncName(func) {\n var result = (func.name + ''),\n array = realNames[result],\n length = hasOwnProperty.call(realNames, result) ? array.length : 0;\n\n while (length--) {\n var data = array[length],\n otherFunc = data.func;\n if (otherFunc == null || otherFunc == func) {\n return data.name;\n }\n }\n return result;\n }\n\n /**\n * Gets the argument placeholder value for `func`.\n *\n * @private\n * @param {Function} func The function to inspect.\n * @returns {*} Returns the placeholder value.\n */\n function getHolder(func) {\n var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;\n return object.placeholder;\n }\n\n /**\n * Gets the appropriate \"iteratee\" function. If `_.iteratee` is customized,\n * this function returns the custom method, otherwise it returns `baseIteratee`.\n * If arguments are provided, the chosen function is invoked with them and\n * its result is returned.\n *\n * @private\n * @param {*} [value] The value to convert to an iteratee.\n * @param {number} [arity] The arity of the created iteratee.\n * @returns {Function} Returns the chosen function or its result.\n */\n function getIteratee() {\n var result = lodash.iteratee || iteratee;\n result = result === iteratee ? baseIteratee : result;\n return arguments.length ? result(arguments[0], arguments[1]) : result;\n }\n\n /**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\n function getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n }\n\n /**\n * Gets the property names, values, and compare flags of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the match data of `object`.\n */\n function getMatchData(object) {\n var result = keys(object),\n length = result.length;\n\n while (length--) {\n var key = result[length],\n value = object[key];\n\n result[length] = [key, value, isStrictComparable(value)];\n }\n return result;\n }\n\n /**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\n function getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n }\n\n /**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\n function getRawTag(value) {\n var isOwn = hasOwnProperty.call(value, symToStringTag),\n tag = value[symToStringTag];\n\n try {\n value[symToStringTag] = undefined;\n var unmasked = true;\n } catch (e) {}\n\n var result = nativeObjectToString.call(value);\n if (unmasked) {\n if (isOwn) {\n value[symToStringTag] = tag;\n } else {\n delete value[symToStringTag];\n }\n }\n return result;\n }\n\n /**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n if (object == null) {\n return [];\n }\n object = Object(object);\n return arrayFilter(nativeGetSymbols(object), function(symbol) {\n return propertyIsEnumerable.call(object, symbol);\n });\n };\n\n /**\n * Creates an array of the own and inherited enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {\n var result = [];\n while (object) {\n arrayPush(result, getSymbols(object));\n object = getPrototype(object);\n }\n return result;\n };\n\n /**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n var getTag = baseGetTag;\n\n // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\n if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n (Map && getTag(new Map) != mapTag) ||\n (Promise && getTag(Promise.resolve()) != promiseTag) ||\n (Set && getTag(new Set) != setTag) ||\n (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n getTag = function(value) {\n var result = baseGetTag(value),\n Ctor = result == objectTag ? value.constructor : undefined,\n ctorString = Ctor ? toSource(Ctor) : '';\n\n if (ctorString) {\n switch (ctorString) {\n case dataViewCtorString: return dataViewTag;\n case mapCtorString: return mapTag;\n case promiseCtorString: return promiseTag;\n case setCtorString: return setTag;\n case weakMapCtorString: return weakMapTag;\n }\n }\n return result;\n };\n }\n\n /**\n * Gets the view, applying any `transforms` to the `start` and `end` positions.\n *\n * @private\n * @param {number} start The start of the view.\n * @param {number} end The end of the view.\n * @param {Array} transforms The transformations to apply to the view.\n * @returns {Object} Returns an object containing the `start` and `end`\n * positions of the view.\n */\n function getView(start, end, transforms) {\n var index = -1,\n length = transforms.length;\n\n while (++index < length) {\n var data = transforms[index],\n size = data.size;\n\n switch (data.type) {\n case 'drop': start += size; break;\n case 'dropRight': end -= size; break;\n case 'take': end = nativeMin(end, start + size); break;\n case 'takeRight': start = nativeMax(start, end - size); break;\n }\n }\n return { 'start': start, 'end': end };\n }\n\n /**\n * Extracts wrapper details from the `source` body comment.\n *\n * @private\n * @param {string} source The source to inspect.\n * @returns {Array} Returns the wrapper details.\n */\n function getWrapDetails(source) {\n var match = source.match(reWrapDetails);\n return match ? match[1].split(reSplitDetails) : [];\n }\n\n /**\n * Checks if `path` exists on `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @param {Function} hasFunc The function to check properties.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n */\n function hasPath(object, path, hasFunc) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n result = false;\n\n while (++index < length) {\n var key = toKey(path[index]);\n if (!(result = object != null && hasFunc(object, key))) {\n break;\n }\n object = object[key];\n }\n if (result || ++index != length) {\n return result;\n }\n length = object == null ? 0 : object.length;\n return !!length && isLength(length) && isIndex(key, length) &&\n (isArray(object) || isArguments(object));\n }\n\n /**\n * Initializes an array clone.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the initialized clone.\n */\n function initCloneArray(array) {\n var length = array.length,\n result = new array.constructor(length);\n\n // Add properties assigned by `RegExp#exec`.\n if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {\n result.index = array.index;\n result.input = array.input;\n }\n return result;\n }\n\n /**\n * Initializes an object clone.\n *\n * @private\n * @param {Object} object The object to clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneObject(object) {\n return (typeof object.constructor == 'function' && !isPrototype(object))\n ? baseCreate(getPrototype(object))\n : {};\n }\n\n /**\n * Initializes an object clone based on its `toStringTag`.\n *\n * **Note:** This function only supports cloning values with tags of\n * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {string} tag The `toStringTag` of the object to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneByTag(object, tag, isDeep) {\n var Ctor = object.constructor;\n switch (tag) {\n case arrayBufferTag:\n return cloneArrayBuffer(object);\n\n case boolTag:\n case dateTag:\n return new Ctor(+object);\n\n case dataViewTag:\n return cloneDataView(object, isDeep);\n\n case float32Tag: case float64Tag:\n case int8Tag: case int16Tag: case int32Tag:\n case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:\n return cloneTypedArray(object, isDeep);\n\n case mapTag:\n return new Ctor;\n\n case numberTag:\n case stringTag:\n return new Ctor(object);\n\n case regexpTag:\n return cloneRegExp(object);\n\n case setTag:\n return new Ctor;\n\n case symbolTag:\n return cloneSymbol(object);\n }\n }\n\n /**\n * Inserts wrapper `details` in a comment at the top of the `source` body.\n *\n * @private\n * @param {string} source The source to modify.\n * @returns {Array} details The details to insert.\n * @returns {string} Returns the modified source.\n */\n function insertWrapDetails(source, details) {\n var length = details.length;\n if (!length) {\n return source;\n }\n var lastIndex = length - 1;\n details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];\n details = details.join(length > 2 ? ', ' : ' ');\n return source.replace(reWrapComment, '{\\n/* [wrapped with ' + details + '] */\\n');\n }\n\n /**\n * Checks if `value` is a flattenable `arguments` object or array.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.\n */\n function isFlattenable(value) {\n return isArray(value) || isArguments(value) ||\n !!(spreadableSymbol && value && value[spreadableSymbol]);\n }\n\n /**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\n function isIndex(value, length) {\n var type = typeof value;\n length = length == null ? MAX_SAFE_INTEGER : length;\n\n return !!length &&\n (type == 'number' ||\n (type != 'symbol' && reIsUint.test(value))) &&\n (value > -1 && value % 1 == 0 && value < length);\n }\n\n /**\n * Checks if the given arguments are from an iteratee call.\n *\n * @private\n * @param {*} value The potential iteratee value argument.\n * @param {*} index The potential iteratee index or key argument.\n * @param {*} object The potential iteratee object argument.\n * @returns {boolean} Returns `true` if the arguments are from an iteratee call,\n * else `false`.\n */\n function isIterateeCall(value, index, object) {\n if (!isObject(object)) {\n return false;\n }\n var type = typeof index;\n if (type == 'number'\n ? (isArrayLike(object) && isIndex(index, object.length))\n : (type == 'string' && index in object)\n ) {\n return eq(object[index], value);\n }\n return false;\n }\n\n /**\n * Checks if `value` is a property name and not a property path.\n *\n * @private\n * @param {*} value The value to check.\n * @param {Object} [object] The object to query keys on.\n * @returns {boolean} Returns `true` if `value` is a property name, else `false`.\n */\n function isKey(value, object) {\n if (isArray(value)) {\n return false;\n }\n var type = typeof value;\n if (type == 'number' || type == 'symbol' || type == 'boolean' ||\n value == null || isSymbol(value)) {\n return true;\n }\n return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||\n (object != null && value in Object(object));\n }\n\n /**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\n function isKeyable(value) {\n var type = typeof value;\n return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n ? (value !== '__proto__')\n : (value === null);\n }\n\n /**\n * Checks if `func` has a lazy counterpart.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` has a lazy counterpart,\n * else `false`.\n */\n function isLaziable(func) {\n var funcName = getFuncName(func),\n other = lodash[funcName];\n\n if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {\n return false;\n }\n if (func === other) {\n return true;\n }\n var data = getData(other);\n return !!data && func === data[0];\n }\n\n /**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\n function isMasked(func) {\n return !!maskSrcKey && (maskSrcKey in func);\n }\n\n /**\n * Checks if `func` is capable of being masked.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `func` is maskable, else `false`.\n */\n var isMaskable = coreJsData ? isFunction : stubFalse;\n\n /**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\n function isPrototype(value) {\n var Ctor = value && value.constructor,\n proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n return value === proto;\n }\n\n /**\n * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` if suitable for strict\n * equality comparisons, else `false`.\n */\n function isStrictComparable(value) {\n return value === value && !isObject(value);\n }\n\n /**\n * A specialized version of `matchesProperty` for source values suitable\n * for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function matchesStrictComparable(key, srcValue) {\n return function(object) {\n if (object == null) {\n return false;\n }\n return object[key] === srcValue &&\n (srcValue !== undefined || (key in Object(object)));\n };\n }\n\n /**\n * A specialized version of `_.memoize` which clears the memoized function's\n * cache when it exceeds `MAX_MEMOIZE_SIZE`.\n *\n * @private\n * @param {Function} func The function to have its output memoized.\n * @returns {Function} Returns the new memoized function.\n */\n function memoizeCapped(func) {\n var result = memoize(func, function(key) {\n if (cache.size === MAX_MEMOIZE_SIZE) {\n cache.clear();\n }\n return key;\n });\n\n var cache = result.cache;\n return result;\n }\n\n /**\n * Merges the function metadata of `source` into `data`.\n *\n * Merging metadata reduces the number of wrappers used to invoke a function.\n * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`\n * may be applied regardless of execution order. Methods like `_.ary` and\n * `_.rearg` modify function arguments, making the order in which they are\n * executed important, preventing the merging of metadata. However, we make\n * an exception for a safe combined case where curried functions have `_.ary`\n * and or `_.rearg` applied.\n *\n * @private\n * @param {Array} data The destination metadata.\n * @param {Array} source The source metadata.\n * @returns {Array} Returns `data`.\n */\n function mergeData(data, source) {\n var bitmask = data[1],\n srcBitmask = source[1],\n newBitmask = bitmask | srcBitmask,\n isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);\n\n var isCombo =\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||\n ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));\n\n // Exit early if metadata can't be merged.\n if (!(isCommon || isCombo)) {\n return data;\n }\n // Use source `thisArg` if available.\n if (srcBitmask & WRAP_BIND_FLAG) {\n data[2] = source[2];\n // Set when currying a bound function.\n newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;\n }\n // Compose partial arguments.\n var value = source[3];\n if (value) {\n var partials = data[3];\n data[3] = partials ? composeArgs(partials, value, source[4]) : value;\n data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];\n }\n // Compose partial right arguments.\n value = source[5];\n if (value) {\n partials = data[5];\n data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;\n data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];\n }\n // Use source `argPos` if available.\n value = source[7];\n if (value) {\n data[7] = value;\n }\n // Use source `ary` if it's smaller.\n if (srcBitmask & WRAP_ARY_FLAG) {\n data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);\n }\n // Use source `arity` if one is not provided.\n if (data[9] == null) {\n data[9] = source[9];\n }\n // Use source `func` and merge bitmasks.\n data[0] = source[0];\n data[1] = newBitmask;\n\n return data;\n }\n\n /**\n * This function is like\n * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * except that it includes inherited enumerable properties.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function nativeKeysIn(object) {\n var result = [];\n if (object != null) {\n for (var key in Object(object)) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\n function objectToString(value) {\n return nativeObjectToString.call(value);\n }\n\n /**\n * A specialized version of `baseRest` which transforms the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @param {Function} transform The rest array transform.\n * @returns {Function} Returns the new function.\n */\n function overRest(func, start, transform) {\n start = nativeMax(start === undefined ? (func.length - 1) : start, 0);\n return function() {\n var args = arguments,\n index = -1,\n length = nativeMax(args.length - start, 0),\n array = Array(length);\n\n while (++index < length) {\n array[index] = args[start + index];\n }\n index = -1;\n var otherArgs = Array(start + 1);\n while (++index < start) {\n otherArgs[index] = args[index];\n }\n otherArgs[start] = transform(array);\n return apply(func, this, otherArgs);\n };\n }\n\n /**\n * Gets the parent value at `path` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} path The path to get the parent value of.\n * @returns {*} Returns the parent value.\n */\n function parent(object, path) {\n return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));\n }\n\n /**\n * Reorder `array` according to the specified indexes where the element at\n * the first index is assigned as the first element, the element at\n * the second index is assigned as the second element, and so on.\n *\n * @private\n * @param {Array} array The array to reorder.\n * @param {Array} indexes The arranged array indexes.\n * @returns {Array} Returns `array`.\n */\n function reorder(array, indexes) {\n var arrLength = array.length,\n length = nativeMin(indexes.length, arrLength),\n oldArray = copyArray(array);\n\n while (length--) {\n var index = indexes[length];\n array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;\n }\n return array;\n }\n\n /**\n * Gets the value at `key`, unless `key` is \"__proto__\" or \"constructor\".\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function safeGet(object, key) {\n if (key === 'constructor' && typeof object[key] === 'function') {\n return;\n }\n\n if (key == '__proto__') {\n return;\n }\n\n return object[key];\n }\n\n /**\n * Sets metadata for `func`.\n *\n * **Note:** If this function becomes hot, i.e. is invoked a lot in a short\n * period of time, it will trip its breaker and transition to an identity\n * function to avoid garbage collection pauses in V8. See\n * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)\n * for more details.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var setData = shortOut(baseSetData);\n\n /**\n * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n var setTimeout = ctxSetTimeout || function(func, wait) {\n return root.setTimeout(func, wait);\n };\n\n /**\n * Sets the `toString` method of `func` to return `string`.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var setToString = shortOut(baseSetToString);\n\n /**\n * Sets the `toString` method of `wrapper` to mimic the source of `reference`\n * with wrapper details in a comment at the top of the source body.\n *\n * @private\n * @param {Function} wrapper The function to modify.\n * @param {Function} reference The reference function.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Function} Returns `wrapper`.\n */\n function setWrapToString(wrapper, reference, bitmask) {\n var source = (reference + '');\n return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));\n }\n\n /**\n * Creates a function that'll short out and invoke `identity` instead\n * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`\n * milliseconds.\n *\n * @private\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new shortable function.\n */\n function shortOut(func) {\n var count = 0,\n lastCalled = 0;\n\n return function() {\n var stamp = nativeNow(),\n remaining = HOT_SPAN - (stamp - lastCalled);\n\n lastCalled = stamp;\n if (remaining > 0) {\n if (++count >= HOT_COUNT) {\n return arguments[0];\n }\n } else {\n count = 0;\n }\n return func.apply(undefined, arguments);\n };\n }\n\n /**\n * A specialized version of `_.shuffle` which mutates and sets the size of `array`.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @param {number} [size=array.length] The size of `array`.\n * @returns {Array} Returns `array`.\n */\n function shuffleSelf(array, size) {\n var index = -1,\n length = array.length,\n lastIndex = length - 1;\n\n size = size === undefined ? length : size;\n while (++index < size) {\n var rand = baseRandom(index, lastIndex),\n value = array[rand];\n\n array[rand] = array[index];\n array[index] = value;\n }\n array.length = size;\n return array;\n }\n\n /**\n * Converts `string` to a property path array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the property path array.\n */\n var stringToPath = memoizeCapped(function(string) {\n var result = [];\n if (string.charCodeAt(0) === 46 /* . */) {\n result.push('');\n }\n string.replace(rePropName, function(match, number, quote, subString) {\n result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));\n });\n return result;\n });\n\n /**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\n function toKey(value) {\n if (typeof value == 'string' || isSymbol(value)) {\n return value;\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\n function toSource(func) {\n if (func != null) {\n try {\n return funcToString.call(func);\n } catch (e) {}\n try {\n return (func + '');\n } catch (e) {}\n }\n return '';\n }\n\n /**\n * Updates wrapper `details` based on `bitmask` flags.\n *\n * @private\n * @returns {Array} details The details to modify.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Array} Returns `details`.\n */\n function updateWrapDetails(details, bitmask) {\n arrayEach(wrapFlags, function(pair) {\n var value = '_.' + pair[0];\n if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {\n details.push(value);\n }\n });\n return details.sort();\n }\n\n /**\n * Creates a clone of `wrapper`.\n *\n * @private\n * @param {Object} wrapper The wrapper to clone.\n * @returns {Object} Returns the cloned wrapper.\n */\n function wrapperClone(wrapper) {\n if (wrapper instanceof LazyWrapper) {\n return wrapper.clone();\n }\n var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);\n result.__actions__ = copyArray(wrapper.__actions__);\n result.__index__ = wrapper.__index__;\n result.__values__ = wrapper.__values__;\n return result;\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of elements split into groups the length of `size`.\n * If `array` can't be split evenly, the final chunk will be the remaining\n * elements.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to process.\n * @param {number} [size=1] The length of each chunk\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the new array of chunks.\n * @example\n *\n * _.chunk(['a', 'b', 'c', 'd'], 2);\n * // => [['a', 'b'], ['c', 'd']]\n *\n * _.chunk(['a', 'b', 'c', 'd'], 3);\n * // => [['a', 'b', 'c'], ['d']]\n */\n function chunk(array, size, guard) {\n if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {\n size = 1;\n } else {\n size = nativeMax(toInteger(size), 0);\n }\n var length = array == null ? 0 : array.length;\n if (!length || size < 1) {\n return [];\n }\n var index = 0,\n resIndex = 0,\n result = Array(nativeCeil(length / size));\n\n while (index < length) {\n result[resIndex++] = baseSlice(array, index, (index += size));\n }\n return result;\n }\n\n /**\n * Creates an array with all falsey values removed. The values `false`, `null`,\n * `0`, `\"\"`, `undefined`, and `NaN` are falsey.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to compact.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.compact([0, 1, false, 2, '', 3]);\n * // => [1, 2, 3]\n */\n function compact(array) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * Creates a new array concatenating `array` with any additional arrays\n * and/or values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to concatenate.\n * @param {...*} [values] The values to concatenate.\n * @returns {Array} Returns the new concatenated array.\n * @example\n *\n * var array = [1];\n * var other = _.concat(array, 2, [3], [[4]]);\n *\n * console.log(other);\n * // => [1, 2, 3, [4]]\n *\n * console.log(array);\n * // => [1]\n */\n function concat() {\n var length = arguments.length;\n if (!length) {\n return [];\n }\n var args = Array(length - 1),\n array = arguments[0],\n index = length;\n\n while (index--) {\n args[index - 1] = arguments[index];\n }\n return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));\n }\n\n /**\n * Creates an array of `array` values not included in the other given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * **Note:** Unlike `_.pullAll`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.without, _.xor\n * @example\n *\n * _.difference([2, 1], [2, 3]);\n * // => [1]\n */\n var difference = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `iteratee` which\n * is invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * **Note:** Unlike `_.pullAllBy`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var differenceBy = baseRest(function(array, values) {\n var iteratee = last(values);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `comparator`\n * which is invoked to compare elements of `array` to `values`. The order and\n * references of result values are determined by the first array. The comparator\n * is invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.pullAllWith`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n *\n * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }]\n */\n var differenceWith = baseRest(function(array, values) {\n var comparator = last(values);\n if (isArrayLikeObject(comparator)) {\n comparator = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)\n : [];\n });\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.drop([1, 2, 3]);\n * // => [2, 3]\n *\n * _.drop([1, 2, 3], 2);\n * // => [3]\n *\n * _.drop([1, 2, 3], 5);\n * // => []\n *\n * _.drop([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function drop(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.dropRight([1, 2, 3]);\n * // => [1, 2]\n *\n * _.dropRight([1, 2, 3], 2);\n * // => [1]\n *\n * _.dropRight([1, 2, 3], 5);\n * // => []\n *\n * _.dropRight([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function dropRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the end.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.dropRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropRightWhile(users, ['active', false]);\n * // => objects for ['barney']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropRightWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the beginning.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.dropWhile(users, function(o) { return !o.active; });\n * // => objects for ['pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropWhile(users, ['active', false]);\n * // => objects for ['pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true)\n : [];\n }\n\n /**\n * Fills elements of `array` with `value` from `start` up to, but not\n * including, `end`.\n *\n * **Note:** This method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Array\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.fill(array, 'a');\n * console.log(array);\n * // => ['a', 'a', 'a']\n *\n * _.fill(Array(3), 2);\n * // => [2, 2, 2]\n *\n * _.fill([4, 6, 8, 10], '*', 1, 3);\n * // => [4, '*', '*', 10]\n */\n function fill(array, value, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {\n start = 0;\n end = length;\n }\n return baseFill(array, value, start, end);\n }\n\n /**\n * This method is like `_.find` except that it returns the index of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.findIndex(users, function(o) { return o.user == 'barney'; });\n * // => 0\n *\n * // The `_.matches` iteratee shorthand.\n * _.findIndex(users, { 'user': 'fred', 'active': false });\n * // => 1\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findIndex(users, ['active', false]);\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.findIndex(users, 'active');\n * // => 2\n */\n function findIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index);\n }\n\n /**\n * This method is like `_.findIndex` except that it iterates over elements\n * of `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });\n * // => 2\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastIndex(users, { 'user': 'barney', 'active': true });\n * // => 0\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastIndex(users, ['active', false]);\n * // => 2\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastIndex(users, 'active');\n * // => 0\n */\n function findLastIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length - 1;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = fromIndex < 0\n ? nativeMax(length + index, 0)\n : nativeMin(index, length - 1);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index, true);\n }\n\n /**\n * Flattens `array` a single level deep.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flatten([1, [2, [3, [4]], 5]]);\n * // => [1, 2, [3, [4]], 5]\n */\n function flatten(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, 1) : [];\n }\n\n /**\n * Recursively flattens `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flattenDeep([1, [2, [3, [4]], 5]]);\n * // => [1, 2, 3, 4, 5]\n */\n function flattenDeep(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, INFINITY) : [];\n }\n\n /**\n * Recursively flatten `array` up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * var array = [1, [2, [3, [4]], 5]];\n *\n * _.flattenDepth(array, 1);\n * // => [1, 2, [3, [4]], 5]\n *\n * _.flattenDepth(array, 2);\n * // => [1, 2, 3, [4], 5]\n */\n function flattenDepth(array, depth) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(array, depth);\n }\n\n /**\n * The inverse of `_.toPairs`; this method returns an object composed\n * from key-value `pairs`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} pairs The key-value pairs.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.fromPairs([['a', 1], ['b', 2]]);\n * // => { 'a': 1, 'b': 2 }\n */\n function fromPairs(pairs) {\n var index = -1,\n length = pairs == null ? 0 : pairs.length,\n result = {};\n\n while (++index < length) {\n var pair = pairs[index];\n result[pair[0]] = pair[1];\n }\n return result;\n }\n\n /**\n * Gets the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias first\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the first element of `array`.\n * @example\n *\n * _.head([1, 2, 3]);\n * // => 1\n *\n * _.head([]);\n * // => undefined\n */\n function head(array) {\n return (array && array.length) ? array[0] : undefined;\n }\n\n /**\n * Gets the index at which the first occurrence of `value` is found in `array`\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. If `fromIndex` is negative, it's used as the\n * offset from the end of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.indexOf([1, 2, 1, 2], 2);\n * // => 1\n *\n * // Search from the `fromIndex`.\n * _.indexOf([1, 2, 1, 2], 2, 2);\n * // => 3\n */\n function indexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseIndexOf(array, value, index);\n }\n\n /**\n * Gets all but the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.initial([1, 2, 3]);\n * // => [1, 2]\n */\n function initial(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 0, -1) : [];\n }\n\n /**\n * Creates an array of unique values that are included in all given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersection([2, 1], [2, 3]);\n * // => [2]\n */\n var intersection = baseRest(function(arrays) {\n var mapped = arrayMap(arrays, castArrayLikeObject);\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped)\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `iteratee`\n * which is invoked for each element of each `arrays` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [2.1]\n *\n * // The `_.property` iteratee shorthand.\n * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }]\n */\n var intersectionBy = baseRest(function(arrays) {\n var iteratee = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n if (iteratee === last(mapped)) {\n iteratee = undefined;\n } else {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `comparator`\n * which is invoked to compare elements of `arrays`. The order and references\n * of result values are determined by the first array. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.intersectionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }]\n */\n var intersectionWith = baseRest(function(arrays) {\n var comparator = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n comparator = typeof comparator == 'function' ? comparator : undefined;\n if (comparator) {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, undefined, comparator)\n : [];\n });\n\n /**\n * Converts all elements in `array` into a string separated by `separator`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to convert.\n * @param {string} [separator=','] The element separator.\n * @returns {string} Returns the joined string.\n * @example\n *\n * _.join(['a', 'b', 'c'], '~');\n * // => 'a~b~c'\n */\n function join(array, separator) {\n return array == null ? '' : nativeJoin.call(array, separator);\n }\n\n /**\n * Gets the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the last element of `array`.\n * @example\n *\n * _.last([1, 2, 3]);\n * // => 3\n */\n function last(array) {\n var length = array == null ? 0 : array.length;\n return length ? array[length - 1] : undefined;\n }\n\n /**\n * This method is like `_.indexOf` except that it iterates over elements of\n * `array` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.lastIndexOf([1, 2, 1, 2], 2);\n * // => 3\n *\n * // Search from the `fromIndex`.\n * _.lastIndexOf([1, 2, 1, 2], 2, 2);\n * // => 1\n */\n function lastIndexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);\n }\n return value === value\n ? strictLastIndexOf(array, value, index)\n : baseFindIndex(array, baseIsNaN, index, true);\n }\n\n /**\n * Gets the element at index `n` of `array`. If `n` is negative, the nth\n * element from the end is returned.\n *\n * @static\n * @memberOf _\n * @since 4.11.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=0] The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n *\n * _.nth(array, 1);\n * // => 'b'\n *\n * _.nth(array, -2);\n * // => 'c';\n */\n function nth(array, n) {\n return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;\n }\n\n /**\n * Removes all given values from `array` using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`\n * to remove elements from an array by predicate.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...*} [values] The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pull(array, 'a', 'c');\n * console.log(array);\n * // => ['b', 'b']\n */\n var pull = baseRest(pullAll);\n\n /**\n * This method is like `_.pull` except that it accepts an array of values to remove.\n *\n * **Note:** Unlike `_.difference`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pullAll(array, ['a', 'c']);\n * console.log(array);\n * // => ['b', 'b']\n */\n function pullAll(array, values) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values)\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `iteratee` which is\n * invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The iteratee is invoked with one argument: (value).\n *\n * **Note:** Unlike `_.differenceBy`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];\n *\n * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');\n * console.log(array);\n * // => [{ 'x': 2 }]\n */\n function pullAllBy(array, values, iteratee) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, getIteratee(iteratee, 2))\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `comparator` which\n * is invoked to compare elements of `array` to `values`. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.differenceWith`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];\n *\n * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);\n * console.log(array);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]\n */\n function pullAllWith(array, values, comparator) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, undefined, comparator)\n : array;\n }\n\n /**\n * Removes elements from `array` corresponding to `indexes` and returns an\n * array of removed elements.\n *\n * **Note:** Unlike `_.at`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...(number|number[])} [indexes] The indexes of elements to remove.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n * var pulled = _.pullAt(array, [1, 3]);\n *\n * console.log(array);\n * // => ['a', 'c']\n *\n * console.log(pulled);\n * // => ['b', 'd']\n */\n var pullAt = flatRest(function(array, indexes) {\n var length = array == null ? 0 : array.length,\n result = baseAt(array, indexes);\n\n basePullAt(array, arrayMap(indexes, function(index) {\n return isIndex(index, length) ? +index : index;\n }).sort(compareAscending));\n\n return result;\n });\n\n /**\n * Removes all elements from `array` that `predicate` returns truthy for\n * and returns an array of the removed elements. The predicate is invoked\n * with three arguments: (value, index, array).\n *\n * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`\n * to pull elements from an array by value.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = [1, 2, 3, 4];\n * var evens = _.remove(array, function(n) {\n * return n % 2 == 0;\n * });\n *\n * console.log(array);\n * // => [1, 3]\n *\n * console.log(evens);\n * // => [2, 4]\n */\n function remove(array, predicate) {\n var result = [];\n if (!(array && array.length)) {\n return result;\n }\n var index = -1,\n indexes = [],\n length = array.length;\n\n predicate = getIteratee(predicate, 3);\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result.push(value);\n indexes.push(index);\n }\n }\n basePullAt(array, indexes);\n return result;\n }\n\n /**\n * Reverses `array` so that the first element becomes the last, the second\n * element becomes the second to last, and so on.\n *\n * **Note:** This method mutates `array` and is based on\n * [`Array#reverse`](https://mdn.io/Array/reverse).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.reverse(array);\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function reverse(array) {\n return array == null ? array : nativeReverse.call(array);\n }\n\n /**\n * Creates a slice of `array` from `start` up to, but not including, `end`.\n *\n * **Note:** This method is used instead of\n * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are\n * returned.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function slice(array, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {\n start = 0;\n end = length;\n }\n else {\n start = start == null ? 0 : toInteger(start);\n end = end === undefined ? length : toInteger(end);\n }\n return baseSlice(array, start, end);\n }\n\n /**\n * Uses a binary search to determine the lowest index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedIndex([30, 50], 40);\n * // => 1\n */\n function sortedIndex(array, value) {\n return baseSortedIndex(array, value);\n }\n\n /**\n * This method is like `_.sortedIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedIndexBy(objects, { 'x': 4 }, 'x');\n * // => 0\n */\n function sortedIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));\n }\n\n /**\n * This method is like `_.indexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedIndexOf([4, 5, 5, 5, 6], 5);\n * // => 1\n */\n function sortedIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value);\n if (index < length && eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.sortedIndex` except that it returns the highest\n * index at which `value` should be inserted into `array` in order to\n * maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedLastIndex([4, 5, 5, 5, 6], 5);\n * // => 4\n */\n function sortedLastIndex(array, value) {\n return baseSortedIndex(array, value, true);\n }\n\n /**\n * This method is like `_.sortedLastIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 1\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');\n * // => 1\n */\n function sortedLastIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);\n }\n\n /**\n * This method is like `_.lastIndexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);\n * // => 3\n */\n function sortedLastIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value, true) - 1;\n if (eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.uniq` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniq([1, 1, 2]);\n * // => [1, 2]\n */\n function sortedUniq(array) {\n return (array && array.length)\n ? baseSortedUniq(array)\n : [];\n }\n\n /**\n * This method is like `_.uniqBy` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);\n * // => [1.1, 2.3]\n */\n function sortedUniqBy(array, iteratee) {\n return (array && array.length)\n ? baseSortedUniq(array, getIteratee(iteratee, 2))\n : [];\n }\n\n /**\n * Gets all but the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.tail([1, 2, 3]);\n * // => [2, 3]\n */\n function tail(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 1, length) : [];\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.take([1, 2, 3]);\n * // => [1]\n *\n * _.take([1, 2, 3], 2);\n * // => [1, 2]\n *\n * _.take([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.take([1, 2, 3], 0);\n * // => []\n */\n function take(array, n, guard) {\n if (!(array && array.length)) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.takeRight([1, 2, 3]);\n * // => [3]\n *\n * _.takeRight([1, 2, 3], 2);\n * // => [2, 3]\n *\n * _.takeRight([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.takeRight([1, 2, 3], 0);\n * // => []\n */\n function takeRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with elements taken from the end. Elements are\n * taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.takeRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeRightWhile(users, ['active', false]);\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeRightWhile(users, 'active');\n * // => []\n */\n function takeRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), false, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` with elements taken from the beginning. Elements\n * are taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.takeWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeWhile(users, ['active', false]);\n * // => objects for ['barney', 'fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeWhile(users, 'active');\n * // => []\n */\n function takeWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3))\n : [];\n }\n\n /**\n * Creates an array of unique values, in order, from all given arrays using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.union([2], [1, 2]);\n * // => [2, 1]\n */\n var union = baseRest(function(arrays) {\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));\n });\n\n /**\n * This method is like `_.union` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which uniqueness is computed. Result values are chosen from the first\n * array in which the value occurs. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.unionBy([2.1], [1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n var unionBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.union` except that it accepts `comparator` which\n * is invoked to compare elements of `arrays`. Result values are chosen from\n * the first array in which the value occurs. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.unionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var unionWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);\n });\n\n /**\n * Creates a duplicate-free version of an array, using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons, in which only the first occurrence of each element\n * is kept. The order of result values is determined by the order they occur\n * in the array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniq([2, 1, 2]);\n * // => [2, 1]\n */\n function uniq(array) {\n return (array && array.length) ? baseUniq(array) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * uniqueness is computed. The order of result values is determined by the\n * order they occur in the array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniqBy([2.1, 1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n function uniqBy(array, iteratee) {\n return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `comparator` which\n * is invoked to compare elements of `array`. The order of result values is\n * determined by the order they occur in the array.The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.uniqWith(objects, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]\n */\n function uniqWith(array, comparator) {\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return (array && array.length) ? baseUniq(array, undefined, comparator) : [];\n }\n\n /**\n * This method is like `_.zip` except that it accepts an array of grouped\n * elements and creates an array regrouping the elements to their pre-zip\n * configuration.\n *\n * @static\n * @memberOf _\n * @since 1.2.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n *\n * _.unzip(zipped);\n * // => [['a', 'b'], [1, 2], [true, false]]\n */\n function unzip(array) {\n if (!(array && array.length)) {\n return [];\n }\n var length = 0;\n array = arrayFilter(array, function(group) {\n if (isArrayLikeObject(group)) {\n length = nativeMax(group.length, length);\n return true;\n }\n });\n return baseTimes(length, function(index) {\n return arrayMap(array, baseProperty(index));\n });\n }\n\n /**\n * This method is like `_.unzip` except that it accepts `iteratee` to specify\n * how regrouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * regrouped values.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip([1, 2], [10, 20], [100, 200]);\n * // => [[1, 10, 100], [2, 20, 200]]\n *\n * _.unzipWith(zipped, _.add);\n * // => [3, 30, 300]\n */\n function unzipWith(array, iteratee) {\n if (!(array && array.length)) {\n return [];\n }\n var result = unzip(array);\n if (iteratee == null) {\n return result;\n }\n return arrayMap(result, function(group) {\n return apply(iteratee, undefined, group);\n });\n }\n\n /**\n * Creates an array excluding all given values using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.pull`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...*} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.xor\n * @example\n *\n * _.without([2, 1, 2, 3], 1, 2);\n * // => [3]\n */\n var without = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, values)\n : [];\n });\n\n /**\n * Creates an array of unique values that is the\n * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)\n * of the given arrays. The order of result values is determined by the order\n * they occur in the arrays.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.without\n * @example\n *\n * _.xor([2, 1], [2, 3]);\n * // => [1, 3]\n */\n var xor = baseRest(function(arrays) {\n return baseXor(arrayFilter(arrays, isArrayLikeObject));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which by which they're compared. The order of result values is determined\n * by the order they occur in the arrays. The iteratee is invoked with one\n * argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2, 3.4]\n *\n * // The `_.property` iteratee shorthand.\n * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var xorBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `comparator` which is\n * invoked to compare elements of `arrays`. The order of result values is\n * determined by the order they occur in the arrays. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.xorWith(objects, others, _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var xorWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);\n });\n\n /**\n * Creates an array of grouped elements, the first of which contains the\n * first elements of the given arrays, the second of which contains the\n * second elements of the given arrays, and so on.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n */\n var zip = baseRest(unzip);\n\n /**\n * This method is like `_.fromPairs` except that it accepts two arrays,\n * one of property identifiers and one of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 0.4.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObject(['a', 'b'], [1, 2]);\n * // => { 'a': 1, 'b': 2 }\n */\n function zipObject(props, values) {\n return baseZipObject(props || [], values || [], assignValue);\n }\n\n /**\n * This method is like `_.zipObject` except that it supports property paths.\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);\n * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }\n */\n function zipObjectDeep(props, values) {\n return baseZipObject(props || [], values || [], baseSet);\n }\n\n /**\n * This method is like `_.zip` except that it accepts `iteratee` to specify\n * how grouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * grouped values.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {\n * return a + b + c;\n * });\n * // => [111, 222]\n */\n var zipWith = baseRest(function(arrays) {\n var length = arrays.length,\n iteratee = length > 1 ? arrays[length - 1] : undefined;\n\n iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;\n return unzipWith(arrays, iteratee);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` wrapper instance that wraps `value` with explicit method\n * chain sequences enabled. The result of such sequences must be unwrapped\n * with `_#value`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Seq\n * @param {*} value The value to wrap.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'pebbles', 'age': 1 }\n * ];\n *\n * var youngest = _\n * .chain(users)\n * .sortBy('age')\n * .map(function(o) {\n * return o.user + ' is ' + o.age;\n * })\n * .head()\n * .value();\n * // => 'pebbles is 1'\n */\n function chain(value) {\n var result = lodash(value);\n result.__chain__ = true;\n return result;\n }\n\n /**\n * This method invokes `interceptor` and returns `value`. The interceptor\n * is invoked with one argument; (value). The purpose of this method is to\n * \"tap into\" a method chain sequence in order to modify intermediate results.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns `value`.\n * @example\n *\n * _([1, 2, 3])\n * .tap(function(array) {\n * // Mutate input array.\n * array.pop();\n * })\n * .reverse()\n * .value();\n * // => [2, 1]\n */\n function tap(value, interceptor) {\n interceptor(value);\n return value;\n }\n\n /**\n * This method is like `_.tap` except that it returns the result of `interceptor`.\n * The purpose of this method is to \"pass thru\" values replacing intermediate\n * results in a method chain sequence.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns the result of `interceptor`.\n * @example\n *\n * _(' abc ')\n * .chain()\n * .trim()\n * .thru(function(value) {\n * return [value];\n * })\n * .value();\n * // => ['abc']\n */\n function thru(value, interceptor) {\n return interceptor(value);\n }\n\n /**\n * This method is the wrapper version of `_.at`.\n *\n * @name at\n * @memberOf _\n * @since 1.0.0\n * @category Seq\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _(object).at(['a[0].b.c', 'a[1]']).value();\n * // => [3, 4]\n */\n var wrapperAt = flatRest(function(paths) {\n var length = paths.length,\n start = length ? paths[0] : 0,\n value = this.__wrapped__,\n interceptor = function(object) { return baseAt(object, paths); };\n\n if (length > 1 || this.__actions__.length ||\n !(value instanceof LazyWrapper) || !isIndex(start)) {\n return this.thru(interceptor);\n }\n value = value.slice(start, +start + (length ? 1 : 0));\n value.__actions__.push({\n 'func': thru,\n 'args': [interceptor],\n 'thisArg': undefined\n });\n return new LodashWrapper(value, this.__chain__).thru(function(array) {\n if (length && !array.length) {\n array.push(undefined);\n }\n return array;\n });\n });\n\n /**\n * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.\n *\n * @name chain\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 }\n * ];\n *\n * // A sequence without explicit chaining.\n * _(users).head();\n * // => { 'user': 'barney', 'age': 36 }\n *\n * // A sequence with explicit chaining.\n * _(users)\n * .chain()\n * .head()\n * .pick('user')\n * .value();\n * // => { 'user': 'barney' }\n */\n function wrapperChain() {\n return chain(this);\n }\n\n /**\n * Executes the chain sequence and returns the wrapped result.\n *\n * @name commit\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2];\n * var wrapped = _(array).push(3);\n *\n * console.log(array);\n * // => [1, 2]\n *\n * wrapped = wrapped.commit();\n * console.log(array);\n * // => [1, 2, 3]\n *\n * wrapped.last();\n * // => 3\n *\n * console.log(array);\n * // => [1, 2, 3]\n */\n function wrapperCommit() {\n return new LodashWrapper(this.value(), this.__chain__);\n }\n\n /**\n * Gets the next value on a wrapped object following the\n * [iterator protocol](https://mdn.io/iteration_protocols#iterator).\n *\n * @name next\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the next iterator value.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 1 }\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 2 }\n *\n * wrapped.next();\n * // => { 'done': true, 'value': undefined }\n */\n function wrapperNext() {\n if (this.__values__ === undefined) {\n this.__values__ = toArray(this.value());\n }\n var done = this.__index__ >= this.__values__.length,\n value = done ? undefined : this.__values__[this.__index__++];\n\n return { 'done': done, 'value': value };\n }\n\n /**\n * Enables the wrapper to be iterable.\n *\n * @name Symbol.iterator\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the wrapper object.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped[Symbol.iterator]() === wrapped;\n * // => true\n *\n * Array.from(wrapped);\n * // => [1, 2]\n */\n function wrapperToIterator() {\n return this;\n }\n\n /**\n * Creates a clone of the chain sequence planting `value` as the wrapped value.\n *\n * @name plant\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @param {*} value The value to plant.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2]).map(square);\n * var other = wrapped.plant([3, 4]);\n *\n * other.value();\n * // => [9, 16]\n *\n * wrapped.value();\n * // => [1, 4]\n */\n function wrapperPlant(value) {\n var result,\n parent = this;\n\n while (parent instanceof baseLodash) {\n var clone = wrapperClone(parent);\n clone.__index__ = 0;\n clone.__values__ = undefined;\n if (result) {\n previous.__wrapped__ = clone;\n } else {\n result = clone;\n }\n var previous = clone;\n parent = parent.__wrapped__;\n }\n previous.__wrapped__ = value;\n return result;\n }\n\n /**\n * This method is the wrapper version of `_.reverse`.\n *\n * **Note:** This method mutates the wrapped array.\n *\n * @name reverse\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _(array).reverse().value()\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function wrapperReverse() {\n var value = this.__wrapped__;\n if (value instanceof LazyWrapper) {\n var wrapped = value;\n if (this.__actions__.length) {\n wrapped = new LazyWrapper(this);\n }\n wrapped = wrapped.reverse();\n wrapped.__actions__.push({\n 'func': thru,\n 'args': [reverse],\n 'thisArg': undefined\n });\n return new LodashWrapper(wrapped, this.__chain__);\n }\n return this.thru(reverse);\n }\n\n /**\n * Executes the chain sequence to resolve the unwrapped value.\n *\n * @name value\n * @memberOf _\n * @since 0.1.0\n * @alias toJSON, valueOf\n * @category Seq\n * @returns {*} Returns the resolved unwrapped value.\n * @example\n *\n * _([1, 2, 3]).value();\n * // => [1, 2, 3]\n */\n function wrapperValue() {\n return baseWrapperValue(this.__wrapped__, this.__actions__);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the number of times the key was returned by `iteratee`. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.countBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': 1, '6': 2 }\n *\n * // The `_.property` iteratee shorthand.\n * _.countBy(['one', 'two', 'three'], 'length');\n * // => { '3': 2, '5': 1 }\n */\n var countBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n ++result[key];\n } else {\n baseAssignValue(result, key, 1);\n }\n });\n\n /**\n * Checks if `predicate` returns truthy for **all** elements of `collection`.\n * Iteration is stopped once `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * **Note:** This method returns `true` for\n * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because\n * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of\n * elements of empty collections.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n * @example\n *\n * _.every([true, 1, null, 'yes'], Boolean);\n * // => false\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.every(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.every(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.every(users, 'active');\n * // => false\n */\n function every(collection, predicate, guard) {\n var func = isArray(collection) ? arrayEvery : baseEvery;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning an array of all elements\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * **Note:** Unlike `_.remove`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.reject\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * _.filter(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.filter(users, { 'age': 36, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.filter(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.filter(users, 'active');\n * // => objects for ['barney']\n *\n * // Combining several predicates using `_.overEvery` or `_.overSome`.\n * _.filter(users, _.overSome([{ 'age': 36 }, ['age', 40]]));\n * // => objects for ['fred', 'barney']\n */\n function filter(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning the first element\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false },\n * { 'user': 'pebbles', 'age': 1, 'active': true }\n * ];\n *\n * _.find(users, function(o) { return o.age < 40; });\n * // => object for 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.find(users, { 'age': 1, 'active': true });\n * // => object for 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.find(users, ['active', false]);\n * // => object for 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.find(users, 'active');\n * // => object for 'barney'\n */\n var find = createFind(findIndex);\n\n /**\n * This method is like `_.find` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=collection.length-1] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * _.findLast([1, 2, 3, 4], function(n) {\n * return n % 2 == 1;\n * });\n * // => 3\n */\n var findLast = createFind(findLastIndex);\n\n /**\n * Creates a flattened array of values by running each element in `collection`\n * thru `iteratee` and flattening the mapped results. The iteratee is invoked\n * with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [n, n];\n * }\n *\n * _.flatMap([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMap(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), 1);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDeep([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMapDeep(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), INFINITY);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDepth([1, 2], duplicate, 2);\n * // => [[1, 1], [2, 2]]\n */\n function flatMapDepth(collection, iteratee, depth) {\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(map(collection, iteratee), depth);\n }\n\n /**\n * Iterates over elements of `collection` and invokes `iteratee` for each element.\n * The iteratee is invoked with three arguments: (value, index|key, collection).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * **Note:** As with other \"Collections\" methods, objects with a \"length\"\n * property are iterated like arrays. To avoid this behavior use `_.forIn`\n * or `_.forOwn` for object iteration.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias each\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEachRight\n * @example\n *\n * _.forEach([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `1` then `2`.\n *\n * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forEach(collection, iteratee) {\n var func = isArray(collection) ? arrayEach : baseEach;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forEach` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @alias eachRight\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEach\n * @example\n *\n * _.forEachRight([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `2` then `1`.\n */\n function forEachRight(collection, iteratee) {\n var func = isArray(collection) ? arrayEachRight : baseEachRight;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The order of grouped values\n * is determined by the order they occur in `collection`. The corresponding\n * value of each key is an array of elements responsible for generating the\n * key. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.groupBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': [4.2], '6': [6.1, 6.3] }\n *\n * // The `_.property` iteratee shorthand.\n * _.groupBy(['one', 'two', 'three'], 'length');\n * // => { '3': ['one', 'two'], '5': ['three'] }\n */\n var groupBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n result[key].push(value);\n } else {\n baseAssignValue(result, key, [value]);\n }\n });\n\n /**\n * Checks if `value` is in `collection`. If `collection` is a string, it's\n * checked for a substring of `value`, otherwise\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * is used for equality comparisons. If `fromIndex` is negative, it's used as\n * the offset from the end of `collection`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {boolean} Returns `true` if `value` is found, else `false`.\n * @example\n *\n * _.includes([1, 2, 3], 1);\n * // => true\n *\n * _.includes([1, 2, 3], 1, 2);\n * // => false\n *\n * _.includes({ 'a': 1, 'b': 2 }, 1);\n * // => true\n *\n * _.includes('abcd', 'bc');\n * // => true\n */\n function includes(collection, value, fromIndex, guard) {\n collection = isArrayLike(collection) ? collection : values(collection);\n fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;\n\n var length = collection.length;\n if (fromIndex < 0) {\n fromIndex = nativeMax(length + fromIndex, 0);\n }\n return isString(collection)\n ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)\n : (!!length && baseIndexOf(collection, value, fromIndex) > -1);\n }\n\n /**\n * Invokes the method at `path` of each element in `collection`, returning\n * an array of the results of each invoked method. Any additional arguments\n * are provided to each invoked method. If `path` is a function, it's invoked\n * for, and `this` bound to, each element in `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array|Function|string} path The path of the method to invoke or\n * the function invoked per iteration.\n * @param {...*} [args] The arguments to invoke each method with.\n * @returns {Array} Returns the array of results.\n * @example\n *\n * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');\n * // => [[1, 5, 7], [1, 2, 3]]\n *\n * _.invokeMap([123, 456], String.prototype.split, '');\n * // => [['1', '2', '3'], ['4', '5', '6']]\n */\n var invokeMap = baseRest(function(collection, path, args) {\n var index = -1,\n isFunc = typeof path == 'function',\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value) {\n result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);\n });\n return result;\n });\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the last element responsible for generating the key. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * var array = [\n * { 'dir': 'left', 'code': 97 },\n * { 'dir': 'right', 'code': 100 }\n * ];\n *\n * _.keyBy(array, function(o) {\n * return String.fromCharCode(o.code);\n * });\n * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }\n *\n * _.keyBy(array, 'dir');\n * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }\n */\n var keyBy = createAggregator(function(result, value, key) {\n baseAssignValue(result, key, value);\n });\n\n /**\n * Creates an array of values by running each element in `collection` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.\n *\n * The guarded methods are:\n * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,\n * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,\n * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,\n * `template`, `trim`, `trimEnd`, `trimStart`, and `words`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * _.map([4, 8], square);\n * // => [16, 64]\n *\n * _.map({ 'a': 4, 'b': 8 }, square);\n * // => [16, 64] (iteration order is not guaranteed)\n *\n * var users = [\n * { 'user': 'barney' },\n * { 'user': 'fred' }\n * ];\n *\n * // The `_.property` iteratee shorthand.\n * _.map(users, 'user');\n * // => ['barney', 'fred']\n */\n function map(collection, iteratee) {\n var func = isArray(collection) ? arrayMap : baseMap;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.sortBy` except that it allows specifying the sort\n * orders of the iteratees to sort by. If `orders` is unspecified, all values\n * are sorted in ascending order. Otherwise, specify an order of \"desc\" for\n * descending or \"asc\" for ascending sort order of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @param {string[]} [orders] The sort orders of `iteratees`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 34 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 36 }\n * ];\n *\n * // Sort by `user` in ascending order and by `age` in descending order.\n * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n */\n function orderBy(collection, iteratees, orders, guard) {\n if (collection == null) {\n return [];\n }\n if (!isArray(iteratees)) {\n iteratees = iteratees == null ? [] : [iteratees];\n }\n orders = guard ? undefined : orders;\n if (!isArray(orders)) {\n orders = orders == null ? [] : [orders];\n }\n return baseOrderBy(collection, iteratees, orders);\n }\n\n /**\n * Creates an array of elements split into two groups, the first of which\n * contains elements `predicate` returns truthy for, the second of which\n * contains elements `predicate` returns falsey for. The predicate is\n * invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the array of grouped elements.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true },\n * { 'user': 'pebbles', 'age': 1, 'active': false }\n * ];\n *\n * _.partition(users, function(o) { return o.active; });\n * // => objects for [['fred'], ['barney', 'pebbles']]\n *\n * // The `_.matches` iteratee shorthand.\n * _.partition(users, { 'age': 1, 'active': false });\n * // => objects for [['pebbles'], ['barney', 'fred']]\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.partition(users, ['active', false]);\n * // => objects for [['barney', 'pebbles'], ['fred']]\n *\n * // The `_.property` iteratee shorthand.\n * _.partition(users, 'active');\n * // => objects for [['fred'], ['barney', 'pebbles']]\n */\n var partition = createAggregator(function(result, value, key) {\n result[key ? 0 : 1].push(value);\n }, function() { return [[], []]; });\n\n /**\n * Reduces `collection` to a value which is the accumulated result of running\n * each element in `collection` thru `iteratee`, where each successive\n * invocation is supplied the return value of the previous. If `accumulator`\n * is not given, the first element of `collection` is used as the initial\n * value. The iteratee is invoked with four arguments:\n * (accumulator, value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.reduce`, `_.reduceRight`, and `_.transform`.\n *\n * The guarded methods are:\n * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,\n * and `sortBy`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduceRight\n * @example\n *\n * _.reduce([1, 2], function(sum, n) {\n * return sum + n;\n * }, 0);\n * // => 3\n *\n * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * return result;\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)\n */\n function reduce(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduce : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);\n }\n\n /**\n * This method is like `_.reduce` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduce\n * @example\n *\n * var array = [[0, 1], [2, 3], [4, 5]];\n *\n * _.reduceRight(array, function(flattened, other) {\n * return flattened.concat(other);\n * }, []);\n * // => [4, 5, 2, 3, 0, 1]\n */\n function reduceRight(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduceRight : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);\n }\n\n /**\n * The opposite of `_.filter`; this method returns the elements of `collection`\n * that `predicate` does **not** return truthy for.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.filter\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true }\n * ];\n *\n * _.reject(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.reject(users, { 'age': 40, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.reject(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.reject(users, 'active');\n * // => objects for ['barney']\n */\n function reject(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, negate(getIteratee(predicate, 3)));\n }\n\n /**\n * Gets a random element from `collection`.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n * @example\n *\n * _.sample([1, 2, 3, 4]);\n * // => 2\n */\n function sample(collection) {\n var func = isArray(collection) ? arraySample : baseSample;\n return func(collection);\n }\n\n /**\n * Gets `n` random elements at unique keys from `collection` up to the\n * size of `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @param {number} [n=1] The number of elements to sample.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the random elements.\n * @example\n *\n * _.sampleSize([1, 2, 3], 2);\n * // => [3, 1]\n *\n * _.sampleSize([1, 2, 3], 4);\n * // => [2, 3, 1]\n */\n function sampleSize(collection, n, guard) {\n if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n var func = isArray(collection) ? arraySampleSize : baseSampleSize;\n return func(collection, n);\n }\n\n /**\n * Creates an array of shuffled values, using a version of the\n * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n * @example\n *\n * _.shuffle([1, 2, 3, 4]);\n * // => [4, 1, 3, 2]\n */\n function shuffle(collection) {\n var func = isArray(collection) ? arrayShuffle : baseShuffle;\n return func(collection);\n }\n\n /**\n * Gets the size of `collection` by returning its length for array-like\n * values or the number of own enumerable string keyed properties for objects.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @returns {number} Returns the collection size.\n * @example\n *\n * _.size([1, 2, 3]);\n * // => 3\n *\n * _.size({ 'a': 1, 'b': 2 });\n * // => 2\n *\n * _.size('pebbles');\n * // => 7\n */\n function size(collection) {\n if (collection == null) {\n return 0;\n }\n if (isArrayLike(collection)) {\n return isString(collection) ? stringSize(collection) : collection.length;\n }\n var tag = getTag(collection);\n if (tag == mapTag || tag == setTag) {\n return collection.size;\n }\n return baseKeys(collection).length;\n }\n\n /**\n * Checks if `predicate` returns truthy for **any** element of `collection`.\n * Iteration is stopped once `predicate` returns truthy. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n * @example\n *\n * _.some([null, 0, 'yes', false], Boolean);\n * // => true\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.some(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.some(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.some(users, 'active');\n * // => true\n */\n function some(collection, predicate, guard) {\n var func = isArray(collection) ? arraySome : baseSome;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Creates an array of elements, sorted in ascending order by the results of\n * running each element in a collection thru each iteratee. This method\n * performs a stable sort, that is, it preserves the original sort order of\n * equal elements. The iteratees are invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 30 },\n * { 'user': 'barney', 'age': 34 }\n * ];\n *\n * _.sortBy(users, [function(o) { return o.user; }]);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 30]]\n *\n * _.sortBy(users, ['user', 'age']);\n * // => objects for [['barney', 34], ['barney', 36], ['fred', 30], ['fred', 48]]\n */\n var sortBy = baseRest(function(collection, iteratees) {\n if (collection == null) {\n return [];\n }\n var length = iteratees.length;\n if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {\n iteratees = [];\n } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {\n iteratees = [iteratees[0]];\n }\n return baseOrderBy(collection, baseFlatten(iteratees, 1), []);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Gets the timestamp of the number of milliseconds that have elapsed since\n * the Unix epoch (1 January 1970 00:00:00 UTC).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Date\n * @returns {number} Returns the timestamp.\n * @example\n *\n * _.defer(function(stamp) {\n * console.log(_.now() - stamp);\n * }, _.now());\n * // => Logs the number of milliseconds it took for the deferred invocation.\n */\n var now = ctxNow || function() {\n return root.Date.now();\n };\n\n /*------------------------------------------------------------------------*/\n\n /**\n * The opposite of `_.before`; this method creates a function that invokes\n * `func` once it's called `n` or more times.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {number} n The number of calls before `func` is invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var saves = ['profile', 'settings'];\n *\n * var done = _.after(saves.length, function() {\n * console.log('done saving!');\n * });\n *\n * _.forEach(saves, function(type) {\n * asyncSave({ 'type': type, 'complete': done });\n * });\n * // => Logs 'done saving!' after the two async saves have completed.\n */\n function after(n, func) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n < 1) {\n return func.apply(this, arguments);\n }\n };\n }\n\n /**\n * Creates a function that invokes `func`, with up to `n` arguments,\n * ignoring any additional arguments.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @param {number} [n=func.length] The arity cap.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.ary(parseInt, 1));\n * // => [6, 8, 10]\n */\n function ary(func, n, guard) {\n n = guard ? undefined : n;\n n = (func && n == null) ? func.length : n;\n return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);\n }\n\n /**\n * Creates a function that invokes `func`, with the `this` binding and arguments\n * of the created function, while it's called less than `n` times. Subsequent\n * calls to the created function return the result of the last `func` invocation.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {number} n The number of calls at which `func` is no longer invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * jQuery(element).on('click', _.before(5, addContactToList));\n * // => Allows adding up to 4 contacts to the list.\n */\n function before(n, func) {\n var result;\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n > 0) {\n result = func.apply(this, arguments);\n }\n if (n <= 1) {\n func = undefined;\n }\n return result;\n };\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of `thisArg`\n * and `partials` prepended to the arguments it receives.\n *\n * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for partially applied arguments.\n *\n * **Note:** Unlike native `Function#bind`, this method doesn't set the \"length\"\n * property of bound functions.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to bind.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * function greet(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n *\n * var object = { 'user': 'fred' };\n *\n * var bound = _.bind(greet, object, 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bind(greet, object, _, '!');\n * bound('hi');\n * // => 'hi fred!'\n */\n var bind = baseRest(function(func, thisArg, partials) {\n var bitmask = WRAP_BIND_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bind));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(func, bitmask, thisArg, partials, holders);\n });\n\n /**\n * Creates a function that invokes the method at `object[key]` with `partials`\n * prepended to the arguments it receives.\n *\n * This method differs from `_.bind` by allowing bound functions to reference\n * methods that may be redefined or don't yet exist. See\n * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)\n * for more details.\n *\n * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Function\n * @param {Object} object The object to invoke the method on.\n * @param {string} key The key of the method.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * var object = {\n * 'user': 'fred',\n * 'greet': function(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n * };\n *\n * var bound = _.bindKey(object, 'greet', 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * object.greet = function(greeting, punctuation) {\n * return greeting + 'ya ' + this.user + punctuation;\n * };\n *\n * bound('!');\n * // => 'hiya fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bindKey(object, 'greet', _, '!');\n * bound('hi');\n * // => 'hiya fred!'\n */\n var bindKey = baseRest(function(object, key, partials) {\n var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bindKey));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(key, bitmask, object, partials, holders);\n });\n\n /**\n * Creates a function that accepts arguments of `func` and either invokes\n * `func` returning its result, if at least `arity` number of arguments have\n * been provided, or returns a function that accepts the remaining `func`\n * arguments, and so on. The arity of `func` may be specified if `func.length`\n * is not sufficient.\n *\n * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curry(abc);\n *\n * curried(1)(2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(1)(_, 3)(2);\n * // => [1, 2, 3]\n */\n function curry(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curry.placeholder;\n return result;\n }\n\n /**\n * This method is like `_.curry` except that arguments are applied to `func`\n * in the manner of `_.partialRight` instead of `_.partial`.\n *\n * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curryRight(abc);\n *\n * curried(3)(2)(1);\n * // => [1, 2, 3]\n *\n * curried(2, 3)(1);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(3)(1, _)(2);\n * // => [1, 2, 3]\n */\n function curryRight(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curryRight.placeholder;\n return result;\n }\n\n /**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\n function debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n timeWaiting = wait - timeSinceLastCall;\n\n return maxing\n ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)\n : timeWaiting;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n clearTimeout(timerId);\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n }\n\n /**\n * Defers invoking the `func` until the current call stack has cleared. Any\n * additional arguments are provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to defer.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.defer(function(text) {\n * console.log(text);\n * }, 'deferred');\n * // => Logs 'deferred' after one millisecond.\n */\n var defer = baseRest(function(func, args) {\n return baseDelay(func, 1, args);\n });\n\n /**\n * Invokes `func` after `wait` milliseconds. Any additional arguments are\n * provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.delay(function(text) {\n * console.log(text);\n * }, 1000, 'later');\n * // => Logs 'later' after one second.\n */\n var delay = baseRest(function(func, wait, args) {\n return baseDelay(func, toNumber(wait) || 0, args);\n });\n\n /**\n * Creates a function that invokes `func` with arguments reversed.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to flip arguments for.\n * @returns {Function} Returns the new flipped function.\n * @example\n *\n * var flipped = _.flip(function() {\n * return _.toArray(arguments);\n * });\n *\n * flipped('a', 'b', 'c', 'd');\n * // => ['d', 'c', 'b', 'a']\n */\n function flip(func) {\n return createWrap(func, WRAP_FLIP_FLAG);\n }\n\n /**\n * Creates a function that memoizes the result of `func`. If `resolver` is\n * provided, it determines the cache key for storing the result based on the\n * arguments provided to the memoized function. By default, the first argument\n * provided to the memoized function is used as the map cache key. The `func`\n * is invoked with the `this` binding of the memoized function.\n *\n * **Note:** The cache is exposed as the `cache` property on the memoized\n * function. Its creation may be customized by replacing the `_.memoize.Cache`\n * constructor with one whose instances implement the\n * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)\n * method interface of `clear`, `delete`, `get`, `has`, and `set`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to have its output memoized.\n * @param {Function} [resolver] The function to resolve the cache key.\n * @returns {Function} Returns the new memoized function.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n * var other = { 'c': 3, 'd': 4 };\n *\n * var values = _.memoize(_.values);\n * values(object);\n * // => [1, 2]\n *\n * values(other);\n * // => [3, 4]\n *\n * object.a = 2;\n * values(object);\n * // => [1, 2]\n *\n * // Modify the result cache.\n * values.cache.set(object, ['a', 'b']);\n * values(object);\n * // => ['a', 'b']\n *\n * // Replace `_.memoize.Cache`.\n * _.memoize.Cache = WeakMap;\n */\n function memoize(func, resolver) {\n if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var memoized = function() {\n var args = arguments,\n key = resolver ? resolver.apply(this, args) : args[0],\n cache = memoized.cache;\n\n if (cache.has(key)) {\n return cache.get(key);\n }\n var result = func.apply(this, args);\n memoized.cache = cache.set(key, result) || cache;\n return result;\n };\n memoized.cache = new (memoize.Cache || MapCache);\n return memoized;\n }\n\n // Expose `MapCache`.\n memoize.Cache = MapCache;\n\n /**\n * Creates a function that negates the result of the predicate `func`. The\n * `func` predicate is invoked with the `this` binding and arguments of the\n * created function.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} predicate The predicate to negate.\n * @returns {Function} Returns the new negated function.\n * @example\n *\n * function isEven(n) {\n * return n % 2 == 0;\n * }\n *\n * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));\n * // => [1, 3, 5]\n */\n function negate(predicate) {\n if (typeof predicate != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return function() {\n var args = arguments;\n switch (args.length) {\n case 0: return !predicate.call(this);\n case 1: return !predicate.call(this, args[0]);\n case 2: return !predicate.call(this, args[0], args[1]);\n case 3: return !predicate.call(this, args[0], args[1], args[2]);\n }\n return !predicate.apply(this, args);\n };\n }\n\n /**\n * Creates a function that is restricted to invoking `func` once. Repeat calls\n * to the function return the value of the first invocation. The `func` is\n * invoked with the `this` binding and arguments of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var initialize = _.once(createApplication);\n * initialize();\n * initialize();\n * // => `createApplication` is invoked once\n */\n function once(func) {\n return before(2, func);\n }\n\n /**\n * Creates a function that invokes `func` with its arguments transformed.\n *\n * @static\n * @since 4.0.0\n * @memberOf _\n * @category Function\n * @param {Function} func The function to wrap.\n * @param {...(Function|Function[])} [transforms=[_.identity]]\n * The argument transforms.\n * @returns {Function} Returns the new function.\n * @example\n *\n * function doubled(n) {\n * return n * 2;\n * }\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var func = _.overArgs(function(x, y) {\n * return [x, y];\n * }, [square, doubled]);\n *\n * func(9, 3);\n * // => [81, 6]\n *\n * func(10, 5);\n * // => [100, 10]\n */\n var overArgs = castRest(function(func, transforms) {\n transforms = (transforms.length == 1 && isArray(transforms[0]))\n ? arrayMap(transforms[0], baseUnary(getIteratee()))\n : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));\n\n var funcsLength = transforms.length;\n return baseRest(function(args) {\n var index = -1,\n length = nativeMin(args.length, funcsLength);\n\n while (++index < length) {\n args[index] = transforms[index].call(this, args[index]);\n }\n return apply(func, this, args);\n });\n });\n\n /**\n * Creates a function that invokes `func` with `partials` prepended to the\n * arguments it receives. This method is like `_.bind` except it does **not**\n * alter the `this` binding.\n *\n * The `_.partial.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 0.2.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var sayHelloTo = _.partial(greet, 'hello');\n * sayHelloTo('fred');\n * // => 'hello fred'\n *\n * // Partially applied with placeholders.\n * var greetFred = _.partial(greet, _, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n */\n var partial = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partial));\n return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);\n });\n\n /**\n * This method is like `_.partial` except that partially applied arguments\n * are appended to the arguments it receives.\n *\n * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var greetFred = _.partialRight(greet, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n *\n * // Partially applied with placeholders.\n * var sayHelloTo = _.partialRight(greet, 'hello', _);\n * sayHelloTo('fred');\n * // => 'hello fred'\n */\n var partialRight = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partialRight));\n return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);\n });\n\n /**\n * Creates a function that invokes `func` with arguments arranged according\n * to the specified `indexes` where the argument value at the first index is\n * provided as the first argument, the argument value at the second index is\n * provided as the second argument, and so on.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to rearrange arguments for.\n * @param {...(number|number[])} indexes The arranged argument indexes.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var rearged = _.rearg(function(a, b, c) {\n * return [a, b, c];\n * }, [2, 0, 1]);\n *\n * rearged('b', 'c', 'a')\n * // => ['a', 'b', 'c']\n */\n var rearg = flatRest(function(func, indexes) {\n return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);\n });\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * created function and arguments from `start` and beyond provided as\n * an array.\n *\n * **Note:** This method is based on the\n * [rest parameter](https://mdn.io/rest_parameters).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.rest(function(what, names) {\n * return what + ' ' + _.initial(names).join(', ') +\n * (_.size(names) > 1 ? ', & ' : '') + _.last(names);\n * });\n *\n * say('hello', 'fred', 'barney', 'pebbles');\n * // => 'hello fred, barney, & pebbles'\n */\n function rest(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start === undefined ? start : toInteger(start);\n return baseRest(func, start);\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * create function and an array of arguments much like\n * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).\n *\n * **Note:** This method is based on the\n * [spread operator](https://mdn.io/spread_operator).\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Function\n * @param {Function} func The function to spread arguments over.\n * @param {number} [start=0] The start position of the spread.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.spread(function(who, what) {\n * return who + ' says ' + what;\n * });\n *\n * say(['fred', 'hello']);\n * // => 'fred says hello'\n *\n * var numbers = Promise.all([\n * Promise.resolve(40),\n * Promise.resolve(36)\n * ]);\n *\n * numbers.then(_.spread(function(x, y) {\n * return x + y;\n * }));\n * // => a Promise of 76\n */\n function spread(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start == null ? 0 : nativeMax(toInteger(start), 0);\n return baseRest(function(args) {\n var array = args[start],\n otherArgs = castSlice(args, 0, start);\n\n if (array) {\n arrayPush(otherArgs, array);\n }\n return apply(func, this, otherArgs);\n });\n }\n\n /**\n * Creates a throttled function that only invokes `func` at most once per\n * every `wait` milliseconds. The throttled function comes with a `cancel`\n * method to cancel delayed `func` invocations and a `flush` method to\n * immediately invoke them. Provide `options` to indicate whether `func`\n * should be invoked on the leading and/or trailing edge of the `wait`\n * timeout. The `func` is invoked with the last arguments provided to the\n * throttled function. Subsequent calls to the throttled function return the\n * result of the last `func` invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the throttled function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.throttle` and `_.debounce`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to throttle.\n * @param {number} [wait=0] The number of milliseconds to throttle invocations to.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=true]\n * Specify invoking on the leading edge of the timeout.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new throttled function.\n * @example\n *\n * // Avoid excessively updating the position while scrolling.\n * jQuery(window).on('scroll', _.throttle(updatePosition, 100));\n *\n * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.\n * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });\n * jQuery(element).on('click', throttled);\n *\n * // Cancel the trailing throttled invocation.\n * jQuery(window).on('popstate', throttled.cancel);\n */\n function throttle(func, wait, options) {\n var leading = true,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (isObject(options)) {\n leading = 'leading' in options ? !!options.leading : leading;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n return debounce(func, wait, {\n 'leading': leading,\n 'maxWait': wait,\n 'trailing': trailing\n });\n }\n\n /**\n * Creates a function that accepts up to one argument, ignoring any\n * additional arguments.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.unary(parseInt));\n * // => [6, 8, 10]\n */\n function unary(func) {\n return ary(func, 1);\n }\n\n /**\n * Creates a function that provides `value` to `wrapper` as its first\n * argument. Any additional arguments provided to the function are appended\n * to those provided to the `wrapper`. The wrapper is invoked with the `this`\n * binding of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {*} value The value to wrap.\n * @param {Function} [wrapper=identity] The wrapper function.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var p = _.wrap(_.escape, function(func, text) {\n * return '' + func(text) + '
';\n * });\n *\n * p('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles
'\n */\n function wrap(value, wrapper) {\n return partial(castFunction(wrapper), value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Casts `value` as an array if it's not one.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Lang\n * @param {*} value The value to inspect.\n * @returns {Array} Returns the cast array.\n * @example\n *\n * _.castArray(1);\n * // => [1]\n *\n * _.castArray({ 'a': 1 });\n * // => [{ 'a': 1 }]\n *\n * _.castArray('abc');\n * // => ['abc']\n *\n * _.castArray(null);\n * // => [null]\n *\n * _.castArray(undefined);\n * // => [undefined]\n *\n * _.castArray();\n * // => []\n *\n * var array = [1, 2, 3];\n * console.log(_.castArray(array) === array);\n * // => true\n */\n function castArray() {\n if (!arguments.length) {\n return [];\n }\n var value = arguments[0];\n return isArray(value) ? value : [value];\n }\n\n /**\n * Creates a shallow clone of `value`.\n *\n * **Note:** This method is loosely based on the\n * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)\n * and supports cloning arrays, array buffers, booleans, date objects, maps,\n * numbers, `Object` objects, regexes, sets, strings, symbols, and typed\n * arrays. The own enumerable properties of `arguments` objects are cloned\n * as plain objects. An empty object is returned for uncloneable values such\n * as error objects, functions, DOM nodes, and WeakMaps.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to clone.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeep\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var shallow = _.clone(objects);\n * console.log(shallow[0] === objects[0]);\n * // => true\n */\n function clone(value) {\n return baseClone(value, CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.clone` except that it accepts `customizer` which\n * is invoked to produce the cloned value. If `customizer` returns `undefined`,\n * cloning is handled by the method instead. The `customizer` is invoked with\n * up to four arguments; (value [, index|key, object, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeepWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(false);\n * }\n * }\n *\n * var el = _.cloneWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 0\n */\n function cloneWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * This method is like `_.clone` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @returns {*} Returns the deep cloned value.\n * @see _.clone\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var deep = _.cloneDeep(objects);\n * console.log(deep[0] === objects[0]);\n * // => false\n */\n function cloneDeep(value) {\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.cloneWith` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the deep cloned value.\n * @see _.cloneWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(true);\n * }\n * }\n *\n * var el = _.cloneDeepWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 20\n */\n function cloneDeepWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * Checks if `object` conforms to `source` by invoking the predicate\n * properties of `source` with the corresponding property values of `object`.\n *\n * **Note:** This method is equivalent to `_.conforms` when `source` is\n * partially applied.\n *\n * @static\n * @memberOf _\n * @since 4.14.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 1; } });\n * // => true\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 2; } });\n * // => false\n */\n function conformsTo(object, source) {\n return source == null || baseConformsTo(object, source, keys(source));\n }\n\n /**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\n function eq(value, other) {\n return value === other || (value !== value && other !== other);\n }\n\n /**\n * Checks if `value` is greater than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n * @see _.lt\n * @example\n *\n * _.gt(3, 1);\n * // => true\n *\n * _.gt(3, 3);\n * // => false\n *\n * _.gt(1, 3);\n * // => false\n */\n var gt = createRelationalOperation(baseGt);\n\n /**\n * Checks if `value` is greater than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than or equal to\n * `other`, else `false`.\n * @see _.lte\n * @example\n *\n * _.gte(3, 1);\n * // => true\n *\n * _.gte(3, 3);\n * // => true\n *\n * _.gte(1, 3);\n * // => false\n */\n var gte = createRelationalOperation(function(value, other) {\n return value >= other;\n });\n\n /**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n * else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\n var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n !propertyIsEnumerable.call(value, 'callee');\n };\n\n /**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\n var isArray = Array.isArray;\n\n /**\n * Checks if `value` is classified as an `ArrayBuffer` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n * @example\n *\n * _.isArrayBuffer(new ArrayBuffer(2));\n * // => true\n *\n * _.isArrayBuffer(new Array(2));\n * // => false\n */\n var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;\n\n /**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\n function isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n }\n\n /**\n * This method is like `_.isArrayLike` except that it also checks if `value`\n * is an object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array-like object,\n * else `false`.\n * @example\n *\n * _.isArrayLikeObject([1, 2, 3]);\n * // => true\n *\n * _.isArrayLikeObject(document.body.children);\n * // => true\n *\n * _.isArrayLikeObject('abc');\n * // => false\n *\n * _.isArrayLikeObject(_.noop);\n * // => false\n */\n function isArrayLikeObject(value) {\n return isObjectLike(value) && isArrayLike(value);\n }\n\n /**\n * Checks if `value` is classified as a boolean primitive or object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.\n * @example\n *\n * _.isBoolean(false);\n * // => true\n *\n * _.isBoolean(null);\n * // => false\n */\n function isBoolean(value) {\n return value === true || value === false ||\n (isObjectLike(value) && baseGetTag(value) == boolTag);\n }\n\n /**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\n var isBuffer = nativeIsBuffer || stubFalse;\n\n /**\n * Checks if `value` is classified as a `Date` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n * @example\n *\n * _.isDate(new Date);\n * // => true\n *\n * _.isDate('Mon April 23 2012');\n * // => false\n */\n var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;\n\n /**\n * Checks if `value` is likely a DOM element.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.\n * @example\n *\n * _.isElement(document.body);\n * // => true\n *\n * _.isElement('');\n * // => false\n */\n function isElement(value) {\n return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);\n }\n\n /**\n * Checks if `value` is an empty object, collection, map, or set.\n *\n * Objects are considered empty if they have no own enumerable string keyed\n * properties.\n *\n * Array-like values such as `arguments` objects, arrays, buffers, strings, or\n * jQuery-like collections are considered empty if they have a `length` of `0`.\n * Similarly, maps and sets are considered empty if they have a `size` of `0`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is empty, else `false`.\n * @example\n *\n * _.isEmpty(null);\n * // => true\n *\n * _.isEmpty(true);\n * // => true\n *\n * _.isEmpty(1);\n * // => true\n *\n * _.isEmpty([1, 2, 3]);\n * // => false\n *\n * _.isEmpty({ 'a': 1 });\n * // => false\n */\n function isEmpty(value) {\n if (value == null) {\n return true;\n }\n if (isArrayLike(value) &&\n (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||\n isBuffer(value) || isTypedArray(value) || isArguments(value))) {\n return !value.length;\n }\n var tag = getTag(value);\n if (tag == mapTag || tag == setTag) {\n return !value.size;\n }\n if (isPrototype(value)) {\n return !baseKeys(value).length;\n }\n for (var key in value) {\n if (hasOwnProperty.call(value, key)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\n function isEqual(value, other) {\n return baseIsEqual(value, other);\n }\n\n /**\n * This method is like `_.isEqual` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with up to\n * six arguments: (objValue, othValue [, index|key, object, other, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, othValue) {\n * if (isGreeting(objValue) && isGreeting(othValue)) {\n * return true;\n * }\n * }\n *\n * var array = ['hello', 'goodbye'];\n * var other = ['hi', 'goodbye'];\n *\n * _.isEqualWith(array, other, customizer);\n * // => true\n */\n function isEqualWith(value, other, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n var result = customizer ? customizer(value, other) : undefined;\n return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;\n }\n\n /**\n * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,\n * `SyntaxError`, `TypeError`, or `URIError` object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an error object, else `false`.\n * @example\n *\n * _.isError(new Error);\n * // => true\n *\n * _.isError(Error);\n * // => false\n */\n function isError(value) {\n if (!isObjectLike(value)) {\n return false;\n }\n var tag = baseGetTag(value);\n return tag == errorTag || tag == domExcTag ||\n (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));\n }\n\n /**\n * Checks if `value` is a finite primitive number.\n *\n * **Note:** This method is based on\n * [`Number.isFinite`](https://mdn.io/Number/isFinite).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.\n * @example\n *\n * _.isFinite(3);\n * // => true\n *\n * _.isFinite(Number.MIN_VALUE);\n * // => true\n *\n * _.isFinite(Infinity);\n * // => false\n *\n * _.isFinite('3');\n * // => false\n */\n function isFinite(value) {\n return typeof value == 'number' && nativeIsFinite(value);\n }\n\n /**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\n function isFunction(value) {\n if (!isObject(value)) {\n return false;\n }\n // The use of `Object#toString` avoids issues with the `typeof` operator\n // in Safari 9 which returns 'object' for typed arrays and other constructors.\n var tag = baseGetTag(value);\n return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n }\n\n /**\n * Checks if `value` is an integer.\n *\n * **Note:** This method is based on\n * [`Number.isInteger`](https://mdn.io/Number/isInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an integer, else `false`.\n * @example\n *\n * _.isInteger(3);\n * // => true\n *\n * _.isInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isInteger(Infinity);\n * // => false\n *\n * _.isInteger('3');\n * // => false\n */\n function isInteger(value) {\n return typeof value == 'number' && value == toInteger(value);\n }\n\n /**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\n function isLength(value) {\n return typeof value == 'number' &&\n value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\n function isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n }\n\n /**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\n function isObjectLike(value) {\n return value != null && typeof value == 'object';\n }\n\n /**\n * Checks if `value` is classified as a `Map` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n * @example\n *\n * _.isMap(new Map);\n * // => true\n *\n * _.isMap(new WeakMap);\n * // => false\n */\n var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;\n\n /**\n * Performs a partial deep comparison between `object` and `source` to\n * determine if `object` contains equivalent property values.\n *\n * **Note:** This method is equivalent to `_.matches` when `source` is\n * partially applied.\n *\n * Partial comparisons will match empty array and empty object `source`\n * values against any array or object value, respectively. See `_.isEqual`\n * for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.isMatch(object, { 'b': 2 });\n * // => true\n *\n * _.isMatch(object, { 'b': 1 });\n * // => false\n */\n function isMatch(object, source) {\n return object === source || baseIsMatch(object, source, getMatchData(source));\n }\n\n /**\n * This method is like `_.isMatch` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with five\n * arguments: (objValue, srcValue, index|key, object, source).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, srcValue) {\n * if (isGreeting(objValue) && isGreeting(srcValue)) {\n * return true;\n * }\n * }\n *\n * var object = { 'greeting': 'hello' };\n * var source = { 'greeting': 'hi' };\n *\n * _.isMatchWith(object, source, customizer);\n * // => true\n */\n function isMatchWith(object, source, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseIsMatch(object, source, getMatchData(source), customizer);\n }\n\n /**\n * Checks if `value` is `NaN`.\n *\n * **Note:** This method is based on\n * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as\n * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for\n * `undefined` and other non-number values.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n * @example\n *\n * _.isNaN(NaN);\n * // => true\n *\n * _.isNaN(new Number(NaN));\n * // => true\n *\n * isNaN(undefined);\n * // => true\n *\n * _.isNaN(undefined);\n * // => false\n */\n function isNaN(value) {\n // An `NaN` primitive is the only value that is not equal to itself.\n // Perform the `toStringTag` check first to avoid errors with some\n // ActiveX objects in IE.\n return isNumber(value) && value != +value;\n }\n\n /**\n * Checks if `value` is a pristine native function.\n *\n * **Note:** This method can't reliably detect native functions in the presence\n * of the core-js package because core-js circumvents this kind of detection.\n * Despite multiple requests, the core-js maintainer has made it clear: any\n * attempt to fix the detection will be obstructed. As a result, we're left\n * with little choice but to throw an error. Unfortunately, this also affects\n * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),\n * which rely on core-js.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n * @example\n *\n * _.isNative(Array.prototype.push);\n * // => true\n *\n * _.isNative(_);\n * // => false\n */\n function isNative(value) {\n if (isMaskable(value)) {\n throw new Error(CORE_ERROR_TEXT);\n }\n return baseIsNative(value);\n }\n\n /**\n * Checks if `value` is `null`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `null`, else `false`.\n * @example\n *\n * _.isNull(null);\n * // => true\n *\n * _.isNull(void 0);\n * // => false\n */\n function isNull(value) {\n return value === null;\n }\n\n /**\n * Checks if `value` is `null` or `undefined`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is nullish, else `false`.\n * @example\n *\n * _.isNil(null);\n * // => true\n *\n * _.isNil(void 0);\n * // => true\n *\n * _.isNil(NaN);\n * // => false\n */\n function isNil(value) {\n return value == null;\n }\n\n /**\n * Checks if `value` is classified as a `Number` primitive or object.\n *\n * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are\n * classified as numbers, use the `_.isFinite` method.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a number, else `false`.\n * @example\n *\n * _.isNumber(3);\n * // => true\n *\n * _.isNumber(Number.MIN_VALUE);\n * // => true\n *\n * _.isNumber(Infinity);\n * // => true\n *\n * _.isNumber('3');\n * // => false\n */\n function isNumber(value) {\n return typeof value == 'number' ||\n (isObjectLike(value) && baseGetTag(value) == numberTag);\n }\n\n /**\n * Checks if `value` is a plain object, that is, an object created by the\n * `Object` constructor or one with a `[[Prototype]]` of `null`.\n *\n * @static\n * @memberOf _\n * @since 0.8.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * _.isPlainObject(new Foo);\n * // => false\n *\n * _.isPlainObject([1, 2, 3]);\n * // => false\n *\n * _.isPlainObject({ 'x': 0, 'y': 0 });\n * // => true\n *\n * _.isPlainObject(Object.create(null));\n * // => true\n */\n function isPlainObject(value) {\n if (!isObjectLike(value) || baseGetTag(value) != objectTag) {\n return false;\n }\n var proto = getPrototype(value);\n if (proto === null) {\n return true;\n }\n var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;\n return typeof Ctor == 'function' && Ctor instanceof Ctor &&\n funcToString.call(Ctor) == objectCtorString;\n }\n\n /**\n * Checks if `value` is classified as a `RegExp` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n * @example\n *\n * _.isRegExp(/abc/);\n * // => true\n *\n * _.isRegExp('/abc/');\n * // => false\n */\n var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;\n\n /**\n * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754\n * double precision number which isn't the result of a rounded unsafe integer.\n *\n * **Note:** This method is based on\n * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.\n * @example\n *\n * _.isSafeInteger(3);\n * // => true\n *\n * _.isSafeInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isSafeInteger(Infinity);\n * // => false\n *\n * _.isSafeInteger('3');\n * // => false\n */\n function isSafeInteger(value) {\n return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is classified as a `Set` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n * @example\n *\n * _.isSet(new Set);\n * // => true\n *\n * _.isSet(new WeakSet);\n * // => false\n */\n var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;\n\n /**\n * Checks if `value` is classified as a `String` primitive or object.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a string, else `false`.\n * @example\n *\n * _.isString('abc');\n * // => true\n *\n * _.isString(1);\n * // => false\n */\n function isString(value) {\n return typeof value == 'string' ||\n (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);\n }\n\n /**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\n function isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && baseGetTag(value) == symbolTag);\n }\n\n /**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\n var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\n /**\n * Checks if `value` is `undefined`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.\n * @example\n *\n * _.isUndefined(void 0);\n * // => true\n *\n * _.isUndefined(null);\n * // => false\n */\n function isUndefined(value) {\n return value === undefined;\n }\n\n /**\n * Checks if `value` is classified as a `WeakMap` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.\n * @example\n *\n * _.isWeakMap(new WeakMap);\n * // => true\n *\n * _.isWeakMap(new Map);\n * // => false\n */\n function isWeakMap(value) {\n return isObjectLike(value) && getTag(value) == weakMapTag;\n }\n\n /**\n * Checks if `value` is classified as a `WeakSet` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.\n * @example\n *\n * _.isWeakSet(new WeakSet);\n * // => true\n *\n * _.isWeakSet(new Set);\n * // => false\n */\n function isWeakSet(value) {\n return isObjectLike(value) && baseGetTag(value) == weakSetTag;\n }\n\n /**\n * Checks if `value` is less than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n * @see _.gt\n * @example\n *\n * _.lt(1, 3);\n * // => true\n *\n * _.lt(3, 3);\n * // => false\n *\n * _.lt(3, 1);\n * // => false\n */\n var lt = createRelationalOperation(baseLt);\n\n /**\n * Checks if `value` is less than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than or equal to\n * `other`, else `false`.\n * @see _.gte\n * @example\n *\n * _.lte(1, 3);\n * // => true\n *\n * _.lte(3, 3);\n * // => true\n *\n * _.lte(3, 1);\n * // => false\n */\n var lte = createRelationalOperation(function(value, other) {\n return value <= other;\n });\n\n /**\n * Converts `value` to an array.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Array} Returns the converted array.\n * @example\n *\n * _.toArray({ 'a': 1, 'b': 2 });\n * // => [1, 2]\n *\n * _.toArray('abc');\n * // => ['a', 'b', 'c']\n *\n * _.toArray(1);\n * // => []\n *\n * _.toArray(null);\n * // => []\n */\n function toArray(value) {\n if (!value) {\n return [];\n }\n if (isArrayLike(value)) {\n return isString(value) ? stringToArray(value) : copyArray(value);\n }\n if (symIterator && value[symIterator]) {\n return iteratorToArray(value[symIterator]());\n }\n var tag = getTag(value),\n func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);\n\n return func(value);\n }\n\n /**\n * Converts `value` to a finite number.\n *\n * @static\n * @memberOf _\n * @since 4.12.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted number.\n * @example\n *\n * _.toFinite(3.2);\n * // => 3.2\n *\n * _.toFinite(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toFinite(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toFinite('3.2');\n * // => 3.2\n */\n function toFinite(value) {\n if (!value) {\n return value === 0 ? value : 0;\n }\n value = toNumber(value);\n if (value === INFINITY || value === -INFINITY) {\n var sign = (value < 0 ? -1 : 1);\n return sign * MAX_INTEGER;\n }\n return value === value ? value : 0;\n }\n\n /**\n * Converts `value` to an integer.\n *\n * **Note:** This method is loosely based on\n * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toInteger(3.2);\n * // => 3\n *\n * _.toInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toInteger(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toInteger('3.2');\n * // => 3\n */\n function toInteger(value) {\n var result = toFinite(value),\n remainder = result % 1;\n\n return result === result ? (remainder ? result - remainder : result) : 0;\n }\n\n /**\n * Converts `value` to an integer suitable for use as the length of an\n * array-like object.\n *\n * **Note:** This method is based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toLength(3.2);\n * // => 3\n *\n * _.toLength(Number.MIN_VALUE);\n * // => 0\n *\n * _.toLength(Infinity);\n * // => 4294967295\n *\n * _.toLength('3.2');\n * // => 3\n */\n function toLength(value) {\n return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;\n }\n\n /**\n * Converts `value` to a number.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n * @example\n *\n * _.toNumber(3.2);\n * // => 3.2\n *\n * _.toNumber(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toNumber(Infinity);\n * // => Infinity\n *\n * _.toNumber('3.2');\n * // => 3.2\n */\n function toNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n if (isObject(value)) {\n var other = typeof value.valueOf == 'function' ? value.valueOf() : value;\n value = isObject(other) ? (other + '') : other;\n }\n if (typeof value != 'string') {\n return value === 0 ? value : +value;\n }\n value = baseTrim(value);\n var isBinary = reIsBinary.test(value);\n return (isBinary || reIsOctal.test(value))\n ? freeParseInt(value.slice(2), isBinary ? 2 : 8)\n : (reIsBadHex.test(value) ? NAN : +value);\n }\n\n /**\n * Converts `value` to a plain object flattening inherited enumerable string\n * keyed properties of `value` to own properties of the plain object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Object} Returns the converted plain object.\n * @example\n *\n * function Foo() {\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.assign({ 'a': 1 }, new Foo);\n * // => { 'a': 1, 'b': 2 }\n *\n * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));\n * // => { 'a': 1, 'b': 2, 'c': 3 }\n */\n function toPlainObject(value) {\n return copyObject(value, keysIn(value));\n }\n\n /**\n * Converts `value` to a safe integer. A safe integer can be compared and\n * represented correctly.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toSafeInteger(3.2);\n * // => 3\n *\n * _.toSafeInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toSafeInteger(Infinity);\n * // => 9007199254740991\n *\n * _.toSafeInteger('3.2');\n * // => 3\n */\n function toSafeInteger(value) {\n return value\n ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)\n : (value === 0 ? value : 0);\n }\n\n /**\n * Converts `value` to a string. An empty string is returned for `null`\n * and `undefined` values. The sign of `-0` is preserved.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.toString(null);\n * // => ''\n *\n * _.toString(-0);\n * // => '-0'\n *\n * _.toString([1, 2, 3]);\n * // => '1,2,3'\n */\n function toString(value) {\n return value == null ? '' : baseToString(value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Assigns own enumerable string keyed properties of source objects to the\n * destination object. Source objects are applied from left to right.\n * Subsequent sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object` and is loosely based on\n * [`Object.assign`](https://mdn.io/Object/assign).\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assignIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assign({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'c': 3 }\n */\n var assign = createAssigner(function(object, source) {\n if (isPrototype(source) || isArrayLike(source)) {\n copyObject(source, keys(source), object);\n return;\n }\n for (var key in source) {\n if (hasOwnProperty.call(source, key)) {\n assignValue(object, key, source[key]);\n }\n }\n });\n\n /**\n * This method is like `_.assign` except that it iterates over own and\n * inherited source properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extend\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assign\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assignIn({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }\n */\n var assignIn = createAssigner(function(object, source) {\n copyObject(source, keysIn(source), object);\n });\n\n /**\n * This method is like `_.assignIn` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extendWith\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignInWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keysIn(source), object, customizer);\n });\n\n /**\n * This method is like `_.assign` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignInWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keys(source), object, customizer);\n });\n\n /**\n * Creates an array of values corresponding to `paths` of `object`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Array} Returns the picked values.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _.at(object, ['a[0].b.c', 'a[1]']);\n * // => [3, 4]\n */\n var at = flatRest(baseAt);\n\n /**\n * Creates an object that inherits from the `prototype` object. If a\n * `properties` object is given, its own enumerable string keyed properties\n * are assigned to the created object.\n *\n * @static\n * @memberOf _\n * @since 2.3.0\n * @category Object\n * @param {Object} prototype The object to inherit from.\n * @param {Object} [properties] The properties to assign to the object.\n * @returns {Object} Returns the new object.\n * @example\n *\n * function Shape() {\n * this.x = 0;\n * this.y = 0;\n * }\n *\n * function Circle() {\n * Shape.call(this);\n * }\n *\n * Circle.prototype = _.create(Shape.prototype, {\n * 'constructor': Circle\n * });\n *\n * var circle = new Circle;\n * circle instanceof Circle;\n * // => true\n *\n * circle instanceof Shape;\n * // => true\n */\n function create(prototype, properties) {\n var result = baseCreate(prototype);\n return properties == null ? result : baseAssign(result, properties);\n }\n\n /**\n * Assigns own and inherited enumerable string keyed properties of source\n * objects to the destination object for all destination properties that\n * resolve to `undefined`. Source objects are applied from left to right.\n * Once a property is set, additional values of the same property are ignored.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaultsDeep\n * @example\n *\n * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var defaults = baseRest(function(object, sources) {\n object = Object(object);\n\n var index = -1;\n var length = sources.length;\n var guard = length > 2 ? sources[2] : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n length = 1;\n }\n\n while (++index < length) {\n var source = sources[index];\n var props = keysIn(source);\n var propsIndex = -1;\n var propsLength = props.length;\n\n while (++propsIndex < propsLength) {\n var key = props[propsIndex];\n var value = object[key];\n\n if (value === undefined ||\n (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n object[key] = source[key];\n }\n }\n }\n\n return object;\n });\n\n /**\n * This method is like `_.defaults` except that it recursively assigns\n * default properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaults\n * @example\n *\n * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });\n * // => { 'a': { 'b': 2, 'c': 3 } }\n */\n var defaultsDeep = baseRest(function(args) {\n args.push(undefined, customDefaultsMerge);\n return apply(mergeWith, undefined, args);\n });\n\n /**\n * This method is like `_.find` except that it returns the key of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findKey(users, function(o) { return o.age < 40; });\n * // => 'barney' (iteration order is not guaranteed)\n *\n * // The `_.matches` iteratee shorthand.\n * _.findKey(users, { 'age': 1, 'active': true });\n * // => 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findKey(users, 'active');\n * // => 'barney'\n */\n function findKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);\n }\n\n /**\n * This method is like `_.findKey` except that it iterates over elements of\n * a collection in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findLastKey(users, function(o) { return o.age < 40; });\n * // => returns 'pebbles' assuming `_.findKey` returns 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastKey(users, { 'age': 36, 'active': true });\n * // => 'barney'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastKey(users, 'active');\n * // => 'pebbles'\n */\n function findLastKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);\n }\n\n /**\n * Iterates over own and inherited enumerable string keyed properties of an\n * object and invokes `iteratee` for each property. The iteratee is invoked\n * with three arguments: (value, key, object). Iteratee functions may exit\n * iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forInRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forIn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).\n */\n function forIn(object, iteratee) {\n return object == null\n ? object\n : baseFor(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * This method is like `_.forIn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forInRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.\n */\n function forInRight(object, iteratee) {\n return object == null\n ? object\n : baseForRight(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * Iterates over own enumerable string keyed properties of an object and\n * invokes `iteratee` for each property. The iteratee is invoked with three\n * arguments: (value, key, object). Iteratee functions may exit iteration\n * early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwnRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forOwn(object, iteratee) {\n return object && baseForOwn(object, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forOwn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwnRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.\n */\n function forOwnRight(object, iteratee) {\n return object && baseForOwnRight(object, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an array of function property names from own enumerable properties\n * of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functionsIn\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functions(new Foo);\n * // => ['a', 'b']\n */\n function functions(object) {\n return object == null ? [] : baseFunctions(object, keys(object));\n }\n\n /**\n * Creates an array of function property names from own and inherited\n * enumerable properties of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functions\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functionsIn(new Foo);\n * // => ['a', 'b', 'c']\n */\n function functionsIn(object) {\n return object == null ? [] : baseFunctions(object, keysIn(object));\n }\n\n /**\n * Gets the value at `path` of `object`. If the resolved value is\n * `undefined`, the `defaultValue` is returned in its place.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.get(object, 'a[0].b.c');\n * // => 3\n *\n * _.get(object, ['a', '0', 'b', 'c']);\n * // => 3\n *\n * _.get(object, 'a.b.c', 'default');\n * // => 'default'\n */\n function get(object, path, defaultValue) {\n var result = object == null ? undefined : baseGet(object, path);\n return result === undefined ? defaultValue : result;\n }\n\n /**\n * Checks if `path` is a direct property of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = { 'a': { 'b': 2 } };\n * var other = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.has(object, 'a');\n * // => true\n *\n * _.has(object, 'a.b');\n * // => true\n *\n * _.has(object, ['a', 'b']);\n * // => true\n *\n * _.has(other, 'a');\n * // => false\n */\n function has(object, path) {\n return object != null && hasPath(object, path, baseHas);\n }\n\n /**\n * Checks if `path` is a direct or inherited property of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.hasIn(object, 'a');\n * // => true\n *\n * _.hasIn(object, 'a.b');\n * // => true\n *\n * _.hasIn(object, ['a', 'b']);\n * // => true\n *\n * _.hasIn(object, 'b');\n * // => false\n */\n function hasIn(object, path) {\n return object != null && hasPath(object, path, baseHasIn);\n }\n\n /**\n * Creates an object composed of the inverted keys and values of `object`.\n * If `object` contains duplicate values, subsequent values overwrite\n * property assignments of previous values.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Object\n * @param {Object} object The object to invert.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invert(object);\n * // => { '1': 'c', '2': 'b' }\n */\n var invert = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n result[value] = key;\n }, constant(identity));\n\n /**\n * This method is like `_.invert` except that the inverted object is generated\n * from the results of running each element of `object` thru `iteratee`. The\n * corresponding inverted value of each inverted key is an array of keys\n * responsible for generating the inverted value. The iteratee is invoked\n * with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Object\n * @param {Object} object The object to invert.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invertBy(object);\n * // => { '1': ['a', 'c'], '2': ['b'] }\n *\n * _.invertBy(object, function(value) {\n * return 'group' + value;\n * });\n * // => { 'group1': ['a', 'c'], 'group2': ['b'] }\n */\n var invertBy = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n if (hasOwnProperty.call(result, value)) {\n result[value].push(key);\n } else {\n result[value] = [key];\n }\n }, getIteratee);\n\n /**\n * Invokes the method at `path` of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };\n *\n * _.invoke(object, 'a[0].b.c.slice', 1, 3);\n * // => [2, 3]\n */\n var invoke = baseRest(baseInvoke);\n\n /**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\n function keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n }\n\n /**\n * Creates an array of the own and inherited enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keysIn(new Foo);\n * // => ['a', 'b', 'c'] (iteration order is not guaranteed)\n */\n function keysIn(object) {\n return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);\n }\n\n /**\n * The opposite of `_.mapValues`; this method creates an object with the\n * same values as `object` and keys generated by running each own enumerable\n * string keyed property of `object` thru `iteratee`. The iteratee is invoked\n * with three arguments: (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapValues\n * @example\n *\n * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {\n * return key + value;\n * });\n * // => { 'a1': 1, 'b2': 2 }\n */\n function mapKeys(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, iteratee(value, key, object), value);\n });\n return result;\n }\n\n /**\n * Creates an object with the same keys as `object` and values generated\n * by running each own enumerable string keyed property of `object` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapKeys\n * @example\n *\n * var users = {\n * 'fred': { 'user': 'fred', 'age': 40 },\n * 'pebbles': { 'user': 'pebbles', 'age': 1 }\n * };\n *\n * _.mapValues(users, function(o) { return o.age; });\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n *\n * // The `_.property` iteratee shorthand.\n * _.mapValues(users, 'age');\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n */\n function mapValues(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, key, iteratee(value, key, object));\n });\n return result;\n }\n\n /**\n * This method is like `_.assign` except that it recursively merges own and\n * inherited enumerable string keyed properties of source objects into the\n * destination object. Source properties that resolve to `undefined` are\n * skipped if a destination value exists. Array and plain object properties\n * are merged recursively. Other objects and value types are overridden by\n * assignment. Source objects are applied from left to right. Subsequent\n * sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {\n * 'a': [{ 'b': 2 }, { 'd': 4 }]\n * };\n *\n * var other = {\n * 'a': [{ 'c': 3 }, { 'e': 5 }]\n * };\n *\n * _.merge(object, other);\n * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }\n */\n var merge = createAssigner(function(object, source, srcIndex) {\n baseMerge(object, source, srcIndex);\n });\n\n /**\n * This method is like `_.merge` except that it accepts `customizer` which\n * is invoked to produce the merged values of the destination and source\n * properties. If `customizer` returns `undefined`, merging is handled by the\n * method instead. The `customizer` is invoked with six arguments:\n * (objValue, srcValue, key, object, source, stack).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} customizer The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * function customizer(objValue, srcValue) {\n * if (_.isArray(objValue)) {\n * return objValue.concat(srcValue);\n * }\n * }\n *\n * var object = { 'a': [1], 'b': [2] };\n * var other = { 'a': [3], 'b': [4] };\n *\n * _.mergeWith(object, other, customizer);\n * // => { 'a': [1, 3], 'b': [2, 4] }\n */\n var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {\n baseMerge(object, source, srcIndex, customizer);\n });\n\n /**\n * The opposite of `_.pick`; this method creates an object composed of the\n * own and inherited enumerable property paths of `object` that are not omitted.\n *\n * **Note:** This method is considerably slower than `_.pick`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to omit.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omit(object, ['a', 'c']);\n * // => { 'b': '2' }\n */\n var omit = flatRest(function(object, paths) {\n var result = {};\n if (object == null) {\n return result;\n }\n var isDeep = false;\n paths = arrayMap(paths, function(path) {\n path = castPath(path, object);\n isDeep || (isDeep = path.length > 1);\n return path;\n });\n copyObject(object, getAllKeysIn(object), result);\n if (isDeep) {\n result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);\n }\n var length = paths.length;\n while (length--) {\n baseUnset(result, paths[length]);\n }\n return result;\n });\n\n /**\n * The opposite of `_.pickBy`; this method creates an object composed of\n * the own and inherited enumerable string keyed properties of `object` that\n * `predicate` doesn't return truthy for. The predicate is invoked with two\n * arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omitBy(object, _.isNumber);\n * // => { 'b': '2' }\n */\n function omitBy(object, predicate) {\n return pickBy(object, negate(getIteratee(predicate)));\n }\n\n /**\n * Creates an object composed of the picked `object` properties.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pick(object, ['a', 'c']);\n * // => { 'a': 1, 'c': 3 }\n */\n var pick = flatRest(function(object, paths) {\n return object == null ? {} : basePick(object, paths);\n });\n\n /**\n * Creates an object composed of the `object` properties `predicate` returns\n * truthy for. The predicate is invoked with two arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pickBy(object, _.isNumber);\n * // => { 'a': 1, 'c': 3 }\n */\n function pickBy(object, predicate) {\n if (object == null) {\n return {};\n }\n var props = arrayMap(getAllKeysIn(object), function(prop) {\n return [prop];\n });\n predicate = getIteratee(predicate);\n return basePickBy(object, props, function(value, path) {\n return predicate(value, path[0]);\n });\n }\n\n /**\n * This method is like `_.get` except that if the resolved value is a\n * function it's invoked with the `this` binding of its parent object and\n * its result is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to resolve.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };\n *\n * _.result(object, 'a[0].b.c1');\n * // => 3\n *\n * _.result(object, 'a[0].b.c2');\n * // => 4\n *\n * _.result(object, 'a[0].b.c3', 'default');\n * // => 'default'\n *\n * _.result(object, 'a[0].b.c3', _.constant('default'));\n * // => 'default'\n */\n function result(object, path, defaultValue) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length;\n\n // Ensure the loop is entered when path is empty.\n if (!length) {\n length = 1;\n object = undefined;\n }\n while (++index < length) {\n var value = object == null ? undefined : object[toKey(path[index])];\n if (value === undefined) {\n index = length;\n value = defaultValue;\n }\n object = isFunction(value) ? value.call(object) : value;\n }\n return object;\n }\n\n /**\n * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,\n * it's created. Arrays are created for missing index properties while objects\n * are created for all other missing properties. Use `_.setWith` to customize\n * `path` creation.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.set(object, 'a[0].b.c', 4);\n * console.log(object.a[0].b.c);\n * // => 4\n *\n * _.set(object, ['x', '0', 'y', 'z'], 5);\n * console.log(object.x[0].y.z);\n * // => 5\n */\n function set(object, path, value) {\n return object == null ? object : baseSet(object, path, value);\n }\n\n /**\n * This method is like `_.set` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.setWith(object, '[0][1]', 'a', Object);\n * // => { '0': { '1': 'a' } }\n */\n function setWith(object, path, value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseSet(object, path, value, customizer);\n }\n\n /**\n * Creates an array of own enumerable string keyed-value pairs for `object`\n * which can be consumed by `_.fromPairs`. If `object` is a map or set, its\n * entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entries\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairs(new Foo);\n * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)\n */\n var toPairs = createToPairs(keys);\n\n /**\n * Creates an array of own and inherited enumerable string keyed-value pairs\n * for `object` which can be consumed by `_.fromPairs`. If `object` is a map\n * or set, its entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entriesIn\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairsIn(new Foo);\n * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)\n */\n var toPairsIn = createToPairs(keysIn);\n\n /**\n * An alternative to `_.reduce`; this method transforms `object` to a new\n * `accumulator` object which is the result of running each of its own\n * enumerable string keyed properties thru `iteratee`, with each invocation\n * potentially mutating the `accumulator` object. If `accumulator` is not\n * provided, a new object with the same `[[Prototype]]` will be used. The\n * iteratee is invoked with four arguments: (accumulator, value, key, object).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The custom accumulator value.\n * @returns {*} Returns the accumulated value.\n * @example\n *\n * _.transform([2, 3, 4], function(result, n) {\n * result.push(n *= n);\n * return n % 2 == 0;\n * }, []);\n * // => [4, 9]\n *\n * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] }\n */\n function transform(object, iteratee, accumulator) {\n var isArr = isArray(object),\n isArrLike = isArr || isBuffer(object) || isTypedArray(object);\n\n iteratee = getIteratee(iteratee, 4);\n if (accumulator == null) {\n var Ctor = object && object.constructor;\n if (isArrLike) {\n accumulator = isArr ? new Ctor : [];\n }\n else if (isObject(object)) {\n accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};\n }\n else {\n accumulator = {};\n }\n }\n (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {\n return iteratee(accumulator, value, index, object);\n });\n return accumulator;\n }\n\n /**\n * Removes the property at `path` of `object`.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 7 } }] };\n * _.unset(object, 'a[0].b.c');\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n *\n * _.unset(object, ['a', '0', 'b', 'c']);\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n */\n function unset(object, path) {\n return object == null ? true : baseUnset(object, path);\n }\n\n /**\n * This method is like `_.set` except that accepts `updater` to produce the\n * value to set. Use `_.updateWith` to customize `path` creation. The `updater`\n * is invoked with one argument: (value).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.update(object, 'a[0].b.c', function(n) { return n * n; });\n * console.log(object.a[0].b.c);\n * // => 9\n *\n * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });\n * console.log(object.x[0].y.z);\n * // => 0\n */\n function update(object, path, updater) {\n return object == null ? object : baseUpdate(object, path, castFunction(updater));\n }\n\n /**\n * This method is like `_.update` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.updateWith(object, '[0][1]', _.constant('a'), Object);\n * // => { '0': { '1': 'a' } }\n */\n function updateWith(object, path, updater, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);\n }\n\n /**\n * Creates an array of the own enumerable string keyed property values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.values(new Foo);\n * // => [1, 2] (iteration order is not guaranteed)\n *\n * _.values('hi');\n * // => ['h', 'i']\n */\n function values(object) {\n return object == null ? [] : baseValues(object, keys(object));\n }\n\n /**\n * Creates an array of the own and inherited enumerable string keyed property\n * values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.valuesIn(new Foo);\n * // => [1, 2, 3] (iteration order is not guaranteed)\n */\n function valuesIn(object) {\n return object == null ? [] : baseValues(object, keysIn(object));\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Clamps `number` within the inclusive `lower` and `upper` bounds.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Number\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n * @example\n *\n * _.clamp(-10, -5, 5);\n * // => -5\n *\n * _.clamp(10, -5, 5);\n * // => 5\n */\n function clamp(number, lower, upper) {\n if (upper === undefined) {\n upper = lower;\n lower = undefined;\n }\n if (upper !== undefined) {\n upper = toNumber(upper);\n upper = upper === upper ? upper : 0;\n }\n if (lower !== undefined) {\n lower = toNumber(lower);\n lower = lower === lower ? lower : 0;\n }\n return baseClamp(toNumber(number), lower, upper);\n }\n\n /**\n * Checks if `n` is between `start` and up to, but not including, `end`. If\n * `end` is not specified, it's set to `start` with `start` then set to `0`.\n * If `start` is greater than `end` the params are swapped to support\n * negative ranges.\n *\n * @static\n * @memberOf _\n * @since 3.3.0\n * @category Number\n * @param {number} number The number to check.\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n * @see _.range, _.rangeRight\n * @example\n *\n * _.inRange(3, 2, 4);\n * // => true\n *\n * _.inRange(4, 8);\n * // => true\n *\n * _.inRange(4, 2);\n * // => false\n *\n * _.inRange(2, 2);\n * // => false\n *\n * _.inRange(1.2, 2);\n * // => true\n *\n * _.inRange(5.2, 4);\n * // => false\n *\n * _.inRange(-3, -2, -6);\n * // => true\n */\n function inRange(number, start, end) {\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n number = toNumber(number);\n return baseInRange(number, start, end);\n }\n\n /**\n * Produces a random number between the inclusive `lower` and `upper` bounds.\n * If only one argument is provided a number between `0` and the given number\n * is returned. If `floating` is `true`, or either `lower` or `upper` are\n * floats, a floating-point number is returned instead of an integer.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Number\n * @param {number} [lower=0] The lower bound.\n * @param {number} [upper=1] The upper bound.\n * @param {boolean} [floating] Specify returning a floating-point number.\n * @returns {number} Returns the random number.\n * @example\n *\n * _.random(0, 5);\n * // => an integer between 0 and 5\n *\n * _.random(5);\n * // => also an integer between 0 and 5\n *\n * _.random(5, true);\n * // => a floating-point number between 0 and 5\n *\n * _.random(1.2, 5.2);\n * // => a floating-point number between 1.2 and 5.2\n */\n function random(lower, upper, floating) {\n if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {\n upper = floating = undefined;\n }\n if (floating === undefined) {\n if (typeof upper == 'boolean') {\n floating = upper;\n upper = undefined;\n }\n else if (typeof lower == 'boolean') {\n floating = lower;\n lower = undefined;\n }\n }\n if (lower === undefined && upper === undefined) {\n lower = 0;\n upper = 1;\n }\n else {\n lower = toFinite(lower);\n if (upper === undefined) {\n upper = lower;\n lower = 0;\n } else {\n upper = toFinite(upper);\n }\n }\n if (lower > upper) {\n var temp = lower;\n lower = upper;\n upper = temp;\n }\n if (floating || lower % 1 || upper % 1) {\n var rand = nativeRandom();\n return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);\n }\n return baseRandom(lower, upper);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the camel cased string.\n * @example\n *\n * _.camelCase('Foo Bar');\n * // => 'fooBar'\n *\n * _.camelCase('--foo-bar--');\n * // => 'fooBar'\n *\n * _.camelCase('__FOO_BAR__');\n * // => 'fooBar'\n */\n var camelCase = createCompounder(function(result, word, index) {\n word = word.toLowerCase();\n return result + (index ? capitalize(word) : word);\n });\n\n /**\n * Converts the first character of `string` to upper case and the remaining\n * to lower case.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to capitalize.\n * @returns {string} Returns the capitalized string.\n * @example\n *\n * _.capitalize('FRED');\n * // => 'Fred'\n */\n function capitalize(string) {\n return upperFirst(toString(string).toLowerCase());\n }\n\n /**\n * Deburrs `string` by converting\n * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)\n * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)\n * letters to basic Latin letters and removing\n * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to deburr.\n * @returns {string} Returns the deburred string.\n * @example\n *\n * _.deburr('déjà vu');\n * // => 'deja vu'\n */\n function deburr(string) {\n string = toString(string);\n return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');\n }\n\n /**\n * Checks if `string` ends with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=string.length] The position to search up to.\n * @returns {boolean} Returns `true` if `string` ends with `target`,\n * else `false`.\n * @example\n *\n * _.endsWith('abc', 'c');\n * // => true\n *\n * _.endsWith('abc', 'b');\n * // => false\n *\n * _.endsWith('abc', 'b', 2);\n * // => true\n */\n function endsWith(string, target, position) {\n string = toString(string);\n target = baseToString(target);\n\n var length = string.length;\n position = position === undefined\n ? length\n : baseClamp(toInteger(position), 0, length);\n\n var end = position;\n position -= target.length;\n return position >= 0 && string.slice(position, end) == target;\n }\n\n /**\n * Converts the characters \"&\", \"<\", \">\", '\"', and \"'\" in `string` to their\n * corresponding HTML entities.\n *\n * **Note:** No other characters are escaped. To escape additional\n * characters use a third-party library like [_he_](https://mths.be/he).\n *\n * Though the \">\" character is escaped for symmetry, characters like\n * \">\" and \"/\" don't need escaping in HTML and have no special meaning\n * unless they're part of a tag or unquoted attribute value. See\n * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)\n * (under \"semi-related fun fact\") for more details.\n *\n * When working with HTML you should always\n * [quote attribute values](http://wonko.com/post/html-escaping) to reduce\n * XSS vectors.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escape('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles'\n */\n function escape(string) {\n string = toString(string);\n return (string && reHasUnescapedHtml.test(string))\n ? string.replace(reUnescapedHtml, escapeHtmlChar)\n : string;\n }\n\n /**\n * Escapes the `RegExp` special characters \"^\", \"$\", \"\\\", \".\", \"*\", \"+\",\n * \"?\", \"(\", \")\", \"[\", \"]\", \"{\", \"}\", and \"|\" in `string`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escapeRegExp('[lodash](https://lodash.com/)');\n * // => '\\[lodash\\]\\(https://lodash\\.com/\\)'\n */\n function escapeRegExp(string) {\n string = toString(string);\n return (string && reHasRegExpChar.test(string))\n ? string.replace(reRegExpChar, '\\\\$&')\n : string;\n }\n\n /**\n * Converts `string` to\n * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the kebab cased string.\n * @example\n *\n * _.kebabCase('Foo Bar');\n * // => 'foo-bar'\n *\n * _.kebabCase('fooBar');\n * // => 'foo-bar'\n *\n * _.kebabCase('__FOO_BAR__');\n * // => 'foo-bar'\n */\n var kebabCase = createCompounder(function(result, word, index) {\n return result + (index ? '-' : '') + word.toLowerCase();\n });\n\n /**\n * Converts `string`, as space separated words, to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the lower cased string.\n * @example\n *\n * _.lowerCase('--Foo-Bar--');\n * // => 'foo bar'\n *\n * _.lowerCase('fooBar');\n * // => 'foo bar'\n *\n * _.lowerCase('__FOO_BAR__');\n * // => 'foo bar'\n */\n var lowerCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + word.toLowerCase();\n });\n\n /**\n * Converts the first character of `string` to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.lowerFirst('Fred');\n * // => 'fred'\n *\n * _.lowerFirst('FRED');\n * // => 'fRED'\n */\n var lowerFirst = createCaseFirst('toLowerCase');\n\n /**\n * Pads `string` on the left and right sides if it's shorter than `length`.\n * Padding characters are truncated if they can't be evenly divided by `length`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.pad('abc', 8);\n * // => ' abc '\n *\n * _.pad('abc', 8, '_-');\n * // => '_-abc_-_'\n *\n * _.pad('abc', 3);\n * // => 'abc'\n */\n function pad(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n if (!length || strLength >= length) {\n return string;\n }\n var mid = (length - strLength) / 2;\n return (\n createPadding(nativeFloor(mid), chars) +\n string +\n createPadding(nativeCeil(mid), chars)\n );\n }\n\n /**\n * Pads `string` on the right side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padEnd('abc', 6);\n * // => 'abc '\n *\n * _.padEnd('abc', 6, '_-');\n * // => 'abc_-_'\n *\n * _.padEnd('abc', 3);\n * // => 'abc'\n */\n function padEnd(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (string + createPadding(length - strLength, chars))\n : string;\n }\n\n /**\n * Pads `string` on the left side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padStart('abc', 6);\n * // => ' abc'\n *\n * _.padStart('abc', 6, '_-');\n * // => '_-_abc'\n *\n * _.padStart('abc', 3);\n * // => 'abc'\n */\n function padStart(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (createPadding(length - strLength, chars) + string)\n : string;\n }\n\n /**\n * Converts `string` to an integer of the specified radix. If `radix` is\n * `undefined` or `0`, a `radix` of `10` is used unless `value` is a\n * hexadecimal, in which case a `radix` of `16` is used.\n *\n * **Note:** This method aligns with the\n * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category String\n * @param {string} string The string to convert.\n * @param {number} [radix=10] The radix to interpret `value` by.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.parseInt('08');\n * // => 8\n *\n * _.map(['6', '08', '10'], _.parseInt);\n * // => [6, 8, 10]\n */\n function parseInt(string, radix, guard) {\n if (guard || radix == null) {\n radix = 0;\n } else if (radix) {\n radix = +radix;\n }\n return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);\n }\n\n /**\n * Repeats the given string `n` times.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to repeat.\n * @param {number} [n=1] The number of times to repeat the string.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the repeated string.\n * @example\n *\n * _.repeat('*', 3);\n * // => '***'\n *\n * _.repeat('abc', 2);\n * // => 'abcabc'\n *\n * _.repeat('abc', 0);\n * // => ''\n */\n function repeat(string, n, guard) {\n if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n return baseRepeat(toString(string), n);\n }\n\n /**\n * Replaces matches for `pattern` in `string` with `replacement`.\n *\n * **Note:** This method is based on\n * [`String#replace`](https://mdn.io/String/replace).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to modify.\n * @param {RegExp|string} pattern The pattern to replace.\n * @param {Function|string} replacement The match replacement.\n * @returns {string} Returns the modified string.\n * @example\n *\n * _.replace('Hi Fred', 'Fred', 'Barney');\n * // => 'Hi Barney'\n */\n function replace() {\n var args = arguments,\n string = toString(args[0]);\n\n return args.length < 3 ? string : string.replace(args[1], args[2]);\n }\n\n /**\n * Converts `string` to\n * [snake case](https://en.wikipedia.org/wiki/Snake_case).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the snake cased string.\n * @example\n *\n * _.snakeCase('Foo Bar');\n * // => 'foo_bar'\n *\n * _.snakeCase('fooBar');\n * // => 'foo_bar'\n *\n * _.snakeCase('--FOO-BAR--');\n * // => 'foo_bar'\n */\n var snakeCase = createCompounder(function(result, word, index) {\n return result + (index ? '_' : '') + word.toLowerCase();\n });\n\n /**\n * Splits `string` by `separator`.\n *\n * **Note:** This method is based on\n * [`String#split`](https://mdn.io/String/split).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to split.\n * @param {RegExp|string} separator The separator pattern to split by.\n * @param {number} [limit] The length to truncate results to.\n * @returns {Array} Returns the string segments.\n * @example\n *\n * _.split('a-b-c', '-', 2);\n * // => ['a', 'b']\n */\n function split(string, separator, limit) {\n if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {\n separator = limit = undefined;\n }\n limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;\n if (!limit) {\n return [];\n }\n string = toString(string);\n if (string && (\n typeof separator == 'string' ||\n (separator != null && !isRegExp(separator))\n )) {\n separator = baseToString(separator);\n if (!separator && hasUnicode(string)) {\n return castSlice(stringToArray(string), 0, limit);\n }\n }\n return string.split(separator, limit);\n }\n\n /**\n * Converts `string` to\n * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).\n *\n * @static\n * @memberOf _\n * @since 3.1.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the start cased string.\n * @example\n *\n * _.startCase('--foo-bar--');\n * // => 'Foo Bar'\n *\n * _.startCase('fooBar');\n * // => 'Foo Bar'\n *\n * _.startCase('__FOO_BAR__');\n * // => 'FOO BAR'\n */\n var startCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + upperFirst(word);\n });\n\n /**\n * Checks if `string` starts with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=0] The position to search from.\n * @returns {boolean} Returns `true` if `string` starts with `target`,\n * else `false`.\n * @example\n *\n * _.startsWith('abc', 'a');\n * // => true\n *\n * _.startsWith('abc', 'b');\n * // => false\n *\n * _.startsWith('abc', 'b', 1);\n * // => true\n */\n function startsWith(string, target, position) {\n string = toString(string);\n position = position == null\n ? 0\n : baseClamp(toInteger(position), 0, string.length);\n\n target = baseToString(target);\n return string.slice(position, position + target.length) == target;\n }\n\n /**\n * Creates a compiled template function that can interpolate data properties\n * in \"interpolate\" delimiters, HTML-escape interpolated data properties in\n * \"escape\" delimiters, and execute JavaScript in \"evaluate\" delimiters. Data\n * properties may be accessed as free variables in the template. If a setting\n * object is given, it takes precedence over `_.templateSettings` values.\n *\n * **Note:** In the development build `_.template` utilizes\n * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)\n * for easier debugging.\n *\n * For more information on precompiling templates see\n * [lodash's custom builds documentation](https://lodash.com/custom-builds).\n *\n * For more information on Chrome extension sandboxes see\n * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The template string.\n * @param {Object} [options={}] The options object.\n * @param {RegExp} [options.escape=_.templateSettings.escape]\n * The HTML \"escape\" delimiter.\n * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]\n * The \"evaluate\" delimiter.\n * @param {Object} [options.imports=_.templateSettings.imports]\n * An object to import into the template as free variables.\n * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]\n * The \"interpolate\" delimiter.\n * @param {string} [options.sourceURL='lodash.templateSources[n]']\n * The sourceURL of the compiled template.\n * @param {string} [options.variable='obj']\n * The data object variable name.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the compiled template function.\n * @example\n *\n * // Use the \"interpolate\" delimiter to create a compiled template.\n * var compiled = _.template('hello <%= user %>!');\n * compiled({ 'user': 'fred' });\n * // => 'hello fred!'\n *\n * // Use the HTML \"escape\" delimiter to escape data property values.\n * var compiled = _.template('<%- value %>');\n * compiled({ 'value': '